{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "9bbc4ecb-830c-4990-a2a9-177ab4d9ed6e",
          "code": "86178-38-3",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=86178-38-3",
          "code_system": "CAS",
          "references": [
            "8f7403c0-05cf-4847-89b4-3d22934d2aec",
            "7110c46a-16c7-46ca-9134-368caaaf847c"
          ]
        },
        {
          "uuid": "4bbad5c8-9835-4e9d-a5d2-72eb76c5e8b7",
          "code": "289-200-9",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.081.062",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "8f7403c0-05cf-4847-89b4-3d22934d2aec"
          ]
        },
        {
          "uuid": "62e18b90-fa9b-4c1e-b34e-63b01162ec5b",
          "code": "98056",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/98056",
          "code_system": "PUBCHEM",
          "references": [
            "8f7403c0-05cf-4847-89b4-3d22934d2aec"
          ]
        },
        {
          "uuid": "88e295ae-584c-fc94-26f0-dff06ab1f6b9",
          "code": "DTXSID30888671",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID30888671",
          "code_system": "EPA CompTox"
        },
        {
          "uuid": "3f683129-adb1-4f52-ac88-54f8474fef16",
          "code": "QQ3S6CM5VF",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "b78c1d0b-3ec6-cd2c-e455-2b04defe2561",
          "code": "72762",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=72762",
          "code_system": "NSC",
          "references": [
            "f6ea0ed0-9aa2-266e-9eec-5d897c6c7d3f"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "2cf4bcfd-cc6e-4cb2-bdcd-e7b97618eddd",
          "name": "(3,3,5-TRIMETHYLCYCLOHEXYL) PROP-2-ENOATE",
          "stdName": "(3,3,5-TRIMETHYLCYCLOHEXYL) PROP-2-ENOATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7110c46a-16c7-46ca-9134-368caaaf847c"
          ],
          "display_name": false
        },
        {
          "uuid": "a653a3cd-08c9-41ab-aa00-4df91d8b9c73",
          "name": "2-PROPENOIC ACID, 3,3,5-TRIMETHYLCYCLOHEXYL ESTER",
          "stdName": "2-PROPENOIC ACID, 3,3,5-TRIMETHYLCYCLOHEXYL ESTER",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7110c46a-16c7-46ca-9134-368caaaf847c"
          ],
          "display_name": false
        },
        {
          "uuid": "01c7da52-1a69-46b3-89c8-2ffc4b742e80",
          "name": "3,3,5-TRIMETHYLCYCLOHEXYL 2-PROPENOATE",
          "stdName": "3,3,5-TRIMETHYLCYCLOHEXYL 2-PROPENOATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7110c46a-16c7-46ca-9134-368caaaf847c"
          ],
          "display_name": false
        },
        {
          "uuid": "1a7629a6-9768-4764-b57c-68fc693bfaea",
          "name": "3,3,5-TRIMETHYLCYCLOHEXYL ACRYLATE",
          "stdName": "3,3,5-TRIMETHYLCYCLOHEXYL ACRYLATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7110c46a-16c7-46ca-9134-368caaaf847c"
          ],
          "display_name": false
        },
        {
          "uuid": "7f785df8-f2e7-4ebb-a340-4d1372ba7a9d",
          "name": "3,3,5-TRIMETHYLCYCLOHEXYL PROP-2-ENOATE",
          "stdName": "3,3,5-TRIMETHYLCYCLOHEXYL PROP-2-ENOATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7110c46a-16c7-46ca-9134-368caaaf847c"
          ],
          "display_name": false
        },
        {
          "uuid": "9c143fa0-fc3d-44b9-be6e-4691b93a1977",
          "name": "ACRYLIC ACID, 3,3,5-TRIMETHYLCYCLOHEXYL ESTER",
          "stdName": "ACRYLIC ACID, 3,3,5-TRIMETHYLCYCLOHEXYL ESTER",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7110c46a-16c7-46ca-9134-368caaaf847c"
          ],
          "display_name": false
        },
        {
          "uuid": "046cec09-8af5-4cac-b04e-4075e9dd941c",
          "name": "ISOPHORYL ACRYLATE",
          "stdName": "ISOPHORYL ACRYLATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7110c46a-16c7-46ca-9134-368caaaf847c"
          ],
          "display_name": true
        },
        {
          "uuid": "05e76e03-d318-b165-60e5-92e588043db1",
          "name": "NSC-72762",
          "stdName": "NSC-72762",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f6ea0ed0-9aa2-266e-9eec-5d897c6c7d3f"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "0f3a2530-1daf-45ae-b5d9-ca17d4cc40f5",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8f7403c0-05cf-4847-89b4-3d22934d2aec",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392268000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7110c46a-16c7-46ca-9134-368caaaf847c",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "f6ea0ed0-9aa2-266e-9eec-5d897c6c7d3f",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "ed80c4a9-20d6-43d8-bf1c-706125f9f541",
          "id": "ed80c4a9-20d6-43d8-bf1c-706125f9f541",
          "molfile": "\n  Marvin  01132112172D          \n\n 14 14  0  0  0  0            999 V2000\n    1.5199   -4.5369    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.5199   -3.7112    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    2.2413   -3.2983    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2413   -2.4772    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    1.5199   -2.0643    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8121   -2.4772    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.5308   -1.7014    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -2.6223    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8121   -3.2983    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9536   -2.0643    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9490   -1.2386    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2367   -0.8257    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6613   -0.8257    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6613    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  9  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  4  5  1  0  0  0  0\n  4 10  1  0  0  0  0\n  6  5  1  0  0  0  0\n  6  7  1  0  0  0  0\n  6  8  1  0  0  0  0\n  6  9  1  0  0  0  0\n 11 10  1  0  0  0  0\n 11 12  2  0  0  0  0\n 11 13  1  0  0  0  0\n 13 14  2  0  0  0  0\nM  END",
          "smiles": "C=CC(=O)OC1CC(C)CC(C)(C)C1",
          "formula": "C12H20O2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "MIXED",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "3736e7b2-bdff-483c-8221-58400d356a59"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "196.2865",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 2
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "f8073d38-e518-42f8-8301-eb91aa12a465",
      "version": "8",
      "structure": {
        "id": "e32ca948-4efc-4c25-91f5-2edafcf205d1",
        "molfile": "\n  Marvin  01132111452D          \n\n 14 14  0  0  0  0            999 V2000\n    2.9490   -1.2386    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8121   -2.4772    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2413   -2.4772    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9536   -2.0643    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6613   -0.8257    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2367   -0.8257    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.5199   -2.0643    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8121   -3.2983    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2413   -3.2983    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6613    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.5199   -3.7112    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.5308   -1.7014    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -2.6223    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.5199   -4.5369    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  4  1  0  0  0  0\n  1  5  1  0  0  0  0\n  1  6  2  0  0  0  0\n  2  7  1  0  0  0  0\n  2 12  1  0  0  0  0\n  2 13  1  0  0  0  0\n  2  8  1  0  0  0  0\n  3  4  1  0  0  0  0\n  3  7  1  0  0  0  0\n  3  9  1  0  0  0  0\n  5 10  2  0  0  0  0\n  8 11  1  0  0  0  0\n  9 11  1  0  0  0  0\n 11 14  1  0  0  0  0\nM  END",
        "smiles": "C=CC(=O)OC1CC(C)CC(C)(C)C1",
        "formula": "C12H20O2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "RACEMIC",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "196.2865",
        "optical_activity": "( + / - )",
        "references": [
          "0f3a2530-1daf-45ae-b5d9-ca17d4cc40f5",
          "7110c46a-16c7-46ca-9134-368caaaf847c"
        ],
        "stereo_centers": 2
      },
      "unii": "QQ3S6CM5VF"
    }
  ]
}