{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "bd84c917-6bc7-4d7e-a70c-b3b374bd5622", "code": "PiHKAL", "comments": "Wikipedia|PiHKAL|Phenethylamines", "type": "CONCEPT", "url": "https://en.wikipedia.org/wiki/PiHKAL", "code_system": "WIKIPEDIA" }, { "uuid": "f4fb79f3-9b6d-4661-b332-a2fbaca4392c", "code": "F-22 (psychedelic)", "type": "PRIMARY", "url": "https://en.wikipedia.org/wiki/F-22_(psychedelic)", "code_system": "WIKIPEDIA" }, { "uuid": "c709d451-ca4a-48dc-8d94-42c93c948406", "code": "16051705", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/16051705", "code_system": "PUBCHEM" }, { "uuid": "f9ba1ea9-da69-41d4-a08f-4f8edbe62577", "code": "952016-51-2", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=952016-51-2", "code_system": "CAS", "references": [ "276b1ea5-55e3-4abf-9e26-a0633c711d95", "4f29eac2-9892-4d27-9aec-9cbc4af357c1" ] }, { "uuid": "5bbef505-f350-0ec8-0344-5b92454162ec", "code": "DTXSID50581591", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID50581591", "code_system": "EPA CompTox" }, { "uuid": "e75eeddf-2358-4346-97c5-fa359d447eb4", "code": "QS9HMZ85HN", "type": "PRIMARY", "code_system": "FDA UNII" } ], "substance_class": "chemical", "references": [ { "uuid": "276b1ea5-55e3-4abf-9e26-a0633c711d95", "citation": "https://en.wikipedia.org/wiki/F-22_(psychedelic)", "doc_type": "WIKI", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "4f29eac2-9892-4d27-9aec-9cbc4af357c1", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "d724b4a6-f475-4df8-b013-01315b109d73", "id": "d724b4a6-f475-4df8-b013-01315b109d73", "molfile": "\n Marvin 01132111092D \n\n 17 18 0 0 0 0 999 V2000\n 0.0532 0.8735 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7677 0.4610 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7677 -0.3640 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0532 -0.7765 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.6612 -0.3640 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.6612 0.4610 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.3757 0.8735 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.0902 0.4610 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.0902 -0.3640 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.8046 0.8735 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n -1.3757 -0.7765 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -1.3757 -1.6015 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.5523 -0.6189 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.0373 0.0485 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.5523 0.7160 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8254 0.2923 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8254 -0.1953 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 2 0 0 0 0\n 1 6 1 0 0 0 0\n 2 3 1 0 0 0 0\n 2 15 1 0 0 0 0\n 3 4 2 0 0 0 0\n 3 13 1 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 2 0 0 0 0\n 5 11 1 0 0 0 0\n 6 7 1 0 0 0 0\n 7 8 1 0 0 0 0\n 8 9 1 0 0 0 0\n 8 10 1 0 0 0 0\n 11 12 1 0 0 0 0\n 13 14 1 0 0 0 0\n 14 15 1 0 0 0 0\n 14 16 1 0 0 0 0\n 14 17 1 0 0 0 0\nM END", "smiles": "CC(Cc1cc2c(cc1OC)CC(C)(C)O2)N", "formula": "C14H21NO2", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "RACEMIC", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "19d99b4d-ab32-432d-aa12-8895ed1a74f4" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "235.3226", "optical_activity": "( + / - )", "stereo_centers": 1 } ], "definition_level": "COMPLETE", "uuid": "e7dc260f-1fcd-49a9-9540-f7ee1ecb130d", "version": "11", "structure": { "id": "0aaa2f49-f72b-4cc6-8f4b-7e5bc3cd9f0a", "molfile": "\n Marvin 01132100482D \n\n 17 18 0 0 0 0 999 V2000\n 10.8503 -2.8325 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.5648 -3.2450 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.5648 -4.0700 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.8503 -4.4825 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.1359 -4.0700 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.1359 -3.2450 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.4214 -2.8325 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.7069 -3.2450 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.7069 -4.0700 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.9925 -2.8325 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 9.4214 -4.4825 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.4214 -5.3075 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.3494 -4.3249 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.8344 -3.6575 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.3494 -2.9900 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 13.6225 -3.4137 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.6225 -3.9013 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 2 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 2 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 2 0 0 0 0\n 1 6 1 0 0 0 0\n 6 7 1 0 0 0 0\n 7 8 1 0 0 0 0\n 8 9 1 0 0 0 0\n 8 10 1 0 0 0 0\n 5 11 1 0 0 0 0\n 11 12 1 0 0 0 0\n 3 13 1 0 0 0 0\n 13 14 1 0 0 0 0\n 14 15 1 0 0 0 0\n 2 15 1 0 0 0 0\n 14 16 1 0 0 0 0\n 14 17 1 0 0 0 0\nM END", "smiles": "CC(Cc1cc2c(cc1OC)CC(C)(C)O2)N", "formula": "C14H21NO2", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "RACEMIC", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "235.3226", "optical_activity": "( + / - )", "references": [ "276b1ea5-55e3-4abf-9e26-a0633c711d95", "4f29eac2-9892-4d27-9aec-9cbc4af357c1" ], "stereo_centers": 1 }, "unii": "QS9HMZ85HN", "relationships": [ { "uuid": "1cd15b50-a5e0-4f6f-9585-390b0f4e5f87", "amount": { "uuid": "cbb31431-da59-4322-bc65-a42ba3bf512b" }, "type": "ACTIVE MOIETY", "references": [ "276b1ea5-55e3-4abf-9e26-a0633c711d95" ], "related_substance": { "uuid": "ef1fa879-ddff-428d-8fa9-18d66b108f88", "refuuid": "e7dc260f-1fcd-49a9-9540-f7ee1ecb130d", "name": "F-22", "unii": "QS9HMZ85HN", "linking_id": "QS9HMZ85HN", "ref_pname": "F-22", "substance_class": "reference" } } ], "names": [ { "uuid": "b854e274-0892-4ff7-ae28-2b9bb04b1f7a", "name": "2,3-DIHYDRO-5-METHOXY-.ALPHA.,2,2-TRIMETHYL-6-BENZOFURANETHANAMINE", "stdName": "2,3-DIHYDRO-5-METHOXY-.ALPHA.,2,2-TRIMETHYL-6-BENZOFURANETHANAMINE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "4f29eac2-9892-4d27-9aec-9cbc4af357c1" ], "display_name": false }, { "uuid": "381f6df1-2adc-459b-b23f-e3374d20babd", "name": "6-BENZOFURANETHANAMINE, 2,3-DIHYDRO-5-METHOXY-.ALPHA.,2,2-TRIMETHYL-", "stdName": "6-BENZOFURANETHANAMINE, 2,3-DIHYDRO-5-METHOXY-.ALPHA.,2,2-TRIMETHYL-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "4f29eac2-9892-4d27-9aec-9cbc4af357c1" ], "display_name": false }, { "uuid": "7d721ff1-83c7-4f0c-a080-b056ae91124d", "name": "F-22", "stdName": "F-22", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "276b1ea5-55e3-4abf-9e26-a0633c711d95" ], "display_name": true }, { "uuid": "fa156486-1be1-4b4b-a985-d5f61bd91fd2", "name": "F-22 (PSYCHEDELIC)", "stdName": "F-22 (PSYCHEDELIC)", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "276b1ea5-55e3-4abf-9e26-a0633c711d95" ], "display_name": false } ], "modifications": { "uuid": "3130b67b-1039-4f90-b565-03919195a65b" } } ] }