{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "149d81d8-75c9-410f-947e-36e64a68eea4",
          "code": "79277-67-1",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=79277-67-1",
          "code_system": "CAS",
          "references": [
            "db4018fc-9bca-46cb-8ece-763c055c848e",
            "567c102c-a0ca-437d-a3d3-c7cf3c2ec15f"
          ]
        },
        {
          "uuid": "ff0eb86a-1ed1-418c-94bd-80852761fab3",
          "code": "128845",
          "comments": "EPA PESTICIDE|CONVENTIONAL CHEMICAL",
          "type": "PRIMARY",
          "url": "http://iaspub.epa.gov/apex/pesticides/f?p=CHEMICALSEARCH:3:0::NO:21,3,31,7,12,25:P3_XCHEMICAL_ID:4038",
          "code_system": "EPA PESTICIDE CODE",
          "references": [
            "db4018fc-9bca-46cb-8ece-763c055c848e"
          ]
        },
        {
          "uuid": "b63befcb-0aef-4905-8772-77be806776f8",
          "code": "91729",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/91729",
          "code_system": "PUBCHEM",
          "references": [
            "db4018fc-9bca-46cb-8ece-763c055c848e"
          ]
        },
        {
          "uuid": "cf75fed3-0300-6471-095d-2a0e863f6476",
          "code": "DTXSID1058185",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID1058185",
          "code_system": "EPA CompTox",
          "references": [
            "20398c4d-8c33-7fe3-751c-8eb36d73ae06"
          ]
        },
        {
          "uuid": "047e7f30-7aeb-4c06-a8ff-5becd7e92712",
          "code": "R1O5RY2GKC",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "0a75f4bd-67d5-43f6-4e8a-a7009417dc53",
          "code": "thifensulfuron",
          "type": "PRIMARY",
          "url": "https://pesticidecompendium.bcpc.org/thifensulfuron.html",
          "code_system": "ALANWOOD",
          "references": [
            "95eeeb7f-e3d0-f94a-ee01-9617a6bcd34a"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "c44fd5da-83cd-4118-aab3-8041fe8b11ca",
          "name": "3-(((((4-METHOXY-6-METHYL-1,3,5-TRIAZIN-2-YL)AMINO)CARBONYL)AMINO)SULFONYL)-2-THIOPHENECARBOXYLIC ACID",
          "stdName": "3-(((((4-METHOXY-6-METHYL-1,3,5-TRIAZIN-2-YL)AMINO)CARBONYL)AMINO)SULFONYL)-2-THIOPHENECARBOXYLIC ACID",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "edb531d0-e48b-489d-955c-6a641171c4ed",
            "d1a79921-8f4e-44d6-b2fc-6e754b7d381c"
          ],
          "display_name": false
        },
        {
          "uuid": "6dd94697-48a9-4cad-b94d-3f690b31c368",
          "name": "3-(4-METHOXY-6-METHYL-1,3,5-TRIAZIN-2-YLCARBAMOYLSULFAMOYL)THIOPHENE-2-CARBOXYLIC ACID",
          "stdName": "3-(4-METHOXY-6-METHYL-1,3,5-TRIAZIN-2-YLCARBAMOYLSULFAMOYL)THIOPHENE-2-CARBOXYLIC ACID",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "edb531d0-e48b-489d-955c-6a641171c4ed",
            "cd38db7d-d478-4194-a0b6-7f933558ace2"
          ],
          "display_name": false
        },
        {
          "uuid": "c7916166-6b1d-443d-a67b-0d0455ed7b88",
          "name": "THIAMETURON",
          "stdName": "THIAMETURON",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a86c64e9-0742-4478-9430-2b6c73ff3bb3",
            "b7d2b3ca-964d-4334-b37e-0bf5654e263b"
          ],
          "display_name": false
        },
        {
          "uuid": "4d391dfa-a443-47d4-a5fd-cc3d3d564be3",
          "name": "THIFENSULFURON",
          "stdName": "THIFENSULFURON",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6e46cbdb-b23f-4881-9e71-dc04e0dc5d05",
            "48de2a78-126e-48d4-afee-6e5d0dadd1cd",
            "1a495f3d-6416-441b-a563-793c50c073a2",
            "a86c64e9-0742-4478-9430-2b6c73ff3bb3"
          ],
          "display_name": true
        },
        {
          "uuid": "598ac277-2651-44c2-bbac-758ce238ef69",
          "name": "THIFENSULFURON [ISO]",
          "stdName": "THIFENSULFURON [ISO]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1a495f3d-6416-441b-a563-793c50c073a2",
            "a86c64e9-0742-4478-9430-2b6c73ff3bb3"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "48de2a78-126e-48d4-afee-6e5d0dadd1cd",
          "citation": "ICSAS BATCH 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "edb531d0-e48b-489d-955c-6a641171c4ed",
          "citation": "ALANWOOD.NET",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "cd38db7d-d478-4194-a0b6-7f933558ace2",
          "citation": "ALANWOOD IUPAC",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d1a79921-8f4e-44d6-b2fc-6e754b7d381c",
          "citation": "ALANWOOD CAS",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b7d2b3ca-964d-4334-b37e-0bf5654e263b",
          "citation": "http://www.alanwood.net/pesticides/thifensulfuron.html",
          "url": "http://www.alanwood.net/pesticides/thifensulfuron.html",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a86c64e9-0742-4478-9430-2b6c73ff3bb3",
          "citation": "WEB PAGE",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1a495f3d-6416-441b-a563-793c50c073a2",
          "citation": "ISO",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "db4018fc-9bca-46cb-8ece-763c055c848e",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390915000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ee8f61a0-0de3-4c79-ac43-66bfcfaa7a5a",
          "citation": "SRS import [R1O5RY2GKC]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=R1O5RY2GKC",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390915000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2d5c7492-79ef-4773-9f2f-a0804aa44146",
          "citation": "CHEMID 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6e46cbdb-b23f-4881-9e71-dc04e0dc5d05",
          "citation": "THIFENSULFURON [ISO]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "20398c4d-8c33-7fe3-751c-8eb36d73ae06",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=79277-67-1",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "95eeeb7f-e3d0-f94a-ee01-9617a6bcd34a",
          "citation": "AW",
          "doc_type": "ALANWOOD",
          "public_domain": true
        },
        {
          "uuid": "567c102c-a0ca-437d-a3d3-c7cf3c2ec15f",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "99ecd189-e7d3-486a-bbe5-e8f39563c23d",
          "id": "99ecd189-e7d3-486a-bbe5-e8f39563c23d",
          "molfile": "\n  Marvin  01132108002D          \n\n 24 25  0  0  0  0            999 V2000\n    5.9631   -6.9425    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2128   -6.5498    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2128   -5.7249    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4571   -5.3382    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4571   -4.5147    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7289   -4.1258    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1604   -4.0775    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8873   -4.4688    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5849   -4.0302    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2983   -4.4446    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2983   -5.2690    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0140   -4.0340    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7277   -4.4481    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1420   -3.7353    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3127   -5.1622    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6665   -4.7667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9145   -5.5677    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7355   -5.5677    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.0086   -4.7890    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3370   -4.2879    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3370   -3.6279    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6642   -3.1944    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.0038   -3.2452    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8873   -5.2974    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  3  4  1  0  0  0  0\n 24  3  2  0  0  0  0\n  4  5  2  0  0  0  0\n  5  6  1  0  0  0  0\n  5  7  1  0  0  0  0\n  7  8  2  0  0  0  0\n  9  8  1  0  0  0  0\n  8 24  1  0  0  0  0\n 10  9  1  0  0  0  0\n 10 11  2  0  0  0  0\n 12 10  1  0  0  0  0\n 13 12  1  0  0  0  0\n 13 14  2  0  0  0  0\n 13 15  2  0  0  0  0\n 16 13  1  0  0  0  0\n 17 16  1  0  0  0  0\n 16 20  2  0  0  0  0\n 18 17  2  0  0  0  0\n 19 18  1  0  0  0  0\n 20 19  1  0  0  0  0\n 21 20  1  0  0  0  0\n 22 21  1  0  0  0  0\n 21 23  2  0  0  0  0\nM  END",
          "smiles": "Cc1nc(NC(=O)NS(=O)(=O)c2ccsc2C(=O)O)nc(n1)OC",
          "formula": "C11H11N5O6S2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "6bd0fd73-e0ee-4abd-9554-9feec8b7e4c4"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "373.3676",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "9890c349-4a82-4b00-8987-05ed3c49806c",
      "version": "4",
      "structure": {
        "id": "bd637813-0d6a-45a6-ad11-809854fb6397",
        "molfile": "\n  Marvin  01132109482D          \n\n 24 25  0  0  0  0            999 V2000\n    9.6642   -3.1944    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3370   -3.6279    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.0038   -3.2452    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3370   -4.2879    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.0086   -4.7890    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7355   -5.5677    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9145   -5.5677    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6665   -4.7667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7277   -4.4481    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1420   -3.7353    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3127   -5.1622    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0140   -4.0340    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2983   -4.4446    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2983   -5.2690    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5849   -4.0302    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8873   -4.4688    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8873   -5.2974    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2128   -5.7249    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2128   -6.5498    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9631   -6.9425    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4571   -5.3382    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4571   -4.5147    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7289   -4.1258    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1604   -4.0775    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  2  0  0  0  0\n  2  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  2  0  0  0  0\n  7  8  1  0  0  0  0\n  8  4  2  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  2  0  0  0  0\n  9 11  2  0  0  0  0\n  9 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  2  0  0  0  0\n 13 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  2  0  0  0  0\n 18 19  1  0  0  0  0\n 19 20  1  0  0  0  0\n 18 21  1  0  0  0  0\n 21 22  2  0  0  0  0\n 22 23  1  0  0  0  0\n 22 24  1  0  0  0  0\n 24 16  2  0  0  0  0\nM  END",
        "smiles": "Cc1nc(NC(=O)NS(=O)(=O)c2ccsc2C(=O)O)nc(n1)OC",
        "formula": "C11H11N5O6S2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "373.3676",
        "optical_activity": "NONE",
        "references": [
          "ee8f61a0-0de3-4c79-ac43-66bfcfaa7a5a",
          "2d5c7492-79ef-4773-9f2f-a0804aa44146"
        ],
        "stereo_centers": 0
      },
      "unii": "R1O5RY2GKC"
    }
  ]
}