{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "1b7a3a5e-a0a0-4660-bdf1-2969b0114b7d",
          "code": "31906-04-4",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=31906-04-4",
          "code_system": "CAS",
          "references": [
            "eff7e87d-1533-4db3-a747-30142dcecbd8",
            "dab258d5-95b2-4aed-a28f-28585e9fc8aa"
          ]
        },
        {
          "uuid": "3c6a4f4d-f6ae-4d61-a700-6019d25fe46a",
          "code": "C092244",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67092244",
          "code_system": "MESH",
          "references": [
            "eff7e87d-1533-4db3-a747-30142dcecbd8"
          ]
        },
        {
          "uuid": "148246cc-0f6a-4591-a826-2e767456b44f",
          "code": "250-863-4",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.046.225",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "eff7e87d-1533-4db3-a747-30142dcecbd8"
          ]
        },
        {
          "uuid": "84e2643a-9182-4560-87b0-049800cadbd1",
          "code": "1426621",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1426621/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "eff7e87d-1533-4db3-a747-30142dcecbd8"
          ]
        },
        {
          "uuid": "eeac857a-af49-44b6-910d-cbf3c2e3a711",
          "code": "SUB169815",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "eff7e87d-1533-4db3-a747-30142dcecbd8"
          ]
        },
        {
          "uuid": "38bb4cd8-7d2c-4b2f-ac76-44fd538c0f8c",
          "code": "91604",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/91604",
          "code_system": "PUBCHEM",
          "references": [
            "eff7e87d-1533-4db3-a747-30142dcecbd8"
          ]
        },
        {
          "uuid": "52405d4c-d8d3-a2a1-5862-5146eacd475a",
          "code": "Tetrahydroxy-1,4-benzoquinone",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Hydroxyisohexyl_3-cyclohexene%20carboxaldehyde",
          "code_system": "WIKIPEDIA",
          "references": [
            "eefd93b0-9a92-b91d-275f-5d505349cbe3"
          ]
        },
        {
          "uuid": "4c6dd03c-b9f9-a833-7445-af732cec64a2",
          "code": "DTXSID1027970",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID1027970",
          "code_system": "EPA CompTox",
          "references": [
            "774ab681-66eb-67ec-acac-b6b75cd687eb"
          ]
        },
        {
          "uuid": "2852ec38-784b-4892-b5a2-88066d073477",
          "code": "QUE43B9Z2Q",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "b15094f9-8c7b-6093-2c71-845cc31987a9",
          "code": "100000159559",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "b5a270d1-e02f-0045-9eea-60f8657a334e"
          ]
        },
        {
          "uuid": "0cbe8732-f880-08f5-104c-24e5fbbda3f2",
          "code": "QUE43B9Z2Q",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=QUE43B9Z2Q",
          "code_system": "DAILYMED",
          "references": [
            "c849faf2-7eb0-05d6-e7e1-b89ef42273c3"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "eac58950-6adb-470d-b56a-b599870b357e",
          "name": "3-CYCLOHEXENE-1-CARBOXALDEHYDE, 4-(4-HYDROXY-4-METHYLPENTYL)-",
          "stdName": "3-CYCLOHEXENE-1-CARBOXALDEHYDE, 4-(4-HYDROXY-4-METHYLPENTYL)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "bbbf68e9-94c6-409c-92b3-056112239f54",
            "e9373d5b-13ea-4405-88ff-e0a33c0be23a"
          ],
          "display_name": false
        },
        {
          "uuid": "6ac27207-a82a-4e98-92e1-ea51cc4e60e3",
          "name": "4-(4-HYDROXY-4-METHYLPENTYL)CYCLOHEX-3-ENE-1-CARBALDEHYDE",
          "stdName": "4-(4-HYDROXY-4-METHYLPENTYL)CYCLOHEX-3-ENE-1-CARBALDEHYDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "bbbf68e9-94c6-409c-92b3-056112239f54",
            "ba3265fc-36d8-4bfb-8c57-7b8948eaa577"
          ],
          "display_name": false
        },
        {
          "uuid": "1e324666-d6e0-4cfc-a2d1-c374957790b6",
          "name": "HYDROXYISOHEXYL 3-CYCLOHEXENE CARBOXALDEHYDE",
          "stdName": "HYDROXYISOHEXYL 3-CYCLOHEXENE CARBOXALDEHYDE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "bbbf68e9-94c6-409c-92b3-056112239f54",
            "3bf2ebe1-d382-4c7c-afb7-0e2631904344",
            "e9373d5b-13ea-4405-88ff-e0a33c0be23a",
            "2ddd799b-c9b2-4bc2-9eb8-65e4b923ae6e"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "f5408a69-2992-4c12-aaf5-293353f2755b",
              "name_org": "INCI"
            }
          ]
        }
      ],
      "references": [
        {
          "uuid": "e9373d5b-13ea-4405-88ff-e0a33c0be23a",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "bbbf68e9-94c6-409c-92b3-056112239f54",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3bf2ebe1-d382-4c7c-afb7-0e2631904344",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ba3265fc-36d8-4bfb-8c57-7b8948eaa577",
          "citation": "evmpd",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "eff7e87d-1533-4db3-a747-30142dcecbd8",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390901000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "92e25646-715e-456d-9473-56a374433053",
          "citation": "SRS import [QUE43B9Z2Q]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=QUE43B9Z2Q",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390901000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2ddd799b-c9b2-4bc2-9eb8-65e4b923ae6e",
          "citation": "HYDROXYISOHEXYL 3-CYCLOHEXENE CARBOXALDEHYDE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "eefd93b0-9a92-b91d-275f-5d505349cbe3",
          "citation": "WIKI",
          "url": "https://en.wikipedia.org/wiki/Tetrahydroxy-1,4-benzoquinone",
          "doc_type": "WIKI",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "774ab681-66eb-67ec-acac-b6b75cd687eb",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=31906-04-4",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "dab258d5-95b2-4aed-a28f-28585e9fc8aa",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "c849faf2-7eb0-05d6-e7e1-b89ef42273c3",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "b5a270d1-e02f-0045-9eea-60f8657a334e",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "0e1a4501-d2c1-4c26-b233-86a5fd6eed98",
          "id": "0e1a4501-d2c1-4c26-b233-86a5fd6eed98",
          "molfile": "\n  Marvin  01132100582D          \n\n 15 15  0  0  0  0            999 V2000\n    5.0724   -0.0814    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4404   -0.6116    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9673    0.0641    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0238   -1.1950    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7260   -1.0241    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0115   -0.6117    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2970   -1.0241    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.5826   -0.6117    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8681   -1.0241    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.1536   -0.6117    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.1536    0.2133    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    0.8681    0.6258    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.5826    0.2133    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.5609    0.6258    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.5609    1.4509    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  2  4  1  0  0  0  0\n  5  2  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  2  0  0  0  0\n  8 13  1  0  0  0  0\n 10  9  1  0  0  0  0\n 11 10  1  0  0  0  0\n 11 12  1  0  0  0  0\n 11 14  1  0  0  0  0\n 13 12  1  0  0  0  0\n 14 15  2  0  0  0  0\nM  END",
          "smiles": "CC(C)(CCCC1=CCC(CC1)C=O)O",
          "formula": "C13H22O2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "RACEMIC",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "13903355-e029-484f-b5a7-5d6e45dd9240"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "210.3131",
          "optical_activity": "( + / - )",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "08d17000-3681-4746-94d4-5f2fb7ff68a0",
      "version": "7",
      "structure": {
        "id": "14ee8c28-d437-4ac5-9f25-c5a07136c8c8",
        "molfile": "\n  Marvin  01132101172D          \n\n 15 15  0  0  0  0            999 V2000\n    5.0238   -1.1950    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4404   -0.6116    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0724   -0.0814    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9673    0.0641    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7260   -1.0241    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0115   -0.6117    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2970   -1.0241    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.5826   -0.6117    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8681   -1.0241    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.1536   -0.6117    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.1536    0.2133    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8681    0.6258    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.5826    0.2133    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.5609    0.6258    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.5609    1.4509    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  2  4  1  0  0  0  0\n  5  2  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  2  0  0  0  0\n 10  9  1  0  0  0  0\n 11 10  1  0  0  0  0\n 11 12  1  0  0  0  0\n 13 12  1  0  0  0  0\n  8 13  1  0  0  0  0\n 11 14  1  0  0  0  0\n 14 15  2  0  0  0  0\nM  END",
        "smiles": "CC(C)(CCCC1=CCC(CC1)C=O)O",
        "formula": "C13H22O2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "RACEMIC",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "210.3131",
        "optical_activity": "( + / - )",
        "references": [
          "e9373d5b-13ea-4405-88ff-e0a33c0be23a",
          "92e25646-715e-456d-9473-56a374433053"
        ],
        "stereo_centers": 1
      },
      "unii": "QUE43B9Z2Q"
    }
  ]
}