{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "88aa66dc-648c-424a-a19e-f2398f97b0a8",
          "code": "N06AB06",
          "comments": "ATC|NERVOUS SYSTEM|PSYCHOANALEPTICS|ANTIDEPRESSANTS|Selective serotonin reuptake inhibitors|sertraline",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=N06AB06&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "d6cc1b54-406c-4b32-859a-3407988bc748"
          ]
        },
        {
          "uuid": "5783ba5f-17a1-4543-99b8-3f2023f4b453",
          "code": "N0000000109",
          "comments": "Cellular or Molecular Interactions [MoA]|Receptor Interactions [MoA]|Active Transporter Interactions [MoA]|Neurotransmitter Transporter Interactions [MoA]|Serotonin Transporter Interactions [MoA]|Serotonin Uptake Inhibitors [MoA]",
          "type": "PRIMARY",
          "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000000109",
          "code_system": "NDF-RT",
          "references": [
            "d6cc1b54-406c-4b32-859a-3407988bc748"
          ]
        },
        {
          "uuid": "495df8cf-9253-4c29-9a4d-c923e4113b67",
          "code": "N0000175696",
          "comments": "Established Pharmacologic Class [EPC]|Serotonin Reuptake Inhibitor [EPC]",
          "type": "PRIMARY",
          "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000175696",
          "code_system": "NDF-RT",
          "references": [
            "d6cc1b54-406c-4b32-859a-3407988bc748"
          ]
        },
        {
          "uuid": "85d28a3f-1f97-494f-87c1-63112699cd83",
          "code": "QN06AB06",
          "comments": "VATC|PSYCHOANALEPTICS|ANTIDEPRESSANTS|Selective serotonin reuptake inhibitors|sertraline",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QN06AB06&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "d6cc1b54-406c-4b32-859a-3407988bc748"
          ]
        },
        {
          "uuid": "1032e4ea-5583-40c9-a2cf-514d77c2859c",
          "code": "79617-96-2",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=79617-96-2",
          "code_system": "CAS",
          "references": [
            "d6cc1b54-406c-4b32-859a-3407988bc748",
            "97d8260e-cfa8-4529-9fc1-b5c0f6822e25"
          ]
        },
        {
          "uuid": "55a4ecdb-23f4-4e83-b02b-b998ea3c41ed",
          "code": "C61939",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C61939",
          "code_system": "NCI_THESAURUS",
          "references": [
            "d6cc1b54-406c-4b32-859a-3407988bc748"
          ]
        },
        {
          "uuid": "32a133c4-7869-448c-94fe-ed639f472076",
          "code": "NBK548513",
          "comments": "LiverTox|CNS|Antidepressant|SSRI",
          "type": "PRIMARY",
          "url": "https://www.ncbi.nlm.nih.gov/books/NBK548513/",
          "code_system": "LIVERTOX",
          "references": [
            "7de76db9-1d7b-1518-ee3d-dc768152dae3"
          ]
        },
        {
          "uuid": "c69bf002-b411-497b-b663-7d942658733e",
          "code": "D020280",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/68020280",
          "code_system": "MESH",
          "references": [
            "d6cc1b54-406c-4b32-859a-3407988bc748"
          ]
        },
        {
          "uuid": "16d0eddd-d195-4c48-bd42-14783fb4b47c",
          "code": "SERTRALINE",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Sertraline",
          "code_system": "WIKIPEDIA",
          "references": [
            "d6cc1b54-406c-4b32-859a-3407988bc748"
          ]
        },
        {
          "uuid": "b2fd1566-d664-4981-a570-e0f8d4309ec0",
          "code": "5277",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=5277",
          "code_system": "INN",
          "references": [
            "d6cc1b54-406c-4b32-859a-3407988bc748"
          ]
        },
        {
          "uuid": "e72d3ea9-ef2b-47bc-b0d3-a3f514ce0764",
          "code": "4798",
          "type": "PRIMARY",
          "url": "http://www.guidetopharmacology.org/GRAC/LigandDisplayForward?ligandId=4798",
          "code_system": "IUPHAR",
          "references": [
            "d6cc1b54-406c-4b32-859a-3407988bc748"
          ]
        },
        {
          "uuid": "b95d005a-f6d5-4202-adc8-50bb9dad31b1",
          "code": "36437",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/36437/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "d6cc1b54-406c-4b32-859a-3407988bc748"
          ]
        },
        {
          "uuid": "ddc5bc7f-4559-479a-8f0b-b0a4a885ae17",
          "code": "m9876",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m9876?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "d6cc1b54-406c-4b32-859a-3407988bc748"
          ]
        },
        {
          "uuid": "c38926ed-a02e-4027-836f-beceffa5f031",
          "code": "DB01104",
          "type": "PRIMARY",
          "url": "http://www.drugbank.ca/drugs/DB01104",
          "code_system": "DRUG BANK",
          "references": [
            "d6cc1b54-406c-4b32-859a-3407988bc748"
          ]
        },
        {
          "uuid": "21cfa1ce-bc85-4424-863f-1825e5fabf35",
          "code": "SUB10499MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "d6cc1b54-406c-4b32-859a-3407988bc748"
          ]
        },
        {
          "uuid": "342fe244-3878-47ec-8ba1-99f7d2fdfda7",
          "code": "CHEMBL809",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL809",
          "code_system": "ChEMBL",
          "references": [
            "d6cc1b54-406c-4b32-859a-3407988bc748"
          ]
        },
        {
          "uuid": "5f51890a-ebbe-44e0-929b-fa37b1223354",
          "code": "68617",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/68617",
          "code_system": "PUBCHEM",
          "references": [
            "d6cc1b54-406c-4b32-859a-3407988bc748"
          ]
        },
        {
          "uuid": "2d9f4e7b-815d-a7e2-518e-0ad8ad0a796e",
          "code": "7037",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/7037",
          "code_system": "HSDB",
          "references": [
            "0487594c-a3c1-9d59-134f-5fdd7765c492"
          ]
        },
        {
          "uuid": "1b3efbb3-cd06-a741-b5f7-f1ed7657ca43",
          "code": "DTXSID6023577",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID6023577",
          "code_system": "EPA CompTox",
          "references": [
            "91b86fd9-fc3d-214a-e202-9b0ba5948e52"
          ]
        },
        {
          "uuid": "ffc74cae-0b06-374b-a1a0-0f1dd8152060",
          "code": "C94725",
          "comments": "Pharmacologic Substance[C1909]|Agent Affecting Nervous System[C78272]|Selective Serotonin Reuptake Inhibitor",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C94725",
          "code_system": "NCI_THESAURUS",
          "references": [
            "7de76db9-1d7b-1518-ee3d-dc768152dae3"
          ]
        },
        {
          "uuid": "40982ce6-ef36-9fc1-ba36-f7850a162162",
          "code": "C265",
          "comments": "Pharmacologic Substance[C1909]|Agent Affecting Nervous System[C78272]|Antidepressant Agent",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C265",
          "code_system": "NCI_THESAURUS",
          "references": [
            "7de76db9-1d7b-1518-ee3d-dc768152dae3"
          ]
        },
        {
          "uuid": "37716762-1217-4835-bc17-69550536d717",
          "code": "QUC7NX6WMB",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "230732cd-a10a-3098-ac9a-dd0a5ffa9870",
          "code": "Sertraline",
          "type": "PRIMARY",
          "url": "https://www.ncbi.nlm.nih.gov/books/n/lactmed/LM328/",
          "code_system": "LACTMED",
          "references": [
            "7de76db9-1d7b-1518-ee3d-dc768152dae3"
          ]
        },
        {
          "uuid": "45ee387e-e6eb-86a3-d3b9-0b2e02c1219b",
          "code": "2436",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/2436",
          "code_system": "DRUG CENTRAL",
          "references": [
            "7de76db9-1d7b-1518-ee3d-dc768152dae3"
          ]
        },
        {
          "uuid": "61d3543f-b2de-b73e-e22c-dcce6abf06f2",
          "code": "9123",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:9123",
          "code_system": "CHEBI",
          "references": [
            "7de76db9-1d7b-1518-ee3d-dc768152dae3"
          ]
        },
        {
          "uuid": "0487ef52-1f8f-29f4-c68f-e64eb07b593c",
          "code": "QUC7NX6WMB",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=QUC7NX6WMB",
          "code_system": "DAILYMED",
          "references": [
            "66cadb27-ce16-b0ac-de27-97918caad81b"
          ]
        },
        {
          "uuid": "eca94fe4-f445-03b4-ba02-9293721e53f0",
          "code": "100000084321",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "029266c0-3d66-9081-1ef9-067cd013c9b3"
          ]
        }
      ],
      "substance_class": "chemical",
      "references": [
        {
          "uuid": "8e58632e-e97f-4b05-85fd-2e17362489f5",
          "citation": "USP Dictionary",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "d28372a2-0736-4101-af02-210bc0035746",
          "citation": "INN Proposed List 48",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL48.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "d3817bd1-3b20-4fce-a132-c6f36d0a798b",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d37e05d1-c539-40d6-942a-f23ad0043e90",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7e3e2390-10af-4b50-ad03-86493df15318",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "38bf0e0b-e017-4634-8e63-f11c4c76ba79",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0c74e1b4-416a-44ad-bb7b-3c7ef42b59c2",
          "citation": "NDF-RT",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9e1ed9d3-d1c6-4805-b545-b3a12932b997",
          "citation": "WIKIPEDIA",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d6cc1b54-406c-4b32-859a-3407988bc748",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390313000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "60906096-26ca-4d7c-965b-46903f399acf",
          "citation": "DMD FEBRUARY 2005 VOL. 33 NO. 2 262-270",
          "url": "http://dmd.aspetjournals.org/content/33/2/262.long",
          "doc_type": "JOURNAL ARTICLE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d2d4bafb-0d9f-4334-845c-a987763757ea",
          "citation": "DMD FEBRUARY 2005 VOL. 33 NO. 2 262-270",
          "url": "http://dmd.aspetjournals.org/content/33/2/262.full.pdf+html",
          "doc_type": "JOURNAL ARTICLE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8ab50f33-9bac-4133-9bac-04c90a674e72",
          "citation": "SRS import [QUC7NX6WMB]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=QUC7NX6WMB",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390313000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b64d0b23-64f4-49ed-a2b6-9af88f37f442",
          "citation": "SERTRALINE [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "e80e1c38-2fe0-464e-9e8b-16d8e2656768",
          "citation": "SERTRALINE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "632d8bf6-0e2a-4355-a92f-2f9db215be6d",
          "citation": "SERTRALINE [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "644dd0be-dc7a-4b1b-83a6-772d25ae654c",
          "citation": "SERTRALINE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "3664408f-23c7-40c4-9582-4cd00e79ae66",
          "citation": "SERTRALINE [VANDF]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "0487594c-a3c1-9d59-134f-5fdd7765c492",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+79617-96-2",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "91b86fd9-fc3d-214a-e202-9b0ba5948e52",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=79617-96-2",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "0daab265-4eac-9085-af28-accba840c80d",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search/r?dbs+lactmed:@term+@rel+@rn+79617-96-2",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "589830a8-b2a5-2e8f-58dc-61333ab5ad53",
          "citation": "SERTRALINE",
          "doc_type": "MICROMEDEX",
          "public_domain": true
        },
        {
          "uuid": "7de76db9-1d7b-1518-ee3d-dc768152dae3",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "97d8260e-cfa8-4529-9fc1-b5c0f6822e25",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "5ee30ef6-3897-44ca-ab50-d5f5dec7fae1",
          "citation": "Drug Metab Dispos 1989;17(1):58",
          "doc_type": "JA",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "db7a4bc8-a811-4c86-9901-235cce44695a",
          "citation": "J Chromatogr 1990;527(2):467",
          "doc_type": "JA",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "66cadb27-ce16-b0ac-de27-97918caad81b",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "42e32747-aae0-f073-19bb-ed533ddad1e4",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "029266c0-3d66-9081-1ef9-067cd013c9b3",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "118e3efb-c3d9-44cd-8d74-d362f42758d4",
          "id": "118e3efb-c3d9-44cd-8d74-d362f42758d4",
          "molfile": "\n  Marvin  01132101082D          \n\n 20 22  0  0  1  0            999 V2000\n   -2.0040   -2.0864    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n   -1.5867   -2.8230    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.7599   -2.8075    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.3426   -2.1173    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    0.4610   -2.1430    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8964   -1.4682    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.7360   -1.4682    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1379   -2.1739    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9956   -2.1791    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    1.6974   -2.8668    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0941   -3.5880    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    0.8629   -2.8771    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.7264   -1.4373    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.3040   -0.7264    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.7135    0.0155    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.5249   -0.0025    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.9653   -0.6955    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.5609   -1.4373    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.8462   -2.0864    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.2454   -1.4166    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1 18  1  0  0  0  0\n  1 19  1  6  0  0  0\n  2  3  1  0  0  0  0\n  4  3  1  0  0  0  0\n  4  5  1  0  0  0  0\n  4 13  1  6  0  0  0\n  6  5  1  0  0  0  0\n 12  5  2  0  0  0  0\n  7  6  2  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n  8 10  2  0  0  0  0\n 11 10  1  0  0  0  0\n 10 12  1  0  0  0  0\n 14 13  1  0  0  0  0\n 18 13  2  0  0  0  0\n 15 14  2  0  0  0  0\n 16 15  1  0  0  0  0\n 16 17  2  0  0  0  0\n 17 18  1  0  0  0  0\n 20 19  1  0  0  0  0\nM  END",
          "smiles": "CN[C@H]1CC[C@@H](c2ccc(c(c2)Cl)Cl)c3ccccc31",
          "formula": "C17H17Cl2N",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "7febd1ca-d8b0-4ba9-8370-54b19672be70"
          },
          "defined_stereo": 2,
          "ez_centers": 0,
          "molecular_weight": "306.2301",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 2
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "6895c1d6-8f30-4484-aed3-85bb17351e85",
      "version": "37",
      "structure": {
        "id": "c6b72336-a867-4a57-a235-8bcd3a739fbf",
        "molfile": "\n  Marvin  01132110162D          \n\n 20 22  0  0  1  0            999 V2000\n   -0.7264   -1.4373    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.3426   -2.1173    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    0.4610   -2.1430    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.5609   -1.4373    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8629   -2.8771    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6974   -2.8668    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.7599   -2.8075    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.0040   -2.0864    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    2.1379   -2.1739    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8964   -1.4682    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.5867   -2.8230    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.7360   -1.4682    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.8462   -2.0864    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0941   -3.5880    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    2.9956   -2.1791    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n   -0.3040   -0.7264    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.9653   -0.6955    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.2454   -1.4166    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.7135    0.0155    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.5249   -0.0025    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  6  0  0  0\n  4  1  2  0  0  0  0\n  5  3  2  0  0  0  0\n  6  5  1  0  0  0  0\n  7  2  1  0  0  0  0\n  8  4  1  0  0  0  0\n  9 12  1  0  0  0  0\n 10  3  1  0  0  0  0\n 11  8  1  0  0  0  0\n 12 10  2  0  0  0  0\n  8 13  1  6  0  0  0\n 14  6  1  0  0  0  0\n 15  9  1  0  0  0  0\n 16  1  1  0  0  0  0\n 17  4  1  0  0  0  0\n 18 13  1  0  0  0  0\n 19 16  2  0  0  0  0\n 20 19  1  0  0  0  0\n 20 17  2  0  0  0  0\n 11  7  1  0  0  0  0\n  9  6  2  0  0  0  0\nM  END",
        "smiles": "CN[C@H]1CC[C@@H](c2ccc(c(c2)Cl)Cl)c3ccccc31",
        "formula": "C17H17Cl2N",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 2,
        "ez_centers": 0,
        "molecular_weight": "306.2301",
        "optical_activity": "( + )",
        "references": [
          "8ab50f33-9bac-4133-9bac-04c90a674e72",
          "8e58632e-e97f-4b05-85fd-2e17362489f5",
          "d28372a2-0736-4101-af02-210bc0035746"
        ],
        "stereo_centers": 2
      },
      "unii": "QUC7NX6WMB",
      "relationships": [
        {
          "uuid": "63fdc1ab-814f-43a9-a522-6c76fee41691",
          "amount": {
            "uuid": "b34442bc-6c0c-44bf-bf1f-a5e07a1495e9"
          },
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "b442d884-3e13-4da4-aa76-319696cae253",
            "refuuid": "6895c1d6-8f30-4484-aed3-85bb17351e85",
            "name": "SERTRALINE",
            "unii": "QUC7NX6WMB",
            "linking_id": "QUC7NX6WMB",
            "ref_pname": "SERTRALINE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "65095594-7bf7-40d5-be73-54097e6684ac",
          "amount": {
            "uuid": "9a32d568-cd7a-4f07-9b9b-0ca67f111c24"
          },
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "130945eb-8ac0-4861-8061-b0d323aa777b",
            "refuuid": "a2ea4486-d852-4e31-a57c-0c1b083ffe90",
            "name": "Sertraline hydrochloride",
            "unii": "UTI8907Y6X",
            "linking_id": "UTI8907Y6X",
            "ref_pname": "Sertraline hydrochloride",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "d03afab4-6b8d-4cd7-bca7-a506227c8d8c",
          "amount": {
            "uuid": "bbd03aee-19e8-4ca5-b54a-97b84d02ef59"
          },
          "type": "METABOLITE LESS ACTIVE->PARENT",
          "interaction_type": "MAJOR",
          "mediator_substance": {
            "uuid": "e496ffa1-c707-4bff-93e1-9eed1b57a788",
            "refuuid": "4275827d-e329-4907-95b5-7d690692872a",
            "name": "CYTOCHROME P450 3A4",
            "unii": "PUO0521HZV",
            "linking_id": "PUO0521HZV",
            "ref_pname": "CYTOCHROME P450 3A4",
            "substance_class": "reference"
          },
          "references": [
            "db7a4bc8-a811-4c86-9901-235cce44695a"
          ],
          "related_substance": {
            "uuid": "30a5487d-3eb1-46a6-be8a-b244165541c8",
            "refuuid": "ef33a936-979c-42ce-ba06-b0ed061272e2",
            "name": "DESMETHYLSERTRALINE",
            "unii": "CJJ71O9BE8",
            "linking_id": "CJJ71O9BE8",
            "ref_pname": "DESMETHYLSERTRALINE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "f418a2c6-5eb8-42d9-b62b-5a3a58235172",
          "amount": {
            "uuid": "d97ddc28-9b5a-478f-b9c6-d7bf0c1bb2ff"
          },
          "type": "METABOLITE LESS ACTIVE->PARENT",
          "mediator_substance": {
            "uuid": "670a7043-8f6b-42ad-a129-c49815d9185b",
            "refuuid": "4f746c19-0e0a-447a-beda-d28b91d6f23e",
            "name": "CYTOCHROME P450 2C19",
            "unii": "081I12ZA58",
            "linking_id": "081I12ZA58",
            "ref_pname": "CYTOCHROME P450 2C19",
            "substance_class": "reference"
          },
          "references": [
            "60906096-26ca-4d7c-965b-46903f399acf"
          ],
          "related_substance": {
            "uuid": "99fe913f-a191-44d3-9842-0069cc2d0b7f",
            "refuuid": "ef33a936-979c-42ce-ba06-b0ed061272e2",
            "name": "DESMETHYLSERTRALINE",
            "unii": "CJJ71O9BE8",
            "linking_id": "CJJ71O9BE8",
            "ref_pname": "DESMETHYLSERTRALINE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "98452832-67d2-4c11-a4a6-2da96932bf75",
          "amount": {
            "uuid": "457afcf4-625b-442f-aedb-7181938a1208"
          },
          "type": "METABOLITE LESS ACTIVE->PARENT",
          "mediator_substance": {
            "uuid": "8a44f880-9762-47bd-bca2-35d38105a9db",
            "refuuid": "cc92795c-ba54-4e71-a72b-1af36b57df6b",
            "name": "CYTOCHROME P450 2D6",
            "unii": "8E4LAA4357",
            "linking_id": "8E4LAA4357",
            "ref_pname": "CYTOCHROME P450 2D6",
            "substance_class": "reference"
          },
          "references": [
            "60906096-26ca-4d7c-965b-46903f399acf"
          ],
          "related_substance": {
            "uuid": "62ab2ec6-9cf2-4eb7-a007-233fac12916d",
            "refuuid": "ef33a936-979c-42ce-ba06-b0ed061272e2",
            "name": "DESMETHYLSERTRALINE",
            "unii": "CJJ71O9BE8",
            "linking_id": "CJJ71O9BE8",
            "ref_pname": "DESMETHYLSERTRALINE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "0a034c24-cb40-4133-bf72-4c4bf5bbd1f6",
          "type": "METABOLITE LESS ACTIVE->PARENT",
          "mediator_substance": {
            "uuid": "06560527-9453-4fac-8fc4-3083936211c8",
            "refuuid": "50fbc0e6-a35d-4d72-849b-84bfc9d44cd5",
            "name": "CYTOCHROME P450 2C9",
            "unii": "L9DP834D1P",
            "linking_id": "L9DP834D1P",
            "ref_pname": "CYTOCHROME P450 2C9",
            "substance_class": "reference"
          },
          "references": [
            "60906096-26ca-4d7c-965b-46903f399acf"
          ],
          "related_substance": {
            "uuid": "2ca92899-8433-487a-a3c1-faaf7fe65e31",
            "refuuid": "ef33a936-979c-42ce-ba06-b0ed061272e2",
            "name": "DESMETHYLSERTRALINE",
            "unii": "CJJ71O9BE8",
            "linking_id": "CJJ71O9BE8",
            "ref_pname": "DESMETHYLSERTRALINE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "8db6f8b6-62e5-40c4-892a-bbd8d4176106",
          "type": "METABOLITE LESS ACTIVE->PARENT",
          "mediator_substance": {
            "uuid": "68ed53e4-d4b1-442c-bebe-52fb5519a574",
            "refuuid": "83e3f07e-be5b-48ac-be08-0c68c20e8bf0",
            "name": "CYTOCHROME P450 2B6",
            "unii": "0UY97CSG1T",
            "linking_id": "0UY97CSG1T",
            "ref_pname": "CYTOCHROME P450 2B6",
            "substance_class": "reference"
          },
          "references": [
            "60906096-26ca-4d7c-965b-46903f399acf"
          ],
          "related_substance": {
            "uuid": "83c6e9cd-02fb-4ddf-877c-033f14938b72",
            "refuuid": "ef33a936-979c-42ce-ba06-b0ed061272e2",
            "name": "DESMETHYLSERTRALINE",
            "unii": "CJJ71O9BE8",
            "linking_id": "CJJ71O9BE8",
            "ref_pname": "DESMETHYLSERTRALINE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "23f6e31c-520d-42cb-a064-1cbdd8e921c1",
          "type": "METABOLITE INACTIVE->PARENT",
          "interaction_type": "MINOR",
          "references": [
            "5ee30ef6-3897-44ca-ab50-d5f5dec7fae1"
          ],
          "related_substance": {
            "uuid": "4749add1-9187-4c6d-9e61-e46fd1c7e94e",
            "refuuid": "3ee041ca-2504-4c6f-8693-6972d7c917dd",
            "name": "SERTRALINE CARBAMOYL-O-GLUCURONIDE",
            "unii": "42M7V4CERF",
            "linking_id": "42M7V4CERF",
            "ref_pname": "SERTRALINE CARBAMOYL-O-GLUCURONIDE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "1e5db140-5261-4b00-8245-80668d30fe89",
          "type": "METABOLITE INACTIVE->PARENT",
          "references": [
            "d2d4bafb-0d9f-4334-845c-a987763757ea"
          ],
          "related_substance": {
            "uuid": "c6fa07f3-a226-49bb-b705-415c12c8c893",
            "refuuid": "d2d26e78-676d-44b2-8fc3-985e1debd37c",
            "name": "SERTRALINE KETONE",
            "unii": "3383LZ11NQ",
            "linking_id": "3383LZ11NQ",
            "ref_pname": "SERTRALINE KETONE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "0b7cf59c-3d65-4701-932f-8cf82bf91f1b",
          "type": "TARGET->INHIBITOR",
          "related_substance": {
            "uuid": "0e6d37ce-1308-4f34-8c43-6d326b2fc8e9",
            "refuuid": "06df8044-d6c0-4403-85ab-26c75e41e405",
            "name": "SODIUM-DEPENDENT SEROTONIN TRANSPORTER",
            "unii": "CJZ26L1EGI",
            "linking_id": "CJZ26L1EGI",
            "ref_pname": "SODIUM-DEPENDENT SEROTONIN TRANSPORTER",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "0fd37673-761e-462a-ad1d-84f9576c2d37",
          "amount": {
            "uuid": "e2b553c1-5e3c-44b3-b090-83c36e0ace2a"
          },
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "4ba5b0bf-31db-41bd-87b7-e4a49e2a1368",
            "refuuid": "a2ea4486-d852-4e31-a57c-0c1b083ffe90",
            "name": "Sertraline hydrochloride",
            "unii": "UTI8907Y6X",
            "linking_id": "UTI8907Y6X",
            "ref_pname": "Sertraline hydrochloride",
            "substance_class": "reference"
          }
        }
      ],
      "names": [
        {
          "uuid": "93ca4ea1-2f6c-4770-baa2-ca9bc52695ca",
          "name": "(+)-Sertraline",
          "stdName": "(+)-SERTRALINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "97d8260e-cfa8-4529-9fc1-b5c0f6822e25"
          ],
          "display_name": false
        },
        {
          "uuid": "4e7cdafe-ec20-4639-991f-4c5bad5b1320",
          "name": "(1S,4S)-4-(3,4-DICHLOROPHENYL)-N-METHYL-1,2,3,4-TETRAHYDRONAPHTHALEN-1-AMINE",
          "stdName": "(1S,4S)-4-(3,4-DICHLOROPHENYL)-N-METHYL-1,2,3,4-TETRAHYDRONAPHTHALEN-1-AMINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9e1ed9d3-d1c6-4805-b545-b3a12932b997",
            "d37e05d1-c539-40d6-942a-f23ad0043e90"
          ],
          "display_name": false
        },
        {
          "uuid": "6ca11ad6-4d71-4886-b641-14f87f9ccd2c",
          "name": "SERTRALINE",
          "stdName": "SERTRALINE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d3817bd1-3b20-4fce-a132-c6f36d0a798b",
            "e80e1c38-2fe0-464e-9e8b-16d8e2656768",
            "d28372a2-0736-4101-af02-210bc0035746",
            "7e3e2390-10af-4b50-ad03-86493df15318",
            "0c74e1b4-416a-44ad-bb7b-3c7ef42b59c2",
            "644dd0be-dc7a-4b1b-83a6-772d25ae654c",
            "3664408f-23c7-40c4-9582-4cd00e79ae66",
            "632d8bf6-0e2a-4355-a92f-2f9db215be6d",
            "b64d0b23-64f4-49ed-a2b6-9af88f37f442",
            "8e58632e-e97f-4b05-85fd-2e17362489f5",
            "d37e05d1-c539-40d6-942a-f23ad0043e90",
            "38bf0e0b-e017-4634-8e63-f11c4c76ba79"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "c60283ae-73af-4608-9e3b-2eda12636fd7",
              "name_org": "INN"
            }
          ]
        },
        {
          "uuid": "04d1c88b-d57b-456c-a4bd-a117d1039b07",
          "name": "SERTRALINE [HSDB]",
          "stdName": "SERTRALINE [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7e3e2390-10af-4b50-ad03-86493df15318",
            "d37e05d1-c539-40d6-942a-f23ad0043e90"
          ],
          "display_name": false
        },
        {
          "uuid": "3d185261-9281-43de-8414-6fbcc839f737",
          "name": "SERTRALINE [MI]",
          "stdName": "SERTRALINE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d3817bd1-3b20-4fce-a132-c6f36d0a798b",
            "d37e05d1-c539-40d6-942a-f23ad0043e90"
          ],
          "display_name": false
        },
        {
          "uuid": "655d33d2-251c-4cd5-b03a-95dbf54be74d",
          "name": "SERTRALINE [VANDF]",
          "stdName": "SERTRALINE [VANDF]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0c74e1b4-416a-44ad-bb7b-3c7ef42b59c2",
            "d37e05d1-c539-40d6-942a-f23ad0043e90"
          ],
          "display_name": false
        },
        {
          "uuid": "07bd5196-1a52-15d2-69a2-c866ca18582a",
          "name": "Sertraline [WHO-DD]",
          "stdName": "SERTRALINE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "42e32747-aae0-f073-19bb-ed533ddad1e4"
          ],
          "display_name": false
        },
        {
          "uuid": "d5fbfffd-cd3b-45bd-9cc7-42e586f6346c",
          "name": "sertraline [INN]",
          "stdName": "SERTRALINE [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d28372a2-0736-4101-af02-210bc0035746"
          ],
          "display_name": false
        }
      ],
      "properties": [
        {
          "uuid": "015e309f-131c-466a-a01c-f22426f3f494",
          "name": "MAXIMUM TOLERATED DOSE",
          "value": {
            "uuid": "c70fd172-07bc-4ed7-93ad-a0ec12a97795",
            "average": 200,
            "units": "mg/day",
            "non_numeric_value": "ORAL"
          },
          "defining": false,
          "parameters": [
            {
              "uuid": "c6511a42-63e0-49bf-b2ed-ed0efb88efcf",
              "name": "CEREBROVASCULAR ACCIDENT, POST-DEPRESSION",
              "value": {
                "uuid": "4f991aad-7adc-42dc-b1eb-e19854899b28",
                "average": 150,
                "units": "mg/day",
                "references": [],
                "non_numeric_value": "ORAL"
              },
              "references": []
            }
          ],
          "property_type": "TOXICITY",
          "references": [
            "589830a8-b2a5-2e8f-58dc-61333ab5ad53"
          ]
        },
        {
          "uuid": "1042ec2b-2817-417e-840b-2da6643a8b89",
          "name": "Tmax",
          "value": {
            "uuid": "85dee72a-82de-4eb0-aaa8-186ad8888bd5",
            "high": 8.4,
            "low": 4.5,
            "units": "hours",
            "non_numeric_value": "ORAL"
          },
          "defining": false,
          "parameters": [
            {
              "uuid": "3d174963-a9ff-4406-a112-c56b31a4261f",
              "name": "EFFECT OF FOOD (TABLET)",
              "type": "PHARMACOKINETIC",
              "value": {
                "uuid": "34e27d86-209b-4d2d-b521-657bc8cede73",
                "average": 5.5,
                "units": "hours",
                "references": []
              },
              "references": []
            },
            {
              "uuid": "0392e600-0125-46b0-97f4-e00e4efe29fd",
              "name": "EFFECT OF FOOD (SOLUTION)",
              "type": "PHARMACOKINETIC",
              "value": {
                "uuid": "490dde97-96f7-4a2f-9e8a-0e3a53017375",
                "average": 7,
                "units": "hours",
                "references": []
              },
              "references": []
            }
          ],
          "property_type": "PHARMACOKINETIC",
          "references": [
            "589830a8-b2a5-2e8f-58dc-61333ab5ad53"
          ]
        },
        {
          "uuid": "58aa8da9-4c71-4b47-9e4e-4b8ca83a9f4a",
          "name": "Volume of Distribution",
          "value": {
            "uuid": "231849e0-ef3d-45b8-bb1a-5b86c634cbe7",
            "average": 20,
            "units": "Liters/Kilogram"
          },
          "defining": false,
          "property_type": "PHARMACOKINETIC",
          "references": [
            "589830a8-b2a5-2e8f-58dc-61333ab5ad53"
          ]
        },
        {
          "uuid": "abcbdb7e-00f8-4d63-a671-824abaf42f28",
          "name": "Biological Half-life",
          "value": {
            "uuid": "44fcc1db-7258-4038-99e4-66008f3fc1b8",
            "high": 26,
            "low": 24,
            "units": "hours"
          },
          "defining": false,
          "property_type": "PHARMACOKINETIC",
          "references": [
            "589830a8-b2a5-2e8f-58dc-61333ab5ad53"
          ]
        }
      ]
    }
  ]
}