{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "9757f08b-a936-4813-adee-1e20ebfabc5d",
          "code": "N06BA07",
          "comments": "ATC|NERVOUS SYSTEM|PSYCHOANALEPTICS|PSYCHOSTIMULANTS, AGENTS USED FOR ADHD AND NOOTROPICS|Centrally acting sympathomimetics|modafinil",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=N06BA07&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "0af75370-b4d7-493a-92d3-37f1d5f67dc3"
          ]
        },
        {
          "uuid": "a77ed843-8618-4e2e-acb6-48f183d29044",
          "code": "N0000175769",
          "comments": "Established Pharmacologic Class [EPC]|Sympathomimetic-like Agent [EPC]",
          "type": "PRIMARY",
          "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000175769",
          "code_system": "NDF-RT",
          "references": [
            "0af75370-b4d7-493a-92d3-37f1d5f67dc3"
          ]
        },
        {
          "uuid": "60bc5e0a-219f-43c3-a0c4-adfc12e46216",
          "code": "N0000175729",
          "comments": "Physiological Effects [PE]|Organ System Specific Effects [PE]|Nervous System Activity Alteration [PE]|Central Nervous System Activity Alteration [PE]|Central Nervous System Stimulation [PE]",
          "type": "PRIMARY",
          "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000175729",
          "code_system": "NDF-RT",
          "references": [
            "0af75370-b4d7-493a-92d3-37f1d5f67dc3"
          ]
        },
        {
          "uuid": "22c765a0-5fd8-4660-b2ef-d63a519f22a3",
          "code": "N0000175651",
          "comments": "Physiological Effects [PE]|Organ System Specific Effects [PE]|Nervous System Activity Alteration [PE]|Peripheral Nervous System Activity Alteration [PE]|Autonomic Nervous System Activity Alteration [PE]|Sympathetic Activity Alteration [PE]|Increased Sympathetic Activity [PE]",
          "type": "PRIMARY",
          "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000175651",
          "code_system": "NDF-RT",
          "references": [
            "0af75370-b4d7-493a-92d3-37f1d5f67dc3"
          ]
        },
        {
          "uuid": "ab5a2908-53d5-4e6a-b020-d42876a46ebb",
          "code": "QN06BA07",
          "comments": "VATC|PSYCHOANALEPTICS|PSYCHOSTIMULANTS, AGENTS USED FOR ADHD AND NOOTROPICS|Centrally acting sympathomimetics|modafinil",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QN06BA07&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "0af75370-b4d7-493a-92d3-37f1d5f67dc3"
          ]
        },
        {
          "uuid": "c9ffb07e-4b26-4bb1-bc13-a6bbb688bc69",
          "code": "68693-11-8",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=68693-11-8",
          "code_system": "CAS",
          "references": [
            "0af75370-b4d7-493a-92d3-37f1d5f67dc3",
            "3ffcb89d-62cb-4bfe-ae92-7f73dfef3474"
          ]
        },
        {
          "uuid": "af63a07b-396e-4501-8762-15454a8b5aa8",
          "code": "C26661",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C26661",
          "code_system": "NCI_THESAURUS",
          "references": [
            "0af75370-b4d7-493a-92d3-37f1d5f67dc3"
          ]
        },
        {
          "uuid": "60e22a78-cde5-48ba-9fe2-d29fa9f8e2e0",
          "code": "C048833",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67048833",
          "code_system": "MESH",
          "references": [
            "0af75370-b4d7-493a-92d3-37f1d5f67dc3"
          ]
        },
        {
          "uuid": "e82daf49-7f10-4eb9-ba9a-3ba38a91a2be",
          "code": "NBK548274",
          "comments": "LiverTox|CNS|Stimulant|Non-amphetamine stimulant",
          "type": "PRIMARY",
          "url": "https://www.ncbi.nlm.nih.gov/books/NBK548274/",
          "code_system": "LIVERTOX",
          "references": [
            "fa57309b-04a1-06c0-201f-51b273ffef17"
          ]
        },
        {
          "uuid": "eb585401-0323-4528-a0f1-5a4aeaffa5db",
          "code": "MODAFINIL",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Modafinil",
          "code_system": "WIKIPEDIA",
          "references": [
            "0af75370-b4d7-493a-92d3-37f1d5f67dc3"
          ]
        },
        {
          "uuid": "01ec9d15-e4a8-4255-88bd-ae3fa0b0aa42",
          "code": "6055",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=6055",
          "code_system": "INN",
          "references": [
            "0af75370-b4d7-493a-92d3-37f1d5f67dc3"
          ]
        },
        {
          "uuid": "67ba55fc-8e4c-4820-8faa-4c24ae163333",
          "code": "1680",
          "comments": "PART 1308 -- SCHEDULES OF CONTROLLED SUBSTANCES|Sec. 1308.11 Schedule IV.|Stimulants",
          "type": "PRIMARY",
          "url": "http://www.ecfr.gov/cgi-bin/text-idx?rgn=div5&node=21:9.0.1.1.9#se21.9.1308_111",
          "code_system": "DEA NO.",
          "references": [
            "0af75370-b4d7-493a-92d3-37f1d5f67dc3"
          ]
        },
        {
          "uuid": "bc2aa3b7-d877-48b4-b5f9-0ce25b39dc8c",
          "code": "7555",
          "type": "PRIMARY",
          "url": "http://www.guidetopharmacology.org/GRAC/LigandDisplayForward?ligandId=7555",
          "code_system": "IUPHAR",
          "references": [
            "0af75370-b4d7-493a-92d3-37f1d5f67dc3"
          ]
        },
        {
          "uuid": "d5e77cb2-2181-4537-99f0-ee041eb61a5a",
          "code": "30125",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/30125/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "0af75370-b4d7-493a-92d3-37f1d5f67dc3"
          ]
        },
        {
          "uuid": "13885d73-5d8a-4d83-872f-b31a02e473af",
          "code": "m7584",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m7584?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "0af75370-b4d7-493a-92d3-37f1d5f67dc3"
          ]
        },
        {
          "uuid": "084d41b5-5620-4f21-a109-bbeb9c6d0cf2",
          "code": "DB00745",
          "type": "PRIMARY",
          "url": "http://www.drugbank.ca/drugs/DB00745",
          "code_system": "DRUG BANK",
          "references": [
            "0af75370-b4d7-493a-92d3-37f1d5f67dc3"
          ]
        },
        {
          "uuid": "4bc5225c-6ef6-467c-8a64-e788e533450c",
          "code": "112111-49-6",
          "type": "SUPERSEDED",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=112111-49-6",
          "code_system": "CAS",
          "references": [
            "0af75370-b4d7-493a-92d3-37f1d5f67dc3",
            "e4f3b8ea-a5e6-424e-90d1-dcff9de85bf2"
          ]
        },
        {
          "uuid": "dc7d1bd4-59ef-4391-88f2-4e3b21fe0530",
          "code": "SUB09026MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "0af75370-b4d7-493a-92d3-37f1d5f67dc3"
          ]
        },
        {
          "uuid": "d3d0074d-bcbe-4c3f-b008-8774230f6c28",
          "code": "CHEMBL1373",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL1373",
          "code_system": "ChEMBL",
          "references": [
            "0af75370-b4d7-493a-92d3-37f1d5f67dc3"
          ]
        },
        {
          "uuid": "722f579f-5f40-4e8d-8700-bf35e78fdfaf",
          "code": "4236",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/4236",
          "code_system": "PUBCHEM",
          "references": [
            "0af75370-b4d7-493a-92d3-37f1d5f67dc3"
          ]
        },
        {
          "uuid": "63d6676a-bde3-3a48-57b7-b505f2660b2b",
          "code": "7585",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/7585",
          "code_system": "HSDB",
          "references": [
            "85e4d370-8ddd-e4be-242f-5280204882ad"
          ]
        },
        {
          "uuid": "8c520b0a-4999-5e7e-2ee9-70c212765a0a",
          "code": "DTXSID0023329",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID0023329",
          "code_system": "EPA CompTox",
          "references": [
            "549beea1-d7fe-1fbd-810e-0b9f90deb5c6"
          ]
        },
        {
          "uuid": "3702f36c-36b9-46ba-8d49-23a279a565f1",
          "code": "73793",
          "comments": "ORPHAN DRUG|Designated/Approved|Treatment of excessive daytime sleepiness in narcolepsy.",
          "type": "PRIMARY",
          "url": "https://www.accessdata.fda.gov/scripts/opdlisting/oopd/detailedIndex.cfm?cfgridkey=73793",
          "code_system": "FDA ORPHAN DRUG"
        },
        {
          "uuid": "1c93126b-7955-37e5-1722-af0e76c71f94",
          "code": "C47795",
          "comments": "Pharmacologic Substance[C1909]|Agent Affecting Nervous System[C78272]|CNS Stimulant",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C47795",
          "code_system": "NCI_THESAURUS",
          "references": [
            "fa57309b-04a1-06c0-201f-51b273ffef17"
          ]
        },
        {
          "uuid": "89ef16d9-3107-4e61-872d-13197165b2dc",
          "code": "R3UK8X3U3D",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "3ee51773-9664-2129-27f6-16409afb21a1",
          "code": "Modafinil",
          "type": "PRIMARY",
          "url": "https://www.ncbi.nlm.nih.gov/books/n/lactmed/LM1393/",
          "code_system": "LACTMED",
          "references": [
            "fa57309b-04a1-06c0-201f-51b273ffef17"
          ]
        },
        {
          "uuid": "d0d65c61-4d20-c36f-eb8b-fb8ae21e8c7d",
          "code": "1826",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/1826",
          "code_system": "DRUG CENTRAL",
          "references": [
            "fa57309b-04a1-06c0-201f-51b273ffef17"
          ]
        },
        {
          "uuid": "4ab97556-a10a-7b8c-df0d-a13c0922e87e",
          "code": "1445404",
          "type": "PRIMARY",
          "url": "https://store.usp.org/product/1445404",
          "code_system": "RS_ITEM_NUM",
          "references": [
            "fa57309b-04a1-06c0-201f-51b273ffef17"
          ]
        },
        {
          "uuid": "f7e9cb76-f0e0-67aa-bf2f-88e4696ea2f8",
          "code": "31859",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:31859",
          "code_system": "CHEBI",
          "references": [
            "fa57309b-04a1-06c0-201f-51b273ffef17"
          ]
        },
        {
          "uuid": "985f95f0-7f31-f98e-b854-52e66e6e8d45",
          "code": "536716",
          "comments": "ORPHAN DRUG|Designated/Withdrawn|Treatment of narcolepsy",
          "codeText": "ORPHAN DRUG|Designated/Withdrawn|Treatment of narcolepsy",
          "type": "PRIMARY",
          "url": "https://www.accessdata.fda.gov/scripts/opdlisting/oopd/detailedIndex.cfm?cfgridkey=536716",
          "code_system": "FDA ORPHAN DRUG"
        },
        {
          "uuid": "76022ef4-a05f-624b-58cd-55ef33180084",
          "code": "100000080329",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "f05a06d2-0930-bc0b-d9f8-726d60cb9750"
          ]
        },
        {
          "uuid": "d38b2ed9-4704-aa5c-cf98-53213deed4ff",
          "code": "GG-74",
          "type": "PRIMARY",
          "url": "https://searchusan.ama-assn.org/finder/usan/search/GG-74/relevant/1/",
          "code_system": "USAN",
          "references": [
            "88cf8c04-2562-afca-f8f3-7b3fc70158ae"
          ]
        },
        {
          "uuid": "fce23573-c4ef-ae76-45a9-f119f681d0ac",
          "code": "R3UK8X3U3D",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=R3UK8X3U3D",
          "code_system": "DAILYMED",
          "references": [
            "d98bde67-9c07-b4d8-67c2-27711c28926d"
          ]
        },
        {
          "uuid": "59a898f8-12bf-11de-4c2d-4041919d4cfa",
          "code": "751178",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=751178",
          "code_system": "NSC",
          "references": [
            "03273aa6-92c8-114d-fba5-935178025b07"
          ]
        },
        {
          "uuid": "085cc755-2d55-99cf-1ba0-f20c94915ff4",
          "code": "759110",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=759110",
          "code_system": "NSC",
          "references": [
            "03273aa6-92c8-114d-fba5-935178025b07"
          ]
        }
      ],
      "substance_class": "chemical",
      "references": [
        {
          "uuid": "d8bc4f4a-f685-4184-b95f-e05664874b7c",
          "citation": "USP Dictionary 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "21d5a204-0163-4373-8320-b8ccc2e89b02",
          "citation": "USP DICTIONARY 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "99e400ce-fd73-4f24-bc7f-09da9ec5669e",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "93349973-edc3-4300-811c-f17c36a470ca",
          "citation": "USP DICTIONARY 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3f9ff0e3-081d-4e76-996a-8291bf9c0e2f",
          "citation": "INN Proposed List 56",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL56.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "d8a8c02a-96af-4fd3-b479-02113f65652d",
          "citation": "EP 7.2",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "418eeadf-c5dc-42d0-9a68-55d0a3d67a4d",
          "citation": "USP 33",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c8ee49ab-c1f2-42cd-bbed-01bb80bdd485",
          "citation": "KEGG 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c1598e93-fa9a-4b86-a690-bd10ead7f1c3",
          "citation": "ORANGE BOOK 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "159947ec-9ad1-4878-aee0-15250d8786fd",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f77e4abe-f1de-4be5-84eb-4da749da8df0",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "38704cc4-d71e-4fe4-b969-89966a425b77",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "38b0dd07-447f-49e0-a64a-e8c0af3799dd",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1b781c78-499c-4e78-941d-91c62ec75897",
          "citation": "NDF-RT",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "86f7e1b8-de80-44ca-8d77-bbc16fdfe741",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9c3daf31-4fa8-48d8-87e4-1e342f82b328",
          "citation": "USP-RS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0af75370-b4d7-493a-92d3-37f1d5f67dc3",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390463000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4b028d7c-10a6-4bef-974f-b262d820b8de",
          "citation": "PHARMACOGENOMICS, VOL. 12, NO. 2, PAGES 215-233",
          "url": "http://www.futuremedicine.com/doi/abs/10.2217/pgs.10.171",
          "doc_type": "JOURNAL ARTICLE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "674dd392-54c6-4d9a-a5d7-9f9e80f9ca22",
          "citation": "SRS import [R3UK8X3U3D]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=R3UK8X3U3D",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390463000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "dd1d5f7c-20f5-4231-af6c-d79008ddda18",
          "citation": "USP Dictionary 2010; INN 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "231f4f07-b423-449b-b926-c687095a9664",
          "citation": "MODAFINIL [USAN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "0b55975c-ec9e-45de-a980-d62d3eb8eea8",
          "citation": "MODAFINIL [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "7349cab5-dc0c-4a0a-a0d6-3a3977935079",
          "citation": "MODAFINIL [EP]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "2b4dbda4-8e5d-460f-b947-4cda01380cd2",
          "citation": "MODAFINIL [USP]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "84a8f474-de1f-46a8-8990-f45073d14d67",
          "citation": "MODAFINIL [JAN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "6138762c-d1c6-4638-b832-3cb8a646e6dd",
          "citation": "MODAFINIL [ORANGE BOOK]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "76fd09a6-44c8-4dc1-96e2-0d70ea451b55",
          "citation": "MODAFINIL [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "e3122b07-a964-413f-bd1c-23d127b6c70b",
          "citation": "MODAFINIL [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "6d4818be-4ed5-4c24-b8d8-6738b9413645",
          "citation": "MODAFINIL [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "a9b3188f-5b30-49d3-97af-8cd6f5af9254",
          "citation": "MODAFINIL [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "0aadc89d-76a6-4ecf-87fc-edfb1509c2b0",
          "citation": "MODAFINIL [VANDF]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "95af4511-2e6e-4b7d-98d6-9c2c09dd576f",
          "citation": "MODAFINIL CIV [USP-RS]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "85e4d370-8ddd-e4be-242f-5280204882ad",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+68693-11-8",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "2547f836-63df-5831-d6a6-281296ae002b",
          "citation": "http://adisinsight.springer.com/drugs/800045045",
          "doc_type": "WEB PAGE",
          "public_domain": true
        },
        {
          "uuid": "549beea1-d7fe-1fbd-810e-0b9f90deb5c6",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=68693-11-8",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "f356d2b4-53dc-8df8-e910-7073736b8618",
          "citation": "http://fco.factsandcomparisons.com/lco/action/doc/retrieve/docid/fc_dfc/5549125#f_pharmacokinetics",
          "doc_type": "LEPINDEX",
          "public_domain": true
        },
        {
          "uuid": "fa57309b-04a1-06c0-201f-51b273ffef17",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "b052d6c5-0375-c1b3-0e9d-2222efd44acc",
          "citation": "https://en.wikipedia.org/wiki/Modafinil#Pharmacodynamics",
          "doc_type": "WIKI",
          "public_domain": true
        },
        {
          "uuid": "3ffcb89d-62cb-4bfe-ae92-7f73dfef3474",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "e4f3b8ea-a5e6-424e-90d1-dcff9de85bf2",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "88cf8c04-2562-afca-f8f3-7b3fc70158ae",
          "citation": "USAD COUN",
          "doc_type": "USANCOUN",
          "public_domain": true
        },
        {
          "uuid": "a8a85ffe-4caf-302e-89cd-40d9b054ef59",
          "citation": "USP 10/2020",
          "doc_type": "USPNF",
          "public_domain": true
        },
        {
          "uuid": "03273aa6-92c8-114d-fba5-935178025b07",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "b8311051-d1dd-4e19-8551-3a1178246366",
          "citation": "EP 10.5",
          "doc_type": "EP",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "5bb85c94-0d1a-4445-b08d-068680f472af",
          "citation": "EP 10.5",
          "doc_type": "EP",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "bbc113e2-e57d-5f5a-c9ac-3f774d4cd00c",
          "citation": "EP 10.5",
          "doc_type": "EP",
          "public_domain": true
        },
        {
          "uuid": "1392757c-ca3a-4f94-9819-6bcf7c5e3fef",
          "citation": "EP 10.5",
          "doc_type": "EP",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "15c91045-c73e-977f-206b-0d0d3325ca07",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "d98bde67-9c07-b4d8-67c2-27711c28926d",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "f05a06d2-0930-bc0b-d9f8-726d60cb9750",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "43e30d12-949f-4a01-9b66-2707632486f6",
          "id": "43e30d12-949f-4a01-9b66-2707632486f6",
          "molfile": "\n  Marvin  01132103352D          \n\n 19 20  0  0  0  0            999 V2000\n    6.0558   -1.8431    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3414   -1.4305    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3414   -0.6056    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6269   -1.8431    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9124   -1.4305    0.0000 S   0  0  0  0  0  0  0  0  0  3  0  0\n    3.9124   -0.6056    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1980   -1.8431    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4836   -1.4306    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4836   -0.6056    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.7691   -0.1931    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.0546   -0.6056    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.0547   -1.4306    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.7691   -1.8431    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1980   -2.6681    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4836   -3.0805    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4836   -3.9055    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1980   -4.3180    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9125   -3.9055    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9124   -3.0805    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  3  2  2  0  0  0  0\n  2  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  6  5  2  0  0  0  0\n  7  5  1  0  0  0  0\n  8  7  1  0  0  0  0\n 14  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n 13  8  2  0  0  0  0\n 10  9  2  0  0  0  0\n 11 10  1  0  0  0  0\n 11 12  2  0  0  0  0\n 12 13  1  0  0  0  0\n 15 14  1  0  0  0  0\n 19 14  2  0  0  0  0\n 16 15  2  0  0  0  0\n 17 16  1  0  0  0  0\n 17 18  2  0  0  0  0\n 18 19  1  0  0  0  0\nM  END",
          "smiles": "c1ccc(cc1)C(c2ccccc2)S(=O)CC(=O)N",
          "formula": "C15H15NO2S",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "c1c0b613-6251-485c-8d7a-1fb4af19bc4b"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "273.3517",
          "optical_activity": "NONE",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "918c21d2-987c-4d99-a63e-1a1bda2e421e",
      "version": "47",
      "structure": {
        "id": "a16f2660-327a-419e-b2f0-4553d0cff072",
        "molfile": "\n  Marvin  01132108232D          \n\n 19 20  0  0  0  0            999 V2000\n    3.9124   -1.4305    0.0000 S   0  3  0  0  0  0  0  0  0  0  0  0\n    4.6269   -1.8431    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3414   -1.4305    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3414   -0.6056    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0558   -1.8431    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1980   -1.8431    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4836   -1.4306    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4836   -0.6056    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.7691   -0.1931    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.0546   -0.6056    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.0547   -1.4306    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.7691   -1.8431    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1980   -2.6681    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4836   -3.0805    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4836   -3.9055    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1980   -4.3180    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9125   -3.9055    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9124   -3.0805    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9124   -0.6056    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  2  0  0  0  0\n  5  3  1  0  0  0  0\n  6  1  1  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  2  0  0  0  0\n 10  9  1  0  0  0  0\n 10 11  2  0  0  0  0\n 11 12  1  0  0  0  0\n 12  7  2  0  0  0  0\n 13  6  1  0  0  0  0\n 14 13  1  0  0  0  0\n 15 14  2  0  0  0  0\n 16 15  1  0  0  0  0\n 16 17  2  0  0  0  0\n 17 18  1  0  0  0  0\n 18 13  2  0  0  0  0\n 19  1  1  0  0  0  0\nM  CHG  2   1   1  19  -1\nM  END",
        "smiles": "c1ccc(cc1)C(c2ccccc2)[S+](CC(=O)N)[O-]",
        "formula": "C15H15NO2S",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "RACEMIC",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "273.3517",
        "optical_activity": "( + / - )",
        "references": [
          "674dd392-54c6-4d9a-a5d7-9f9e80f9ca22",
          "dd1d5f7c-20f5-4231-af6c-d79008ddda18",
          "3f9ff0e3-081d-4e76-996a-8291bf9c0e2f"
        ],
        "stereo_centers": 1
      },
      "unii": "R3UK8X3U3D",
      "relationships": [
        {
          "uuid": "d8fb5061-c54c-43f6-a6ff-9fa2fa39c34f",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "a0c0107d-b4f3-45de-9b64-48b1149e5b36",
            "refuuid": "918c21d2-987c-4d99-a63e-1a1bda2e421e",
            "name": "MODAFINIL",
            "unii": "R3UK8X3U3D",
            "linking_id": "R3UK8X3U3D",
            "ref_pname": "MODAFINIL",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "c5b3417c-e902-4d2c-bd7e-2f1d563cb6a0",
          "qualification": "PLASMA; URINE",
          "type": "METABOLITE->PARENT",
          "interaction_type": "MAJOR",
          "related_substance": {
            "uuid": "e01624b6-ef88-4bf8-bdfb-9ddb53a7290e",
            "refuuid": "c7f8614b-694a-44c4-8f94-e1ae31a77466",
            "name": "MODAFINIL ACID",
            "unii": "54N37HN7N4",
            "linking_id": "54N37HN7N4",
            "ref_pname": "MODAFINIL ACID",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "ac71ebd7-e9e8-4467-83db-23cdc5d217d0",
          "qualification": "PLASMA",
          "type": "METABOLITE->PARENT",
          "interaction_type": "MAJOR",
          "related_substance": {
            "uuid": "58e42bba-67d3-42e6-8552-4ce53529edd1",
            "refuuid": "ff912e68-f047-417c-9498-0707fd2d9f76",
            "name": "MODAFINIL SULFONE",
            "unii": "946LME1J4S",
            "linking_id": "946LME1J4S",
            "ref_pname": "MODAFINIL SULFONE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "6157357f-d184-4589-aceb-75b00286af70",
          "type": "ENANTIOMER->RACEMATE",
          "related_substance": {
            "uuid": "493d6700-8c34-4177-9624-b738264161f2",
            "refuuid": "efa3cb44-e857-473f-8352-24ee13444e35",
            "name": "MODAFINIL, (S)-",
            "unii": "152JRG3T0U",
            "linking_id": "152JRG3T0U",
            "ref_pname": "MODAFINIL, (S)-",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "ddfa546e-0c48-4d75-8501-116cb3a6b30d",
          "type": "ENANTIOMER->RACEMATE",
          "related_substance": {
            "uuid": "fdbcf8e7-0c05-48fb-9338-00d6cbfa1872",
            "refuuid": "81e28d47-0a99-4f45-9c10-6fabdba37779",
            "name": "ARMODAFINIL",
            "unii": "V63XWA605I",
            "linking_id": "V63XWA605I",
            "ref_pname": "ARMODAFINIL",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "72a35e26-35f8-477c-b9a0-592e03084b3b",
          "amount": {
            "uuid": "bfe0bfea-a633-4868-a17c-b017188bc1b6",
            "average": 60,
            "units": "%"
          },
          "type": "BINDER->LIGAND",
          "interaction_type": "BINDING",
          "references": [
            "f356d2b4-53dc-8df8-e910-7073736b8618"
          ],
          "related_substance": {
            "uuid": "7fd25357-9569-42e2-a1d3-a47801cb285b",
            "refuuid": "e95d330b-4c2d-44bb-a61b-860afeb4aa30",
            "name": "PLASMA PROTEIN FRACTION (HUMAN)",
            "unii": "6D53G0FD0Z",
            "linking_id": "6D53G0FD0Z",
            "ref_pname": "PLASMA PROTEIN FRACTION (HUMAN)",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "6dde9bd1-9862-46f1-8268-bc795c16125c",
          "type": "TARGET->INHIBITOR",
          "references": [
            "b052d6c5-0375-c1b3-0e9d-2222efd44acc"
          ],
          "related_substance": {
            "uuid": "5d04bce7-fd78-410e-a920-0b88153a3a80",
            "refuuid": "5630b02a-204e-4bcd-bb78-b4f1e1118451",
            "name": "SODIUM-DEPENDENT DOPAMINE TRANSPORTER",
            "unii": "F202H3PMO2",
            "linking_id": "F202H3PMO2",
            "ref_pname": "SODIUM-DEPENDENT DOPAMINE TRANSPORTER",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "9c6a6fc8-202e-4f4e-9bc7-a3e818cc90d0",
          "amount": {
            "uuid": "17261c88-f6ff-42bc-bfd6-740c6e815f57",
            "units": "PERCENT PEAK AREA",
            "high_limit": 0.5
          },
          "qualification": "EP",
          "type": "IMPURITY->PARENT",
          "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)",
          "references": [
            "5bb85c94-0d1a-4445-b08d-068680f472af"
          ],
          "related_substance": {
            "uuid": "f5b8aaf2-91ef-4518-882b-b8c23c647ab3",
            "refuuid": "f5a444be-44a2-414c-accd-64f87a4d0bcd",
            "name": "MODAFINIL ESTER",
            "unii": "5BAP7W5TXD",
            "linking_id": "5BAP7W5TXD",
            "ref_pname": "MODAFINIL ESTER"
          }
        },
        {
          "uuid": "334c986b-9488-4b8e-81c9-57e88315c362",
          "amount": {
            "uuid": "d40f46d7-d167-42e5-a213-ae403d638508",
            "units": "PERCENT PEAK AREA",
            "high_limit": 0.5
          },
          "qualification": "EP",
          "type": "IMPURITY->PARENT",
          "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)",
          "references": [
            "b8311051-d1dd-4e19-8551-3a1178246366"
          ],
          "related_substance": {
            "uuid": "913f6976-961e-4410-8fbb-9d1f21256bda",
            "refuuid": "ff912e68-f047-417c-9498-0707fd2d9f76",
            "name": "MODAFINIL SULFONE",
            "unii": "946LME1J4S",
            "linking_id": "946LME1J4S",
            "ref_pname": "MODAFINIL SULFONE"
          }
        },
        {
          "uuid": "a5ae777a-978d-4b42-a1c0-00a30c5ac6ba",
          "amount": {
            "uuid": "5ffa6c11-af68-4e7c-9acd-a4f847d205e2",
            "units": "PERCENT PEAK AREA",
            "high_limit": 0.2
          },
          "qualification": "EP",
          "type": "IMPURITY->PARENT",
          "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)",
          "references": [
            "1392757c-ca3a-4f94-9819-6bcf7c5e3fef"
          ],
          "related_substance": {
            "uuid": "4b3fac9f-37e0-4c44-b4bc-99ef1ae7b257",
            "refuuid": "c7f8614b-694a-44c4-8f94-e1ae31a77466",
            "name": "MODAFINIL ACID",
            "unii": "54N37HN7N4",
            "linking_id": "54N37HN7N4",
            "ref_pname": "MODAFINIL ACID"
          }
        }
      ],
      "names": [
        {
          "uuid": "70a13bb3-1e5b-4b79-86db-81ee96409c90",
          "name": "(±)-MODAFINIL",
          "stdName": "(+/-)-MODAFINIL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "86f7e1b8-de80-44ca-8d77-bbc16fdfe741"
          ],
          "display_name": false
        },
        {
          "uuid": "8ab8621c-82cd-4a05-b69e-935d1bc1882a",
          "name": "2-[(Diphenylmethyl)sulfinyl]acetamide",
          "stdName": "2-((DIPHENYLMETHYL)SULFINYL)ACETAMIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "21d5a204-0163-4373-8320-b8ccc2e89b02"
          ],
          "display_name": false
        },
        {
          "uuid": "2e63d58e-66d9-476a-bb36-2ebb87c66d59",
          "name": "ACETAMIDE, 2-((DIPHENYLMETHYL)SULFINYL)-",
          "stdName": "ACETAMIDE, 2-((DIPHENYLMETHYL)SULFINYL)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "21d5a204-0163-4373-8320-b8ccc2e89b02"
          ],
          "display_name": false
        },
        {
          "uuid": "20ecf77b-38b0-4afa-b5ce-8383a8a22ed9",
          "name": "CEP 1538",
          "stdName": "CEP 1538",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "21d5a204-0163-4373-8320-b8ccc2e89b02"
          ],
          "display_name": false
        },
        {
          "uuid": "06cc987a-6f43-4684-8e91-2235a7c9eb2b",
          "name": "CEP-1538",
          "stdName": "CEP-1538",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "99e400ce-fd73-4f24-bc7f-09da9ec5669e"
          ],
          "display_name": false
        },
        {
          "uuid": "98ee012d-4280-4735-bd2d-96e8703c9d4a",
          "name": "CRC-40476",
          "stdName": "CRC-40476",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "86f7e1b8-de80-44ca-8d77-bbc16fdfe741"
          ],
          "display_name": false
        },
        {
          "uuid": "5cd928a0-afd4-4e5a-a6c3-2210c9fef1b3",
          "name": "CRL 40476",
          "stdName": "CRL 40476",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "21d5a204-0163-4373-8320-b8ccc2e89b02"
          ],
          "display_name": false
        },
        {
          "uuid": "7320082d-d9cd-428c-af90-f3318dcfa7f7",
          "name": "CRL-40476",
          "stdName": "CRL-40476",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "99e400ce-fd73-4f24-bc7f-09da9ec5669e"
          ],
          "display_name": false
        },
        {
          "uuid": "4e2f2351-631b-43f5-a73d-e867f9ee89ed",
          "name": "DEP-1538",
          "stdName": "DEP-1538",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "86f7e1b8-de80-44ca-8d77-bbc16fdfe741"
          ],
          "display_name": false
        },
        {
          "uuid": "9deb0579-a64d-4f31-a481-0f6957a2f528",
          "name": "MODAFINIL",
          "stdName": "MODAFINIL",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "38704cc4-d71e-4fe4-b969-89966a425b77",
            "e3122b07-a964-413f-bd1c-23d127b6c70b",
            "d8bc4f4a-f685-4184-b95f-e05664874b7c",
            "0aadc89d-76a6-4ecf-87fc-edfb1509c2b0",
            "84a8f474-de1f-46a8-8990-f45073d14d67",
            "c1598e93-fa9a-4b86-a690-bd10ead7f1c3",
            "2b4dbda4-8e5d-460f-b947-4cda01380cd2",
            "38b0dd07-447f-49e0-a64a-e8c0af3799dd",
            "231f4f07-b423-449b-b926-c687095a9664",
            "418eeadf-c5dc-42d0-9a68-55d0a3d67a4d",
            "7349cab5-dc0c-4a0a-a0d6-3a3977935079",
            "3f9ff0e3-081d-4e76-996a-8291bf9c0e2f",
            "76fd09a6-44c8-4dc1-96e2-0d70ea451b55",
            "6d4818be-4ed5-4c24-b8d8-6738b9413645",
            "c8ee49ab-c1f2-42cd-bbed-01bb80bdd485",
            "159947ec-9ad1-4878-aee0-15250d8786fd",
            "a9b3188f-5b30-49d3-97af-8cd6f5af9254",
            "0b55975c-ec9e-45de-a980-d62d3eb8eea8",
            "93349973-edc3-4300-811c-f17c36a470ca",
            "d8a8c02a-96af-4fd3-b479-02113f65652d",
            "6138762c-d1c6-4638-b832-3cb8a646e6dd",
            "f77e4abe-f1de-4be5-84eb-4da749da8df0",
            "1b781c78-499c-4e78-941d-91c62ec75897"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "25ea4dfc-9e1b-481c-8b4c-a32db710090c",
              "name_org": "USAN"
            },
            {
              "uuid": "eb469244-50fb-4cdb-b429-a35b893d35b8",
              "name_org": "INN"
            }
          ]
        },
        {
          "uuid": "d52900dd-df1a-4976-9f5e-25ef25009702",
          "name": "MODAFINIL CIV",
          "stdName": "MODAFINIL CIV",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9c3daf31-4fa8-48d8-87e4-1e342f82b328",
            "95af4511-2e6e-4b7d-98d6-9c2c09dd576f"
          ],
          "display_name": false
        },
        {
          "uuid": "f6a0f84e-1ffd-479a-9983-e69bd55e50a5",
          "name": "MODAFINIL CIV [USP-RS]",
          "stdName": "MODAFINIL CIV [USP-RS]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9c3daf31-4fa8-48d8-87e4-1e342f82b328"
          ],
          "display_name": false
        },
        {
          "uuid": "d5dabe85-cdc7-013f-8e56-f67c25570edd",
          "name": "MODAFINIL [EP MONOGRAPH]",
          "stdName": "MODAFINIL [EP MONOGRAPH]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "bbc113e2-e57d-5f5a-c9ac-3f774d4cd00c"
          ],
          "display_name": false
        },
        {
          "uuid": "d928f2c9-cb9f-4e68-b8b9-0ae3e8872a2b",
          "name": "MODAFINIL [HSDB]",
          "stdName": "MODAFINIL [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "38704cc4-d71e-4fe4-b969-89966a425b77"
          ],
          "display_name": false
        },
        {
          "uuid": "bb9c44a8-98b5-4113-9a11-4f73155b3ec6",
          "name": "MODAFINIL [JAN]",
          "stdName": "MODAFINIL [JAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c8ee49ab-c1f2-42cd-bbed-01bb80bdd485"
          ],
          "display_name": false
        },
        {
          "uuid": "48426d8c-c226-46d3-a9a1-eae843bbbcba",
          "name": "MODAFINIL [MART.]",
          "stdName": "MODAFINIL [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "159947ec-9ad1-4878-aee0-15250d8786fd"
          ],
          "display_name": false
        },
        {
          "uuid": "f28335be-89c7-4cf6-a1f2-1c1aa5c6ab67",
          "name": "MODAFINIL [MI]",
          "stdName": "MODAFINIL [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f77e4abe-f1de-4be5-84eb-4da749da8df0"
          ],
          "display_name": false
        },
        {
          "uuid": "fc6f5ccf-52a6-49d3-ab7c-237bae757d05",
          "name": "MODAFINIL [ORANGE BOOK]",
          "stdName": "MODAFINIL [ORANGE BOOK]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c1598e93-fa9a-4b86-a690-bd10ead7f1c3"
          ],
          "display_name": false
        },
        {
          "uuid": "850a75c6-3b55-470a-84cf-086d96bbfe50",
          "name": "MODAFINIL [USAN]",
          "stdName": "MODAFINIL [USAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "93349973-edc3-4300-811c-f17c36a470ca"
          ],
          "display_name": false
        },
        {
          "uuid": "6c9ec32e-a4d0-ffb9-19b1-db5bbe7cfe1a",
          "name": "MODAFINIL [USP MONOGRAPH]",
          "stdName": "MODAFINIL [USP MONOGRAPH]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a8a85ffe-4caf-302e-89cd-40d9b054ef59"
          ],
          "display_name": false
        },
        {
          "uuid": "f801e16a-7140-4d6b-b0e9-5a6069d1f16e",
          "name": "MODAFINIL [VANDF]",
          "stdName": "MODAFINIL [VANDF]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1b781c78-499c-4e78-941d-91c62ec75897"
          ],
          "display_name": false
        },
        {
          "uuid": "e7a198dd-8c9a-4049-9233-a9a22e537795",
          "name": "MODAPHONIL",
          "stdName": "MODAPHONIL",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "86f7e1b8-de80-44ca-8d77-bbc16fdfe741"
          ],
          "display_name": false
        },
        {
          "uuid": "98f6cf3b-ffc8-4ffb-b3f1-83dc8e20d3de",
          "name": "MODIODAL",
          "stdName": "MODIODAL",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "86f7e1b8-de80-44ca-8d77-bbc16fdfe741"
          ],
          "display_name": false
        },
        {
          "uuid": "a085a437-cf39-98bc-33c2-4ca0b95c4e7e",
          "name": "Modafinil [WHO-DD]",
          "stdName": "MODAFINIL [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "15c91045-c73e-977f-206b-0d0d3325ca07"
          ],
          "display_name": false
        },
        {
          "uuid": "65f050ae-e81d-1938-1c64-845e47ad3b9f",
          "name": "NSC-751178",
          "stdName": "NSC-751178",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "03273aa6-92c8-114d-fba5-935178025b07"
          ],
          "display_name": false
        },
        {
          "uuid": "035973a3-ef66-c67c-46e3-f6b05bb707a8",
          "name": "NSC-759110",
          "stdName": "NSC-759110",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "03273aa6-92c8-114d-fba5-935178025b07"
          ],
          "display_name": false
        },
        {
          "uuid": "e93f2872-84ec-4740-a9a8-4eb4257a7224",
          "name": "PROVIGIL",
          "stdName": "PROVIGIL",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "21d5a204-0163-4373-8320-b8ccc2e89b02"
          ],
          "display_name": false
        },
        {
          "uuid": "1e3da4dd-7453-6b42-1ac8-5858cad4165c",
          "name": "THN-102 COMPONENT MODAFINIL",
          "stdName": "THN-102 COMPONENT MODAFINIL",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2547f836-63df-5831-d6a6-281296ae002b",
            "d8bc4f4a-f685-4184-b95f-e05664874b7c"
          ],
          "display_name": false
        },
        {
          "uuid": "7412c8a8-7a89-cd17-fcf9-928589139e7b",
          "name": "THN102 COMPONENT MODAFINIL",
          "stdName": "THN102 COMPONENT MODAFINIL",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2547f836-63df-5831-d6a6-281296ae002b",
            "d8bc4f4a-f685-4184-b95f-e05664874b7c"
          ],
          "display_name": false
        },
        {
          "uuid": "bf6a19de-0dcd-481f-9bda-6bb936a6d4c7",
          "name": "modafinil [INN]",
          "stdName": "MODAFINIL [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3f9ff0e3-081d-4e76-996a-8291bf9c0e2f"
          ],
          "display_name": false
        }
      ],
      "properties": [
        {
          "uuid": "f292824b-c795-4696-99f8-6a90c23e8c63",
          "name": "Biological Half-life",
          "value": {
            "uuid": "9bb1604d-79d9-42a4-8d95-f76de8df5f0e",
            "average": 15,
            "units": "hours"
          },
          "defining": false,
          "property_type": "PHARMACOKINETIC",
          "references": [
            "f356d2b4-53dc-8df8-e910-7073736b8618"
          ]
        },
        {
          "uuid": "d52820dc-e90f-4d87-a23e-e3745c23b14a",
          "name": "Volume of Distribution",
          "value": {
            "uuid": "61584473-bace-4bb2-9d64-8020334fee46",
            "average": 0.9,
            "units": "Liters/Kilogram"
          },
          "defining": false,
          "property_type": "PHARMACOKINETIC",
          "references": [
            "f356d2b4-53dc-8df8-e910-7073736b8618"
          ]
        }
      ]
    }
  ]
}