{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "b0687f36-230b-488d-a46d-a05935de5d0d",
          "code": "92-93-3",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=92-93-3",
          "code_system": "CAS",
          "references": [
            "b3b6d7af-ca76-422e-9aff-c00b0d486707",
            "9d5c9371-0358-4d25-8d54-ccb3100d8091"
          ]
        },
        {
          "uuid": "61e8e360-9f57-4fab-8ce5-2ca51e8453dd",
          "code": "C040438",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67040438",
          "code_system": "MESH",
          "references": [
            "b3b6d7af-ca76-422e-9aff-c00b0d486707"
          ]
        },
        {
          "uuid": "274ed0bd-f0cf-4a93-9a7a-2d233f3d4e2c",
          "code": "203602",
          "comments": "EPA PESTICIDE|CONVENTIONAL CHEMICAL",
          "type": "PRIMARY",
          "url": "http://iaspub.epa.gov/apex/pesticides/f?p=CHEMICALSEARCH:3:0::NO:21,3,31,7,12,25:P3_XCHEMICAL_ID:4503",
          "code_system": "EPA PESTICIDE CODE",
          "references": [
            "b3b6d7af-ca76-422e-9aff-c00b0d486707"
          ]
        },
        {
          "uuid": "7152be6c-85b8-443d-8144-b317606cb5d6",
          "code": "m7950",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m7950?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "b3b6d7af-ca76-422e-9aff-c00b0d486707"
          ]
        },
        {
          "uuid": "abbe9356-3ee1-4a89-93d5-c60ad77bd7f0",
          "code": "202-204-7",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.002.005",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "b3b6d7af-ca76-422e-9aff-c00b0d486707"
          ]
        },
        {
          "uuid": "98d0ce0a-3321-4898-8aeb-bd2d980490aa",
          "code": "7114",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/7114",
          "code_system": "PUBCHEM",
          "references": [
            "b3b6d7af-ca76-422e-9aff-c00b0d486707"
          ]
        },
        {
          "uuid": "0524eb2a-c8fb-092a-271c-d254c9392c99",
          "code": "2632",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/2632",
          "code_system": "HSDB",
          "references": [
            "2a7bd8f5-153f-0432-42c5-40abb139131d"
          ]
        },
        {
          "uuid": "47bb69a1-3ae5-064c-d6a0-506be505f20c",
          "code": "DTXSID9041522",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID9041522",
          "code_system": "EPA CompTox",
          "references": [
            "fbf13aad-6af2-b2ed-f597-e073e02110fe"
          ]
        },
        {
          "uuid": "b2d0abce-f500-8479-1286-744aab5bef1f",
          "code": "DB12300",
          "type": "PRIMARY",
          "url": "https://go.drugbank.com/drugs/DB12300",
          "code_system": "DRUG BANK",
          "references": [
            "9936d994-a2b8-ced0-d56e-250ef7f59f36"
          ]
        },
        {
          "uuid": "322df40b-0ac0-462d-952b-3fceee1b8455",
          "code": "QM80NUW6WZ",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "665dbbc3-71a9-e305-5d7d-859b625e7899",
          "code": "QM80NUW6WZ",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=QM80NUW6WZ",
          "code_system": "DAILYMED",
          "references": [
            "79b99ca1-d51a-3ccb-77a6-192c3cbbb74f"
          ]
        },
        {
          "uuid": "5459a330-91e2-5098-b0f4-94883f21a659",
          "code": "2571811",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/2571811/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "cee4dd74-a527-69a4-1d82-5e386e238af1"
          ]
        },
        {
          "uuid": "435c8567-b0ed-8cfa-fed8-94178e5a5730",
          "code": "1324",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=1324",
          "code_system": "NSC",
          "references": [
            "d1ca36e4-46c0-fde2-82ed-e55e846d3a05"
          ]
        },
        {
          "uuid": "96113934-66e9-6bd2-64ff-0c9a2625e131",
          "code": "300000053548",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "de0f5346-49ec-5af6-3727-a029897ea096"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "459226f1-6218-4191-a1f7-c107d47d8772",
          "name": "4-NITRO-1,1'-BIPHENYL",
          "stdName": "4-NITRO-1,1'-BIPHENYL",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d4be5423-d9a6-4eba-a1e5-161b9f57607e",
            "ce5935db-2336-453c-bd33-e3fb6a08666a"
          ],
          "display_name": false
        },
        {
          "uuid": "7d5fa15a-570d-4d75-aad2-f2950c6b4b7f",
          "name": "4-NITROBIPHENYL",
          "stdName": "4-NITROBIPHENYL",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d4be5423-d9a6-4eba-a1e5-161b9f57607e",
            "ce5935db-2336-453c-bd33-e3fb6a08666a"
          ],
          "display_name": false
        },
        {
          "uuid": "f36f234b-f9e2-ae4a-d452-d08aac877670",
          "name": "4-NITROBIPHENYL [IARC]",
          "stdName": "4-NITROBIPHENYL [IARC]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f812a098-ce82-ab80-09c2-d8aa1fdab3d1"
          ],
          "display_name": false
        },
        {
          "uuid": "f702143c-da04-4f22-a1b3-6bac34e8ae57",
          "name": "NITRO-1,1'-BIPHENYL, 4-",
          "stdName": "NITRO-1,1'-BIPHENYL, 4-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "aa2decbd-fee0-4d4e-906d-da3e18044827"
          ],
          "display_name": false
        },
        {
          "uuid": "50edbf46-11f8-41b9-a159-978a63c3b89c",
          "name": "NSC-1324",
          "stdName": "NSC-1324",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1afe962c-901c-4918-8a86-e8c201b8d7e2",
            "ce5935db-2336-453c-bd33-e3fb6a08666a"
          ],
          "display_name": false
        },
        {
          "uuid": "6fbc4275-bbef-425c-b56a-e56f8094fbc1",
          "name": "P-NITROBIPHENYL",
          "stdName": "P-NITROBIPHENYL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d4be5423-d9a6-4eba-a1e5-161b9f57607e",
            "ce5935db-2336-453c-bd33-e3fb6a08666a",
            "0433356e-c2e0-4d97-8d80-b601fd1ab4ab",
            "7f64cb9a-c812-4015-b14b-52c5f6883198",
            "1b42694f-07e3-4e16-aaba-c6e539b256a7",
            "3014c7cc-98cb-441a-87d4-991cb10cb81a"
          ],
          "display_name": true
        },
        {
          "uuid": "a312b36a-a781-4214-b243-2309578fd2e5",
          "name": "P-NITROBIPHENYL [HSDB]",
          "stdName": "P-NITROBIPHENYL [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ce5935db-2336-453c-bd33-e3fb6a08666a",
            "1b42694f-07e3-4e16-aaba-c6e539b256a7"
          ],
          "display_name": false
        },
        {
          "uuid": "217e8341-5101-4944-b3e5-d7b113efb8ef",
          "name": "P-NITROBIPHENYL [MI]",
          "stdName": "P-NITROBIPHENYL [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ce5935db-2336-453c-bd33-e3fb6a08666a",
            "7f64cb9a-c812-4015-b14b-52c5f6883198"
          ],
          "display_name": false
        },
        {
          "uuid": "7a8a8a0a-6773-4ec7-bb8c-61c45abe87ef",
          "name": "P-NITRODIPHENYL",
          "stdName": "P-NITRODIPHENYL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d4be5423-d9a6-4eba-a1e5-161b9f57607e",
            "ce5935db-2336-453c-bd33-e3fb6a08666a"
          ],
          "display_name": false
        },
        {
          "uuid": "9fae6ede-5b91-452b-a625-40f95af3984c",
          "name": "PNB",
          "stdName": "PNB",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d4be5423-d9a6-4eba-a1e5-161b9f57607e",
            "ce5935db-2336-453c-bd33-e3fb6a08666a"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "aa2decbd-fee0-4d4e-906d-da3e18044827",
          "citation": "ICSAS BATCH 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "7f64cb9a-c812-4015-b14b-52c5f6883198",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ce5935db-2336-453c-bd33-e3fb6a08666a",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d4be5423-d9a6-4eba-a1e5-161b9f57607e",
          "citation": "Merck",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1afe962c-901c-4918-8a86-e8c201b8d7e2",
          "citation": "ChemID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1b42694f-07e3-4e16-aaba-c6e539b256a7",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b3b6d7af-ca76-422e-9aff-c00b0d486707",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390882000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "97a455bd-af1b-40af-a783-e407652e154c",
          "citation": "SRS import [QM80NUW6WZ]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=QM80NUW6WZ",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390882000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "aecba8cb-2ef9-4f8b-93df-2f0450d613db",
          "citation": "CHEMID 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0433356e-c2e0-4d97-8d80-b601fd1ab4ab",
          "citation": "P-NITROBIPHENYL [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "3014c7cc-98cb-441a-87d4-991cb10cb81a",
          "citation": "P-NITROBIPHENYL [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "2a7bd8f5-153f-0432-42c5-40abb139131d",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+92-93-3",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "fbf13aad-6af2-b2ed-f597-e073e02110fe",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=92-93-3",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "cee4dd74-a527-69a4-1d82-5e386e238af1",
          "citation": "RXNORM",
          "doc_type": "NLM",
          "public_domain": true
        },
        {
          "uuid": "f812a098-ce82-ab80-09c2-d8aa1fdab3d1",
          "citation": "IARC",
          "doc_type": "IARC",
          "public_domain": true
        },
        {
          "uuid": "9936d994-a2b8-ced0-d56e-250ef7f59f36",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "9d5c9371-0358-4d25-8d54-ccb3100d8091",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "d1ca36e4-46c0-fde2-82ed-e55e846d3a05",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "79b99ca1-d51a-3ccb-77a6-192c3cbbb74f",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "de0f5346-49ec-5af6-3727-a029897ea096",
          "citation": "SMS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "fea4c37b-9e8c-494f-959b-75e9cffd69ba",
          "id": "fea4c37b-9e8c-494f-959b-75e9cffd69ba",
          "molfile": "\n  Marvin  01132113112D          \n\n 15 16  0  0  0  0            999 V2000\n    4.0274   -4.3480    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    4.4400   -5.0625    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n    4.0274   -5.7770    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2650   -5.0625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6774   -4.3480    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5024   -4.3480    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9149   -5.0625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5024   -5.7770    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6774   -5.7770    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7400   -5.0625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1524   -5.7770    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9774   -5.7770    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3899   -5.0625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9774   -4.3480    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1524   -4.3480    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  2  0  0  0  0\n  4  2  1  0  0  0  0\n  5  4  1  0  0  0  0\n  4  9  2  0  0  0  0\n  6  5  2  0  0  0  0\n  7  6  1  0  0  0  0\n  7  8  2  0  0  0  0\n  7 10  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10 11  1  0  0  0  0\n 10 15  2  0  0  0  0\n 11 12  2  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  2  0  0  0  0\n 14 15  1  0  0  0  0\nM  CHG  2   1  -1   2   1\nM  END",
          "smiles": "c1ccc(cc1)-c2ccc(cc2)[N+](=O)[O-]",
          "formula": "C12H9NO2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "50a8c32f-1a7d-4b63-8742-7d946699fc0e"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "199.2058",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "884cc80b-0832-425d-967f-54c5ced4e026",
      "version": "11",
      "structure": {
        "id": "ed8826ec-a3f7-4418-87b2-022dd8325f82",
        "molfile": "\n  Marvin  01132112172D          \n\n 15 16  0  0  0  0            999 V2000\n    6.9149   -5.0625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7400   -5.0625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1524   -5.7770    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9774   -5.7770    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3899   -5.0625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9774   -4.3480    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1524   -4.3480    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5024   -4.3480    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6774   -4.3480    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2650   -5.0625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4400   -5.0625    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n    4.0274   -4.3480    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    4.0274   -5.7770    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6774   -5.7770    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5024   -5.7770    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  2  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  2  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  2  0  0  0  0\n  2  7  1  0  0  0  0\n  1  8  2  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  2  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 11 13  2  0  0  0  0\n 10 14  1  0  0  0  0\n 14 15  2  0  0  0  0\n  1 15  1  0  0  0  0\nM  CHG  2  11   1  12  -1\nM  END",
        "smiles": "c1ccc(cc1)-c2ccc(cc2)[N+](=O)[O-]",
        "formula": "C12H9NO2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "199.2058",
        "optical_activity": "NONE",
        "references": [
          "97a455bd-af1b-40af-a783-e407652e154c",
          "aecba8cb-2ef9-4f8b-93df-2f0450d613db"
        ],
        "stereo_centers": 0
      },
      "unii": "QM80NUW6WZ"
    }
  ]
}