{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "8a18334b-9379-4376-aac1-35fc6cddeb95",
          "code": "2545-89-3",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=2545-89-3",
          "code_system": "CAS",
          "references": [
            "cdafd186-7ee3-47ff-bf6d-21442a8fdf39",
            "dc5e5787-e912-4ede-a87b-625dda25ffe6"
          ]
        },
        {
          "uuid": "408185bc-3433-7b42-7f58-85d5cc5077e4",
          "code": "74883",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:74883",
          "code_system": "CHEBI",
          "references": [
            "b593b937-37d7-d00c-e7da-cecdaf13e630"
          ]
        },
        {
          "uuid": "48637c2f-b66c-4585-9125-a9066da0ad08",
          "code": "7009628",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/7009628",
          "code_system": "PUBCHEM",
          "references": [
            "f9eba0c4-000f-fd18-28ed-f9870de877ba"
          ]
        },
        {
          "uuid": "8d286f35-05d0-4036-a806-bd49b4440ca9",
          "code": "QVD4946YTC",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "1a6efc16-290b-4f8b-5cfc-aa31a8d313da",
          "code": "DTXSID00600266",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID00600266",
          "code_system": "EPA CompTox",
          "references": [
            "f6c163d4-057b-be8e-3c3b-46b9f271a7e3"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "1af8e0ad-0d1c-4ed9-a10b-13c2199e8a3d",
          "amount": {
            "uuid": "61727da2-b212-4cfa-915c-d9cf60ff635b"
          },
          "type": "SOLVATE->ANHYDROUS",
          "references": [
            "5bf53167-ef88-402b-81de-de154f6be99a"
          ],
          "related_substance": {
            "uuid": "7794c351-b0f7-4aa5-a8b2-61d4e66435f4",
            "refuuid": "5d023a04-920c-46f2-a84e-d1d1d1e9d025",
            "name": "Tyrosylglutamic acid monohydrate",
            "unii": "B7T68V6PN2",
            "linking_id": "B7T68V6PN2",
            "ref_pname": "Tyrosylglutamic acid monohydrate",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "952ae5d4-4d84-4478-b7a0-99740e7b7be3",
          "amount": {
            "uuid": "b8e762dd-eb9d-478a-b036-a2eb867ce161"
          },
          "type": "SALT/SOLVATE->PARENT",
          "references": [
            "70b0947a-87ee-450c-8c83-874e8f048646"
          ],
          "related_substance": {
            "uuid": "88df4dc3-1077-415a-a586-20fbb84cfd30",
            "refuuid": "5d023a04-920c-46f2-a84e-d1d1d1e9d025",
            "name": "Tyrosylglutamic acid monohydrate",
            "unii": "B7T68V6PN2",
            "linking_id": "B7T68V6PN2",
            "ref_pname": "Tyrosylglutamic acid monohydrate",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "538a7f08-92f3-4ba0-86b0-32f38d974268",
          "name": "L-Glutamic acid, L-tyrosyl-",
          "stdName": "L-GLUTAMIC ACID, L-TYROSYL-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5bf53167-ef88-402b-81de-de154f6be99a"
          ],
          "display_name": false
        },
        {
          "uuid": "d1ab6119-0c76-4b8e-ad95-12da45f4197c",
          "name": "L-Tyrosyl-L-glutamic acid",
          "stdName": "L-TYROSYL-L-GLUTAMIC ACID",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "dc5e5787-e912-4ede-a87b-625dda25ffe6"
          ],
          "display_name": false
        },
        {
          "uuid": "9c764731-26d3-49d2-939b-7ae0305be891",
          "name": "Tyrosylglutamic acid",
          "stdName": "TYROSYLGLUTAMIC ACID",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cdd042d9-024c-4a9d-9257-737a487b34b8"
          ],
          "display_name": true
        }
      ],
      "references": [
        {
          "uuid": "cdd042d9-024c-4a9d-9257-737a487b34b8",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "cdafd186-7ee3-47ff-bf6d-21442a8fdf39",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392233000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f9eba0c4-000f-fd18-28ed-f9870de877ba",
          "citation": "PUBCHEM",
          "doc_type": "PUBCHEM",
          "public_domain": true
        },
        {
          "uuid": "dc5e5787-e912-4ede-a87b-625dda25ffe6",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "b593b937-37d7-d00c-e7da-cecdaf13e630",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "5bf53167-ef88-402b-81de-de154f6be99a",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "70b0947a-87ee-450c-8c83-874e8f048646",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "f6c163d4-057b-be8e-3c3b-46b9f271a7e3",
          "citation": "EPA CompTox",
          "doc_type": "EPA",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "483c146b-ec4d-4250-8b76-0df630d0e3bd",
          "id": "483c146b-ec4d-4250-8b76-0df630d0e3bd",
          "molfile": "\n  CDK     01102413582D\n\n 22 22  0  0  1  0  0  0  0  0999 V2000\n   25.1411   -9.2493    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   25.1411  -10.8093    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   23.7963   -8.4693    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   26.4860   -8.4693    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   27.8442   -9.2493    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   26.4860   -6.9227    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   22.4918   -9.2493    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   29.1890   -8.4693    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   30.5473   -9.2493    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   29.1890   -6.9227    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   31.8921   -8.4693    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   30.5473  -10.8093    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   21.1470   -8.4693    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   19.7887   -9.2493    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   19.7887  -10.8093    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   21.1470  -11.5893    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   22.4918  -10.8093    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   18.4439  -11.5893    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   30.5473   -6.1427    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   30.5473   -4.5827    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   31.8921   -3.8027    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   29.1890   -3.8027    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  1  0  0  0\n  1  3  1  0  0  0  0\n  1  4  1  0  0  0  0\n  3  7  1  0  0  0  0\n  4  5  1  0  0  0  0\n  4  6  2  0  0  0  0\n  8  5  1  1  0  0  0\n  7 13  2  0  0  0  0\n  7 17  1  0  0  0  0\n  8  9  1  0  0  0  0\n  8 10  1  0  0  0  0\n  9 11  1  0  0  0  0\n  9 12  2  0  0  0  0\n 10 19  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  2  0  0  0  0\n 15 16  1  0  0  0  0\n 15 18  1  0  0  0  0\n 16 17  2  0  0  0  0\n 19 20  1  0  0  0  0\n 20 21  1  0  0  0  0\n 20 22  2  0  0  0  0\nM  END",
          "smiles": "c1cc(ccc1C[C@@H](C(=O)N[C@@H](CCC(=O)O)C(=O)O)N)O",
          "formula": "C14H18N2O6",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "3a9de9dc-fe01-439e-a7a0-ef28fb632f69"
          },
          "defined_stereo": 2,
          "ez_centers": 0,
          "molecular_weight": "310.3031",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 2
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "c8c12db3-0373-4e79-b1c4-0cec4133a666",
      "version": "15",
      "structure": {
        "id": "9ee5918c-55c5-4c0d-9d74-a1f1fea19b23",
        "molfile": "\n   JSDraw201102413582D\n\n 22 22  0  0  1  0              0 V2000\n   25.1411   -9.2493    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   25.1411  -10.8093    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   23.7963   -8.4693    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   26.4860   -8.4693    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   27.8442   -9.2493    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   26.4860   -6.9227    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   22.4918   -9.2493    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   29.1890   -8.4693    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   30.5473   -9.2493    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   29.1890   -6.9227    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   31.8921   -8.4693    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   30.5473  -10.8093    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   21.1470   -8.4693    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   19.7887   -9.2493    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   19.7887  -10.8093    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   21.1470  -11.5893    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   22.4918  -10.8093    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   18.4439  -11.5893    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   30.5473   -6.1427    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   30.5473   -4.5827    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   31.8921   -3.8027    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   29.1890   -3.8027    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  1  0  0  0\n  1  3  1  0  0  0  0\n  1  4  1  0  0  0  0\n  3  7  1  0  0  0  0\n  4  5  1  0  0  0  0\n  4  6  2  0  0  0  0\n  8  5  1  1  0  0  0\n  7 13  2  0  0  0  0\n  7 17  1  0  0  0  0\n  8  9  1  0  0  0  0\n  8 10  1  0  0  0  0\n  9 11  1  0  0  0  0\n  9 12  2  0  0  0  0\n 10 19  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  2  0  0  0  0\n 15 16  1  0  0  0  0\n 15 18  1  0  0  0  0\n 16 17  2  0  0  0  0\n 19 20  1  0  0  0  0\n 20 21  1  0  0  0  0\n 20 22  2  0  0  0  0\nM  END",
        "smiles": "c1cc(ccc1C[C@@H](C(=O)N[C@@H](CCC(=O)O)C(=O)O)N)O",
        "formula": "C14H18N2O6",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 2,
        "ez_centers": 0,
        "molecular_weight": "310.3031",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "cdd042d9-024c-4a9d-9257-737a487b34b8",
          "dc5e5787-e912-4ede-a87b-625dda25ffe6"
        ],
        "stereo_centers": 2
      },
      "unii": "QVD4946YTC"
    }
  ]
}