{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "41ec02fa-2f7c-4b8a-90d2-493607758fb2", "code": "644-26-8", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=644-26-8", "code_system": "CAS", "references": [ "2b9561bd-b03d-4b6c-b8d7-a43f6570de99", "c0081509-20a2-4b57-a374-6f03aef50132" ] }, { "uuid": "e67f59d3-c031-4a29-9b2a-80583c4c5688", "code": "C72170", "type": "PRIMARY", "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C72170", "code_system": "NCI_THESAURUS", "references": [ "2b9561bd-b03d-4b6c-b8d7-a43f6570de99" ] }, { "uuid": "4f5a7007-27d7-4925-bd3c-eda5d8bb0696", "code": "C015677", "type": "PRIMARY", "url": "http://www.ncbi.nlm.nih.gov/mesh/67015677", "code_system": "MESH", "references": [ "2b9561bd-b03d-4b6c-b8d7-a43f6570de99" ] }, { "uuid": "2834570a-801a-4414-8931-b62e6fd633e2", "code": "AMYLOCAINE", "type": "PRIMARY", "url": "https://en.wikipedia.org/wiki/Amylocaine", "code_system": "WIKIPEDIA", "references": [ "2b9561bd-b03d-4b6c-b8d7-a43f6570de99" ] }, { "uuid": "901a21af-043c-4e1f-ad26-b11df42ac50d", "code": "40660", "comments": "RxNorm", "type": "PRIMARY", "url": "https://rxnav.nlm.nih.gov/REST/rxcui/40660/allProperties.xml?prop=all", "code_system": "RXCUI", "references": [ "2b9561bd-b03d-4b6c-b8d7-a43f6570de99" ] }, { "uuid": "0a8c3dd1-5be6-4dd2-b1de-2567ebd3f3e5", "code": "m1877", "comments": "Merck Index", "type": "PRIMARY", "url": "https://merckindex.rsc.org/monographs/m1877?q=authorize", "code_system": "MERCK INDEX", "references": [ "2b9561bd-b03d-4b6c-b8d7-a43f6570de99" ] }, { "uuid": "71ead4a8-90ce-4863-859f-f261b0f462b7", "code": "SUB12893MIG", "type": "PRIMARY", "code_system": "EVMPD", "references": [ "2b9561bd-b03d-4b6c-b8d7-a43f6570de99" ] }, { "uuid": "c3a89432-2a72-455a-ad1a-6996ab31acb4", "code": "CHEMBL1740065", "type": "PRIMARY", "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL1740065", "code_system": "ChEMBL", "references": [ "2b9561bd-b03d-4b6c-b8d7-a43f6570de99" ] }, { "uuid": "99d36e32-0352-496b-8f9d-1db259e6915e", "code": "10767", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/10767", "code_system": "PUBCHEM", "references": [ "2b9561bd-b03d-4b6c-b8d7-a43f6570de99" ] }, { "uuid": "50cffe84-65a2-4d2a-98d8-49b3fddbb6aa", "code": "211-411-1", "type": "PRIMARY", "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.010.375", "code_system": "ECHA (EC/EINECS)", "references": [ "2b9561bd-b03d-4b6c-b8d7-a43f6570de99" ] }, { "uuid": "9a6cc384-17ca-bc3e-962f-9cacb2a5c8f9", "code": "DTXSID6047862", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID6047862", "code_system": "EPA CompTox", "references": [ "f1218adb-b95b-a87d-8222-78f067292b39" ] }, { "uuid": "588838dc-b621-ff07-4a4d-caddef5ce10f", "code": "C245", "comments": "Pharmacologic Substance[C1909]|Agent Affecting Nervous System[C78272]|Anesthetic Agent", "type": "CONCEPT", "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C245", "code_system": "NCI_THESAURUS", "references": [ "4efcb135-6478-033f-8a75-4b5b6761411d" ] }, { "uuid": "478821f7-36df-4780-70d8-8d952427e52d", "code": "206", "type": "PRIMARY", "url": "https://drugcentral.org/drugcard/206", "code_system": "DRUG CENTRAL", "references": [ "4efcb135-6478-033f-8a75-4b5b6761411d" ] }, { "uuid": "30369629-cd42-2113-ee05-972cd896248e", "code": "DB09088", "type": "PRIMARY", "url": "http://www.drugbank.ca/drugs/DB09088", "code_system": "DRUG BANK", "references": [ "4efcb135-6478-033f-8a75-4b5b6761411d" ] }, { "uuid": "4d7eb126-a597-4a95-8b66-39e4510d5c15", "code": "QRW683O56T", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "0e7f426c-c4f2-f6cd-accd-e849db133748", "code": "100000077416", "type": "PRIMARY", "code_system": "SMS_ID", "references": [ "b8cd833b-7162-f22f-22e9-5673afc6fcc2" ] } ], "relationships": [ { "uuid": "b79adb22-dd76-43d3-8ad4-32ac0235be10", "type": "ACTIVE MOIETY", "related_substance": { "uuid": "c3ffe0de-207b-445a-b770-5eb4531a9141", "refuuid": "8ec06ff5-7a6d-4db6-a93b-c2c9a2b8e3bf", "name": "AMYLOCAINE", "unii": "QRW683O56T", "linking_id": "QRW683O56T", "ref_pname": "AMYLOCAINE", "substance_class": "reference" } }, { "uuid": "40c196f0-74d4-4c9e-940e-f4ef917d4cd9", "type": "SALT/SOLVATE->PARENT", "related_substance": { "uuid": "750849f7-ea52-44ee-b1e4-3c9498625c68", "refuuid": "81e12c56-0597-4ab4-a1a8-612c1f1e1c63", "name": "AMYLOCAINE HYDROCHLORIDE", "unii": "224EF0K14Q", "linking_id": "224EF0K14Q", "ref_pname": "AMYLOCAINE HYDROCHLORIDE", "substance_class": "reference" } } ], "substance_class": "chemical", "names": [ { "uuid": "8337ca2d-94fc-4dff-9580-4d158fc1cd67", "name": "AMYLOCAINE", "stdName": "AMYLOCAINE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "d427d3e9-ae23-4f62-bf59-ace9d60b37d9", "b81e9258-e108-41dd-9377-a00ef29da155", "b3dee253-c83f-4d5a-b00c-526d22c6e69d", "2236902c-b94a-4445-a30d-f222d7d61382", "572f7325-61f0-41de-a010-a1e192e49b07", "da98d099-949d-4476-b8bc-429b4191e3e2" ], "display_name": true }, { "uuid": "101c87e8-ac26-460b-89e8-be48055e3a21", "name": "AMYLOCAINE [MI]", "stdName": "AMYLOCAINE [MI]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "b81e9258-e108-41dd-9377-a00ef29da155", "572f7325-61f0-41de-a010-a1e192e49b07" ], "display_name": false }, { "uuid": "ca98c290-83d4-3e58-6dc8-80c9e19531fb", "name": "Amylocaine [WHO-DD]", "stdName": "AMYLOCAINE [WHO-DD]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "eff096d2-18e1-c4b5-0109-6dd9e402b1e3" ], "display_name": false } ], "references": [ { "uuid": "da98d099-949d-4476-b8bc-429b4191e3e2", "citation": "USP Dictionary", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "572f7325-61f0-41de-a010-a1e192e49b07", "citation": "MERCK INDEX", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "b81e9258-e108-41dd-9377-a00ef29da155", "citation": "MERCK INDEX", "doc_type": "MERCK INDEX", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "d427d3e9-ae23-4f62-bf59-ace9d60b37d9", "citation": "WHO-DD", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "2b9561bd-b03d-4b6c-b8d7-a43f6570de99", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493390555000, "tags": [ "NOMEN" ] }, { "uuid": "e246f037-38a5-4985-80b0-154538bc3a02", "citation": "SRS import [QRW683O56T]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=QRW683O56T", "doc_type": "SRS", "public_domain": true, "document_date": 1493390555000, "tags": [ "NOMEN" ] }, { "uuid": "b3dee253-c83f-4d5a-b00c-526d22c6e69d", "citation": "AMYLOCAINE [MI]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "2236902c-b94a-4445-a30d-f222d7d61382", "citation": "AMYLOCAINE [WHO-DD]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "f1218adb-b95b-a87d-8222-78f067292b39", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=644-26-8", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "4efcb135-6478-033f-8a75-4b5b6761411d", "doc_type": "SYSTEM", "public_domain": true }, { "uuid": "c0081509-20a2-4b57-a374-6f03aef50132", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "eff096d2-18e1-c4b5-0109-6dd9e402b1e3", "citation": "WHO-DD", "doc_type": "WHO DRUG DICTIONARY", "public_domain": true }, { "uuid": "b8cd833b-7162-f22f-22e9-5673afc6fcc2", "citation": "EU-SRS", "doc_type": "EMA LIST", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "e45a0a70-fd6d-4376-ac2f-5048671a9951", "id": "e45a0a70-fd6d-4376-ac2f-5048671a9951", "molfile": "\n Marvin 01132111492D \n\n 17 17 0 0 0 0 999 V2000\n 0.4615 1.5452 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.4615 0.7202 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.1760 0.3077 0.0000 C 0 0 0 0 0 0 0 0 0 3 0 0\n 1.5885 1.0222 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7635 -0.4068 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.0615 -0.4068 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n -0.4740 -1.1212 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.4740 0.3077 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.8905 -0.1048 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.6050 0.3077 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.6050 1.1327 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3.3194 -0.1048 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.0339 0.3077 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.7484 -0.1048 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.7484 -0.9298 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.0339 -1.3423 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.3194 -0.9298 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 3 2 1 0 0 0 0\n 3 4 1 0 0 0 0\n 5 3 1 0 0 0 0\n 9 3 1 0 0 0 0\n 5 6 1 0 0 0 0\n 6 7 1 0 0 0 0\n 6 8 1 0 0 0 0\n 10 9 1 0 0 0 0\n 10 11 2 0 0 0 0\n 10 12 1 0 0 0 0\n 12 13 1 0 0 0 0\n 12 17 2 0 0 0 0\n 13 14 2 0 0 0 0\n 14 15 1 0 0 0 0\n 15 16 2 0 0 0 0\n 16 17 1 0 0 0 0\nM END", "smiles": "CCC(C)(CN(C)C)OC(=O)c1ccccc1", "formula": "C14H21NO2", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "RACEMIC", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "018ce2d7-81f2-4ec2-b971-1cfaa62136b6" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "235.3226", "optical_activity": "( + / - )", "stereo_centers": 1 } ], "definition_level": "COMPLETE", "uuid": "8ec06ff5-7a6d-4db6-a93b-c2c9a2b8e3bf", "version": "10", "structure": { "id": "9b7d7e54-ab63-4d89-b157-b0e939a10999", "molfile": "\n Marvin 01132108052D \n\n 17 17 0 0 0 0 999 V2000\n 2.6050 0.3077 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.3194 -0.1048 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.0339 0.3077 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.7484 -0.1048 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.7484 -0.9298 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.0339 -1.3423 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.3194 -0.9298 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.6050 1.1327 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1.8905 -0.1048 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7635 -0.4068 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.1760 0.3077 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.4615 0.7202 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.4615 1.5452 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.5885 1.0222 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.0615 -0.4068 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n -0.4740 -1.1212 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.4740 0.3077 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 2 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 2 0 0 0 0\n 6 7 1 0 0 0 0\n 2 7 2 0 0 0 0\n 1 8 2 0 0 0 0\n 1 9 1 0 0 0 0\n 10 11 1 0 0 0 0\n 11 12 1 0 0 0 0\n 12 13 1 0 0 0 0\n 11 14 1 0 0 0 0\n 15 16 1 0 0 0 0\n 15 17 1 0 0 0 0\n 10 15 1 0 0 0 0\n 9 11 1 0 0 0 0\nM END", "smiles": "CCC(C)(CN(C)C)OC(=O)c1ccccc1", "formula": "C14H21NO2", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "RACEMIC", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "235.3226", "optical_activity": "( + / - )", "references": [ "e246f037-38a5-4985-80b0-154538bc3a02", "da98d099-949d-4476-b8bc-429b4191e3e2" ], "stereo_centers": 1 }, "unii": "QRW683O56T" } ] }