{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2026-09-09", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "a89bb442-05b3-4ac8-ba87-3b0be09404bb", "code": "823817-10-3", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=823817-10-3", "code_system": "CAS", "references": [ "3818864f-f7ee-4aa0-811f-3f8f663b7358", "d7425fc4-4a18-4602-afdd-ac78980a497f" ] }, { "uuid": "521991ea-a02c-4f14-ad67-930133d68738", "code": "6710098", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/6710098", "code_system": "PUBCHEM", "references": [ "3818864f-f7ee-4aa0-811f-3f8f663b7358" ] }, { "uuid": "ff9daa27-1e7a-384b-848a-b163ee29d451", "code": "DTXSID20231713", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID20231713", "code_system": "EPA CompTox", "references": [ "7e20f9e7-4fbe-bec0-b430-f8c2f8464fbc" ] }, { "uuid": "e527233c-ed54-4b8d-99a6-b2b2dadcd761", "code": "R28L9FO334", "type": "PRIMARY", "code_system": "FDA UNII" } ], "substance_class": "chemical", "names": [ { "uuid": "864ff313-389a-47c9-bb42-21eb999183f3", "name": "CAPRYLTYROSINAMIDE", "stdName": "CAPRYLTYROSINAMIDE", "type": "of", "languages": [ "en" ], "preferred": false, "references": [ "a50fb924-a5b5-4f5c-9bcd-4d565e844334", "eb0d255d-ccdb-474d-9b8b-ffc8d862c014", "dfe96995-6abf-4120-9474-b83ccbe5a0ae" ], "display_name": true, "domains": [ "cosmetic" ], "name_orgs": [ { "uuid": "6a8318b4-bdd9-47d7-aef7-5518efee8e40", "name_org": "INCI" } ] }, { "uuid": "d59a0613-4765-4267-8ea7-2ca953c7855c", "name": "L-TYROSINE, N-(1-OXONONYL)-", "stdName": "L-TYROSINE, N-(1-OXONONYL)-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "fb077074-4ae4-4bae-aa9e-ddd1ae83d033", "dfe96995-6abf-4120-9474-b83ccbe5a0ae" ], "display_name": false } ], "references": [ { "uuid": "a50fb924-a5b5-4f5c-9bcd-4d565e844334", "citation": "PCPC", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "dfe96995-6abf-4120-9474-b83ccbe5a0ae", "citation": "PERSONAL CARE PRODUCTS COUNCIL", "doc_type": "PERSONAL CARE PRODUCTS COUNCIL", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "fb077074-4ae4-4bae-aa9e-ddd1ae83d033", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "3818864f-f7ee-4aa0-811f-3f8f663b7358", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493391455000, "tags": [ "NOMEN" ] }, { "uuid": "8a5ae208-bc4c-4c43-ba66-a4901d6c83d4", "citation": "SRS import [R28L9FO334]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=R28L9FO334", "doc_type": "SRS", "public_domain": true, "document_date": 1493391455000, "tags": [ "NOMEN" ] }, { "uuid": "eb0d255d-ccdb-474d-9b8b-ffc8d862c014", "citation": "CAPRYLTYROSINAMIDE [INCI]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "7e20f9e7-4fbe-bec0-b430-f8c2f8464fbc", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=823817-10-3", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "d7425fc4-4a18-4602-afdd-ac78980a497f", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "f6f1766e-253e-4083-b969-164da1657a71", "id": "f6f1766e-253e-4083-b969-164da1657a71", "molfile": "\n Marvin 01132112482D \n\n 23 23 0 0 1 0 999 V2000\n 9.0705 -5.0069 0.0000 C 0 0 2 0 0 0 0 0 0 2 0 0\n 8.3561 -4.5944 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.6416 -5.0069 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.9271 -4.5944 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.2127 -5.0069 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.2127 -5.8319 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.4982 -6.2444 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.9271 -6.2444 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.6416 -5.8319 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.7850 -4.5944 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 10.4995 -5.0069 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.4995 -5.8319 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 11.2140 -4.5944 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.9284 -5.0069 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.6429 -4.5944 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.3574 -5.0069 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.0719 -4.5943 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.7864 -5.0069 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.5008 -4.5943 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.2153 -5.0069 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.0705 -5.8319 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.7850 -6.2444 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.3561 -6.2444 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 1 10 1 6 0 0 0\n 1 21 1 0 0 0 0\n 3 2 1 0 0 0 0\n 3 4 1 0 0 0 0\n 9 3 2 0 0 0 0\n 4 5 2 0 0 0 0\n 5 6 1 0 0 0 0\n 6 7 1 0 0 0 0\n 6 8 2 0 0 0 0\n 8 9 1 0 0 0 0\n 10 11 1 0 0 0 0\n 11 12 2 0 0 0 0\n 11 13 1 0 0 0 0\n 13 14 1 0 0 0 0\n 14 15 1 0 0 0 0\n 15 16 1 0 0 0 0\n 16 17 1 0 0 0 0\n 17 18 1 0 0 0 0\n 18 19 1 0 0 0 0\n 19 20 1 0 0 0 0\n 21 22 1 0 0 0 0\n 21 23 2 0 0 0 0\nM END", "smiles": "CCCCCCCCC(=O)N[C@@H](Cc1ccc(cc1)O)C(=O)O", "formula": "C18H27NO4", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "d902bb44-b1d9-413e-aae8-65fc623b423f" }, "defined_stereo": 1, "ez_centers": 0, "molecular_weight": "321.412", "optical_activity": "UNSPECIFIED", "stereo_centers": 1 } ], "definition_level": "COMPLETE", "uuid": "79325829-f65d-46d0-a3da-c86ca907bea9", "version": "5", "structure": { "id": "f883cfe9-7c83-4b74-acdd-354cfe22148f", "molfile": "\n Marvin 01132112532D \n\n 23 23 0 0 1 0 999 V2000\n 6.2127 -5.0069 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.9271 -4.5944 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.6416 -5.0069 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.6416 -5.8319 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.9271 -6.2444 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.2127 -5.8319 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.3561 -4.5944 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.0705 -5.0069 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 9.7850 -4.5944 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 10.4995 -5.0069 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.2140 -4.5944 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.9284 -5.0069 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.6429 -4.5944 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.3574 -5.0069 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.0719 -4.5943 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.7864 -5.0069 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.5008 -4.5943 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.2153 -5.0069 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.0705 -5.8319 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.7850 -6.2444 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.4982 -6.2444 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.4995 -5.8319 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.3561 -6.2444 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 2 0 0 0 0\n 3 2 1 0 0 0 0\n 4 3 2 0 0 0 0\n 5 4 1 0 0 0 0\n 6 5 2 0 0 0 0\n 1 6 1 0 0 0 0\n 3 7 1 0 0 0 0\n 7 8 1 0 0 0 0\n 8 9 1 6 0 0 0\n 9 10 1 0 0 0 0\n 10 11 1 0 0 0 0\n 11 12 1 0 0 0 0\n 12 13 1 0 0 0 0\n 13 14 1 0 0 0 0\n 14 15 1 0 0 0 0\n 15 16 1 0 0 0 0\n 16 17 1 0 0 0 0\n 17 18 1 0 0 0 0\n 8 19 1 0 0 0 0\n 19 20 1 0 0 0 0\n 6 21 1 0 0 0 0\n 10 22 2 0 0 0 0\n 19 23 2 0 0 0 0\nM END", "smiles": "CCCCCCCCC(=O)N[C@@H](Cc1ccc(cc1)O)C(=O)O", "formula": "C18H27NO4", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "defined_stereo": 1, "ez_centers": 0, "molecular_weight": "321.412", "optical_activity": "UNSPECIFIED", "references": [ "8a5ae208-bc4c-4c43-ba66-a4901d6c83d4", "fb077074-4ae4-4bae-aa9e-ddd1ae83d033" ], "stereo_centers": 1 }, "unii": "R28L9FO334" } ] }