{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "cc9ed106-aa45-4207-97b1-4abe214a68c5",
          "code": "546-80-5",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=546-80-5",
          "code_system": "CAS",
          "references": [
            "b037a269-88fb-4116-abe5-c72c1e945412",
            "c0e37cbe-7259-4d60-96a8-cde4df49dbd2"
          ]
        },
        {
          "uuid": "ef0bf53b-0721-4196-97d5-44aaf2a9eed7",
          "code": "m10816",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m10816?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "b037a269-88fb-4116-abe5-c72c1e945412"
          ]
        },
        {
          "uuid": "fe7db5ea-ba49-4cb7-941c-6d962b1909ea",
          "code": "208-912-2",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.008.103",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "b037a269-88fb-4116-abe5-c72c1e945412"
          ]
        },
        {
          "uuid": "cc604923-bb5e-4a3e-a2f2-b078e41fec20",
          "code": "261491",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/261491",
          "code_system": "PUBCHEM",
          "references": [
            "b037a269-88fb-4116-abe5-c72c1e945412"
          ]
        },
        {
          "uuid": "b05d4ce0-d252-51f6-af4d-d1159744389d",
          "code": "DTXSID3026148",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID3026148",
          "code_system": "EPA CompTox",
          "references": [
            "abc811c4-7d49-9725-197f-38b9a524c838"
          ]
        },
        {
          "uuid": "8749d8c5-c41a-4cfc-8813-5635f6d0930f",
          "code": "R0SQ9G0DU5",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "fe42c8ae-88b4-5a93-484a-1c6c9348a27e",
          "code": "9577",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:9577",
          "code_system": "CHEBI",
          "references": [
            "bed7f3f0-33fa-4bcc-b469-d1e4268b62bf"
          ]
        },
        {
          "uuid": "f4302a58-3a68-bd89-7c02-2d9e1d576fc2",
          "code": "93742",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=93742",
          "code_system": "NSC",
          "references": [
            "bd007ca0-e971-7918-d699-7a02acf141b6"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "e2413bc6-af9f-4721-946f-b7d6511a3c43",
          "name": "(-)-THUJONE",
          "stdName": "(-)-THUJONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "10a6e60a-314d-4ee8-8713-99885013c066",
            "1f79b465-68e4-4f23-aea7-281f78e79f88"
          ],
          "display_name": false
        },
        {
          "uuid": "58843a98-a18b-4540-b89d-c550426093a6",
          "name": ".ALPHA.-THUJONE",
          "stdName": ".ALPHA.-THUJONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "10a6e60a-314d-4ee8-8713-99885013c066",
            "1334a1de-ddba-42b6-90de-ebb11cf906a7",
            "1f79b465-68e4-4f23-aea7-281f78e79f88",
            "37525cd3-6e7d-4733-95b1-8e9060d6f866"
          ],
          "display_name": true
        },
        {
          "uuid": "cd759a89-9494-4659-b04c-ca2b528c9d8b",
          "name": ".ALPHA.-THUJONE [MI]",
          "stdName": ".ALPHA.-THUJONE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "10a6e60a-314d-4ee8-8713-99885013c066",
            "37525cd3-6e7d-4733-95b1-8e9060d6f866"
          ],
          "display_name": false
        },
        {
          "uuid": "1c8efa1c-ff50-4848-8a9b-cb3cc0911dbd",
          "name": "3-THUJANONE, (1S,4R,5R)-(-)-",
          "stdName": "3-THUJANONE, (1S,4R,5R)-(-)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "10a6e60a-314d-4ee8-8713-99885013c066",
            "1f79b465-68e4-4f23-aea7-281f78e79f88"
          ],
          "display_name": false
        },
        {
          "uuid": "13a60a68-cd8e-4cd1-b8c0-44a9155d1a89",
          "name": "ALFA-THUJONE",
          "stdName": "ALFA-THUJONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "10a6e60a-314d-4ee8-8713-99885013c066",
            "1804255c-7de3-48fc-829a-ec0d2150704d"
          ],
          "display_name": false
        },
        {
          "uuid": "d76881bd-b6a2-45bd-a4e7-92e79980fff5",
          "name": "ALPHA-THUJONE",
          "stdName": "ALPHA-THUJONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "10a6e60a-314d-4ee8-8713-99885013c066",
            "8520c989-4aed-4138-84ad-fb68e4ab805f"
          ],
          "display_name": false
        },
        {
          "uuid": "34a4684d-2792-4848-a6f5-effca9c7656f",
          "name": "BICYCLO(3.1.0)HEXAN-3-ONE, 4-METHYL-1-(1-METHYLETHYL)-, (1S,4R,5R)-",
          "stdName": "BICYCLO(3.1.0)HEXAN-3-ONE, 4-METHYL-1-(1-METHYLETHYL)-, (1S,4R,5R)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "10a6e60a-314d-4ee8-8713-99885013c066",
            "1f79b465-68e4-4f23-aea7-281f78e79f88"
          ],
          "display_name": false
        },
        {
          "uuid": "bfd8485d-d4cb-4279-a84a-fe27f6a8f1a9",
          "name": "NSC-93742",
          "stdName": "NSC-93742",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "10a6e60a-314d-4ee8-8713-99885013c066",
            "ff4d50d9-9071-45e5-acba-f3847aeb475f"
          ],
          "display_name": false
        },
        {
          "uuid": "7f190317-9a48-43a6-8641-c5a3ed8dc104",
          "name": "THUJONE, .ALPHA.-",
          "stdName": "THUJONE, .ALPHA.-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "10a6e60a-314d-4ee8-8713-99885013c066",
            "1f79b465-68e4-4f23-aea7-281f78e79f88"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "1f79b465-68e4-4f23-aea7-281f78e79f88",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "10a6e60a-314d-4ee8-8713-99885013c066",
          "citation": "STN (SCIFINDER)",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8520c989-4aed-4138-84ad-fb68e4ab805f",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "37525cd3-6e7d-4733-95b1-8e9060d6f866",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1804255c-7de3-48fc-829a-ec0d2150704d",
          "citation": "SWISS MEDIC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ff4d50d9-9071-45e5-acba-f3847aeb475f",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b037a269-88fb-4116-abe5-c72c1e945412",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391320000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d9f374fb-340e-4e3a-8f8c-062f31a2bba1",
          "citation": "SRS import [R0SQ9G0DU5]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=R0SQ9G0DU5",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391320000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1334a1de-ddba-42b6-90de-ebb11cf906a7",
          "citation": ".ALPHA.-THUJONE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "abc811c4-7d49-9725-197f-38b9a524c838",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=546-80-5",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "d88a0e82-960c-29b7-7b09-045282d65d46",
          "citation": "Organic Chemistry: Chemistry of the carbocyclic compounds, new ed., rev. translated from the 11th German ed., by E. E. Fournier d' Albe, rev. 1929; By Victor von Richter",
          "url": "https://books.google.com/books?id=QhZDAAAAIAAJ&pg=PA512&lpg=PA512&dq=TANACETONE&source=bl&ots=H_-QAerba4&sig=GwxLZUShmH464KdwxQEskYNttkI&hl=en&sa=X&ved=0ahUKEwjE18SzjJXbAhXNtVMKHcusBr04ChDoAQgoMAA#v=onepage&q=TANACETONE&f=false",
          "doc_type": "BOOK",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "bed7f3f0-33fa-4bcc-b469-d1e4268b62bf",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "c0e37cbe-7259-4d60-96a8-cde4df49dbd2",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "bd007ca0-e971-7918-d699-7a02acf141b6",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "06f0c339-c9ed-4571-9921-105e85e2a5a6",
          "id": "06f0c339-c9ed-4571-9921-105e85e2a5a6",
          "molfile": "\n  Marvin  01132100392D          \n\n 11 12  0  0  1  0            999 V2000\n    9.5919   -9.7211    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    8.8756   -9.3052    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5919   -8.8961    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n   10.2993   -8.4810    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.0141   -8.8983    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.7195   -8.4810    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.0141   -9.7211    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n   11.5938  -10.3053    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0013   -8.3025    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    8.2859   -8.7140    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0013   -7.4796    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  1  0  0  0\n  1  3  1  0  0  0  0\n  7  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  3  4  1  0  0  0  0\n  3  9  1  6  0  0  0\n  5  4  1  0  0  0  0\n  5  6  2  0  0  0  0\n  7  5  1  0  0  0  0\n  7  8  1  6  0  0  0\n  9 10  1  0  0  0  0\n  9 11  1  0  0  0  0\nM  END",
          "smiles": "C[C@H](C)[C@]12C[C@@H]2[C@@H](C)C(=O)C1",
          "formula": "C10H16O",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "51891ac0-a4e3-42d5-9485-7acbe8c18045"
          },
          "defined_stereo": 3,
          "ez_centers": 0,
          "molecular_weight": "152.2338",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 3
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "77df7ffb-77da-479d-bb41-4a95133ea572",
      "version": "6",
      "structure": {
        "id": "89bac36d-b478-40d0-966e-a6d9ecf706f6",
        "molfile": "\n  Marvin  01132107092D          \n\n 11 12  0  0  1  0            999 V2000\n    8.8756   -9.3052    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5919   -8.8961    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   10.2993   -8.4810    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.0141   -8.8983    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.7195   -8.4810    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.0141   -9.7211    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    9.5919   -9.7211    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   11.5938  -10.3053    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0013   -8.3025    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0013   -7.4796    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2859   -8.7140    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  1  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  4  5  2  0  0  0  0\n  6  4  1  0  0  0  0\n  7  6  1  0  0  0  0\n  2  7  1  0  0  0  0\n  7  1  1  1  0  0  0\n  6  8  1  6  0  0  0\n  2  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n  9 11  1  0  0  0  0\nM  END",
        "smiles": "CC(C)[C@]12C[C@@H]2[C@@H](C)C(=O)C1",
        "formula": "C10H16O",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 3,
        "ez_centers": 0,
        "molecular_weight": "152.2338",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "d88a0e82-960c-29b7-7b09-045282d65d46",
          "1f79b465-68e4-4f23-aea7-281f78e79f88"
        ],
        "stereo_centers": 3
      },
      "unii": "R0SQ9G0DU5"
    }
  ]
}