{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "2ce085e1-17cf-4fe5-9281-d19810acb396",
          "code": "50650-76-5",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=50650-76-5",
          "code_system": "CAS",
          "references": [
            "e229448d-d1c1-40a6-bc4b-04f0729a6136",
            "efa342d1-e3c4-4b31-a392-e5e79e927d54"
          ]
        },
        {
          "uuid": "be18d125-6bde-4ad6-8142-2d8882f6ca4c",
          "code": "C66429",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C66429",
          "code_system": "NCI_THESAURUS",
          "references": [
            "e229448d-d1c1-40a6-bc4b-04f0729a6136"
          ]
        },
        {
          "uuid": "32635eab-77ae-4d9e-bec1-6f72e8401830",
          "code": "4808",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=4808",
          "code_system": "INN",
          "references": [
            "e229448d-d1c1-40a6-bc4b-04f0729a6136"
          ]
        },
        {
          "uuid": "edc2a609-cae7-4e46-9398-ff9ca9add619",
          "code": "m8885",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m8885?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "e229448d-d1c1-40a6-bc4b-04f0729a6136"
          ]
        },
        {
          "uuid": "88d73670-ebc0-4614-ae78-ced665ad1163",
          "code": "SUB09927MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "e229448d-d1c1-40a6-bc4b-04f0729a6136"
          ]
        },
        {
          "uuid": "9d2ab915-3668-4798-b19d-124c353fc615",
          "code": "CHEMBL1473700",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL1473700",
          "code_system": "ChEMBL",
          "references": [
            "e229448d-d1c1-40a6-bc4b-04f0729a6136"
          ]
        },
        {
          "uuid": "27a7bf51-19ed-4cf9-b763-44da65d5095c",
          "code": "50259",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/50259",
          "code_system": "PUBCHEM",
          "references": [
            "e229448d-d1c1-40a6-bc4b-04f0729a6136"
          ]
        },
        {
          "uuid": "84320502-136b-caf9-afe7-dbc89692a99e",
          "code": "DTXSID2048298",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID2048298",
          "code_system": "EPA CompTox",
          "references": [
            "cb1f6205-033f-0388-9da9-b3d0f24c8f88"
          ]
        },
        {
          "uuid": "e44d978d-d4c0-38d2-29db-4110482f7141",
          "code": "C78284",
          "comments": "Pharmacologic Substance[C1909]|Agent Affecting Integumentary System",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C78284",
          "code_system": "NCI_THESAURUS",
          "references": [
            "04973c77-08b0-4309-0207-5d039c2c1948"
          ]
        },
        {
          "uuid": "6a1d0618-6118-da8f-e05a-efe8deb86bdc",
          "code": "2058907",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/2058907/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "0daf4782-d36f-ec8d-7835-d05931fce4be"
          ]
        },
        {
          "uuid": "0a8288c3-876e-441b-92ac-3dbc1eabcde8",
          "code": "R49EFA73Q7",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "ace9fba1-7d2b-eff8-84fa-abd46ab47d8b",
          "code": "3479",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/3479",
          "code_system": "DRUG CENTRAL",
          "references": [
            "04973c77-08b0-4309-0207-5d039c2c1948"
          ]
        },
        {
          "uuid": "6e3d6c92-e3e5-0c08-9a65-7176d2c60a9f",
          "code": "59009",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:59009",
          "code_system": "CHEBI",
          "references": [
            "04973c77-08b0-4309-0207-5d039c2c1948"
          ]
        },
        {
          "uuid": "173d5b89-cce2-9dbe-6485-a61f18bddba3",
          "code": "R49EFA73Q7",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=R49EFA73Q7",
          "code_system": "DAILYMED",
          "references": [
            "a8c3167f-d1b8-9e07-baf6-64741243103f"
          ]
        },
        {
          "uuid": "bc7ee9a6-8d24-d3b3-6b7a-839683416036",
          "code": "100000081694",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "08510952-0195-eac7-4918-78271df7fdfc"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "8d1eb60a-8517-4cfc-9df2-c4649d66724c",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "ddfe9394-80ad-4a45-8fd1-db2afd446707",
            "refuuid": "6c43782b-6d22-4e83-a480-96517cde569a",
            "name": "PIROCTONE",
            "unii": "R49EFA73Q7",
            "linking_id": "R49EFA73Q7",
            "ref_pname": "PIROCTONE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "249ee072-cdb1-4b63-b30a-581be6a971e3",
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "656a9319-2fcd-4780-82fc-83ecedcecb46",
            "refuuid": "15d59e62-185b-4ba6-bfce-3767c239513e",
            "name": "PIROCTONE OLAMINE",
            "unii": "A4V5C6R9FB",
            "linking_id": "A4V5C6R9FB",
            "ref_pname": "PIROCTONE OLAMINE",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "edb1d272-37c1-47bf-9f74-3b45ea3ff6ec",
          "name": "1-HYDROXY-4-METHYL-6(2,4,4-TRIMETHYLPENTYL)-2-PYRIDONE",
          "stdName": "1-HYDROXY-4-METHYL-6(2,4,4-TRIMETHYLPENTYL)-2-PYRIDONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "963dcee2-18d4-4621-955f-cb7158eeeafc",
            "e72af820-814d-4266-b175-80434085a18b"
          ],
          "display_name": false
        },
        {
          "uuid": "98d691c5-35eb-4988-8afe-08c14d9be83c",
          "name": "PIROCTONE",
          "stdName": "PIROCTONE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "81340def-41e5-43e3-9a71-2ce303e9edb8",
            "339757ca-59d2-4960-989d-ab4fe9752aa3",
            "963dcee2-18d4-4621-955f-cb7158eeeafc",
            "582677ad-bbad-4775-b5c3-d560f395f9c5",
            "ef37bc14-bcc3-4112-8dfe-1184d7f06fc4",
            "0718b9f2-e1f5-40c0-886b-d93d8d28b0a0",
            "5dedcb02-8e64-4968-a5a6-2ada1fe636c8",
            "3c199a8e-9ffe-45bc-b6f4-374e8dbe1868",
            "93c66053-916d-4b6c-940d-8340f17c700b",
            "02df2971-b62a-415c-a21f-e7abb8fa81db"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "2b2f2836-0c1c-491d-adf1-4c8fabb5ec3f",
              "name_org": "INN"
            },
            {
              "uuid": "96042b0e-298b-49fe-ade3-fc54fe4e2b79",
              "name_org": "USAN"
            }
          ]
        },
        {
          "uuid": "84147f62-1c44-4f1a-b83a-858017acf7eb",
          "name": "PIROCTONE [MI]",
          "stdName": "PIROCTONE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "963dcee2-18d4-4621-955f-cb7158eeeafc",
            "93c66053-916d-4b6c-940d-8340f17c700b"
          ],
          "display_name": false
        },
        {
          "uuid": "7db00b0b-9716-4592-9d98-1d2261d43656",
          "name": "PIROCTONE [USAN]",
          "stdName": "PIROCTONE [USAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "339757ca-59d2-4960-989d-ab4fe9752aa3"
          ],
          "display_name": false
        },
        {
          "uuid": "108371e4-bbbb-4955-9d96-9231ef0dce0b",
          "name": "PIROCTONOL",
          "stdName": "PIROCTONOL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "963dcee2-18d4-4621-955f-cb7158eeeafc",
            "e72af820-814d-4266-b175-80434085a18b"
          ],
          "display_name": false
        },
        {
          "uuid": "b2b39dd4-1aad-b4ad-4579-e382b69bf444",
          "name": "Piroctone [WHO-DD]",
          "stdName": "PIROCTONE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9661be2d-122c-009c-899a-3544eb3cb60e"
          ],
          "display_name": false
        },
        {
          "uuid": "e007393d-cbc2-4867-89fd-f2dcfe0e8d55",
          "name": "piroctone [INN]",
          "stdName": "PIROCTONE [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5dedcb02-8e64-4968-a5a6-2ada1fe636c8"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "81340def-41e5-43e3-9a71-2ce303e9edb8",
          "citation": "USP Dictionary",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "5dedcb02-8e64-4968-a5a6-2ada1fe636c8",
          "citation": "INN Proposed List 43",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL43.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "339757ca-59d2-4960-989d-ab4fe9752aa3",
          "citation": "USP DICTIONARY 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "93c66053-916d-4b6c-940d-8340f17c700b",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "963dcee2-18d4-4621-955f-cb7158eeeafc",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0718b9f2-e1f5-40c0-886b-d93d8d28b0a0",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e72af820-814d-4266-b175-80434085a18b",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e229448d-d1c1-40a6-bc4b-04f0729a6136",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390589000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "727fe806-cfd8-48d8-a5fe-36d983282467",
          "citation": "SRS import [R49EFA73Q7]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=R49EFA73Q7",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390589000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "281600b7-b578-4273-8960-ed1fb02da07f",
          "citation": "USP Dictionary; INN 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ef37bc14-bcc3-4112-8dfe-1184d7f06fc4",
          "citation": "PIROCTONE [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "02df2971-b62a-415c-a21f-e7abb8fa81db",
          "citation": "PIROCTONE [USAN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "3c199a8e-9ffe-45bc-b6f4-374e8dbe1868",
          "citation": "PIROCTONE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "582677ad-bbad-4775-b5c3-d560f395f9c5",
          "citation": "PIROCTONE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "cb1f6205-033f-0388-9da9-b3d0f24c8f88",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=50650-76-5",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "04973c77-08b0-4309-0207-5d039c2c1948",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "0daf4782-d36f-ec8d-7835-d05931fce4be",
          "citation": "RXNORM",
          "doc_type": "NLM",
          "public_domain": true
        },
        {
          "uuid": "efa342d1-e3c4-4b31-a392-e5e79e927d54",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "a8c3167f-d1b8-9e07-baf6-64741243103f",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "9661be2d-122c-009c-899a-3544eb3cb60e",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "08510952-0195-eac7-4918-78271df7fdfc",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "84d26f08-e1ac-4dcc-8336-261c90dda663",
          "id": "84d26f08-e1ac-4dcc-8336-261c90dda663",
          "molfile": "\n  Marvin  01132106532D          \n\n 17 17  0  0  0  0            999 V2000\n    3.9591   -1.3275    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9591   -2.1514    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    4.6782   -2.5531    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3973   -2.1484    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3973   -1.3158    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1163   -0.9053    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1163   -0.0815    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8325   -1.3158    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8325   -2.1484    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5545   -2.5473    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1163   -2.5473    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1163   -3.3711    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2372   -2.5502    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5181   -2.1484    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.9796   -1.3713    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.8106   -2.5704    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8304   -1.3511    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n 13  2  1  0  0  0  0\n  3  4  1  0  0  0  0\n  5  4  2  0  0  0  0\n 11  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n  8  6  2  0  0  0  0\n  8  9  1  0  0  0  0\n 10  9  2  0  0  0  0\n  9 11  1  0  0  0  0\n 12 11  1  0  0  0  0\n 14 13  1  0  0  0  0\n 14 15  1  0  0  0  0\n 14 16  1  0  0  0  0\n 14 17  1  0  0  0  0\nM  END",
          "smiles": "Cc1cc(CC(C)CC(C)(C)C)n(c(=O)c1)O",
          "formula": "C14H23NO2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "RACEMIC",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "8ba83d86-9f56-4a91-bbcf-5c220be1167c"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "237.3385",
          "optical_activity": "( + / - )",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "6c43782b-6d22-4e83-a480-96517cde569a",
      "version": "14",
      "structure": {
        "id": "f6f62c01-3b76-4c5c-8ab8-c400b238b28e",
        "molfile": "\n  Marvin  01132112482D          \n\n 17 17  0  0  0  0            999 V2000\n    5.3973   -2.1484    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1163   -2.5473    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8325   -2.1484    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3973   -1.3158    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8325   -1.3158    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1163   -0.9053    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6782   -2.5531    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5545   -2.5473    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1163   -3.3711    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5181   -2.1484    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2372   -2.5502    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9591   -2.1514    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1163   -0.0815    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9591   -1.3275    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.9796   -1.3713    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.8106   -2.5704    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8304   -1.3511    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  1  2  0  0  0  0\n  5  6  2  0  0  0  0\n  6  4  1  0  0  0  0\n  7  1  1  0  0  0  0\n  8  3  2  0  0  0  0\n  9  2  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12  7  1  0  0  0  0\n 13  6  1  0  0  0  0\n 10 15  1  0  0  0  0\n 14 12  1  0  0  0  0\n 10 16  1  0  0  0  0\n  5  3  1  0  0  0  0\n 10 17  1  0  0  0  0\nM  END",
        "smiles": "Cc1cc(CC(C)CC(C)(C)C)n(c(=O)c1)O",
        "formula": "C14H23NO2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "RACEMIC",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "237.3385",
        "optical_activity": "( + / - )",
        "references": [
          "281600b7-b578-4273-8960-ed1fb02da07f",
          "727fe806-cfd8-48d8-a5fe-36d983282467",
          "5dedcb02-8e64-4968-a5a6-2ada1fe636c8"
        ],
        "stereo_centers": 1
      },
      "unii": "R49EFA73Q7"
    }
  ]
}