{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "6011c728-bfbc-41c4-b691-d2d93b424d55",
          "code": "329-01-1",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=329-01-1",
          "code_system": "CAS",
          "references": [
            "01c8c7d2-6c56-4c84-9a95-9914f69fb75b",
            "489cde30-8060-4cdb-9b7e-2ac53ca5678c"
          ]
        },
        {
          "uuid": "18254aa1-a891-4b42-9dbe-1b1d0344d465",
          "code": "206-341-3",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.005.766",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "01c8c7d2-6c56-4c84-9a95-9914f69fb75b"
          ]
        },
        {
          "uuid": "0f866eea-0fd9-4453-a6dd-571ce9f83045",
          "code": "9483",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/9483",
          "code_system": "PUBCHEM",
          "references": [
            "01c8c7d2-6c56-4c84-9a95-9914f69fb75b"
          ]
        },
        {
          "uuid": "6368cb17-4020-e5fc-ab1d-a16c17831c74",
          "code": "DTXSID0027143",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID0027143",
          "code_system": "EPA CompTox",
          "references": [
            "307b7a8a-9ff3-8961-1263-be2326c0bd66"
          ]
        },
        {
          "uuid": "7ed80b9e-0750-4809-bb15-07cd383feab2",
          "code": "QPS7LLZ6XM",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "313cd3bc-e891-4df8-97aa-0007b506531f",
          "name": ".ALPHA.,.ALPHA.,.ALPHA.-TRIFLUORO-3-TOLYL ISOCYANATE",
          "stdName": ".ALPHA.,.ALPHA.,.ALPHA.-TRIFLUORO-3-TOLYL ISOCYANATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2f23af0a-d563-404b-ae81-cf1f7c5834aa",
            "aff26017-fabe-4184-a847-a0ab422aabb2"
          ],
          "display_name": false
        },
        {
          "uuid": "eae8f8fe-90d6-415e-9527-32e0f1ef1617",
          "name": ".ALPHA.,.ALPHA.,.ALPHA.-TRIFLUORO-M-TOLYL ISOCYANATE",
          "stdName": ".ALPHA.,.ALPHA.,.ALPHA.-TRIFLUORO-M-TOLYL ISOCYANATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2f23af0a-d563-404b-ae81-cf1f7c5834aa",
            "aff26017-fabe-4184-a847-a0ab422aabb2"
          ],
          "display_name": false
        },
        {
          "uuid": "7949bf16-e077-493d-9043-0457326ff0cf",
          "name": "1-(TRIFLUOROMETHYL)-3-(ISOCYANATO)BENZENE",
          "stdName": "1-(TRIFLUOROMETHYL)-3-(ISOCYANATO)BENZENE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2f23af0a-d563-404b-ae81-cf1f7c5834aa",
            "aff26017-fabe-4184-a847-a0ab422aabb2"
          ],
          "display_name": false
        },
        {
          "uuid": "f0eaf945-12f8-4d92-a8fe-e3fd97d23f6f",
          "name": "1-ISOCYANATO-3-TRIFLUOROMETHYLBENZENE",
          "stdName": "1-ISOCYANATO-3-TRIFLUOROMETHYLBENZENE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2f23af0a-d563-404b-ae81-cf1f7c5834aa",
            "aff26017-fabe-4184-a847-a0ab422aabb2"
          ],
          "display_name": false
        },
        {
          "uuid": "7df8d8f2-69e1-49eb-b514-908a806df576",
          "name": "3-(TRIFLUOROMETHYL)PHENYL ISOCYANATE",
          "stdName": "3-(TRIFLUOROMETHYL)PHENYL ISOCYANATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2f23af0a-d563-404b-ae81-cf1f7c5834aa"
          ],
          "display_name": true
        },
        {
          "uuid": "81c940bd-efa5-4de3-95e3-987e1f216a94",
          "name": "BENZENE, 1-ISOCYANATO-3-(TRIFLUOROMETHYL)-",
          "stdName": "BENZENE, 1-ISOCYANATO-3-(TRIFLUOROMETHYL)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2f23af0a-d563-404b-ae81-cf1f7c5834aa",
            "aff26017-fabe-4184-a847-a0ab422aabb2"
          ],
          "display_name": false
        },
        {
          "uuid": "bd226239-128f-4758-b6ca-b232f26c3464",
          "name": "ISOCYANIC ACID, .ALPHA.,.ALPHA.,.ALPHA.-TRIFLUORO-M-TOLYL ESTER",
          "stdName": "ISOCYANIC ACID, .ALPHA.,.ALPHA.,.ALPHA.-TRIFLUORO-M-TOLYL ESTER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2295944e-ad48-4e19-bfb2-40ba5e887f2a",
            "aff26017-fabe-4184-a847-a0ab422aabb2"
          ],
          "display_name": false
        },
        {
          "uuid": "c0d8401a-1ccc-4990-9c8b-3d7d54f1f5e3",
          "name": "M-(TRIFLUOROMETHYL)PHENYL ISOCYANATE",
          "stdName": "M-(TRIFLUOROMETHYL)PHENYL ISOCYANATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2f23af0a-d563-404b-ae81-cf1f7c5834aa",
            "aff26017-fabe-4184-a847-a0ab422aabb2"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "2f23af0a-d563-404b-ae81-cf1f7c5834aa",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "aff26017-fabe-4184-a847-a0ab422aabb2",
          "citation": "STN (SCIFINDER)",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2295944e-ad48-4e19-bfb2-40ba5e887f2a",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "01c8c7d2-6c56-4c84-9a95-9914f69fb75b",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391007000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "85ddf4b2-b533-4b8e-8379-3c18335ce2fb",
          "citation": "SRS import [QPS7LLZ6XM]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=QPS7LLZ6XM",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391007000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6c6e8892-224f-4b8c-a52c-157330d7f091",
          "citation": "CHEMID  2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "307b7a8a-9ff3-8961-1263-be2326c0bd66",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=329-01-1",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "489cde30-8060-4cdb-9b7e-2ac53ca5678c",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "bad073fc-a6be-4236-b5e9-4bedd4182320",
          "id": "bad073fc-a6be-4236-b5e9-4bedd4182320",
          "molfile": "\n  Marvin  01132109402D          \n\n 13 13  0  0  0  0            999 V2000\n    7.1920   -2.7381    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1920   -3.5631    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3669   -3.5631    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0171   -3.5631    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1920   -4.3882    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8924   -4.8007    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8924   -5.6258    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1920   -6.0384    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4870   -5.6258    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4870   -4.8007    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7481   -6.0384    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7481   -6.8634    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7481   -7.6886    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  2  4  1  0  0  0  0\n  5  2  1  0  0  0  0\n  5  6  1  0  0  0  0\n  5 10  2  0  0  0  0\n  6  7  2  0  0  0  0\n  7  8  1  0  0  0  0\n  9  8  2  0  0  0  0\n 10  9  1  0  0  0  0\n  9 11  1  0  0  0  0\n 11 12  2  0  0  0  0\n 12 13  2  0  0  0  0\nM  END",
          "smiles": "c1cc(cc(c1)N=C=O)C(F)(F)F",
          "formula": "C8H4F3NO",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "5c268241-2427-41b4-9588-4ec1b7abc81e"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "187.119",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "92eee53e-b67c-4231-b72e-860169a3fb7e",
      "version": "3",
      "structure": {
        "id": "4829117b-15f5-4fa0-b918-0e32b5db5799",
        "molfile": "\n  Marvin  01132103472D          \n\n 13 13  0  0  0  0            999 V2000\n    7.1920   -4.3882    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4870   -4.8007    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4870   -5.6258    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1920   -6.0384    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8924   -5.6258    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8924   -4.8007    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7481   -6.0384    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7481   -6.8634    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7481   -7.6886    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1920   -3.5631    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1920   -2.7381    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3669   -3.5631    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0171   -3.5631    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  2  0  0  0  0\n  3  4  1  0  0  0  0\n  5  4  2  0  0  0  0\n  6  5  1  0  0  0  0\n  1  6  2  0  0  0  0\n  3  7  1  0  0  0  0\n  7  8  2  0  0  0  0\n  8  9  2  0  0  0  0\n  1 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 10 12  1  0  0  0  0\n 10 13  1  0  0  0  0\nM  END",
        "smiles": "c1cc(cc(c1)N=C=O)C(F)(F)F",
        "formula": "C8H4F3NO",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "187.119",
        "optical_activity": "NONE",
        "references": [
          "6c6e8892-224f-4b8c-a52c-157330d7f091",
          "85ddf4b2-b533-4b8e-8379-3c18335ce2fb"
        ],
        "stereo_centers": 0
      },
      "unii": "QPS7LLZ6XM"
    }
  ]
}