{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "34d665fe-5696-4137-80a7-47493d22cd73",
          "code": "60046-25-5",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=60046-25-5",
          "code_system": "CAS",
          "references": [
            "f512101f-229b-4f58-b81a-e7618c9e25ec",
            "13ad2a9b-7018-40dd-ac6f-545b60f45235"
          ]
        },
        {
          "uuid": "60d84b3b-1d3a-421f-b13b-39b00bbae7f1",
          "code": "262-037-0",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.056.379",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "f512101f-229b-4f58-b81a-e7618c9e25ec"
          ]
        },
        {
          "uuid": "66ac1f51-425c-48f1-b731-685c231859ce",
          "code": "108880",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/108880",
          "code_system": "PUBCHEM",
          "references": [
            "f512101f-229b-4f58-b81a-e7618c9e25ec"
          ]
        },
        {
          "uuid": "48b4db54-3f4d-455a-ab0a-af26eff994dc",
          "code": "R320ILS1YQ",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "2da60dd6-285e-878e-84b2-4a504160e166",
          "code": "DTXSID301021206",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID301021206",
          "code_system": "EPA CompTox"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "ac4fae3f-0bc7-4c31-a882-6dd393e33811",
          "name": "D-GLUCO-HEPTONIC ACID, .GAMMA.-LACTONE, (2.XI.)-",
          "stdName": "D-GLUCO-HEPTONIC ACID, .GAMMA.-LACTONE, (2.XI.)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "caca9723-0a2e-422c-bc98-7445f2b363ae",
            "95cf6aa4-1ac9-49f4-91ce-94fe6fa8e828"
          ],
          "display_name": false
        },
        {
          "uuid": "469e5fef-11f9-43a0-881b-e06e639a09e4",
          "name": "D-GLUCOHEPTONO-1,4-LACTONE",
          "stdName": "D-GLUCOHEPTONO-1,4-LACTONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "caca9723-0a2e-422c-bc98-7445f2b363ae",
            "95cf6aa4-1ac9-49f4-91ce-94fe6fa8e828"
          ],
          "display_name": false
        },
        {
          "uuid": "1df2ae5f-b4e5-41c5-8290-b48b42f5aec1",
          "name": "GLUCOHEPTONIC ACID, .GAMMA.-LACTONE",
          "stdName": "GLUCOHEPTONIC ACID, .GAMMA.-LACTONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "caca9723-0a2e-422c-bc98-7445f2b363ae",
            "95cf6aa4-1ac9-49f4-91ce-94fe6fa8e828"
          ],
          "display_name": false
        },
        {
          "uuid": "d71d9d57-726d-44da-9758-6c1944751d9d",
          "name": "GLUCOHEPTONOLACTONE",
          "stdName": "GLUCOHEPTONOLACTONE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b1fd1f41-c7da-4a4a-b4ea-03f60fc942bc",
            "7d3c978d-1eb6-4f54-aaa2-3fd92f2c489d",
            "95cf6aa4-1ac9-49f4-91ce-94fe6fa8e828"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "8b567437-1e73-4353-b6e0-bcc10d5ef020",
              "name_org": "INCI"
            }
          ]
        }
      ],
      "references": [
        {
          "uuid": "b1fd1f41-c7da-4a4a-b4ea-03f60fc942bc",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "95cf6aa4-1ac9-49f4-91ce-94fe6fa8e828",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "caca9723-0a2e-422c-bc98-7445f2b363ae",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f512101f-229b-4f58-b81a-e7618c9e25ec",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391503000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0cb51a61-3dc7-4b62-b926-b0890b70142c",
          "citation": "SRS import [R320ILS1YQ]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=R320ILS1YQ",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391503000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7d3c978d-1eb6-4f54-aaa2-3fd92f2c489d",
          "citation": "GLUCOHEPTONOLACTONE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "13ad2a9b-7018-40dd-ac6f-545b60f45235",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "a2a1c613-cb87-4598-a988-d9c92326766d",
          "id": "a2a1c613-cb87-4598-a988-d9c92326766d",
          "molfile": "\n  Marvin  01132108272D          \n\n 14 14  0  0  1  0            999 V2000\n   14.1101   -6.1267    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n   13.6709   -5.4284    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   14.9345   -6.0955    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.3197   -5.3659    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   13.7249   -6.8563    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n   14.1642   -7.5546    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   12.9005   -6.8875    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n   12.3907   -6.2389    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.6163   -6.5234    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9310   -6.0641    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.6475   -7.3477    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n   10.9989   -7.8576    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   12.4412   -7.5728    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n   12.7257   -8.3472    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  6  0  0  0\n  1  3  1  0  0  0  0\n  1  5  1  0  0  0  0\n  3  4  1  0  0  0  0\n  5  6  1  1  0  0  0\n  5  7  1  0  0  0  0\n  7  8  1  1  0  0  0\n  7 13  1  0  0  0  0\n  9  8  1  0  0  0  0\n  9 10  2  0  0  0  0\n 11  9  1  0  0  0  0\n 11 12  1  0  0  0  0\n 13 11  1  0  0  0  0\n 13 14  1  1  0  0  0\nM  END",
          "smiles": "C([C@H]([C@H]([C@H]1[C@H](C(C(=O)O1)O)O)O)O)O",
          "formula": "C7H12O7",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "EPIMERIC",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "9e83f7f8-d4a4-42ec-8008-998f33760d07"
          },
          "defined_stereo": 4,
          "ez_centers": 0,
          "molecular_weight": "208.1663",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 5
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "d1275b1b-44bf-44ee-9f2c-18370a71da32",
      "version": "4",
      "structure": {
        "id": "835104e2-6d71-4eb9-93f0-18b91b5868a0",
        "molfile": "\n  Marvin  01132106492D          \n\n 14 14  0  0  1  0            999 V2000\n   12.9005   -6.8875    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   12.3907   -6.2389    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.6163   -6.5234    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9310   -6.0641    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.6475   -7.3477    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9989   -7.8576    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   12.4412   -7.5728    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   12.7257   -8.3472    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   13.7249   -6.8563    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   14.1642   -7.5546    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   14.1101   -6.1267    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   13.6709   -5.4284    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   14.9345   -6.0955    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.3197   -5.3659    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  1  0  0  0\n  3  2  1  0  0  0  0\n  3  4  2  0  0  0  0\n  5  3  1  0  0  0  0\n  5  6  1  0  0  0  0\n  7  5  1  0  0  0  0\n  7  8  1  1  0  0  0\n  1  7  1  0  0  0  0\n  1  9  1  0  0  0  0\n  9 10  1  1  0  0  0\n  9 11  1  0  0  0  0\n 11 12  1  6  0  0  0\n 11 13  1  0  0  0  0\n 13 14  1  0  0  0  0\nM  END",
        "smiles": "C([C@H]([C@H]([C@H]1[C@H](C(C(=O)O1)O)O)O)O)O",
        "formula": "C7H12O7",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "EPIMERIC",
        "defined_stereo": 4,
        "ez_centers": 0,
        "molecular_weight": "208.1663",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "caca9723-0a2e-422c-bc98-7445f2b363ae",
          "0cb51a61-3dc7-4b62-b926-b0890b70142c"
        ],
        "stereo_centers": 5
      },
      "unii": "R320ILS1YQ"
    }
  ]
}