{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "2e17be7e-9574-4242-8184-622c14ba01ee",
          "code": "R3PSM6BEG8",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "f3b1cc5b-1aeb-4c7b-ba3d-4b17e65d73dd",
          "code": "1366416-29-6",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=1366416-29-6",
          "code_system": "CAS",
          "references": [
            "b59b49f9-603b-416e-a417-8e633397f8c1"
          ]
        },
        {
          "uuid": "026dc372-7632-6459-e01d-1bd8367a4a23",
          "code": "155907915",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/155907915",
          "code_system": "PUBCHEM",
          "references": [
            "330a29a8-e2f9-a852-b6fe-477789f9d507"
          ]
        },
        {
          "uuid": "8a179c7f-bf3a-aa45-0c2d-f7c931a63254",
          "code": "DTXSID501337077",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID501337077",
          "code_system": "EPA CompTox",
          "references": [
            "65c7bc58-2e67-9d54-327d-49121339111e"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "e8054229-828f-4ae7-9c5b-a1c466e0e808",
          "amount": {
            "uuid": "4be8e6eb-14c6-4b69-8cae-1e7fd733c0a1"
          },
          "type": "ACTIVE MOIETY",
          "references": [
            "c433e570-cf52-4aa9-ab24-fa2501d0fe80"
          ],
          "related_substance": {
            "uuid": "6b8adfee-cc28-4ea5-ae23-23989d6394c5",
            "refuuid": "d2790505-2288-4e71-8b85-aa3fb810ada1",
            "name": "N-METHYL-N-ALLYLTRYPTAMINE",
            "unii": "R3PSM6BEG8",
            "linking_id": "R3PSM6BEG8",
            "ref_pname": "N-METHYL-N-ALLYLTRYPTAMINE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "0cb755f2-cbfe-4ecf-906b-7a4715b4ced8",
          "amount": {
            "uuid": "0c7e85b3-b4a7-44a4-aff1-dd5f7122b2f7"
          },
          "comments": "May be an agonist",
          "type": "TARGET->AGONIST",
          "references": [
            "83bbe5e4-9029-45e2-97a8-d1cf78f5f36e"
          ],
          "related_substance": {
            "uuid": "c69855d8-e88b-49f7-9363-9eb5a4d2894c",
            "refuuid": "d78d31c8-4aa9-4058-b1bc-4b11d2e862e3",
            "name": "5-HYDROXYTRYPTAMINE RECEPTOR 2A",
            "unii": "NQI5D806LC",
            "linking_id": "NQI5D806LC",
            "ref_pname": "5-HYDROXYTRYPTAMINE RECEPTOR 2A",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "3bd75cbf-eb39-4edc-8011-dfc99d641463",
          "name": "(2-(1H-INDOL-3-YL)ETHYL)(METHYL)(PROP-2-EN-1-YL)AMINE",
          "stdName": "(2-(1H-INDOL-3-YL)ETHYL)(METHYL)(PROP-2-EN-1-YL)AMINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b59b49f9-603b-416e-a417-8e633397f8c1"
          ],
          "display_name": false
        },
        {
          "uuid": "8cfbf765-9b8c-4765-8dab-62da95fffd84",
          "name": "1H-INDOLE-3-ETHANAMINE, N-METHYL-N-2-PROPEN-1-YL-",
          "stdName": "1H-INDOLE-3-ETHANAMINE, N-METHYL-N-2-PROPEN-1-YL-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b59b49f9-603b-416e-a417-8e633397f8c1"
          ],
          "display_name": false
        },
        {
          "uuid": "dc6fd114-e458-4c78-8c9d-8a50d1fbc861",
          "name": "MALT",
          "stdName": "MALT",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c433e570-cf52-4aa9-ab24-fa2501d0fe80"
          ],
          "display_name": false
        },
        {
          "uuid": "e90dce5f-6653-b541-939c-4b9390cb4f68",
          "name": "MALT [JAN]",
          "stdName": "MALT [JAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "33e84c13-ae1c-843f-59b5-9af6a79dd3af"
          ],
          "display_name": false
        },
        {
          "uuid": "fc59ecd7-24c4-4a09-9202-83e5ff868700",
          "name": "N-(2-(1H-INDOL-3-YL)ETHYL)-N-METHYLPROP-2-EN-1-AMINE",
          "stdName": "N-(2-(1H-INDOL-3-YL)ETHYL)-N-METHYLPROP-2-EN-1-AMINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c433e570-cf52-4aa9-ab24-fa2501d0fe80"
          ],
          "display_name": false
        },
        {
          "uuid": "b097fbd5-6260-4f1a-b282-079a889e702e",
          "name": "N-METHYL-N-ALLYLTRYPTAMINE",
          "stdName": "N-METHYL-N-ALLYLTRYPTAMINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c433e570-cf52-4aa9-ab24-fa2501d0fe80"
          ],
          "display_name": true
        }
      ],
      "references": [
        {
          "uuid": "33e84c13-ae1c-843f-59b5-9af6a79dd3af",
          "citation": "JAN",
          "doc_type": "JAN",
          "public_domain": true
        },
        {
          "uuid": "b59b49f9-603b-416e-a417-8e633397f8c1",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "c433e570-cf52-4aa9-ab24-fa2501d0fe80",
          "citation": "https://isomerdesign.com/PiHKAL/explore.php?domain=pk&id=5646",
          "url": "https://isomerdesign.com/PiHKAL/explore.php?domain=pk&id=5646",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "330a29a8-e2f9-a852-b6fe-477789f9d507",
          "citation": "PUBCHEM",
          "doc_type": "PUBCHEM",
          "public_domain": true
        },
        {
          "uuid": "65c7bc58-2e67-9d54-327d-49121339111e",
          "citation": "EPA CompTox",
          "doc_type": "EPA",
          "public_domain": true
        },
        {
          "uuid": "83bbe5e4-9029-45e2-97a8-d1cf78f5f36e",
          "citation": "https://psychedelicreview.com/compound/malt/",
          "url": "https://psychedelicreview.com/compound/malt/",
          "doc_type": "WEB PAGE",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "7787255f-b3d8-40d4-a8c8-38547ad210f0",
          "id": "7787255f-b3d8-40d4-a8c8-38547ad210f0",
          "molfile": "\n  Marvin  04202114572D          \n\n 16 17  0  0  0  0            999 V2000\n    3.0247   -2.4118    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2177   -2.2403    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.9627   -1.4557    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.1558   -1.2841    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    0.9008   -0.4995    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0939   -0.3280    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.1611    0.4566    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.3238    1.1241    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.1611    1.7915    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.9457    1.5366    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.9457    0.7116    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.6602    0.2991    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.3746    0.7116    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.3746    1.5366    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.6602    1.9491    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6037   -1.8972    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  2  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  4 16  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  2  0  0  0  0\n  7 11  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  2  0  0  0  0\n 10 15  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  2  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  2  0  0  0  0\nM  END",
          "smiles": "C=CCN(C)CCc1c[nH]c2ccccc12",
          "formula": "C14H18N2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "5b001395-1d82-4d15-8945-ab9dcd5e78a3"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "214.3066",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "d2790505-2288-4e71-8b85-aa3fb810ada1",
      "version": "8",
      "structure": {
        "id": "328e7f3d-b1e2-4a8c-b9d2-9db009b4c046",
        "molfile": "\n   JSDraw204202110572D\n\n 16 17  0  0  0  0              0 V2000\n   30.2728  -11.8190    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   28.7468  -11.4947    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   28.2647  -10.0111    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   26.7389   -9.6867    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   26.2567   -8.2030    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   24.7309   -7.8788    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   24.2487   -6.3951    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   25.1656   -5.1330    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   24.2487   -3.8710    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   22.7651   -4.3530    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   22.7651   -5.9130    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   21.4141   -6.6930    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   20.0632   -5.9130    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   20.0632   -4.3530    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   21.4141   -3.5730    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   25.6949  -10.8460    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  2  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  2  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  2  0  0  0  0\n  7 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  2  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  2  0  0  0  0\n 10 15  1  0  0  0  0\n  4 16  1  0  0  0  0\nM  END",
        "smiles": "C=CCN(C)CCc1c[nH]c2ccccc12",
        "formula": "C14H18N2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "214.3066",
        "optical_activity": "NONE",
        "references": [
          "b59b49f9-603b-416e-a417-8e633397f8c1",
          "c433e570-cf52-4aa9-ab24-fa2501d0fe80"
        ],
        "stereo_centers": 0
      },
      "unii": "R3PSM6BEG8"
    }
  ]
}