{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "fcd7985a-76e1-43fa-b3a7-db1ad0381e93", "code": "83055-99-6", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=83055-99-6", "code_system": "CAS", "references": [ "1ad18e6a-a968-4739-9d7b-745d4bcc51d7", "f46159ef-c1de-403f-a533-ff303186cdfa" ] }, { "uuid": "fa788545-409f-43a6-b4f0-cdeaaa226982", "code": "128820", "comments": "EPA PESTICIDE|CONVENTIONAL CHEMICAL", "type": "PRIMARY", "url": "http://iaspub.epa.gov/apex/pesticides/f?p=CHEMICALSEARCH:3:0::NO:21,3,31,7,12,25:P3_XCHEMICAL_ID:1406", "code_system": "EPA PESTICIDE CODE", "references": [ "1ad18e6a-a968-4739-9d7b-745d4bcc51d7" ] }, { "uuid": "f07a4829-c05a-4b31-b708-2512baf6786c", "code": "m2323", "comments": "Merck Index", "type": "PRIMARY", "url": "https://merckindex.rsc.org/monographs/m2323?q=authorize", "code_system": "MERCK INDEX", "references": [ "1ad18e6a-a968-4739-9d7b-745d4bcc51d7" ] }, { "uuid": "ab74e428-224b-4105-ade1-2484dddec3ea", "code": "54960", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/54960", "code_system": "PUBCHEM", "references": [ "1ad18e6a-a968-4739-9d7b-745d4bcc51d7" ] }, { "uuid": "fce821d9-debc-b1d8-6ae6-6995c531d48c", "code": "DTXSID7024164", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID7024164", "code_system": "EPA CompTox", "references": [ "7f03ba70-cea1-410e-c52c-71534fdfe1c7" ] }, { "uuid": "39116b90-9c81-c56e-c36f-2e75fcb27903", "code": "3017", "type": "PRIMARY", "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:3017", "code_system": "CHEBI", "references": [ "8997bea4-26da-a5cc-e745-b1b874d9e4a6" ] }, { "uuid": "44442b21-9f90-45de-b7c3-4a11d6794b46", "code": "QWL4I737BL", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "38175a6b-ca58-0c21-2d18-6b5c5325e25b", "code": "bensulfuron-methyl", "type": "PRIMARY", "url": "https://pesticidecompendium.bcpc.org/bensulfuron-methyl.html", "code_system": "ALANWOOD", "references": [ "08d15a10-47a6-8c24-2db3-4eeda646a619" ] } ], "substance_class": "chemical", "names": [ { "uuid": "5da52a5d-dc90-4ecc-a13d-9e62885e2139", "name": "BENSULFURON METHYL ESTER", "stdName": "BENSULFURON METHYL ESTER", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "0111f407-be6f-4477-87f0-50969ea8be2c", "76e1adef-7f26-44bb-9f4b-a066cb0d510b" ], "display_name": false }, { "uuid": "c5a48c26-b9d6-4b58-a0bf-0ad8cee2282a", "name": "BENSULFURON-METHYL", "stdName": "BENSULFURON-METHYL", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "5dd3542a-9e03-490d-bc6c-dcc2c6939366", "a4790020-4485-4a0e-98ae-b8596a92abf7", "0111f407-be6f-4477-87f0-50969ea8be2c", "33132a50-b655-4caf-a452-e860318917c8", "9f930cfc-b13a-43a5-a063-93bdf60482cd", "eb687148-ca52-42f3-a282-95a8b8563247" ], "display_name": true }, { "uuid": "b83dadf0-50db-4981-9b9e-d16fdae8bbbd", "name": "BENSULFURON-METHYL [ISO]", "stdName": "BENSULFURON-METHYL [ISO]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "0111f407-be6f-4477-87f0-50969ea8be2c", "9f930cfc-b13a-43a5-a063-93bdf60482cd" ], "display_name": false }, { "uuid": "46520d5e-b979-4bcc-8cec-054977ad0fe1", "name": "BENSULFURON-METHYL [MI]", "stdName": "BENSULFURON-METHYL [MI]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "a4790020-4485-4a0e-98ae-b8596a92abf7", "0111f407-be6f-4477-87f0-50969ea8be2c" ], "display_name": false }, { "uuid": "b516a0df-4f09-48bd-bc18-f5a5dc8619dc", "name": "METHYL .ALPHA.-((4,6-DIMETHOXYPYRIMIDIN-2-YLCARBAMOYL)SULFAMOYL)-O-TOLUATE", "stdName": "METHYL .ALPHA.-((4,6-DIMETHOXYPYRIMIDIN-2-YLCARBAMOYL)SULFAMOYL)-O-TOLUATE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "0111f407-be6f-4477-87f0-50969ea8be2c", "3effcc3b-f341-42c1-8cb3-be403de91474" ], "display_name": false } ], "references": [ { "uuid": "33132a50-b655-4caf-a452-e860318917c8", "citation": "ICSAS BATCH 2010", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "3effcc3b-f341-42c1-8cb3-be403de91474", "citation": "http://www.alanwood.net/pesticides/derivatives/bensulfuron-methyl.html", "url": "http://www.alanwood.net/pesticides/derivatives/bensulfuron-methyl.html", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "0111f407-be6f-4477-87f0-50969ea8be2c", "citation": "WEB PAGE", "doc_type": "WEB PAGE", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "a4790020-4485-4a0e-98ae-b8596a92abf7", "citation": "MERCK INDEX", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "76e1adef-7f26-44bb-9f4b-a066cb0d510b", "citation": "CFSAN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "9f930cfc-b13a-43a5-a063-93bdf60482cd", "citation": "ISO", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "1ad18e6a-a968-4739-9d7b-745d4bcc51d7", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493390960000, "tags": [ "NOMEN" ] }, { "uuid": "d0a653b4-ab75-434c-baed-fef879299fba", "citation": "SRS import [QWL4I737BL]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=QWL4I737BL", "doc_type": "SRS", "public_domain": true, "document_date": 1493390960000, "tags": [ "NOMEN" ] }, { "uuid": "77e942a4-73d3-4848-bb95-ce9494ca60aa", "citation": "CHEMID 2010", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "eb687148-ca52-42f3-a282-95a8b8563247", "citation": "BENSULFURON-METHYL [MI]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "5dd3542a-9e03-490d-bc6c-dcc2c6939366", "citation": "BENSULFURON-METHYL [ISO]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "7f03ba70-cea1-410e-c52c-71534fdfe1c7", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=83055-99-6", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "08d15a10-47a6-8c24-2db3-4eeda646a619", "citation": "AW", "doc_type": "ALANWOOD", "public_domain": true }, { "uuid": "8997bea4-26da-a5cc-e745-b1b874d9e4a6", "doc_type": "SYSTEM", "public_domain": true }, { "uuid": "f46159ef-c1de-403f-a533-ff303186cdfa", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "a8503c09-1a3a-4ac8-8cb2-623d473cbc7c", "id": "a8503c09-1a3a-4ac8-8cb2-623d473cbc7c", "molfile": "\n Marvin 01132108442D \n\n 28 29 0 0 0 0 999 V2000\n 5.4173 0.7299 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.4173 -0.0951 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.7029 -0.5076 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.9884 -0.0951 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.7029 -1.3326 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.4173 -1.7451 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.4173 -2.5701 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.7029 -2.9826 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.9884 -2.5701 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.9884 -1.7451 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.2739 -1.3326 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.5595 -1.7451 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1470 -1.0306 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.9720 -2.4596 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1.8450 -2.1576 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 1.1305 -1.7451 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.1305 -0.9201 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 0.4161 -2.1576 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n -0.2984 -1.7451 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.2984 -0.9201 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n -1.0129 -0.5076 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.0129 0.3174 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -1.7273 0.7299 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.7273 -0.9201 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.7273 -1.7451 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.4418 -2.1576 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -2.4418 -2.9826 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.0129 -2.1576 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 3 2 1 0 0 0 0\n 3 4 2 0 0 0 0\n 5 3 1 0 0 0 0\n 5 6 1 0 0 0 0\n 5 10 2 0 0 0 0\n 6 7 2 0 0 0 0\n 7 8 1 0 0 0 0\n 9 8 2 0 0 0 0\n 10 9 1 0 0 0 0\n 10 11 1 0 0 0 0\n 11 12 1 0 0 0 0\n 12 13 2 0 0 0 0\n 12 14 2 0 0 0 0\n 12 15 1 0 0 0 0\n 15 16 1 0 0 0 0\n 16 17 2 0 0 0 0\n 16 18 1 0 0 0 0\n 18 19 1 0 0 0 0\n 19 20 1 0 0 0 0\n 19 28 2 0 0 0 0\n 20 21 2 0 0 0 0\n 21 22 1 0 0 0 0\n 21 24 1 0 0 0 0\n 22 23 1 0 0 0 0\n 25 24 2 0 0 0 0\n 25 26 1 0 0 0 0\n 28 25 1 0 0 0 0\n 26 27 1 0 0 0 0\nM END", "smiles": "COc1cc(nc(n1)NC(=O)NS(=O)(=O)Cc2ccccc2C(=O)OC)OC", "formula": "C16H18N4O7S", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "cfd30742-77a2-4ee5-a0d3-fbb406e2fd4e" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "410.4034", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "4956262d-df26-4cfe-a8b1-c41dd4172a53", "version": "5", "structure": { "id": "6711ee71-6ff5-4965-a503-5d45bd060f98", "molfile": "\n Marvin 01132105222D \n\n 28 29 0 0 0 0 999 V2000\n 4.7029 -1.3326 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.9884 -1.7451 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.2739 -1.3326 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.5595 -1.7451 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 1.8450 -2.1576 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 1.1305 -1.7451 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.4161 -2.1576 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n -0.2984 -1.7451 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.0129 -2.1576 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n -1.7273 -1.7451 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.7273 -0.9201 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.0129 -0.5076 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.2984 -0.9201 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n -1.0129 0.3174 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -1.7273 0.7299 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.4418 -2.1576 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -2.4418 -2.9826 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.1305 -0.9201 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1470 -1.0306 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.9720 -2.4596 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3.9884 -2.5701 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.7029 -2.9826 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.4173 -2.5701 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.4173 -1.7451 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.7029 -0.5076 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.4173 -0.0951 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.4173 0.7299 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.9884 -0.0951 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 2 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 1 0 0 0 0\n 6 7 1 0 0 0 0\n 7 8 1 0 0 0 0\n 8 9 1 0 0 0 0\n 9 10 2 0 0 0 0\n 10 11 1 0 0 0 0\n 12 11 2 0 0 0 0\n 13 12 1 0 0 0 0\n 8 13 2 0 0 0 0\n 12 14 1 0 0 0 0\n 14 15 1 0 0 0 0\n 10 16 1 0 0 0 0\n 16 17 1 0 0 0 0\n 6 18 2 0 0 0 0\n 4 19 2 0 0 0 0\n 4 20 2 0 0 0 0\n 2 21 1 0 0 0 0\n 21 22 2 0 0 0 0\n 23 22 1 0 0 0 0\n 24 23 2 0 0 0 0\n 1 24 1 0 0 0 0\n 1 25 1 0 0 0 0\n 25 26 1 0 0 0 0\n 26 27 1 0 0 0 0\n 25 28 2 0 0 0 0\nM END", "smiles": "COc1cc(nc(n1)NC(=O)NS(=O)(=O)Cc2ccccc2C(=O)OC)OC", "formula": "C16H18N4O7S", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "410.4034", "optical_activity": "NONE", "references": [ "77e942a4-73d3-4848-bb95-ce9494ca60aa", "d0a653b4-ab75-434c-baed-fef879299fba" ], "stereo_centers": 0 }, "unii": "QWL4I737BL" } ] }