{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "c40969fd-5bed-465b-bdff-e1e44dbcefd9",
          "code": "5979-28-2",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=5979-28-2",
          "code_system": "CAS",
          "references": [
            "a1d8592b-529f-43e1-a99c-aedd6be6cf5b",
            "d2b0c7d6-c2d8-49eb-acd5-12ea9209793a"
          ]
        },
        {
          "uuid": "67d6ace8-9176-4c66-80f1-0eb2856c21b9",
          "code": "227-783-3",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.025.258",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "a1d8592b-529f-43e1-a99c-aedd6be6cf5b"
          ]
        },
        {
          "uuid": "6be6a97c-394b-851d-cd6d-2fb85e04de3f",
          "code": "DTXSID6021452",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID6021452",
          "code_system": "EPA CompTox",
          "references": [
            "93707c1b-bc4d-b9a6-fdaf-93b65c753813"
          ]
        },
        {
          "uuid": "dc11bf91-cc28-489a-9208-0d232f70371a",
          "code": "R3896P1A0H",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "b6fd9c5b-1018-3ef4-eeff-777e9e5a1a8a",
          "code": "Pigment Yellow 16",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Pigment_Yellow_16",
          "code_system": "WIKIPEDIA",
          "references": [
            "6eadf531-e4e7-b41c-134c-512557ca203b"
          ]
        },
        {
          "uuid": "d2fc9e07-e857-a6f0-d338-0461a4411beb",
          "code": "521238",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=521238",
          "code_system": "NSC",
          "references": [
            "e3e7702d-e1ac-77f9-b0d4-232b41abb8ec"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "aef8d411-fccf-44f6-b9c3-6592c078bba8",
          "name": "BUTANAMIDE, N,N'-(3,3'-DIMETHYL(1,1'-BIPHENYL)-4,4'-DIYL)BIS(2-(2-(2,4-DICHLOROPHENYL)DIAZENYL)-3-OXO-",
          "stdName": "BUTANAMIDE, N,N'-(3,3'-DIMETHYL(1,1'-BIPHENYL)-4,4'-DIYL)BIS(2-(2-(2,4-DICHLOROPHENYL)DIAZENYL)-3-OXO-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ec150957-1de4-4bb4-878e-d87dd074b09b",
            "70d49c6e-fc35-460f-bbdb-a03b8c0ee9d1"
          ],
          "display_name": false
        },
        {
          "uuid": "adb9d66a-41ee-4819-8d72-48beadf4497b",
          "name": "C.I. 20040",
          "stdName": "C.I. 20040",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ec150957-1de4-4bb4-878e-d87dd074b09b",
            "70d49c6e-fc35-460f-bbdb-a03b8c0ee9d1"
          ],
          "display_name": false
        },
        {
          "uuid": "c6ea6ee5-6556-4a36-841d-76ae1c6a9678",
          "name": "C.I. PIGMENT YELLOW 16",
          "stdName": "C.I. PIGMENT YELLOW 16",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "70d49c6e-fc35-460f-bbdb-a03b8c0ee9d1",
            "24ba3d08-5314-4b9d-8635-996f7c63b8e4"
          ],
          "display_name": false
        },
        {
          "uuid": "14af9204-546a-4c9e-a1cb-53bc1de96437",
          "name": "CHROMATEX YELLOW JN",
          "stdName": "CHROMATEX YELLOW JN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ec150957-1de4-4bb4-878e-d87dd074b09b",
            "70d49c6e-fc35-460f-bbdb-a03b8c0ee9d1"
          ],
          "display_name": false
        },
        {
          "uuid": "4e49398e-09e5-4b86-b6d9-1be172aee697",
          "name": "CI 20040",
          "stdName": "CI 20040",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": true,
          "references": [
            "fbb50c4b-fe35-498c-a4fa-f157b03f3c97",
            "70d49c6e-fc35-460f-bbdb-a03b8c0ee9d1",
            "fd8e65bd-2c9c-4335-b873-d1006cda8e74",
            "8f316a93-d8cf-46d2-9375-0a201a44c5ad"
          ],
          "display_name": false,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "14f86b36-f993-4240-a228-f7dad62f15c6",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "e13251d0-873b-4985-a0dc-b0a92cbc53f3",
          "name": "CI PIGMENT YELLOW 16",
          "stdName": "CI PIGMENT YELLOW 16",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "70d49c6e-fc35-460f-bbdb-a03b8c0ee9d1",
            "af5f2d2a-fb7d-4a05-8ce7-8bdc51143cc6"
          ],
          "display_name": false
        },
        {
          "uuid": "8f332e13-7b2d-4284-85bb-f8d463ac2bdd",
          "name": "HELIO FAST YELLOW FPV",
          "stdName": "HELIO FAST YELLOW FPV",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ec150957-1de4-4bb4-878e-d87dd074b09b",
            "70d49c6e-fc35-460f-bbdb-a03b8c0ee9d1"
          ],
          "display_name": false
        },
        {
          "uuid": "d8ff21fc-f6f2-4f39-9728-5c89c34053b6",
          "name": "HOSTAPERM YELLOW NCG",
          "stdName": "HOSTAPERM YELLOW NCG",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ec150957-1de4-4bb4-878e-d87dd074b09b",
            "70d49c6e-fc35-460f-bbdb-a03b8c0ee9d1"
          ],
          "display_name": false
        },
        {
          "uuid": "6f8a55a8-7084-4947-8873-39202113cf8d",
          "name": "IRGALITE FAST YELLOW GC",
          "stdName": "IRGALITE FAST YELLOW GC",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ec150957-1de4-4bb4-878e-d87dd074b09b",
            "70d49c6e-fc35-460f-bbdb-a03b8c0ee9d1"
          ],
          "display_name": false
        },
        {
          "uuid": "ab859afd-1299-4a24-a64f-400cb52fa1f2",
          "name": "LIGHT YELLOW JN",
          "stdName": "LIGHT YELLOW JN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ec150957-1de4-4bb4-878e-d87dd074b09b",
            "70d49c6e-fc35-460f-bbdb-a03b8c0ee9d1"
          ],
          "display_name": false
        },
        {
          "uuid": "57fc0dee-35b7-45e6-9ac3-80a3a25fe102",
          "name": "NSC-521238",
          "stdName": "NSC-521238",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ec150957-1de4-4bb4-878e-d87dd074b09b",
            "70d49c6e-fc35-460f-bbdb-a03b8c0ee9d1"
          ],
          "display_name": false
        },
        {
          "uuid": "c615436e-7279-4833-b152-0f15c8995bdb",
          "name": "PERMANENT YELLOW NCG 70",
          "stdName": "PERMANENT YELLOW NCG 70",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ec150957-1de4-4bb4-878e-d87dd074b09b",
            "70d49c6e-fc35-460f-bbdb-a03b8c0ee9d1"
          ],
          "display_name": false
        },
        {
          "uuid": "e51e097b-4364-4b05-96ff-b1f1e3eb280c",
          "name": "PIGMENT YELLOW 16",
          "stdName": "PIGMENT YELLOW 16",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "70d49c6e-fc35-460f-bbdb-a03b8c0ee9d1",
            "8f316a93-d8cf-46d2-9375-0a201a44c5ad"
          ],
          "display_name": true
        },
        {
          "uuid": "68598b9e-af02-47c3-87eb-8fddaa436687",
          "name": "PLASTOL YELLOW 3GL",
          "stdName": "PLASTOL YELLOW 3GL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ec150957-1de4-4bb4-878e-d87dd074b09b",
            "70d49c6e-fc35-460f-bbdb-a03b8c0ee9d1"
          ],
          "display_name": false
        },
        {
          "uuid": "56b42c06-070e-4846-976f-ddeb83a82d9a",
          "name": "PV-YELLOW G",
          "stdName": "PV-YELLOW G",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ec150957-1de4-4bb4-878e-d87dd074b09b",
            "70d49c6e-fc35-460f-bbdb-a03b8c0ee9d1"
          ],
          "display_name": false
        },
        {
          "uuid": "7ba71b08-bb37-4df3-ab97-3d8c9ec19c8c",
          "name": "RESAMINE FAST YELLOW 3GL",
          "stdName": "RESAMINE FAST YELLOW 3GL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ec150957-1de4-4bb4-878e-d87dd074b09b",
            "70d49c6e-fc35-460f-bbdb-a03b8c0ee9d1"
          ],
          "display_name": false
        },
        {
          "uuid": "c8a6e165-f17f-4b75-a2ba-281dddac37fb",
          "name": "SEGNALE LIGHT YELLOW NCG",
          "stdName": "SEGNALE LIGHT YELLOW NCG",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ec150957-1de4-4bb4-878e-d87dd074b09b",
            "70d49c6e-fc35-460f-bbdb-a03b8c0ee9d1"
          ],
          "display_name": false
        },
        {
          "uuid": "553f66ee-c350-4d3a-83a4-dcb4130962f6",
          "name": "SILOTON YELLOW NCG",
          "stdName": "SILOTON YELLOW NCG",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ec150957-1de4-4bb4-878e-d87dd074b09b",
            "70d49c6e-fc35-460f-bbdb-a03b8c0ee9d1"
          ],
          "display_name": false
        },
        {
          "uuid": "f471e844-4b8a-4044-a0e3-4dcb01124921",
          "name": "TERMOSOLIDO YELLOW GL SUPRA",
          "stdName": "TERMOSOLIDO YELLOW GL SUPRA",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ec150957-1de4-4bb4-878e-d87dd074b09b",
            "70d49c6e-fc35-460f-bbdb-a03b8c0ee9d1"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "fbb50c4b-fe35-498c-a4fa-f157b03f3c97",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "70d49c6e-fc35-460f-bbdb-a03b8c0ee9d1",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "24ba3d08-5314-4b9d-8635-996f7c63b8e4",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "af5f2d2a-fb7d-4a05-8ce7-8bdc51143cc6",
          "citation": "ICSAS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ec150957-1de4-4bb4-878e-d87dd074b09b",
          "citation": "SCIFINDER",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8f316a93-d8cf-46d2-9375-0a201a44c5ad",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a1d8592b-529f-43e1-a99c-aedd6be6cf5b",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391981000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "da454eaf-9e47-41bb-b2cf-ec99e27bae67",
          "citation": "SRS import [R3896P1A0H]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=R3896P1A0H",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391981000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "fd8e65bd-2c9c-4335-b873-d1006cda8e74",
          "citation": "CI 20040 [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "93707c1b-bc4d-b9a6-fdaf-93b65c753813",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=5979-28-2",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "6eadf531-e4e7-b41c-134c-512557ca203b",
          "citation": "WIKI",
          "doc_type": "WIKI",
          "public_domain": true
        },
        {
          "uuid": "e3e7702d-e1ac-77f9-b0d4-232b41abb8ec",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "d2b0c7d6-c2d8-49eb-acd5-12ea9209793a",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "c862d3cd-879e-4fbf-9906-2f749f38347d",
          "id": "c862d3cd-879e-4fbf-9906-2f749f38347d",
          "molfile": "\n  Marvin  01132110212D          \n\n 48 51  0  0  0  0            999 V2000\n    2.3482   -4.9949    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1730   -4.9796    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5987   -5.6863    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5721   -4.2576    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    3.1465   -3.5509    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3216   -3.5662    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    1.8959   -2.8595    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.0711   -2.8749    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6454   -2.1681    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.0445   -1.4462    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6321   -0.7317    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    1.8694   -1.4308    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2951   -2.1376    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1201   -2.1376    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    4.3970   -4.2423    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7962   -3.5203    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8128   -4.9548    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6378   -4.9510    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0403   -4.2309    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8652   -4.2194    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2876   -4.9281    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8851   -5.6482    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0602   -5.6597    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6477   -6.3742    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1125   -4.9165    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5349   -5.6252    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3598   -5.6137    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7623   -4.8936    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5873   -4.8936    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   11.1707   -5.4769    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7582   -6.1914    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.9957   -5.4769    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n   12.5790   -6.0603    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   13.4041   -6.0603    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   13.9874   -6.6437    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.7843   -6.4301    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.3677   -7.0134    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.1541   -7.8104    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.7375   -8.3938    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n   14.3573   -8.0239    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.7739   -7.4405    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.0144   -7.5933    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n   12.4082   -4.7625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.2051   -4.5489    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.9957   -4.0480    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3399   -4.1849    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7923   -3.4924    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5150   -4.1964    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  2  0  0  0  0\n  4  2  1  0  0  0  0\n  5  4  1  0  0  0  0\n  4 15  1  0  0  0  0\n  6  5  2  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  1  0  0  0  0\n  7 13  2  0  0  0  0\n  9  8  2  0  0  0  0\n 10  9  1  0  0  0  0\n 10 11  1  0  0  0  0\n 10 12  2  0  0  0  0\n 13 12  1  0  0  0  0\n 13 14  1  0  0  0  0\n 15 16  2  0  0  0  0\n 15 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 19 18  1  0  0  0  0\n 18 23  2  0  0  0  0\n 20 19  2  0  0  0  0\n 21 20  1  0  0  0  0\n 22 21  2  0  0  0  0\n 21 25  1  0  0  0  0\n 23 22  1  0  0  0  0\n 23 24  1  0  0  0  0\n 25 26  1  0  0  0  0\n 48 25  2  0  0  0  0\n 26 27  2  0  0  0  0\n 27 28  1  0  0  0  0\n 28 29  1  0  0  0  0\n 28 46  2  0  0  0  0\n 29 30  1  0  0  0  0\n 30 31  2  0  0  0  0\n 30 32  1  0  0  0  0\n 32 33  1  0  0  0  0\n 32 43  1  0  0  0  0\n 33 34  2  0  0  0  0\n 34 35  1  0  0  0  0\n 36 35  1  0  0  0  0\n 35 41  2  0  0  0  0\n 37 36  2  0  0  0  0\n 38 37  1  0  0  0  0\n 38 39  1  0  0  0  0\n 40 38  2  0  0  0  0\n 41 40  1  0  0  0  0\n 41 42  1  0  0  0  0\n 43 44  1  0  0  0  0\n 43 45  2  0  0  0  0\n 46 47  1  0  0  0  0\n 46 48  1  0  0  0  0\nM  END",
          "smiles": "Cc1cc(ccc1NC(=O)C(C(=O)C)/N=N/c2ccc(cc2Cl)Cl)-c3ccc(c(C)c3)NC(=O)C(C(=O)C)/N=N/c4ccc(cc4Cl)Cl",
          "formula": "C34H28Cl4N6O4",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "MIXED",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "5dfc7482-f231-4db7-81fd-c1233d19077d"
          },
          "defined_stereo": 0,
          "ez_centers": 2,
          "molecular_weight": "726.437",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 2
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "4083a6b6-49e3-4768-a2a4-11406da38ad6",
      "version": "6",
      "structure": {
        "id": "43ff3f75-e552-46b2-9402-94c143c2c188",
        "molfile": "\n  Marvin  01132103352D          \n\n 48 51  0  0  0  0            999 V2000\n    1.0711   -2.8749    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3482   -4.9949    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5987   -5.6863    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3216   -3.5662    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1730   -4.9796    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.8959   -2.8595    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1465   -3.5509    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5721   -4.2576    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6477   -6.3742    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8128   -4.9548    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3970   -4.2423    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0602   -5.6597    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.0445   -1.4462    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6378   -4.9510    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8851   -5.6482    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2951   -2.1376    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7962   -3.5203    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2876   -4.9281    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0403   -4.2309    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5349   -5.6252    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.0144   -7.5933    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    8.1125   -4.9165    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3598   -5.6137    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7582   -6.1914    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8652   -4.2194    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1201   -2.1376    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n   14.3573   -8.0239    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.7375   -8.3938    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n   13.7739   -7.4405    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.1541   -7.8104    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.5790   -6.0603    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    1.8694   -1.4308    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7623   -4.8936    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.1707   -5.4769    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.9874   -6.6437    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5150   -4.1964    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5873   -4.8936    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   13.4041   -6.0603    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   11.9957   -5.4769    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.3677   -7.0134    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.7843   -6.4301    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3399   -4.1849    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6321   -0.7317    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n   12.4082   -4.7625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.9957   -4.0480    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   13.2051   -4.5489    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7923   -3.4924    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6454   -2.1681    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  5  2  1  0  0  0  0\n  5  3  2  0  0  0  0\n  1  6  1  0  0  0  0\n  6  4  1  0  0  0  0\n  4  7  2  0  0  0  0\n  7  8  1  0  0  0  0\n  8  5  1  0  0  0  0\n  8 11  1  0  0  0  0\n 11 10  1  0  0  0  0\n 12  9  1  0  0  0  0\n 10 14  1  0  0  0  0\n 14 12  1  0  0  0  0\n 12 15  2  0  0  0  0\n  6 16  2  0  0  0  0\n 11 17  2  0  0  0  0\n 15 18  1  0  0  0  0\n 19 14  2  0  0  0  0\n 18 22  1  0  0  0  0\n 22 20  2  0  0  0  0\n 20 23  1  0  0  0  0\n 18 25  2  0  0  0  0\n 25 19  1  0  0  0  0\n 16 26  1  0  0  0  0\n 29 27  1  0  0  0  0\n 29 21  1  0  0  0  0\n 27 30  2  0  0  0  0\n 30 28  1  0  0  0  0\n 13 32  2  0  0  0  0\n 16 32  1  0  0  0  0\n 23 33  2  0  0  0  0\n 34 24  2  0  0  0  0\n 35 29  2  0  0  0  0\n 36 22  1  0  0  0  0\n 33 37  1  0  0  0  0\n 37 34  1  0  0  0  0\n 31 38  2  0  0  0  0\n 38 35  1  0  0  0  0\n 34 39  1  0  0  0  0\n 39 31  1  0  0  0  0\n 30 40  1  0  0  0  0\n 40 41  2  0  0  0  0\n 41 35  1  0  0  0  0\n 33 42  1  0  0  0  0\n 42 36  2  0  0  0  0\n 13 43  1  0  0  0  0\n 39 44  1  0  0  0  0\n 44 45  2  0  0  0  0\n 44 46  1  0  0  0  0\n 42 47  1  0  0  0  0\n 13 48  1  0  0  0  0\n 48  1  2  0  0  0  0\nM  END",
        "smiles": "Cc1cc(ccc1NC(=O)C(C(=O)C)/N=N/c2ccc(cc2Cl)Cl)-c3ccc(c(C)c3)NC(=O)C(C(=O)C)/N=N/c4ccc(cc4Cl)Cl",
        "formula": "C34H28Cl4N6O4",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "MIXED",
        "defined_stereo": 0,
        "ez_centers": 2,
        "molecular_weight": "726.437",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "da454eaf-9e47-41bb-b2cf-ec99e27bae67",
          "af5f2d2a-fb7d-4a05-8ce7-8bdc51143cc6"
        ],
        "stereo_centers": 2
      },
      "unii": "R3896P1A0H"
    }
  ]
}