{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "2588f07f-4e89-488d-956e-decf3ceb87c5",
          "code": "24967-27-9",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=24967-27-9",
          "code_system": "CAS",
          "references": [
            "ef79bcf6-a3b4-41ec-9b87-53ef5516b6cd",
            "0be83417-aefa-4f38-bd14-4fd6c958e989"
          ]
        },
        {
          "uuid": "2a7cc282-b42b-4102-92ec-b0994046c26b",
          "code": "246-550-7",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.042.303",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "ef79bcf6-a3b4-41ec-9b87-53ef5516b6cd"
          ]
        },
        {
          "uuid": "28ac749e-61bf-4bb2-90c1-45dfbe5840dc",
          "code": "65309",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/65309",
          "code_system": "PUBCHEM",
          "references": [
            "ef79bcf6-a3b4-41ec-9b87-53ef5516b6cd"
          ]
        },
        {
          "uuid": "946c73a6-5030-3ec5-8760-a0ad970da6ea",
          "code": "DTXSID80179682",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID80179682",
          "code_system": "EPA CompTox",
          "references": [
            "24172443-c7ce-8a8e-17e6-3e6150b30bb6"
          ]
        },
        {
          "uuid": "a8e4ff34-a4d7-449e-a21d-5d29d85ecf7f",
          "code": "QR7675ZK8X",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "66eb9e4b-0ad3-2cc8-2a53-81e143756f03",
          "code": "DB03991",
          "type": "PRIMARY",
          "url": "http://www.drugbank.ca/drugs/DB03991",
          "code_system": "DRUG BANK",
          "references": [
            "0b0f6f22-5238-f627-9e33-4abdfdb353a7"
          ]
        },
        {
          "uuid": "505bafaa-9b10-ce03-d1c1-1c269036ef7f",
          "code": "34873",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:34873",
          "code_system": "CHEBI",
          "references": [
            "0b0f6f22-5238-f627-9e33-4abdfdb353a7"
          ]
        },
        {
          "uuid": "5ae53115-45c1-a0d3-101b-95e77ac4fad9",
          "code": "28062",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:28062",
          "code_system": "CHEBI",
          "references": [
            "0b0f6f22-5238-f627-9e33-4abdfdb353a7"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "3d42bb2e-8736-4359-a9c3-3d5641b96849",
          "name": "2,3-DEHYDRO-2-DEOXY-N-ACETYLNEURAMINIC ACID",
          "stdName": "2,3-DEHYDRO-2-DEOXY-N-ACETYLNEURAMINIC ACID",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3d55b567-066c-415a-b268-e10a76095b54",
            "306e07d2-f87b-40b1-b249-70ec77dd6367"
          ],
          "display_name": false
        },
        {
          "uuid": "85a4c789-a894-40d2-8857-11fc35688ece",
          "name": "2-DEOXY-2,3-DEHYDRO-N-ACETYLNEURAMINIC ACID",
          "stdName": "2-DEOXY-2,3-DEHYDRO-N-ACETYLNEURAMINIC ACID",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "76a659c1-b37e-421e-8cdc-9cfe2f6a53f2",
            "919fb092-c9b7-4883-a9ec-68c12776c181"
          ],
          "display_name": true
        },
        {
          "uuid": "87747ea6-f370-4fa1-83d3-a3dc84f513dc",
          "name": "2-DEOXY-2,3-DIDEHYDRO-N-ACETYLNEURAMINIC ACID",
          "stdName": "2-DEOXY-2,3-DIDEHYDRO-N-ACETYLNEURAMINIC ACID",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3d55b567-066c-415a-b268-e10a76095b54",
            "306e07d2-f87b-40b1-b249-70ec77dd6367"
          ],
          "display_name": false
        },
        {
          "uuid": "791adff0-e5a8-402c-bb40-f516e4e32ea3",
          "name": "5-ACETAMIDO-2,6-ANHYDRO-3,5-DIDEOXY-D-GLYCERO-D-GALACTONON-2-ENONIC ACID",
          "stdName": "5-ACETAMIDO-2,6-ANHYDRO-3,5-DIDEOXY-D-GLYCERO-D-GALACTONON-2-ENONIC ACID",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3d55b567-066c-415a-b268-e10a76095b54",
            "306e07d2-f87b-40b1-b249-70ec77dd6367"
          ],
          "display_name": false
        },
        {
          "uuid": "07d77b27-4312-477a-b518-451c49ac97c1",
          "name": "D-GLYCERO-D-GALACTO-NON-2-ENONIC ACID, 5-(ACETYLAMINO)-2,6-ANHYDRO-3,5-DIDEOXY-",
          "stdName": "D-GLYCERO-D-GALACTO-NON-2-ENONIC ACID, 5-(ACETYLAMINO)-2,6-ANHYDRO-3,5-DIDEOXY-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3d55b567-066c-415a-b268-e10a76095b54",
            "306e07d2-f87b-40b1-b249-70ec77dd6367"
          ],
          "display_name": false
        },
        {
          "uuid": "07ff13b8-cef5-4ca4-82fa-58460836eba5",
          "name": "D-GLYCERO-D-GALACTO-NON-2-ENONIC ACID, 5-ACETAMIDO-2,6-ANHYDRO-3,5-DIDEOXY-",
          "stdName": "D-GLYCERO-D-GALACTO-NON-2-ENONIC ACID, 5-ACETAMIDO-2,6-ANHYDRO-3,5-DIDEOXY-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3d55b567-066c-415a-b268-e10a76095b54",
            "306e07d2-f87b-40b1-b249-70ec77dd6367"
          ],
          "display_name": false
        },
        {
          "uuid": "fa8c20ae-8505-40dc-b2b8-a4e5772dcc89",
          "name": "DANA",
          "stdName": "DANA",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3d55b567-066c-415a-b268-e10a76095b54",
            "306e07d2-f87b-40b1-b249-70ec77dd6367"
          ],
          "display_name": false
        },
        {
          "uuid": "497e9d52-3c50-44e2-8907-c9518119cb9d",
          "name": "NEURAMINIC ACID, N-ACETYL-2,3-DIDEHYDRO-2-DEOXY-",
          "stdName": "NEURAMINIC ACID, N-ACETYL-2,3-DIDEHYDRO-2-DEOXY-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3d55b567-066c-415a-b268-e10a76095b54",
            "306e07d2-f87b-40b1-b249-70ec77dd6367"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "919fb092-c9b7-4883-a9ec-68c12776c181",
          "citation": "CHEMID 2011 Drugportal",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "76a659c1-b37e-421e-8cdc-9cfe2f6a53f2",
          "citation": "DRUGPORTAL 2011",
          "doc_type": "CHEMID",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3d55b567-066c-415a-b268-e10a76095b54",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "306e07d2-f87b-40b1-b249-70ec77dd6367",
          "citation": "STN (SCIFINDER)",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ef79bcf6-a3b4-41ec-9b87-53ef5516b6cd",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391049000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ee6e4285-8e0a-4725-8a59-2e5de35c1c6d",
          "citation": "CHEMID  2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "24172443-c7ce-8a8e-17e6-3e6150b30bb6",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=24967-27-9",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "0b0f6f22-5238-f627-9e33-4abdfdb353a7",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "0be83417-aefa-4f38-bd14-4fd6c958e989",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "ec04e1e9-c537-4037-9b24-368f3ace7837",
          "id": "ec04e1e9-c537-4037-9b24-368f3ace7837",
          "molfile": "\n  Marvin  01132112132D          \n\n 20 20  0  0  1  0            999 V2000\n    9.7695   -4.7321    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    9.2392   -4.1001    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5819   -4.5888    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.8641   -3.8136    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4873   -5.5074    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n   10.0176   -6.1393    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6748   -5.6506    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    8.6748   -4.8256    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9604   -4.4131    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2459   -4.8256    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2459   -5.6506    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    6.5314   -6.0631    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9604   -6.0631    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    7.9604   -6.8881    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2459   -7.3006    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5314   -6.8881    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2459   -8.1256    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9604   -3.5881    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2459   -3.1756    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6748   -3.1756    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  6  0  0  0\n  1  3  1  0  0  0  0\n  1  5  1  0  0  0  0\n  3  4  1  0  0  0  0\n  5  6  1  1  0  0  0\n  5  7  1  0  0  0  0\n  7  8  1  1  0  0  0\n  7 13  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  2  0  0  0  0\n  9 18  1  0  0  0  0\n 11 10  1  0  0  0  0\n 11 12  1  1  0  0  0\n 13 11  1  0  0  0  0\n 13 14  1  6  0  0  0\n 14 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 15 17  2  0  0  0  0\n 18 19  1  0  0  0  0\n 18 20  2  0  0  0  0\nM  END",
          "smiles": "CC(=O)N[C@@H]1[C@H](C=C(C(=O)O)O[C@H]1[C@@H]([C@@H](CO)O)O)O",
          "formula": "C11H17NO8",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "13884d73-83fd-49e5-b955-8e0ca558a0d7"
          },
          "defined_stereo": 5,
          "ez_centers": 0,
          "molecular_weight": "291.255",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 5
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "6044822a-9ffc-484e-b063-1049aae1220a",
      "version": "9",
      "structure": {
        "id": "2d2f794b-63ab-4bb5-8eda-a095dea1caee",
        "molfile": "\n  Marvin  01132102262D          \n\n 21 21  0  0  1  0            999 V2000\n    9.4873   -5.5074    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    9.7695   -4.7321    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   10.5819   -4.5888    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.8641   -3.8136    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2392   -4.1001    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0176   -6.1393    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6748   -5.6506    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    7.9604   -6.0631    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    7.9604   -6.8881    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2459   -7.3006    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5314   -6.8881    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2459   -8.1256    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2459   -5.6506    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    6.5314   -6.0631    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2459   -4.8256    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9604   -4.4131    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6748   -4.8256    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9604   -3.5881    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2459   -3.1756    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6748   -3.1756    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9570   -6.4258    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  2  5  1  6  0  0  0\n  1  6  1  1  0  0  0\n  1  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  6  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 10 12  2  0  0  0  0\n  8 13  1  0  0  0  0\n 13 14  1  1  0  0  0\n 13 15  1  0  0  0  0\n 16 15  2  0  0  0  0\n 17 16  1  0  0  0  0\n  7 17  1  0  0  0  0\n 16 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n 18 20  2  0  0  0  0\n  7 21  1  6  0  0  0\nM  END",
        "smiles": "CC(=O)N[C@@H]1[C@H](C=C(C(=O)O)O[C@@]1([H])[C@@H]([C@@H](CO)O)O)O",
        "formula": "C11H17NO8",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 5,
        "ez_centers": 0,
        "molecular_weight": "291.255",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "ee6e4285-8e0a-4725-8a59-2e5de35c1c6d"
        ],
        "stereo_centers": 5
      },
      "unii": "QR7675ZK8X"
    }
  ]
}