{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "75c34ba4-6347-4907-940a-e357a1979523", "code": "51202-86-9", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=51202-86-9", "code_system": "CAS", "references": [ "ea9e0168-dfad-4175-91a7-79fceb26557a", "4c116482-a618-4fe5-ac6e-04652d81d4ae" ] }, { "uuid": "018bdeaa-1aa8-4b1d-9502-55b9d289c453", "code": "257-055-0", "type": "PRIMARY", "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.051.851", "code_system": "ECHA (EC/EINECS)", "references": [ "ea9e0168-dfad-4175-91a7-79fceb26557a" ] }, { "uuid": "d59c83e0-7609-45a1-b30e-10196e8dcd9b", "code": "6441668", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/6441668", "code_system": "PUBCHEM", "references": [ "ea9e0168-dfad-4175-91a7-79fceb26557a" ] }, { "uuid": "daff8666-eab6-46f5-a7f8-5bf53de872a8", "code": "R4BK39J29W", "type": "PRIMARY", "code_system": "FDA UNII", "references": [ "4c116482-a618-4fe5-ac6e-04652d81d4ae" ] }, { "uuid": "0624ccba-83ca-83bb-00f3-b42ba10f4a07", "code": "DTXSID8068624", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID8068624", "code_system": "EPA CompTox", "references": [ "4dd3d727-b5ab-54b0-bea7-838a6e22633f" ] } ], "substance_class": "chemical", "names": [ { "uuid": "7547f719-d766-4507-87c8-980a12fad9f3", "name": "2,2'-(1,4-Phenylene)bis[4-[(4-methoxyphenyl)methylene]oxazol-5(4H)-one]", "stdName": "2,2'-(1,4-PHENYLENE)BIS(4-((4-METHOXYPHENYL)METHYLENE)OXAZOL-5(4H)-ONE)", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "4c116482-a618-4fe5-ac6e-04652d81d4ae" ], "display_name": true }, { "uuid": "c484b1e2-820e-4168-b84b-713ef14c7b13", "name": "2,2′-(1,4-Phenylene)bis[4-[(4-methoxyphenyl)methylene]-5(4H)-oxazolone]", "stdName": "2,2'-(1,4-PHENYLENE)BIS(4-((4-METHOXYPHENYL)METHYLENE)-5(4H)-OXAZOLONE)", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "4c116482-a618-4fe5-ac6e-04652d81d4ae" ], "display_name": false }, { "uuid": "5f984e7f-620a-401e-8caa-af0680342022", "name": "5(4H)-OXAZOLONE, 2,2'-(1,4-PHENYLENE)BIS(4-((4-METHOXYPHENYL)METHYLENE)-", "stdName": "5(4H)-OXAZOLONE, 2,2'-(1,4-PHENYLENE)BIS(4-((4-METHOXYPHENYL)METHYLENE)-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "fd88f20a-2529-4727-b03b-c40513af1756", "c6da8619-7134-45e8-8197-3fdff179aaf2" ], "display_name": false } ], "references": [ { "uuid": "fd88f20a-2529-4727-b03b-c40513af1756", "citation": "CHEMID", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "c6da8619-7134-45e8-8197-3fdff179aaf2", "citation": "EPA", "doc_type": "EPA", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "ea9e0168-dfad-4175-91a7-79fceb26557a", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493393763000, "tags": [ "NOMEN" ] }, { "uuid": "5e0012c9-d699-4f07-01c3-e30354414860", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=51202-86-9", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "4c116482-a618-4fe5-ac6e-04652d81d4ae", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "4dd3d727-b5ab-54b0-bea7-838a6e22633f", "citation": "EPA CompTox", "doc_type": "EPA", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "f7521e25-1d50-48aa-a93a-f8992c0c4206", "id": "f7521e25-1d50-48aa-a93a-f8992c0c4206", "molfile": "\n Marvin 03272315132D \n\n 36 40 0 0 0 0 999 V2000\n 2.4750 1.4520 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5300 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.3338 4.2167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.2788 5.6687 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 0.8250 4.3099 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 4.3099 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.9838 1.3588 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 11.8088 1.3588 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.5695 1.8645 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.7849 2.1194 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 4.5695 1.0395 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3.3000 1.4520 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.7849 0.7845 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.2370 2.3494 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.9906 2.0139 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.1508 3.1699 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.6580 2.4988 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.8182 3.6548 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.5718 3.3193 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.0625 2.1665 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.2375 2.1665 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.4750 2.8810 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.8250 2.8810 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.0625 3.5954 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.2375 3.5954 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.2392 3.8042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.0239 3.5493 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 7.2392 4.6292 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.5088 4.2167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.0239 4.8842 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.7463 3.5022 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.5713 3.5022 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.3338 2.7877 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.9838 2.7877 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.7463 2.0733 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.5713 2.0733 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 12 2 3 0 0 0\n 1 20 1 0 0 0 0\n 2 13 2 0 0 0 0\n 3 29 2 3 0 0 0\n 3 31 1 0 0 0 0\n 4 30 2 0 0 0 0\n 5 6 1 0 0 0 0\n 5 25 1 0 0 0 0\n 7 8 1 0 0 0 0\n 7 36 1 0 0 0 0\n 9 10 2 0 0 0 0\n 9 11 1 0 0 0 0\n 9 14 1 0 0 0 0\n 10 12 1 0 0 0 0\n 11 13 1 0 0 0 0\n 12 13 1 0 0 0 0\n 14 15 2 0 0 0 0\n 14 16 1 0 0 0 0\n 15 17 1 0 0 0 0\n 16 18 2 0 0 0 0\n 17 19 2 0 0 0 0\n 18 19 1 0 0 0 0\n 19 26 1 0 0 0 0\n 20 21 2 0 0 0 0\n 20 22 1 0 0 0 0\n 21 23 1 0 0 0 0\n 22 24 2 0 0 0 0\n 23 25 2 0 0 0 0\n 24 25 1 0 0 0 0\n 26 27 2 0 0 0 0\n 26 28 1 0 0 0 0\n 27 29 1 0 0 0 0\n 28 30 1 0 0 0 0\n 29 30 1 0 0 0 0\n 31 32 2 0 0 0 0\n 31 33 1 0 0 0 0\n 32 34 1 0 0 0 0\n 33 35 2 0 0 0 0\n 34 36 2 0 0 0 0\n 35 36 1 0 0 0 0\nM END", "smiles": "COc1ccc(cc1)C=C2C(=O)OC(=N2)c3ccc(cc3)C4=NC(=Cc5ccc(cc5)OC)C(=O)O4", "formula": "C28H20N2O6", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "9977a885-6b73-4139-a6c4-691728beef94" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "480.4693", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "31fd0b84-fdb7-4f4c-b3f8-d6e7d3d57a8e", "version": "7", "structure": { "id": "8e976962-ab6d-47e5-ab91-420b2ac769ba", "molfile": "2,2'-(1,4-Phenylene)bis[4-[(4-methoxyphenyl)methylene]-5(4H)-oxazolone]\n JSDraw203272315132D\n\n 36 40 0 0 0 0 0 V2000\n 18.0592 -10.3099 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 20.0542 -13.0555 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 31.0287 -5.0821 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.0338 -2.3365 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 14.9393 -4.9059 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 13.3793 -4.9059 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 34.1487 -10.4861 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 35.7087 -10.4861 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 22.0199 -9.5299 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 20.5362 -9.0479 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 22.0199 -11.0899 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 19.6192 -10.3099 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 20.5362 -11.5720 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 23.2819 -8.6130 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 24.7070 -9.2474 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 23.1189 -7.0615 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 25.9691 -8.3305 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 24.3810 -6.1446 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 25.8060 -6.7790 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.2792 -8.9588 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.7193 -8.9588 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.0592 -7.6078 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.9393 -7.6078 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.2792 -6.2569 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.7193 -6.2569 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.0680 -5.8621 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.5517 -6.3441 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 27.0680 -4.3021 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 29.4687 -5.0821 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.5517 -3.8200 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 31.8087 -6.4332 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 33.3687 -6.4332 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 31.0287 -7.7842 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 34.1487 -7.7842 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 31.8087 -9.1351 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 33.3687 -9.1351 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 12 2 3 0 0 0\n 1 20 1 0 0 0 0\n 2 13 2 0 0 0 0\n 3 29 2 3 0 0 0\n 3 31 1 0 0 0 0\n 4 30 2 0 0 0 0\n 5 6 1 0 0 0 0\n 5 25 1 0 0 0 0\n 7 8 1 0 0 0 0\n 7 36 1 0 0 0 0\n 9 10 2 0 0 0 0\n 9 11 1 0 0 0 0\n 9 14 1 0 0 0 0\n 10 12 1 0 0 0 0\n 11 13 1 0 0 0 0\n 12 13 1 0 0 0 0\n 14 15 2 0 0 0 0\n 14 16 1 0 0 0 0\n 15 17 1 0 0 0 0\n 16 18 2 0 0 0 0\n 17 19 2 0 0 0 0\n 18 19 1 0 0 0 0\n 19 26 1 0 0 0 0\n 20 21 2 0 0 0 0\n 20 22 1 0 0 0 0\n 21 23 1 0 0 0 0\n 22 24 2 0 0 0 0\n 23 25 2 0 0 0 0\n 24 25 1 0 0 0 0\n 26 27 2 0 0 0 0\n 26 28 1 0 0 0 0\n 27 29 1 0 0 0 0\n 28 30 1 0 0 0 0\n 29 30 1 0 0 0 0\n 31 32 2 0 0 0 0\n 31 33 1 0 0 0 0\n 32 34 1 0 0 0 0\n 33 35 2 0 0 0 0\n 34 36 2 0 0 0 0\n 35 36 1 0 0 0 0\nM END", "smiles": "COc1ccc(cc1)C=C2C(=O)OC(=N2)c3ccc(cc3)C4=NC(=Cc5ccc(cc5)OC)C(=O)O4", "formula": "C28H20N2O6", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "480.4693", "optical_activity": "NONE", "references": [ "fd88f20a-2529-4727-b03b-c40513af1756", "4c116482-a618-4fe5-ac6e-04652d81d4ae" ], "stereo_centers": 0 }, "unii": "R4BK39J29W" } ] }