{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "2649cf89-4d26-4f99-b5af-c70d39fa3af8",
          "code": "6068-78-6",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=6068-78-6",
          "code_system": "CAS",
          "references": [
            "a7fd344b-8b4d-4aed-9a83-3d9558d0aa41",
            "9158cfcb-4274-406e-9227-26ebeaee29fd"
          ]
        },
        {
          "uuid": "4e8477d5-3de3-4cfe-beb1-a60c0f12edfe",
          "code": "145826",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/145826",
          "code_system": "PUBCHEM",
          "references": [
            "a7fd344b-8b4d-4aed-9a83-3d9558d0aa41"
          ]
        },
        {
          "uuid": "5e3bb472-e6f2-a640-9be0-c449a82fa27b",
          "code": "DTXSID40209494",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID40209494",
          "code_system": "EPA CompTox",
          "references": [
            "abaac09a-3644-44a4-c83a-3520ec285795"
          ]
        },
        {
          "uuid": "451b6614-e1bd-4bf6-8678-cc7a377af696",
          "code": "R1I1R1C88V",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "relationships": [
        {
          "uuid": "07228235-62cb-42f9-acc7-435129d36313",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "69df2590-62b6-4044-9116-d7df1f5d5297",
            "refuuid": "ecf9aa0c-0599-4494-ab7d-f772c09954a3",
            "name": "3',4'-DIHYDROXYFLAVONOL",
            "unii": "R1I1R1C88V",
            "linking_id": "R1I1R1C88V",
            "ref_pname": "3',4'-DIHYDROXYFLAVONOL",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "9f5f0402-48de-49b2-bd4d-7275743d339f",
          "name": "2-(3,4-DIHYDROXYPHENYL)-3-HYDROXY-4H-BENZOPYRAN-4-ONE",
          "stdName": "2-(3,4-DIHYDROXYPHENYL)-3-HYDROXY-4H-BENZOPYRAN-4-ONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "11a3e4bf-d7b4-462a-8eb8-a0a064d55079",
            "84e7795f-dc64-47f7-ae25-172ba72bee7b"
          ],
          "display_name": false
        },
        {
          "uuid": "6a6d52d4-c65e-4c4f-a284-060f83a1e664",
          "name": "3',4'-DIHYDROXYFLAVONOL",
          "stdName": "3',4'-DIHYDROXYFLAVONOL",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "11a3e4bf-d7b4-462a-8eb8-a0a064d55079",
            "84e7795f-dc64-47f7-ae25-172ba72bee7b"
          ],
          "display_name": true
        },
        {
          "uuid": "c8287a86-263e-4675-a6c5-a9d97fe0c7fb",
          "name": "3,3',4'-TRIHYDROXYFLAVONE",
          "stdName": "3,3',4'-TRIHYDROXYFLAVONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b252ceae-b2eb-44ac-bf4e-258f835e05af"
          ],
          "display_name": false
        },
        {
          "uuid": "b9d7847a-734f-4650-bae4-6974144a145d",
          "name": "4H-1-BENZOPYRAN-4-ONE, 2-(3,4-DIHYDROXYPHENYL)-3-HYDROXY-",
          "stdName": "4H-1-BENZOPYRAN-4-ONE, 2-(3,4-DIHYDROXYPHENYL)-3-HYDROXY-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "11a3e4bf-d7b4-462a-8eb8-a0a064d55079",
            "84e7795f-dc64-47f7-ae25-172ba72bee7b"
          ],
          "display_name": false
        },
        {
          "uuid": "322d81cf-c39f-4814-bf8a-54a1a18caf83",
          "name": "5,7-DIDEOXYQUERCETIN",
          "stdName": "5,7-DIDEOXYQUERCETIN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "11a3e4bf-d7b4-462a-8eb8-a0a064d55079",
            "84e7795f-dc64-47f7-ae25-172ba72bee7b"
          ],
          "display_name": false
        },
        {
          "uuid": "387713a4-4c58-4cae-899a-80c5526408f0",
          "name": "DIOHF",
          "stdName": "DIOHF",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "11a3e4bf-d7b4-462a-8eb8-a0a064d55079",
            "41db1b1c-02cf-4e3a-bb61-4fea93e997b6"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "b252ceae-b2eb-44ac-bf4e-258f835e05af",
          "citation": "http://pubs.acs.org/doi/pdf/10.1021/jm070352h",
          "url": "http://pubs.acs.org/doi/pdf/10.1021/jm070352h",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "84e7795f-dc64-47f7-ae25-172ba72bee7b",
          "citation": "stn",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "11a3e4bf-d7b4-462a-8eb8-a0a064d55079",
          "citation": "STN (SCIFINDER)",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "41db1b1c-02cf-4e3a-bb61-4fea93e997b6",
          "citation": "http://www.sciencedirect.com/science/article/pii/S0014299911002263#",
          "url": "http://www.sciencedirect.com/science/article/pii/S0014299911002263#",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a7fd344b-8b4d-4aed-9a83-3d9558d0aa41",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391007000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "028e3ed2-53a6-43c9-a1d0-e98dba8898ad",
          "citation": "SRS import [R1I1R1C88V]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=R1I1R1C88V",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391007000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f0735457-9797-42cb-a52f-95f0ad987cf1",
          "citation": "CHEMID  2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "abaac09a-3644-44a4-c83a-3520ec285795",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=6068-78-6",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "9158cfcb-4274-406e-9227-26ebeaee29fd",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "30351431-d35c-487a-b2fb-c1307066e663",
          "id": "30351431-d35c-487a-b2fb-c1307066e663",
          "molfile": "\n  Marvin  01132102352D          \n\n 20 22  0  0  0  0            999 V2000\n    4.1653   -5.1538    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9903   -5.1538    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4051   -4.4416    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2300   -4.4416    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6402   -5.1538    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2300   -5.8705    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4051   -5.8705    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9903   -6.5828    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4651   -5.1538    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8799   -4.4416    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7049   -4.4416    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1150   -3.7247    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9400   -3.7247    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3548   -4.4416    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9400   -5.1538    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1150   -5.1538    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7049   -5.8705    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1150   -6.5828    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8799   -5.8705    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4651   -6.5828    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  7  2  2  0  0  0  0\n  3  4  2  0  0  0  0\n  5  4  1  0  0  0  0\n  5  6  2  0  0  0  0\n  9  5  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  9 10  1  0  0  0  0\n  9 19  2  0  0  0  0\n 11 10  1  0  0  0  0\n 11 12  1  0  0  0  0\n 16 11  2  0  0  0  0\n 12 13  2  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  2  0  0  0  0\n 16 15  1  0  0  0  0\n 17 16  1  0  0  0  0\n 17 18  2  0  0  0  0\n 19 17  1  0  0  0  0\n 19 20  1  0  0  0  0\nM  END",
          "smiles": "c1ccc2c(c1)c(=O)c(c(-c3ccc(c(c3)O)O)o2)O",
          "formula": "C15H10O5",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "8d888668-bf76-4461-b21f-262819371d5d"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "270.2375",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "ecf9aa0c-0599-4494-ab7d-f772c09954a3",
      "version": "3",
      "structure": {
        "id": "2e7d348b-765e-4c46-94d4-c0c074533397",
        "molfile": "\n  Marvin  01132102302D          \n\n 20 22  0  0  0  0            999 V2000\n    7.4651   -5.1538    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8799   -5.8705    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7049   -5.8705    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1150   -5.1538    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7049   -4.4416    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8799   -4.4416    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1150   -3.7247    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9400   -3.7247    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3548   -4.4416    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9400   -5.1538    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1150   -6.5828    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4651   -6.5828    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6402   -5.1538    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2300   -5.8705    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4051   -5.8705    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9903   -5.1538    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4051   -4.4416    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2300   -4.4416    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1653   -5.1538    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9903   -6.5828    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  2  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  1  6  1  0  0  0  0\n  5  7  2  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  2  0  0  0  0\n  9 10  1  0  0  0  0\n  4 10  2  0  0  0  0\n  3 11  2  0  0  0  0\n  2 12  1  0  0  0  0\n  1 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  2  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  2  0  0  0  0\n 17 18  1  0  0  0  0\n 13 18  2  0  0  0  0\n 16 19  1  0  0  0  0\n 15 20  1  0  0  0  0\nM  END",
        "smiles": "c1ccc2c(c1)c(=O)c(c(-c3ccc(c(c3)O)O)o2)O",
        "formula": "C15H10O5",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "270.2375",
        "optical_activity": "NONE",
        "references": [
          "f0735457-9797-42cb-a52f-95f0ad987cf1",
          "028e3ed2-53a6-43c9-a1d0-e98dba8898ad"
        ],
        "stereo_centers": 0
      },
      "unii": "R1I1R1C88V"
    }
  ]
}