{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "75a51ccf-2fe3-44e7-ae1e-8007b405c063",
          "code": "203214",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/203214/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "9de3300c-79ab-4ac1-9428-ee3b00e3e3d3"
          ]
        },
        {
          "uuid": "ae25307b-1bde-49ed-a94d-e76cdfe68ace",
          "code": "m4361",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m4361?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "9de3300c-79ab-4ac1-9428-ee3b00e3e3d3"
          ]
        },
        {
          "uuid": "576cfdd7-5cac-4a2d-8b8f-3e553a9ec428",
          "code": "SUB01674MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "9de3300c-79ab-4ac1-9428-ee3b00e3e3d3"
          ]
        },
        {
          "uuid": "71603e53-6a94-4e6b-b783-f52fa6f712d4",
          "code": "CHEMBL139",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL139",
          "code_system": "ChEMBL",
          "references": [
            "9de3300c-79ab-4ac1-9428-ee3b00e3e3d3"
          ]
        },
        {
          "uuid": "6a5ec65a-5705-4822-98ee-d330b5a9254f",
          "code": "5018304",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/5018304",
          "code_system": "PUBCHEM",
          "references": [
            "9de3300c-79ab-4ac1-9428-ee3b00e3e3d3"
          ]
        },
        {
          "uuid": "ce16f880-0014-46e0-9bc5-9b5166713ac8",
          "code": "15307-79-6",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=15307-79-6",
          "code_system": "CAS",
          "references": [
            "9de3300c-79ab-4ac1-9428-ee3b00e3e3d3",
            "01beda45-bf04-49da-af99-56ba9b1dd756"
          ]
        },
        {
          "uuid": "df2f7c41-b823-4166-9973-77ffdf7bf925",
          "code": "C47984",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C47984",
          "code_system": "NCI_THESAURUS",
          "references": [
            "9de3300c-79ab-4ac1-9428-ee3b00e3e3d3"
          ]
        },
        {
          "uuid": "f31f5f4b-9f3b-4186-b52b-8483b7064fba",
          "code": "239-346-4",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.035.754",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "9de3300c-79ab-4ac1-9428-ee3b00e3e3d3"
          ]
        },
        {
          "uuid": "191a41cc-82b0-d0d4-15a9-ed68a20c5dd4",
          "code": "DTXSID3037208",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID3037208",
          "code_system": "EPA CompTox",
          "references": [
            "8ea43825-8b21-14a3-2ff8-299e065893c8"
          ]
        },
        {
          "uuid": "e6fb03cb-9422-8852-fdc5-e5933c5acf7d",
          "code": "C1323",
          "comments": "Pharmacologic Substance[C1909]|Agent Affecting Nervous System[C78272]|Analgesic Agent[C241]|Nonnarcotic Analgesic[C2198]|Analgesic and Antipyretic[C2356]|Nonsteroidal Antiinflammatory Drug[C257]|Cyclooxygenase Inhibitor",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C1323",
          "code_system": "NCI_THESAURUS",
          "references": [
            "53965eb8-a4b4-d236-cb43-780da8578d96"
          ]
        },
        {
          "uuid": "fb0d904c-5820-4e55-8fe3-d7de3e5123a9",
          "code": "QTG126297Q",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "90777bc4-0ae4-d143-ef22-e86fbfc3e6da",
          "code": "DBSALT000466",
          "type": "PRIMARY",
          "url": "https://go.drugbank.com/drugs/DBSALT000466",
          "code_system": "DRUG BANK",
          "references": [
            "53965eb8-a4b4-d236-cb43-780da8578d96"
          ]
        },
        {
          "uuid": "b9f8d901-14fa-f246-7b67-25a2d27eb087",
          "code": "4509",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:4509",
          "code_system": "CHEBI",
          "references": [
            "53965eb8-a4b4-d236-cb43-780da8578d96"
          ]
        },
        {
          "uuid": "04dc84fa-7fda-4426-70a7-7bdd7a80e2b7",
          "code": "1188800",
          "type": "PRIMARY",
          "url": "https://store.usp.org/product/1188800",
          "code_system": "RS_ITEM_NUM",
          "references": [
            "53965eb8-a4b4-d236-cb43-780da8578d96"
          ]
        },
        {
          "uuid": "545ca79d-948f-0cae-dc37-7ba815700eb3",
          "code": "100000092272",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "e345a9b1-06c8-7ade-a1e1-6440db36ffcc"
          ]
        },
        {
          "uuid": "16f6e5c5-5222-4502-9b3b-371034bf5474",
          "code": "QTG126297Q",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=QTG126297Q",
          "code_system": "DAILYMED",
          "references": [
            "f9a459c2-1740-7874-f151-211d82675abe"
          ]
        },
        {
          "uuid": "b1c62ce0-f87a-8fd0-3b4b-91ec4f941c69",
          "code": "756725",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=756725",
          "code_system": "NSC",
          "references": [
            "15c44207-f777-a966-1eb2-b7ed2a289fc1"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "194a5152-6c6e-4996-9878-13cb82248a11",
          "amount": {
            "uuid": "925929dc-7265-4299-8787-3ce4ad433570"
          },
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "991877e3-8ae9-44ef-9a1c-32fff6384d95",
            "refuuid": "a10ca419-e677-4cae-bd40-5150a9eeeabe",
            "name": "DICLOFENAC",
            "unii": "144O8QL0L1",
            "linking_id": "144O8QL0L1",
            "ref_pname": "DICLOFENAC",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "3e3b1956-0f1a-4a01-8a33-a85357170770",
          "amount": {
            "uuid": "0d4b3bd8-d8e4-414b-8e9d-2de00bf7c438"
          },
          "type": "PARENT->SALT/SOLVATE",
          "related_substance": {
            "uuid": "7ecee9e4-745c-4669-bee9-d71553edef4d",
            "refuuid": "a10ca419-e677-4cae-bd40-5150a9eeeabe",
            "name": "DICLOFENAC",
            "unii": "144O8QL0L1",
            "linking_id": "144O8QL0L1",
            "ref_pname": "DICLOFENAC",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "cc50d700-e5e3-4271-a625-ca9676be650b",
          "amount": {
            "uuid": "5ea24e6a-e141-454a-9f5f-0d65e935312f",
            "type": "RELATIONSHIP_AMOUNT",
            "units": "WEIGHT PERCENT",
            "high_limit": 101,
            "low_limit": 99
          },
          "qualification": "EP",
          "type": "BASIS OF STRENGTH->SUBSTANCE",
          "interaction_type": "ASSAY (TITRATION)",
          "references": [
            "d6464131-2698-4fe3-9fe2-555655049370"
          ],
          "related_substance": {
            "uuid": "d24cf78a-b196-49af-b3fb-08a1fbb27368",
            "refuuid": "4fd1e2a4-5291-41f6-b702-a38409a948ed",
            "name": "DICLOFENAC SODIUM",
            "unii": "QTG126297Q",
            "linking_id": "QTG126297Q",
            "ref_pname": "DICLOFENAC SODIUM",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "4b1196d2-5260-4434-9361-11d3bcbf2e6b",
          "amount": {
            "uuid": "e1f9d95e-e901-4113-8e9e-2ccad796fbfe",
            "type": "RELATIONSHIP_AMOUNT",
            "units": "WEIGHT PERCENT",
            "high_limit": 101,
            "low_limit": 99
          },
          "qualification": "USP",
          "type": "BASIS OF STRENGTH->SUBSTANCE",
          "interaction_type": "ASSAY (TITRATION)",
          "references": [
            "9c118794-f44f-4e1e-a92d-eb9ab4e88119"
          ],
          "related_substance": {
            "uuid": "8af72002-d129-46c8-af7c-7ee6ba5e934b",
            "refuuid": "4fd1e2a4-5291-41f6-b702-a38409a948ed",
            "name": "DICLOFENAC SODIUM",
            "unii": "QTG126297Q",
            "linking_id": "QTG126297Q",
            "ref_pname": "DICLOFENAC SODIUM",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "d83c5dcf-4b80-4995-b89e-dab7bf5cb08f",
          "amount": {
            "uuid": "ea0df6f1-c8c5-4f8d-9b9e-440e02b19429",
            "type": "RELATIONSHIP_AMOUNT",
            "units": "PERCENT PEAK AREA",
            "high_limit": 0.2
          },
          "qualification": "EP",
          "type": "IMPURITY->PARENT",
          "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)",
          "references": [
            "d6464131-2698-4fe3-9fe2-555655049370"
          ],
          "related_substance": {
            "uuid": "49ffa282-d924-4954-8dd3-226b28e157c1",
            "refuuid": "b823f50f-620a-4c5c-8064-dc94a607c753",
            "name": "1-(2,6-DICHLOROPHENYL)INDOLIN-2-ONE",
            "unii": "CL5Y02756K",
            "linking_id": "CL5Y02756K",
            "ref_pname": "1-(2,6-DICHLOROPHENYL)INDOLIN-2-ONE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "311f309d-2931-44cb-be25-5626ac758b59",
          "amount": {
            "uuid": "5058bf68-5f62-4ba2-bb16-6fe43454402a",
            "type": "RELATIONSHIP_AMOUNT",
            "units": "PERCENT PEAK AREA",
            "high_limit": 0.2
          },
          "qualification": "EP",
          "type": "IMPURITY->PARENT",
          "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)",
          "references": [
            "d6464131-2698-4fe3-9fe2-555655049370"
          ],
          "related_substance": {
            "uuid": "82195da0-01ea-4ce1-88a0-9f776a7b5f10",
            "refuuid": "0cb1826d-b1a7-4ca4-ac33-c6c13728dfe6",
            "name": "2-((2,6-DICHLOROPHENYL)AMINO)BENZALDEHYDE",
            "unii": "9218J5N522",
            "linking_id": "9218J5N522",
            "ref_pname": "2-((2,6-DICHLOROPHENYL)AMINO)BENZALDEHYDE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "019979f9-be98-493a-b07e-6df48718a3e6",
          "amount": {
            "uuid": "db3d72aa-91c8-4006-9b89-994724f331d6",
            "type": "RELATIONSHIP_AMOUNT",
            "units": "PERCENT PEAK AREA",
            "high_limit": 0.2
          },
          "qualification": "EP",
          "type": "IMPURITY->PARENT",
          "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)",
          "references": [
            "d6464131-2698-4fe3-9fe2-555655049370"
          ],
          "related_substance": {
            "uuid": "5a6cbf46-5eea-42b3-b26d-f1cf40c760c6",
            "refuuid": "69ea5221-8e42-4d83-91c5-1d9976897f77",
            "name": "(2-((2,6-DICHLOROPHENYL)AMINO)PHENYL)METHANOL",
            "unii": "N15K6R858V",
            "linking_id": "N15K6R858V",
            "ref_pname": "(2-((2,6-DICHLOROPHENYL)AMINO)PHENYL)METHANOL",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "5f378f1b-4d2d-42d0-8dfa-ac2b2e07fcf7",
          "amount": {
            "uuid": "322a349e-172d-4791-a816-883d967b0208",
            "type": "RELATIONSHIP_AMOUNT",
            "units": "PERCENT PEAK AREA",
            "high_limit": 0.2
          },
          "qualification": "EP",
          "type": "IMPURITY->PARENT",
          "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)",
          "references": [
            "d6464131-2698-4fe3-9fe2-555655049370"
          ],
          "related_substance": {
            "uuid": "ea285beb-5b13-44bc-96f9-1cc422bf4830",
            "refuuid": "2bd66a72-3a13-4b28-b1c9-0634d965e80e",
            "name": "2-[2-[(2-Bromo-6-chlorophenyl)amino]phenyl]acetic acid",
            "unii": "BM90YC1N04",
            "linking_id": "BM90YC1N04",
            "ref_pname": "2-[2-[(2-Bromo-6-chlorophenyl)amino]phenyl]acetic acid",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "c2fc3fd1-d530-4f89-b412-c4c7f835ea4e",
          "amount": {
            "uuid": "4d133872-b742-40c3-ae55-680da826c07e",
            "type": "RELATIONSHIP_AMOUNT",
            "units": "PERCENT PEAK AREA",
            "high_limit": 0.2
          },
          "qualification": "EP",
          "type": "IMPURITY->PARENT",
          "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)",
          "references": [
            "d6464131-2698-4fe3-9fe2-555655049370"
          ],
          "related_substance": {
            "uuid": "e34e3663-bcaf-4912-ab31-54f5c1fbefa8",
            "refuuid": "b4c1d05b-f412-4726-848f-db1a6bab2ce6",
            "name": "OXINDOLE",
            "unii": "0S9338U62H",
            "linking_id": "0S9338U62H",
            "ref_pname": "OXINDOLE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "ade630a1-20f5-4c03-8a5d-2265b20f2afd",
          "amount": {
            "uuid": "6b8f1276-38cf-4d27-81cc-949eacc8795d"
          },
          "qualification": "USP",
          "type": "IMPURITY->PARENT",
          "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)",
          "related_substance": {
            "uuid": "4ef26354-6769-441c-911b-436b7c17aa79",
            "refuuid": "b823f50f-620a-4c5c-8064-dc94a607c753",
            "name": "1-(2,6-DICHLOROPHENYL)INDOLIN-2-ONE",
            "unii": "CL5Y02756K",
            "linking_id": "CL5Y02756K",
            "ref_pname": "1-(2,6-DICHLOROPHENYL)INDOLIN-2-ONE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "96809d4a-af74-4f3d-875d-ad30ebfca02e",
          "amount": {
            "uuid": "b68b5c8b-f3a1-48e6-84a5-b9fa5e95c7dc"
          },
          "type": "IMPURITY->PARENT",
          "references": [
            "996a35e5-2750-4e70-bc28-63b43c8d374a"
          ],
          "related_substance": {
            "uuid": "191fd4ce-87b6-4f7a-bf16-50429edd397e",
            "refuuid": "e032e6a2-d9fa-4fa4-b793-917cd3b8c118",
            "name": "N-nitroso-diclofenac",
            "unii": "3J6RXA3F5D",
            "linking_id": "3J6RXA3F5D",
            "ref_pname": "N-nitroso-diclofenac",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "ea5d86e1-ed3c-427d-9867-72038d9631aa",
          "name": "ABITREN",
          "stdName": "ABITREN",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "42cf9212-37be-450c-ba41-36e163ed5140"
          ],
          "display_name": false
        },
        {
          "uuid": "68e6ac64-3e9d-457a-a081-59f0656782e1",
          "name": "ARTHROTEC COMPONENT DICLOFENAC SODIUM",
          "stdName": "ARTHROTEC COMPONENT DICLOFENAC SODIUM",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8e91104f-0794-4a52-9251-a27c0c927c37"
          ],
          "display_name": false
        },
        {
          "uuid": "4702f606-7c54-460a-ac68-683c23aebb5a",
          "name": "BENFOFEN",
          "stdName": "BENFOFEN",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "244facbe-97cf-4a22-bd56-4b17c64227ee"
          ],
          "display_name": false
        },
        {
          "uuid": "72c7a15c-509b-428d-8035-c6c372b94871",
          "name": "BENZENEACETIC ACID, 2-((2,6-DICHLOROPHENYL)AMINO)-, MONOSODIUM SALT",
          "stdName": "BENZENEACETIC ACID, 2-((2,6-DICHLOROPHENYL)AMINO)-, MONOSODIUM SALT",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "00e55be4-87b4-4312-be6f-3b7ae2cf6345"
          ],
          "display_name": false
        },
        {
          "uuid": "df115a26-3514-41f1-a1ca-fca128d4fb95",
          "name": "DEALGIC",
          "stdName": "DEALGIC",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "244facbe-97cf-4a22-bd56-4b17c64227ee"
          ],
          "display_name": false
        },
        {
          "uuid": "058001ba-4b19-4afb-a111-3e5d69cdcb85",
          "name": "DEFLAMAT",
          "stdName": "DEFLAMAT",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "244facbe-97cf-4a22-bd56-4b17c64227ee"
          ],
          "display_name": false
        },
        {
          "uuid": "a0cb9a03-8735-403d-8c10-679f0f1c5d98",
          "name": "DELPHINAC",
          "stdName": "DELPHINAC",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "244facbe-97cf-4a22-bd56-4b17c64227ee"
          ],
          "display_name": false
        },
        {
          "uuid": "fa0a29f6-5748-440c-979f-77dc4ae162a0",
          "name": "DICLOFENAC SODIUM",
          "stdName": "DICLOFENAC SODIUM",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e6122cf2-f1cf-41d1-a8e2-8c8574540b6d",
            "e2c51d2f-7073-480c-bffb-e2789d9eb53e",
            "38f63f1f-f4b0-4ae4-b681-5bf10809abf4",
            "8948eb50-737f-4714-a254-20d5e18893d1",
            "e090e0f7-67d2-4e85-9575-b727a52383f8",
            "7751e0b9-666c-49f0-b049-8613a8379b86",
            "207ab257-75a3-4f85-893c-1d8a8f7daaf6",
            "4650ea4b-c5ad-45d6-bba9-c42227181d9b",
            "3784824e-c632-45e3-aa33-3a3ba116e4b2",
            "b584a14f-e05f-4ed5-8d1b-580104a9597e",
            "0944df96-0c90-4bde-9fd5-11d24c2129da",
            "4f621c09-f087-45c1-9f1b-231a747b1105",
            "de38e368-554d-4385-84d5-f1d60190b0a6",
            "cded08d5-c0e4-4a54-97ec-9ad16826959a",
            "dfcf54e5-4963-4a22-a0a1-31924e1c1f36",
            "24eb7d30-ad09-4002-9afa-37a9b94e5ad9",
            "ef7909bf-f3de-4055-bc76-4a55639683ae",
            "7d240386-4533-4ce8-b57c-bbced1476a4a",
            "e743c1f9-14cf-436f-bb8a-3341d77eba5a"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "b4ba992b-416f-4f71-80ed-73ec232801bf",
              "name_org": "USAN"
            }
          ]
        },
        {
          "uuid": "11dce272-b625-4388-9a70-be7a534bab0c",
          "name": "DICLOFENAC SODIUM SALT",
          "stdName": "DICLOFENAC SODIUM SALT",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "244facbe-97cf-4a22-bd56-4b17c64227ee",
            "55ee824f-d85b-4d72-ad2b-b99f1ea13dbe"
          ],
          "display_name": false
        },
        {
          "uuid": "4477b89d-3a0c-4e06-aaf4-0f3f04cd44d7",
          "name": "DICLOFENAC SODIUM SALT [MI]",
          "stdName": "DICLOFENAC SODIUM SALT [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "244facbe-97cf-4a22-bd56-4b17c64227ee"
          ],
          "display_name": false
        },
        {
          "uuid": "01afba12-ed75-a617-bd5d-dea9fb1ccbf4",
          "name": "DICLOFENAC SODIUM [EP MONOGRAPH]",
          "stdName": "DICLOFENAC SODIUM [EP MONOGRAPH]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4d8a0505-0655-52a4-0353-ce87043c641e"
          ],
          "display_name": false
        },
        {
          "uuid": "7ef49870-e5e1-473c-9017-ccc8ac0ddecf",
          "name": "DICLOFENAC SODIUM [GREEN BOOK]",
          "stdName": "DICLOFENAC SODIUM [GREEN BOOK]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "24eb7d30-ad09-4002-9afa-37a9b94e5ad9"
          ],
          "display_name": false
        },
        {
          "uuid": "252c2803-6601-4f5f-9456-279ab3fa12fa",
          "name": "DICLOFENAC SODIUM [JAN]",
          "stdName": "DICLOFENAC SODIUM [JAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c425a125-2670-b889-c250-71c6876a0d24"
          ],
          "display_name": false
        },
        {
          "uuid": "c7537070-f685-4419-a793-ed10b008156d",
          "name": "DICLOFENAC SODIUM [MART.]",
          "stdName": "DICLOFENAC SODIUM [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3784824e-c632-45e3-aa33-3a3ba116e4b2"
          ],
          "display_name": false
        },
        {
          "uuid": "c2cdfd8b-d56d-471e-aa2b-16fc958ec39a",
          "name": "DICLOFENAC SODIUM [ORANGE BOOK]",
          "stdName": "DICLOFENAC SODIUM [ORANGE BOOK]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "de38e368-554d-4385-84d5-f1d60190b0a6"
          ],
          "display_name": false
        },
        {
          "uuid": "23082d5f-2497-4d6a-ace8-d6cf432a4b57",
          "name": "DICLOFENAC SODIUM [USAN]",
          "stdName": "DICLOFENAC SODIUM [USAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4f621c09-f087-45c1-9f1b-231a747b1105"
          ],
          "display_name": false
        },
        {
          "uuid": "6663760b-b3b6-4843-ae25-9b7a9bc3ef85",
          "name": "DICLOFENAC SODIUM [USP MONOGRAPH]",
          "stdName": "DICLOFENAC SODIUM [USP MONOGRAPH]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4f9d0de2-33b3-6ab3-a9d0-b5f8309f4a0b"
          ],
          "display_name": false
        },
        {
          "uuid": "bbc75590-14b1-464f-b862-a66902b71da6",
          "name": "DICLOFENAC SODIUM [USP-RS]",
          "stdName": "DICLOFENAC SODIUM [USP-RS]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e2c51d2f-7073-480c-bffb-e2789d9eb53e"
          ],
          "display_name": false
        },
        {
          "uuid": "bd38d95a-43fa-4490-b0e4-fc30d0d8f59f",
          "name": "DICLOFENAC SODIUM [VANDF]",
          "stdName": "DICLOFENAC SODIUM [VANDF]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "38f63f1f-f4b0-4ae4-b681-5bf10809abf4"
          ],
          "display_name": false
        },
        {
          "uuid": "0a437ee1-f2fc-4a91-a8e0-b3fcfa34df29",
          "name": "DICLOFLEX",
          "stdName": "DICLOFLEX",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "244facbe-97cf-4a22-bd56-4b17c64227ee"
          ],
          "display_name": false
        },
        {
          "uuid": "340ec6ee-a0a9-43fe-8b83-660625ee1532",
          "name": "DICLOMAX",
          "stdName": "DICLOMAX",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "244facbe-97cf-4a22-bd56-4b17c64227ee"
          ],
          "display_name": false
        },
        {
          "uuid": "75da5d63-ff41-4c69-aa27-6087c818a3e4",
          "name": "DICLOPHENAC SODIUM",
          "stdName": "DICLOPHENAC SODIUM",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0768a370-96c3-42ce-a06b-8dd3c95dfd7e"
          ],
          "display_name": false
        },
        {
          "uuid": "dedbef30-94f9-4587-b4e5-3c8bb437fed9",
          "name": "DICLOPHLOGONT",
          "stdName": "DICLOPHLOGONT",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "244facbe-97cf-4a22-bd56-4b17c64227ee"
          ],
          "display_name": false
        },
        {
          "uuid": "9f134e32-d65f-4463-bc82-77e48c9aff4d",
          "name": "DICLOREUM",
          "stdName": "DICLOREUM",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "244facbe-97cf-4a22-bd56-4b17c64227ee"
          ],
          "display_name": false
        },
        {
          "uuid": "de117372-8a5f-4da5-a0ac-a7f051265837",
          "name": "DURAVOLTEN",
          "stdName": "DURAVOLTEN",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "244facbe-97cf-4a22-bd56-4b17c64227ee"
          ],
          "display_name": false
        },
        {
          "uuid": "893bca51-eb82-4fea-a00a-58eff9253f02",
          "name": "DYLOJECT",
          "stdName": "DYLOJECT",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "43d04b4a-769c-4541-8347-4750916d8436"
          ],
          "display_name": false
        },
        {
          "uuid": "6b9966b6-5fc4-7629-b4c8-59a8f0ffad3d",
          "name": "Diclofenac sodium [WHO-DD]",
          "stdName": "DICLOFENAC SODIUM [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4b074dae-e718-b3c7-c463-0f5ebbf455f3"
          ],
          "display_name": false
        },
        {
          "uuid": "0c2fab00-ac96-4f14-bb47-82b6d62169fb",
          "name": "ECOFENAC",
          "stdName": "ECOFENAC",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "244facbe-97cf-4a22-bd56-4b17c64227ee"
          ],
          "display_name": false
        },
        {
          "uuid": "81800eb4-2c32-4c41-b182-4f780573d183",
          "name": "EFFEKTON",
          "stdName": "EFFEKTON",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "244facbe-97cf-4a22-bd56-4b17c64227ee"
          ],
          "display_name": false
        },
        {
          "uuid": "358b837e-ea1b-44ab-9eae-ddbf9e6efdd7",
          "name": "GP 45840",
          "stdName": "GP 45840",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f4d23bae-cd8a-43b4-bb4f-9d4565715f8c"
          ],
          "display_name": false
        },
        {
          "uuid": "a4868ab2-65b7-4fa1-96db-bc0132e03ba4",
          "name": "GP-45840",
          "stdName": "GP-45840",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c4f159e1-e9ae-472c-8298-e7d6dccf1e4b"
          ],
          "display_name": false
        },
        {
          "uuid": "41edfb12-96ca-4f2a-91c9-91deadb5c036",
          "name": "LEXOBENE",
          "stdName": "LEXOBENE",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "244facbe-97cf-4a22-bd56-4b17c64227ee"
          ],
          "display_name": false
        },
        {
          "uuid": "9788621e-71a4-4d79-922a-fa85e98264cf",
          "name": "NERIODIN",
          "stdName": "NERIODIN",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "244facbe-97cf-4a22-bd56-4b17c64227ee"
          ],
          "display_name": false
        },
        {
          "uuid": "00bc4d03-191e-4d0d-893c-3662982da009",
          "name": "NOVAPIRINA",
          "stdName": "NOVAPIRINA",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "244facbe-97cf-4a22-bd56-4b17c64227ee"
          ],
          "display_name": false
        },
        {
          "uuid": "d623fedf-823f-d06f-804b-67faa2bebc87",
          "name": "NSC-756725",
          "stdName": "NSC-756725",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "15c44207-f777-a966-1eb2-b7ed2a289fc1"
          ],
          "display_name": false
        },
        {
          "uuid": "d4bf6e83-0b97-48f2-97c0-14ffe48c3089",
          "name": "PENNSAID",
          "stdName": "PENNSAID",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "21fff7b8-e8e6-440d-ac6f-e18f77357916"
          ],
          "display_name": false
        },
        {
          "uuid": "aba02a6a-a6b4-4b22-850c-2a2b45ff8894",
          "name": "PRIMOFENAC",
          "stdName": "PRIMOFENAC",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "244facbe-97cf-4a22-bd56-4b17c64227ee"
          ],
          "display_name": false
        },
        {
          "uuid": "cf61c6a8-43b4-4e4b-8f7d-a2036a8ab978",
          "name": "PROPHENATIN",
          "stdName": "PROPHENATIN",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "244facbe-97cf-4a22-bd56-4b17c64227ee"
          ],
          "display_name": false
        },
        {
          "uuid": "9fceb6e3-5e04-46a4-b182-5d58753b09af",
          "name": "REWODINA",
          "stdName": "REWODINA",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "244facbe-97cf-4a22-bd56-4b17c64227ee"
          ],
          "display_name": false
        },
        {
          "uuid": "dfff8099-d1bc-433b-b3e1-246bee115709",
          "name": "RHUMALGAN",
          "stdName": "RHUMALGAN",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "244facbe-97cf-4a22-bd56-4b17c64227ee"
          ],
          "display_name": false
        },
        {
          "uuid": "65e1c376-2536-4748-9dfa-67a56ac37cd2",
          "name": "SODIUM DICLOFENAC",
          "stdName": "SODIUM DICLOFENAC",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "55870c67-c61b-4c56-a29e-d5023173ef78"
          ],
          "display_name": false
        },
        {
          "uuid": "1c6f151d-5279-45ff-b7cc-3869b7d8190e",
          "name": "SOLARAZE",
          "stdName": "SOLARAZE",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e090e0f7-67d2-4e85-9575-b727a52383f8"
          ],
          "display_name": false
        },
        {
          "uuid": "72282273-b5a0-4ad3-b4ed-0b32e4c862f5",
          "name": "Sodium [O-(2,6-dichloroanilino)phenyl]acetate",
          "stdName": "SODIUM (O-(2,6-DICHLOROANILINO)PHENYL)ACETATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "00e55be4-87b4-4312-be6f-3b7ae2cf6345"
          ],
          "display_name": false
        },
        {
          "uuid": "bfe8c79d-115e-41ce-b757-dd8b5ccc1076",
          "name": "VOLDAL",
          "stdName": "VOLDAL",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "244facbe-97cf-4a22-bd56-4b17c64227ee"
          ],
          "display_name": false
        },
        {
          "uuid": "1b912bf1-7991-43b4-bdfb-57d116d05758",
          "name": "VOLTAREN",
          "stdName": "VOLTAREN",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e090e0f7-67d2-4e85-9575-b727a52383f8"
          ],
          "display_name": false
        },
        {
          "uuid": "71e818a5-cd39-43e9-bd06-f588335fc421",
          "name": "XENID",
          "stdName": "XENID",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "244facbe-97cf-4a22-bd56-4b17c64227ee"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "e090e0f7-67d2-4e85-9575-b727a52383f8",
          "citation": "USP Dictionary 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "c4f159e1-e9ae-472c-8298-e7d6dccf1e4b",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "00e55be4-87b4-4312-be6f-3b7ae2cf6345",
          "citation": "USP DICTIONARY 2008",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "21fff7b8-e8e6-440d-ac6f-e18f77357916",
          "citation": "ORANGE BOOK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4f621c09-f087-45c1-9f1b-231a747b1105",
          "citation": "USP DICTIONARY 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "dc7685c2-5659-49fc-b13f-fe98a560630d",
          "citation": "http://dailymed.nlm.nih.gov/dailymed/drugInfo.cfm?id=34611",
          "url": "http://dailymed.nlm.nih.gov/dailymed/drugInfo.cfm?id=34611",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "cded08d5-c0e4-4a54-97ec-9ad16826959a",
          "citation": "EP 7.2",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7751e0b9-666c-49f0-b049-8613a8379b86",
          "citation": "USP 33",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8e91104f-0794-4a52-9251-a27c0c927c37",
          "citation": "DAILYMED",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "de38e368-554d-4385-84d5-f1d60190b0a6",
          "citation": "ORANGE BOOK 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3784824e-c632-45e3-aa33-3a3ba116e4b2",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "24eb7d30-ad09-4002-9afa-37a9b94e5ad9",
          "citation": "FDA SRS 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e2c51d2f-7073-480c-bffb-e2789d9eb53e",
          "citation": "USP/NF",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e743c1f9-14cf-436f-bb8a-3341d77eba5a",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "38f63f1f-f4b0-4ae4-b681-5bf10809abf4",
          "citation": "NDF-RT",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "42cf9212-37be-450c-ba41-36e163ed5140",
          "citation": "http://www.drugs.com/international/abitren.html",
          "url": "http://www.drugs.com/international/abitren.html",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "55870c67-c61b-4c56-a29e-d5023173ef78",
          "citation": "DMF",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "244facbe-97cf-4a22-bd56-4b17c64227ee",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0768a370-96c3-42ce-a06b-8dd3c95dfd7e",
          "citation": "EVMPD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "43d04b4a-769c-4541-8347-4750916d8436",
          "citation": "http://www.accessdata.fda.gov/scripts/cder/drugsatfda/index.cfm?fuseaction=Search.Label_ApprovalHist",
          "url": "http://www.accessdata.fda.gov/scripts/cder/drugsatfda/index.cfm?fuseaction=Search.Label_ApprovalHist",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f4d23bae-cd8a-43b4-bb4f-9d4565715f8c",
          "citation": "USP DICTIONARY",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9de3300c-79ab-4ac1-9428-ee3b00e3e3d3",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389735000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d6464131-2698-4fe3-9fe2-555655049370",
          "citation": "EP 7.8 DICLOFENAC SODIUM MONOGRAPH",
          "doc_type": "EUROPEAN PHARMACOPEIA",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9c118794-f44f-4e1e-a92d-eb9ab4e88119",
          "citation": "USP 35 DICLOFENAC SODIUM MONOGRAPH",
          "doc_type": "USP",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b80857ed-8880-43ef-86a2-8ac2f9aff2cd",
          "citation": "SRS import [QTG126297Q]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=QTG126297Q",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389735000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8948eb50-737f-4714-a254-20d5e18893d1",
          "citation": "DICLOFENAC SODIUM [USAN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "0944df96-0c90-4bde-9fd5-11d24c2129da",
          "citation": "DICLOFENAC SODIUM [EP]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "ef7909bf-f3de-4055-bc76-4a55639683ae",
          "citation": "DICLOFENAC SODIUM [USP]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "dfcf54e5-4963-4a22-a0a1-31924e1c1f36",
          "citation": "DICLOFENAC SODIUM [ORANGE BOOK]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "7d240386-4533-4ce8-b57c-bbced1476a4a",
          "citation": "DICLOFENAC SODIUM [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "e6122cf2-f1cf-41d1-a8e2-8c8574540b6d",
          "citation": "DICLOFENAC SODIUM [GREEN BOOK]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "207ab257-75a3-4f85-893c-1d8a8f7daaf6",
          "citation": "DICLOFENAC SODIUM [USP-RS]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "4650ea4b-c5ad-45d6-bba9-c42227181d9b",
          "citation": "DICLOFENAC SODIUM [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "b584a14f-e05f-4ed5-8d1b-580104a9597e",
          "citation": "DICLOFENAC SODIUM [VANDF]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "55ee824f-d85b-4d72-ad2b-b99f1ea13dbe",
          "citation": "DICLOFENAC SODIUM SALT [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "c425a125-2670-b889-c250-71c6876a0d24",
          "citation": "JAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "8ea43825-8b21-14a3-2ff8-299e065893c8",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=15307-79-6",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "53965eb8-a4b4-d236-cb43-780da8578d96",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "01beda45-bf04-49da-af99-56ba9b1dd756",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "ac3f6d37-58d6-b1ca-f1db-f31fa6ea8d07",
          "citation": "USP43-NF38 - 1347, Diclofenac Sodium Monograph",
          "doc_type": "USPNF",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "4f9d0de2-33b3-6ab3-a9d0-b5f8309f4a0b",
          "citation": "USP 10/2020",
          "doc_type": "USPNF",
          "public_domain": true
        },
        {
          "uuid": "4d8a0505-0655-52a4-0353-ce87043c641e",
          "citation": "EP 10.5",
          "doc_type": "EP",
          "public_domain": true
        },
        {
          "uuid": "15c44207-f777-a966-1eb2-b7ed2a289fc1",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "f9a459c2-1740-7874-f151-211d82675abe",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "4b074dae-e718-b3c7-c463-0f5ebbf455f3",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "e345a9b1-06c8-7ade-a1e1-6440db36ffcc",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "996a35e5-2750-4e70-bc28-63b43c8d374a",
          "citation": "Updated Information | Recommended Acceptable Intake Limits for Nitrosamine Drug Substance-Related Impurities (NDSRIs); Table 1",
          "url": "https://www.fda.gov/regulatory-information/search-fda-guidance-documents/updated-information-recommended-acceptable-intake-limits-nitrosamine-drug-substance-related",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "5ffb8ad7-bb8a-4ce0-b9a4-665903bb9acd",
          "citation": "Updated Information | Recommended Acceptable Intake Limits for Nitrosamine Drug Substance-Related Impurities (NDSRIs); Table 1",
          "url": "https://www.fda.gov/regulatory-information/search-fda-guidance-documents/updated-information-recommended-acceptable-intake-limits-nitrosamine-drug-substance-related",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "e5e622d2-6a91-4087-8029-590d4b741214",
          "id": "e5e622d2-6a91-4087-8029-590d4b741214",
          "molfile": "\n  Marvin  01132111542D          \n\n  1  0  0  0  0  0            999 V2000\n    6.0217   -2.0381    0.0000 Na  0  3  0  0  0  0  0  0  0  0  0  0\nM  CHG  1   1   1\nM  END",
          "smiles": "[Na+]",
          "formula": "Na",
          "atropisomerism": "No",
          "charge": 1,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "f805b105-62fe-427e-978a-0ad9e814d447"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "22.9898",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "642943a4-fc25-45fd-a869-52c047587e67",
          "id": "642943a4-fc25-45fd-a869-52c047587e67",
          "molfile": "\n  Marvin  01132105122D          \n\n 19 20  0  0  0  0            999 V2000\n    5.3355   -2.1203    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    4.9269   -1.4136    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3304   -0.7042    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1019   -1.4136    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6881   -2.1203    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1122   -2.8297    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6881   -3.5467    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8631   -3.5493    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4750   -2.8297    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8631   -2.1203    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4750   -1.4136    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6423   -1.4213    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.2336   -0.7196    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6295    0.0000    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    0.4086   -0.7196    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -1.4213    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.4086   -2.1383    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.2362   -2.1383    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6500   -2.8297    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  3  2  2  0  0  0  0\n  2  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  6  5  1  0  0  0  0\n  5 10  2  0  0  0  0\n  6  7  2  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  2  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 12 11  1  0  0  0  0\n 13 12  1  0  0  0  0\n 18 12  2  0  0  0  0\n 14 13  1  0  0  0  0\n 15 13  2  0  0  0  0\n 16 15  1  0  0  0  0\n 16 17  2  0  0  0  0\n 17 18  1  0  0  0  0\n 19 18  1  0  0  0  0\nM  CHG  1   1  -1\nM  END",
          "smiles": "c1ccc(c(c1)CC(=O)[O-])Nc2c(cccc2Cl)Cl",
          "formula": "C14H10Cl2NO2",
          "atropisomerism": "No",
          "charge": -1,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "b62ea262-2cbb-421e-8eaa-2dae96a91c2a"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "295.1411",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "4fd1e2a4-5291-41f6-b702-a38409a948ed",
      "version": "65",
      "structure": {
        "id": "918b698b-3705-4d64-9164-d7ab5812086e",
        "molfile": "\n  Marvin  01132107332D          \n\n 20 20  0  0  0  0            999 V2000\n   14.6585   -3.6908    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   13.8257   -3.6984    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.0465   -4.3975    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.1103   -3.6908    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.8715   -4.3975    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.4171   -2.9968    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.4197   -4.4155    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.2853   -3.6908    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.5190   -4.3975    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n   17.5138   -2.9814    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   13.8335   -5.1068    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n   13.8129   -2.2771    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n   12.1835   -3.6984    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.6585   -5.1068    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.5921   -4.4155    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.5921   -2.9968    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.2956   -5.1068    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.8715   -5.8239    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.0465   -5.8265    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   18.2052   -4.3153    0.0000 Na  0  3  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  1  1  0  0  0  0\n  4  8  1  0  0  0  0\n  5  3  2  0  0  0  0\n  6  2  2  0  0  0  0\n  7  2  1  0  0  0  0\n  8  5  1  0  0  0  0\n  9  4  1  0  0  0  0\n 10  4  2  0  0  0  0\n 11  7  1  0  0  0  0\n 12  6  1  0  0  0  0\n 13 15  1  0  0  0  0\n 14  3  1  0  0  0  0\n 15  7  2  0  0  0  0\n 16  6  1  0  0  0  0\n 17  5  1  0  0  0  0\n 18 19  1  0  0  0  0\n 19 14  2  0  0  0  0\n 13 16  2  0  0  0  0\n 17 18  2  0  0  0  0\nM  CHG  2   9  -1  20   1\nM  END",
        "smiles": "c1ccc(c(c1)CC(=O)[O-])Nc2c(cccc2Cl)Cl.[Na+]",
        "formula": "C14H10Cl2NO2.Na",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "318.1309",
        "optical_activity": "NONE",
        "references": [
          "b80857ed-8880-43ef-86a2-8ac2f9aff2cd",
          "e090e0f7-67d2-4e85-9575-b727a52383f8"
        ],
        "stereo_centers": 0
      },
      "unii": "QTG126297Q"
    }
  ]
}