{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2026-09-09", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "60bc8bbc-ed5b-447a-a847-e610919fb4b9", "code": "74061-79-3", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=74061-79-3", "code_system": "CAS", "references": [ "185f2bd7-aa3c-4951-9fb7-d77a7773517b", "4cdbabc2-5b1b-4f64-8cc7-da44f4f58cf6" ] }, { "uuid": "262d5237-92ef-43c2-80f8-74e31e8e2bdd", "code": "94672", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/94672", "code_system": "PUBCHEM", "references": [ "185f2bd7-aa3c-4951-9fb7-d77a7773517b" ] }, { "uuid": "9bc40267-22c7-4d1e-bc39-089c233597e5", "code": "QTS6XJP5LC", "type": "PRIMARY", "code_system": "FDA UNII", "references": [ "4cdbabc2-5b1b-4f64-8cc7-da44f4f58cf6" ] }, { "uuid": "d26e185c-f9dd-c2fd-3bf6-d067a7a7c61e", "code": "DTXSID50995513", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID50995513", "code_system": "EPA CompTox", "references": [ "9942652d-465a-0a8e-1fe8-cc2477ab5304" ] } ], "substance_class": "chemical", "names": [ { "uuid": "fda00b9a-59ae-43bf-a682-b6603de6b5b4", "name": "(+)-Sesaminol", "stdName": "(+)-SESAMINOL", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "4cdbabc2-5b1b-4f64-8cc7-da44f4f58cf6" ], "display_name": false }, { "uuid": "c5ab39dd-28bc-481d-9bf0-9673af98d2ff", "name": "1,3-Benzodioxol-5-ol, 6-[(1S,3aR,4S,6aR)-4-(1,3-benzodioxol-5-yl)tetrahydro-1H,3H-furo[3,4-c]furan-1-yl]-", "stdName": "1,3-BENZODIOXOL-5-OL, 6-((1S,3AR,4S,6AR)-4-(1,3-BENZODIOXOL-5-YL)TETRAHYDRO-1H,3H-FURO(3,4-C)FURAN-1-YL)-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "4cdbabc2-5b1b-4f64-8cc7-da44f4f58cf6" ], "display_name": false }, { "uuid": "54458f77-5dea-4837-bdac-5a46a5f04642", "name": "6-[(1S,3aR,4S,6aR)-4-(1,3-Benzodioxol-5-yl)tetrahydro-1H,3H-furo[3,4-c]furan-1-yl]-1,3-benzodioxol-5-ol", "stdName": "6-((1S,3AR,4S,6AR)-4-(1,3-BENZODIOXOL-5-YL)TETRAHYDRO-1H,3H-FURO(3,4-C)FURAN-1-YL)-1,3-BENZODIOXOL-5-OL", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "4cdbabc2-5b1b-4f64-8cc7-da44f4f58cf6" ], "display_name": false }, { "uuid": "818ba3bd-def4-4252-8661-e1049e9e6c6b", "name": "Sesaminol", "stdName": "SESAMINOL", "type": "of", "languages": [ "en" ], "preferred": true, "references": [ "74a2592d-0bbc-4a33-b1dc-44780d58ec1c" ], "display_name": false, "domains": [ "cosmetic" ], "name_orgs": [ { "uuid": "faaa80f7-d4b7-445a-84a1-c1cd8ffa06aa", "name_org": "INCI" } ] }, { "uuid": "cfc2ecc5-2193-4bf3-8298-d62827e7fe82", "name": "Sesaminol, (+)-", "stdName": "SESAMINOL, (+)-", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "4cdbabc2-5b1b-4f64-8cc7-da44f4f58cf6" ], "display_name": true } ], "references": [ { "uuid": "74a2592d-0bbc-4a33-b1dc-44780d58ec1c", "citation": "CFSAN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "185f2bd7-aa3c-4951-9fb7-d77a7773517b", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493392731000, "tags": [ "NOMEN" ] }, { "uuid": "9942652d-465a-0a8e-1fe8-cc2477ab5304", "citation": "EPA CompTox", "doc_type": "EPA", "public_domain": true }, { "uuid": "4cdbabc2-5b1b-4f64-8cc7-da44f4f58cf6", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "3d396eaf-26dc-4647-beda-97d4551207f5", "id": "3d396eaf-26dc-4647-beda-97d4551207f5", "molfile": "\n Marvin 01132103152D \n\n 27 32 0 0 1 0 999 V2000\n 4.1914 -1.8275 0.0000 C 0 0 1 0 0 0 0 0 0 1 0 0\n 4.9794 -1.5424 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.4824 -2.1963 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0130 -2.8837 0.0000 C 0 0 2 0 0 0 0 0 0 2 0 0\n 5.6753 -3.1855 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.3962 -2.7748 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1087 -3.1855 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.9051 -2.9340 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.3829 -3.6047 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.8884 -4.2753 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1087 -4.0154 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.3962 -4.4262 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.6753 -4.0154 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9627 -4.4262 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2250 -2.6490 0.0000 C 0 0 1 0 0 0 0 0 0 1 0 0\n 3.4370 -2.9340 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.9340 -2.2802 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3.4034 -1.5928 0.0000 C 0 0 2 0 0 0 0 0 0 2 0 0\n 2.6993 -1.2658 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.7161 -0.4359 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.0119 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.2909 -0.3940 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.5197 -0.1090 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 -0.7629 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.4610 -1.4502 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1.2658 -1.2156 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.9700 -1.6515 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 1 0 0 0\n 1 15 1 0 0 0 0\n 18 1 1 0 0 0 0\n 2 3 1 0 0 0 0\n 4 3 1 6 0 0 0\n 4 5 1 0 0 0 0\n 15 4 1 0 0 0 0\n 5 6 1 0 0 0 0\n 5 13 2 0 0 0 0\n 6 7 2 0 0 0 0\n 7 8 1 0 0 0 0\n 7 11 1 0 0 0 0\n 8 9 1 0 0 0 0\n 9 10 1 0 0 0 0\n 10 11 1 0 0 0 0\n 11 12 2 0 0 0 0\n 12 13 1 0 0 0 0\n 13 14 1 0 0 0 0\n 15 16 1 1 0 0 0\n 17 16 1 0 0 0 0\n 18 17 1 6 0 0 0\n 18 19 1 0 0 0 0\n 20 19 1 0 0 0 0\n 27 19 2 0 0 0 0\n 21 20 2 0 0 0 0\n 22 21 1 0 0 0 0\n 23 22 1 0 0 0 0\n 26 22 2 0 0 0 0\n 24 23 1 0 0 0 0\n 25 24 1 0 0 0 0\n 26 25 1 0 0 0 0\n 27 26 1 0 0 0 0\nM END", "smiles": "c1cc2c(cc1[C@@H]3[C@H]4CO[C@H](c5cc6c(cc5O)OCO6)[C@H]4CO3)OCO2", "formula": "C20H18O7", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "7ebb04ad-77c4-4676-a45b-afc065fbdba3" }, "defined_stereo": 4, "ez_centers": 0, "molecular_weight": "370.3535", "optical_activity": "UNSPECIFIED", "stereo_centers": 4 } ], "definition_level": "COMPLETE", "uuid": "26bdd36e-6dda-4676-bffa-a8dff0ea6923", "version": "10", "structure": { "id": "361a565e-1aed-4031-acb6-e937e6560443", "molfile": "\n Marvin 01132102532D \n\n 29 34 0 0 1 0 999 V2000\n 5.6753 -3.1855 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.3962 -2.7748 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1087 -3.1855 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.9051 -2.9340 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.3829 -3.6047 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.8884 -4.2753 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1087 -4.0154 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.3962 -4.4262 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.6753 -4.0154 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9627 -4.4262 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.9340 -2.2802 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3.4034 -1.5928 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 4.1914 -1.8275 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 4.9794 -1.5424 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.4824 -2.1963 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0130 -2.8837 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 4.2250 -2.6490 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 3.4370 -2.9340 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.9700 -1.6515 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.2658 -1.2156 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.4610 -1.4502 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 -0.7629 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.5197 -0.1090 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1.2909 -0.3940 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.0119 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.7161 -0.4359 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.6993 -1.2658 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.1831 -0.9976 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2166 -3.4705 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n 16 1 1 6 0 0 0\n 1 9 2 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 2 0 0 0 0\n 3 7 1 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 1 0 0 0 0\n 6 7 1 0 0 0 0\n 7 8 2 0 0 0 0\n 8 9 1 0 0 0 0\n 9 10 1 0 0 0 0\n 11 12 1 0 0 0 0\n 11 18 1 0 0 0 0\n 12 13 1 0 0 0 0\n 12 27 1 6 0 0 0\n 13 14 1 0 0 0 0\n 13 17 1 0 0 0 0\n 13 28 1 6 0 0 0\n 14 15 1 0 0 0 0\n 15 16 1 0 0 0 0\n 16 17 1 0 0 0 0\n 17 18 1 0 0 0 0\n 17 29 1 6 0 0 0\n 19 20 1 0 0 0 0\n 19 27 2 0 0 0 0\n 20 21 1 0 0 0 0\n 20 24 2 0 0 0 0\n 21 22 1 0 0 0 0\n 22 23 1 0 0 0 0\n 23 24 1 0 0 0 0\n 24 25 1 0 0 0 0\n 25 26 2 0 0 0 0\n 26 27 1 0 0 0 0\nM END", "smiles": "c1cc2c(cc1[C@@H]3[C@@]4([H])CO[C@H](c5cc6c(cc5O)OCO6)[C@@]4([H])CO3)OCO2", "formula": "C20H18O7", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "defined_stereo": 4, "ez_centers": 0, "molecular_weight": "370.3535", "optical_activity": "( + )", "references": [ "74a2592d-0bbc-4a33-b1dc-44780d58ec1c", "4cdbabc2-5b1b-4f64-8cc7-da44f4f58cf6" ], "stereo_centers": 4 }, "unii": "QTS6XJP5LC" } ] }