{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "3766649a-794e-41d3-b705-0a013aee754a",
          "code": "1360540-81-3",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=1360540-81-3",
          "code_system": "CAS",
          "references": [
            "2927a962-f39c-4292-abdf-df85b0750069",
            "0a5be517-9484-4b15-a0e2-34bfb05d1e93"
          ]
        },
        {
          "uuid": "25afeff2-161a-bd58-60c2-47f30a01ae88",
          "code": "56837361",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/56837361",
          "code_system": "PUBCHEM",
          "references": [
            "5f9c5897-31a8-f2f2-8008-5d7149f1a286"
          ]
        },
        {
          "uuid": "924483a9-5f68-4c6b-9bda-c4be0830df2a",
          "code": "QX6T87A52I",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "446eff0d-58cf-7380-07e4-ff1af484d294",
          "code": "11422",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=11422",
          "code_system": "INN",
          "references": [
            "ec78dee8-a72e-4b09-3436-5d187ff281ba"
          ]
        },
        {
          "uuid": "ebb2a161-79bc-0399-ade5-33e0847fc396",
          "code": "C175762",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C175762",
          "code_system": "NCI_THESAURUS",
          "references": [
            "fa7d4f97-e138-9f0c-84b2-3d4620350fb0"
          ]
        },
        {
          "uuid": "77581b83-d604-a946-6f91-fdfdb6b85aae",
          "code": "JK-231",
          "type": "PRIMARY",
          "url": "https://searchusan.ama-assn.org/finder/usan/search/JK-231/relevant/1/",
          "code_system": "USAN",
          "references": [
            "117c3987-abd6-6bdf-37dc-d0892459510e"
          ]
        },
        {
          "uuid": "a1ff72f5-4128-1bd0-cef3-1918c3a5dec3",
          "code": "300000027551",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "9392a626-ddec-ed2e-d9c8-d6e4aabc5aa4"
          ]
        }
      ],
      "substance_class": "chemical",
      "references": [
        {
          "uuid": "2927a962-f39c-4292-abdf-df85b0750069",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390972000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9c1bb211-507f-40af-bed4-74bf3a9d98bd",
          "citation": "SRS import [QX6T87A52I]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=QX6T87A52I",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390972000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "117c3987-abd6-6bdf-37dc-d0892459510e",
          "citation": "USAN COUN",
          "doc_type": "USANCOUN",
          "public_domain": true
        },
        {
          "uuid": "5f9c5897-31a8-f2f2-8008-5d7149f1a286",
          "citation": "PUBCHEM",
          "doc_type": "PUBCHEM",
          "public_domain": true
        },
        {
          "uuid": "ec78dee8-a72e-4b09-3436-5d187ff281ba",
          "citation": "INN Proposed List 123",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL123.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "0a5be517-9484-4b15-a0e2-34bfb05d1e93",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "76266fbf-e083-4838-ba9c-5d1bf7cd9a8e",
          "citation": "October 27, 2021",
          "doc_type": "USANCOUN",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "fa7d4f97-e138-9f0c-84b2-3d4620350fb0",
          "doc_type": "NCI THESAURUS",
          "public_domain": true
        },
        {
          "uuid": "9392a626-ddec-ed2e-d9c8-d6e4aabc5aa4",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "d1fba009-2a39-4f5f-ba18-209b2ef20c10",
          "id": "d1fba009-2a39-4f5f-ba18-209b2ef20c10",
          "molfile": "\n  Marvin  01132110512D          \n\n 22 24  0  0  0  0            999 V2000\n    8.6123   -5.2792    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6123   -4.4542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8979   -4.0417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1835   -4.4542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4690   -4.0417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4690   -3.2167    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7545   -4.4542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7545   -5.2794    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0445   -5.6912    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3281   -5.2831    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6105   -5.6973    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8931   -5.2831    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8931   -4.4545    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6105   -4.0403    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3281   -4.4545    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0427   -4.0422    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3268   -4.0417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3270   -3.2167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0396   -2.8061    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7543   -3.2187    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7559   -4.0396    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0442   -4.4559    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  2  0  0  0  0\n  3  2  1  0  0  0  0\n  2 17  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  5  6  2  0  0  0  0\n  7  5  1  0  0  0  0\n  8  7  1  0  0  0  0\n  7 16  2  0  0  0  0\n  9  8  2  0  0  0  0\n 10  9  1  0  0  0  0\n 10 11  1  0  0  0  0\n 15 10  2  0  0  0  0\n 12 11  1  0  0  0  0\n 13 12  1  0  0  0  0\n 14 13  1  0  0  0  0\n 15 14  1  0  0  0  0\n 16 15  1  0  0  0  0\n 18 17  1  0  0  0  0\n 17 22  2  0  0  0  0\n 19 18  2  0  0  0  0\n 20 19  1  0  0  0  0\n 21 20  2  0  0  0  0\n 22 21  1  0  0  0  0\nM  END",
          "smiles": "c1ccc(cc1)C(=O)CCC(=O)c2ccc3c(c2)OCCO3",
          "formula": "C18H16O4",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "7964f1f4-af16-4680-b923-2d701137fae7"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "296.3179",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "5b577231-405b-4726-aeab-8e3dba1a61b2",
      "version": "17",
      "structure": {
        "id": "a82d6aa1-16f2-41d3-800e-8002ce893643",
        "molfile": "\n  Marvin  01132108442D          \n\n 22 24  0  0  0  0            999 V2000\n    4.3281   -4.4545    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0427   -4.0422    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7545   -4.4542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7545   -5.2794    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0445   -5.6912    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3281   -5.2831    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6105   -5.6973    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8931   -5.2831    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8931   -4.4545    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6105   -4.0403    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4690   -4.0417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1835   -4.4542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8979   -4.0417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6123   -4.4542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3268   -4.0417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3270   -3.2167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0396   -2.8061    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7543   -3.2187    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7559   -4.0396    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0442   -4.4559    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4690   -3.2167    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6123   -5.2792    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  2  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  2  0  0  0  0\n  5  4  1  0  0  0  0\n  1  6  1  0  0  0  0\n  6  5  2  0  0  0  0\n  6  7  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10  9  1  0  0  0  0\n  1 10  1  0  0  0  0\n  3 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 16 15  2  0  0  0  0\n 17 16  1  0  0  0  0\n 18 17  2  0  0  0  0\n 19 18  1  0  0  0  0\n 20 19  2  0  0  0  0\n 15 20  1  0  0  0  0\n 11 21  2  0  0  0  0\n 14 22  2  0  0  0  0\nM  END",
        "smiles": "c1ccc(cc1)C(=O)CCC(=O)c2ccc3c(c2)OCCO3",
        "formula": "C18H16O4",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "296.3179",
        "optical_activity": "NONE",
        "references": [
          "9c1bb211-507f-40af-bed4-74bf3a9d98bd",
          "ec78dee8-a72e-4b09-3436-5d187ff281ba"
        ],
        "stereo_centers": 0
      },
      "unii": "QX6T87A52I",
      "relationships": [
        {
          "uuid": "dbd5dbee-d793-47d8-aad2-1dcc27f92bb0",
          "amount": {
            "uuid": "fa456de9-c236-4b37-86c8-8ca2aef44c37"
          },
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "ddcd1c5c-e7ff-41f0-8e3b-c4ba4a45a74a",
            "refuuid": "5b577231-405b-4726-aeab-8e3dba1a61b2",
            "name": "DALOSIRVAT",
            "unii": "QX6T87A52I",
            "linking_id": "QX6T87A52I",
            "ref_pname": "DALOSIRVAT",
            "substance_class": "reference"
          }
        }
      ],
      "names": [
        {
          "uuid": "3e6aa124-f485-087d-5519-22cd041d7d80",
          "name": "1,4-BUTANEDIONE, 1-(2,3-DIHYDRO-1,4-BENZODIOXIN-6-YL)-4-PHENYL-",
          "stdName": "1,4-BUTANEDIONE, 1-(2,3-DIHYDRO-1,4-BENZODIOXIN-6-YL)-4-PHENYL-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0a5be517-9484-4b15-a0e2-34bfb05d1e93"
          ],
          "display_name": false
        },
        {
          "uuid": "254308c7-4402-4dee-bc09-33f9a68b343c",
          "name": "1-(2,3-DIHYDRO-1,4-BENZODIOXIN-6-YL)-4-PHENYL-BUTANE-1,4-DIONE",
          "stdName": "1-(2,3-DIHYDRO-1,4-BENZODIOXIN-6-YL)-4-PHENYL-BUTANE-1,4-DIONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ec78dee8-a72e-4b09-3436-5d187ff281ba"
          ],
          "display_name": false
        },
        {
          "uuid": "abbc38b4-53ba-408d-b0fb-e983c9a128f0",
          "name": "1-(2,3-DIHYDRO-BENZO(1,4)DIOXIN-6-YL)-4-PHENYL-BUTANE-1,4-DIONE",
          "stdName": "1-(2,3-DIHYDRO-BENZO(1,4)DIOXIN-6-YL)-4-PHENYL-BUTANE-1,4-DIONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ec78dee8-a72e-4b09-3436-5d187ff281ba"
          ],
          "display_name": false
        },
        {
          "uuid": "bf3e9694-bfd3-2f6a-18d8-067cdd999f77",
          "name": "DALOSIRVAT",
          "stdName": "DALOSIRVAT",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ec78dee8-a72e-4b09-3436-5d187ff281ba",
            "0a5be517-9484-4b15-a0e2-34bfb05d1e93"
          ],
          "display_name": true,
          "domains": [
            "drug",
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "374d794a-c39c-486b-96ac-c71b4be4be3c",
              "name_org": "USAN"
            },
            {
              "uuid": "90587293-2616-4d0c-887b-093a5a23214e",
              "name_org": "INN"
            },
            {
              "uuid": "0bc397f0-4837-4c23-93af-733f3e85933c",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "f024963c-c750-4e56-9f62-761f2071f44c",
          "name": "DALOSIRVAT [USAN]",
          "stdName": "DALOSIRVAT [USAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "76266fbf-e083-4838-ba9c-5d1bf7cd9a8e"
          ],
          "display_name": false
        },
        {
          "uuid": "d1511744-f111-4fe2-a9ad-77ae5bcaae77",
          "name": "SM-04554",
          "stdName": "SM-04554",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0a5be517-9484-4b15-a0e2-34bfb05d1e93"
          ],
          "display_name": false
        },
        {
          "uuid": "69cf4d32-d6e5-4e6e-b0c7-77033f5b432f",
          "name": "SM04554",
          "stdName": "SM04554",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0a5be517-9484-4b15-a0e2-34bfb05d1e93"
          ],
          "display_name": false
        },
        {
          "uuid": "702d3075-da93-12a1-3543-36c8e138d9c6",
          "name": "dalosirvat [INN]",
          "stdName": "DALOSIRVAT [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ec78dee8-a72e-4b09-3436-5d187ff281ba"
          ],
          "display_name": false
        }
      ],
      "modifications": {
        "uuid": "74cb2567-3c7e-44e1-8b3a-a21bf00bf846"
      }
    }
  ]
}