{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "9940e268-a1db-4b30-81e0-b0a24e609364", "code": "67401-27-8", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=67401-27-8", "code_system": "CAS", "references": [ "74aa68e5-a2b1-46d4-bae8-ab18a2365068", "70e722c1-6b8c-4897-b5a9-a99ee1e86889" ] }, { "uuid": "112346a6-b9ea-44f1-848a-3364f1be3764", "code": "266-685-5", "type": "PRIMARY", "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.060.604", "code_system": "ECHA (EC/EINECS)", "references": [ "74aa68e5-a2b1-46d4-bae8-ab18a2365068" ] }, { "uuid": "b35ec8a0-af01-4557-8415-93377b575b39", "code": "105426", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/105426", "code_system": "PUBCHEM", "references": [ "74aa68e5-a2b1-46d4-bae8-ab18a2365068" ] }, { "uuid": "a95acbdb-7b61-1973-0f21-e904f3ab2910", "code": "DTXSID90217761", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID90217761", "code_system": "EPA CompTox", "references": [ "511a96eb-66e2-aa89-8af7-8dbb69cab826" ] }, { "uuid": "5e800292-9763-4f36-a28f-f8ba27cd65a8", "code": "QXV7P275TL", "type": "PRIMARY", "code_system": "FDA UNII" } ], "substance_class": "chemical", "names": [ { "uuid": "17bbe20a-ece2-412d-ba09-894f598742bd", "name": "2-CYCLOHEXEN-1-ONE, 3-(3-BUTEN-1-YL)-2,4,4-TRIMETHYL-", "stdName": "2-CYCLOHEXEN-1-ONE, 3-(3-BUTEN-1-YL)-2,4,4-TRIMETHYL-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "9e95fb46-0214-43b6-9940-35905c5c81cf", "70e722c1-6b8c-4897-b5a9-a99ee1e86889" ], "display_name": false }, { "uuid": "b58cd28d-063a-4045-8d98-5ec6fb3b504a", "name": "2-CYCLOHEXEN-1-ONE, 3-(3-BUTENYL)-2,4,4-TRIMETHYL-", "stdName": "2-CYCLOHEXEN-1-ONE, 3-(3-BUTENYL)-2,4,4-TRIMETHYL-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "9e95fb46-0214-43b6-9940-35905c5c81cf", "70e722c1-6b8c-4897-b5a9-a99ee1e86889" ], "display_name": false }, { "uuid": "3ce36104-18fd-4724-93d0-4abc05a63590", "name": "3-(3-BUTENYL)-2,4,4-TRIMETHYLCYCLOHEX-2-EN-1-ONE", "stdName": "3-(3-BUTENYL)-2,4,4-TRIMETHYLCYCLOHEX-2-EN-1-ONE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "93e08220-8a18-4fd6-872e-9751c13c8870" ], "display_name": true }, { "uuid": "1011fd25-8bea-4a63-b592-3bb53fa87590", "name": "MEGASTIGMA-5,9-DIEN-4-ONE", "stdName": "MEGASTIGMA-5,9-DIEN-4-ONE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "9e95fb46-0214-43b6-9940-35905c5c81cf", "70e722c1-6b8c-4897-b5a9-a99ee1e86889" ], "display_name": false } ], "references": [ { "uuid": "9e95fb46-0214-43b6-9940-35905c5c81cf", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "70e722c1-6b8c-4897-b5a9-a99ee1e86889", "citation": "STN (SCIFINDER)", "doc_type": "STN (SCIFINDER)", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "74aa68e5-a2b1-46d4-bae8-ab18a2365068", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493392770000, "tags": [ "NOMEN" ] }, { "uuid": "511a96eb-66e2-aa89-8af7-8dbb69cab826", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=67401-27-8", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "93e08220-8a18-4fd6-872e-9751c13c8870", "citation": "CHEMID", "doc_type": "CHEMID", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "04b5decc-50ab-46b9-9770-e8b0cea71f56", "id": "04b5decc-50ab-46b9-9770-e8b0cea71f56", "molfile": "\n Marvin 01132100322D \n\n 14 14 0 0 0 0 999 V2000\n 7.6549 -4.8492 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.6549 -5.6742 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.3694 -6.0866 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.0839 -5.6742 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.7983 -6.0866 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.5128 -5.6741 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.2273 -6.0866 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.3694 -6.9116 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.6516 -7.6869 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.1819 -6.7684 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.6549 -7.3242 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.9405 -6.9116 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.9405 -6.0866 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.2260 -5.6742 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 3 2 2 0 0 0 0\n 2 13 1 0 0 0 0\n 4 3 1 0 0 0 0\n 3 8 1 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 1 0 0 0 0\n 6 7 2 0 0 0 0\n 8 9 1 0 0 0 0\n 8 10 1 0 0 0 0\n 8 11 1 0 0 0 0\n 11 12 1 0 0 0 0\n 13 12 1 0 0 0 0\n 13 14 2 0 0 0 0\nM END", "smiles": "C=CCCC1=C(C)C(=O)CCC1(C)C", "formula": "C13H20O", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "d044b6c3-6cf9-4231-b245-02276fa9ddbb" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "192.2978", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "3397bca5-4c2f-4f7a-ade5-3b1ab3b2eedf", "version": "5", "structure": { "id": "1a85d665-069c-4f84-ac53-a2a8bb084681", "molfile": "\n Marvin 01132101332D \n\n 14 14 0 0 0 0 999 V2000\n 9.0839 -5.6742 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.3694 -6.0866 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.6549 -5.6742 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.6549 -4.8492 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.9405 -6.0866 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.2260 -5.6742 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.9405 -6.9116 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.6549 -7.3242 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.3694 -6.9116 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.6516 -7.6869 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.1819 -6.7684 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.7983 -6.0866 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.5128 -5.6741 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.2273 -6.0866 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 2 0 0 0 0\n 3 4 1 0 0 0 0\n 3 5 1 0 0 0 0\n 5 6 2 0 0 0 0\n 5 7 1 0 0 0 0\n 8 7 1 0 0 0 0\n 9 8 1 0 0 0 0\n 9 10 1 0 0 0 0\n 9 11 1 0 0 0 0\n 2 9 1 0 0 0 0\n 1 12 1 0 0 0 0\n 12 13 1 0 0 0 0\n 13 14 2 0 0 0 0\nM END", "smiles": "C=CCCC1=C(C)C(=O)CCC1(C)C", "formula": "C13H20O", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "192.2978", "optical_activity": "NONE", "references": [ "9e95fb46-0214-43b6-9940-35905c5c81cf" ], "stereo_centers": 0 }, "unii": "QXV7P275TL" } ] }