{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "1be15861-6644-487d-bdbf-d1ba4d98350e", "code": "106359-54-0", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=106359-54-0", "code_system": "CAS", "references": [ "b9427067-5f4a-4e14-98ad-79d7c6030d31", "1f492638-9b5c-4f7b-8115-1c06bb67945e" ] }, { "uuid": "97223c19-f69b-41e4-bd9d-43d77452201a", "code": "44369716", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/44369716", "code_system": "PUBCHEM", "references": [ "b9427067-5f4a-4e14-98ad-79d7c6030d31" ] }, { "uuid": "968279f6-a1e2-0621-a9ab-461512a54bbc", "code": "DTXSID00147585", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID00147585", "code_system": "EPA CompTox", "references": [ "68d5502f-bd11-077f-9bb6-fc16cb0ed194" ] }, { "uuid": "57bac632-abe5-4c6a-8103-f58ee0ff4fe1", "code": "R3GRG20IPQ", "type": "PRIMARY", "code_system": "FDA UNII" } ], "substance_class": "chemical", "names": [ { "uuid": "25e314bd-e7b3-4461-9ada-ae360ebd418c", "name": "(1,1'-BIPHENYL)-4-CARBOXAMIDE, N-HYDROXY-", "stdName": "(1,1'-BIPHENYL)-4-CARBOXAMIDE, N-HYDROXY-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "4f5164d3-39b2-4e8d-9cf6-115b6b4a77c6", "b5959ff2-ba51-4c65-8c8a-ddcbfb0bdc04" ], "display_name": false }, { "uuid": "341f93cb-2c88-43d8-8c74-f91b2ac680e6", "name": "BIPHENYLHYDROXAMIC ACID", "stdName": "BIPHENYLHYDROXAMIC ACID", "type": "of", "languages": [ "en" ], "preferred": false, "references": [ "e6e0d53e-7145-495b-911c-ab6ecf91d688", "4f5164d3-39b2-4e8d-9cf6-115b6b4a77c6", "48a6f4b9-f637-4f4e-9133-5005068a8c29" ], "display_name": true, "domains": [ "cosmetic" ], "name_orgs": [ { "uuid": "2fd822da-5113-4a93-bbfb-d28a8242fdb5", "name_org": "INCI" } ] } ], "references": [ { "uuid": "e6e0d53e-7145-495b-911c-ab6ecf91d688", "citation": "PCPC", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "4f5164d3-39b2-4e8d-9cf6-115b6b4a77c6", "citation": "PERSONAL CARE PRODUCTS COUNCIL", "doc_type": "PERSONAL CARE PRODUCTS COUNCIL", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "b5959ff2-ba51-4c65-8c8a-ddcbfb0bdc04", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "b9427067-5f4a-4e14-98ad-79d7c6030d31", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493391418000, "tags": [ "NOMEN" ] }, { "uuid": "c6c2dc53-5c4f-4acf-bc53-5d14413081aa", "citation": "SRS import [R3GRG20IPQ]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=R3GRG20IPQ", "doc_type": "SRS", "public_domain": true, "document_date": 1493391418000, "tags": [ "NOMEN" ] }, { "uuid": "48a6f4b9-f637-4f4e-9133-5005068a8c29", "citation": "BIPHENYLHYDROXAMIC ACID [INCI]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "68d5502f-bd11-077f-9bb6-fc16cb0ed194", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=106359-54-0", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "1f492638-9b5c-4f7b-8115-1c06bb67945e", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "58a4d05c-bb3c-496b-9359-84cd8a0f3003", "id": "58a4d05c-bb3c-496b-9359-84cd8a0f3003", "molfile": "\n Marvin 01132104362D \n\n 16 17 0 0 0 0 999 V2000\n 7.7292 -4.7088 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.0147 -4.2962 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 6.3002 -4.7088 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.3002 -5.5338 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.5858 -4.2962 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.5858 -3.4713 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.8713 -3.0588 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.1568 -3.4713 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.1568 -4.2962 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.8713 -4.7088 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.4424 -3.0588 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.7279 -3.4713 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.0134 -3.0588 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.0134 -2.2338 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.7279 -1.8213 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.4424 -2.2338 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 3 2 1 0 0 0 0\n 3 4 2 0 0 0 0\n 5 3 1 0 0 0 0\n 5 6 1 0 0 0 0\n 10 5 2 0 0 0 0\n 6 7 2 0 0 0 0\n 7 8 1 0 0 0 0\n 8 9 2 0 0 0 0\n 11 8 1 0 0 0 0\n 9 10 1 0 0 0 0\n 12 11 1 0 0 0 0\n 11 16 2 0 0 0 0\n 13 12 2 0 0 0 0\n 14 13 1 0 0 0 0\n 15 14 2 0 0 0 0\n 16 15 1 0 0 0 0\nM END", "smiles": "c1ccc(cc1)-c2ccc(cc2)C(=O)NO", "formula": "C13H11NO2", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "d9013b6d-ebf1-40de-8f26-310276acef37" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "213.2324", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "441ea876-6bec-4af8-b0b0-de4489c81806", "version": "4", "structure": { "id": "a4a603b4-25cf-42fd-b087-f72e4331f14a", "molfile": "\n Marvin 01132108332D \n\n 16 17 0 0 0 0 999 V2000\n 4.1568 -3.4713 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.8713 -3.0588 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.5858 -3.4713 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.5858 -4.2962 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.8713 -4.7088 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.1568 -4.2962 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.3002 -4.7088 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.0147 -4.2962 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 7.7292 -4.7088 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.3002 -5.5338 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3.4424 -3.0588 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.7279 -3.4713 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.0134 -3.0588 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.0134 -2.2338 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.7279 -1.8213 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.4424 -2.2338 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 2 0 0 0 0\n 3 2 1 0 0 0 0\n 4 3 2 0 0 0 0\n 5 4 1 0 0 0 0\n 6 5 2 0 0 0 0\n 1 6 1 0 0 0 0\n 4 7 1 0 0 0 0\n 7 8 1 0 0 0 0\n 8 9 1 0 0 0 0\n 7 10 2 0 0 0 0\n 11 1 1 0 0 0 0\n 12 11 1 0 0 0 0\n 13 12 2 0 0 0 0\n 14 13 1 0 0 0 0\n 15 14 2 0 0 0 0\n 16 15 1 0 0 0 0\n 11 16 2 0 0 0 0\nM END", "smiles": "c1ccc(cc1)-c2ccc(cc2)C(=O)NO", "formula": "C13H11NO2", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "213.2324", "optical_activity": "NONE", "references": [ "b5959ff2-ba51-4c65-8c8a-ddcbfb0bdc04", "c6c2dc53-5c4f-4acf-bc53-5d14413081aa" ], "stereo_centers": 0 }, "unii": "R3GRG20IPQ" } ] }