{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "f9808772-0381-4e92-86cb-a9acd3efb40e",
          "code": "87-73-0",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=87-73-0",
          "code_system": "CAS",
          "references": [
            "5156024b-16ee-49f2-9c3a-1e53e49ab552",
            "0fef3d2a-adb2-4d8b-8b9d-ba9380caac1b"
          ]
        },
        {
          "uuid": "ba9166a6-200e-4c09-8885-10eb2239391b",
          "code": "D005937",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/68005937",
          "code_system": "MESH",
          "references": [
            "5156024b-16ee-49f2-9c3a-1e53e49ab552"
          ]
        },
        {
          "uuid": "c4803965-c915-4f93-89d8-cf0b7af12c0f",
          "code": "SACCHARIC ACID",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Saccharic_acid",
          "code_system": "WIKIPEDIA",
          "references": [
            "5156024b-16ee-49f2-9c3a-1e53e49ab552"
          ]
        },
        {
          "uuid": "c774de9a-a82c-4d3e-8968-7986021d2165",
          "code": "m5755",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m5755?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "5156024b-16ee-49f2-9c3a-1e53e49ab552"
          ]
        },
        {
          "uuid": "9156228b-f31a-47ab-8dc1-53affdc73cf4",
          "code": "201-768-1",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.001.608",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "5156024b-16ee-49f2-9c3a-1e53e49ab552"
          ]
        },
        {
          "uuid": "d4baa145-2bc9-4d65-8146-44d21b883048",
          "code": "33037",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/33037",
          "code_system": "PUBCHEM",
          "references": [
            "5156024b-16ee-49f2-9c3a-1e53e49ab552"
          ]
        },
        {
          "uuid": "c0f42c0d-313f-4de4-a8fc-5f6795fb0f76",
          "code": "1788997",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1788997/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "a4e2d402-154e-f807-09e0-f3ab900685c3"
          ]
        },
        {
          "uuid": "fe164525-8b5d-6159-e3f6-67738dc5e8f8",
          "code": "DB03603",
          "type": "PRIMARY",
          "url": "https://go.drugbank.com/drugs/DB03603",
          "code_system": "DRUG BANK",
          "references": [
            "5353acf0-417a-9736-b526-7b5ec56705da"
          ]
        },
        {
          "uuid": "85508d42-af9a-40f4-b82d-4c67d4cf9121",
          "code": "QLZ991V4A2",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "ed59c6e9-27c2-bfb7-e55d-85980071234d",
          "code": "16002",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:16002",
          "code_system": "CHEBI",
          "references": [
            "5353acf0-417a-9736-b526-7b5ec56705da"
          ]
        },
        {
          "uuid": "a596d6d3-d813-dd5a-deba-0adb598a8f09",
          "code": "33801",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:33801",
          "code_system": "CHEBI",
          "references": [
            "5353acf0-417a-9736-b526-7b5ec56705da"
          ]
        },
        {
          "uuid": "32622c7d-b7ef-e670-80cf-da73e5a0a260",
          "code": "35392",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:35392",
          "code_system": "CHEBI",
          "references": [
            "5353acf0-417a-9736-b526-7b5ec56705da"
          ]
        },
        {
          "uuid": "5b08ba1f-4574-3f40-ead1-1ab88dd4a156",
          "code": "17301",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:17301",
          "code_system": "CHEBI",
          "references": [
            "5353acf0-417a-9736-b526-7b5ec56705da"
          ]
        },
        {
          "uuid": "9329e088-eeae-b44d-686a-fa8a4845fe0d",
          "code": "DTXSID60859455",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID60859455",
          "code_system": "EPA CompTox",
          "references": [
            "5353acf0-417a-9736-b526-7b5ec56705da"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "79ff88f3-9bda-4a43-bd41-da51407fa8aa",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "72d4c770-1e83-48ea-9896-ab502d51bb81",
            "refuuid": "143b0731-8592-4c89-8d54-ac86d722fa10",
            "name": "GLUCARIC ACID",
            "unii": "QLZ991V4A2",
            "linking_id": "QLZ991V4A2",
            "ref_pname": "GLUCARIC ACID",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "1a49d10d-6810-43a7-ac50-9f751d21527b",
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "125985ac-07f5-4e2f-8acf-934203af835d",
            "refuuid": "25749664-5be6-4a41-a462-250edebd03fe",
            "name": "MONOPOTASSIUM D-GLUCARATE",
            "unii": "JK4659NLIH",
            "linking_id": "JK4659NLIH",
            "ref_pname": "MONOPOTASSIUM D-GLUCARATE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "5cc9ee9a-5864-4ebb-b611-b91286711343",
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "d61abb60-63eb-4d93-ad45-bfeac7516813",
            "refuuid": "10feb1e5-af86-4fed-b9dc-e0874d8465a0",
            "name": "POTASSIUM SODIUM SACCHARATE",
            "unii": "73U34YC90U",
            "linking_id": "73U34YC90U",
            "ref_pname": "POTASSIUM SODIUM SACCHARATE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "1a80d749-edd7-486c-89cb-c99f3c26dc94",
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "37d6b47b-d95e-49bc-87af-580c6c85ff40",
            "refuuid": "041d4773-0c02-4b94-8046-95a5aa6da6f0",
            "name": "TECHNETIUM TC-99M GLUCARATE",
            "unii": "RXZ75FE8AA",
            "linking_id": "RXZ75FE8AA",
            "ref_pname": "TECHNETIUM TC-99M GLUCARATE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "7ef8f8f4-8424-4e2a-a9dd-0e7a28cd997c",
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "ca205bea-d01a-41d0-b6f5-b376bfc165ac",
            "refuuid": "aca2cf45-2bf7-41bf-97ce-76e7dbc0f456",
            "name": "METHAMPHETAMINE SACCHARATE",
            "unii": "K2J544L5HP",
            "linking_id": "K2J544L5HP",
            "ref_pname": "METHAMPHETAMINE SACCHARATE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "85346e37-8c04-4c86-8e4b-d1db9ee818e0",
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "1bac77ad-2189-47f2-b068-01c4535e8628",
            "refuuid": "bf3b915f-1cc4-426c-9f46-f46484c7dfb3",
            "name": "CALCIUM SACCHARATE",
            "unii": "6AP9J91K4V",
            "linking_id": "6AP9J91K4V",
            "ref_pname": "CALCIUM SACCHARATE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "585ed03f-8786-41a1-b173-45853bb01daf",
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "45df2c8b-d88a-4d6c-8776-de15d9373bd1",
            "refuuid": "4918e15c-2a41-45e2-a443-703746313e1a",
            "name": "CALCIUM SACCHARATE ANHYDROUS",
            "unii": "SST07NLK7J",
            "linking_id": "SST07NLK7J",
            "ref_pname": "CALCIUM SACCHARATE ANHYDROUS",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "ff7d5425-f7b8-41a4-82e6-054b1c21f568",
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "a6554cc1-2b1a-40c1-872e-62a3b3023967",
            "refuuid": "d0a44a5d-4e0c-4815-adbb-585f97473ea8",
            "name": "DEXTROAMPHETAMINE SACCHARATE",
            "unii": "G83415V073",
            "linking_id": "G83415V073",
            "ref_pname": "DEXTROAMPHETAMINE SACCHARATE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "9138c7e2-7ec8-408c-a626-2c287618575b",
          "type": "SALT/SOLVATE->PARENT",
          "references": [
            "a4085941-8de9-446c-9f51-dd5e3aead49b"
          ],
          "related_substance": {
            "uuid": "7e10860f-bc51-4964-bd65-0b0db0245360",
            "refuuid": "59fbd80f-9595-4116-abd4-73936fde4485",
            "name": "DIPOTASSIUM GLUCARATE",
            "unii": "U9GJZ222NU",
            "linking_id": "U9GJZ222NU",
            "ref_pname": "DIPOTASSIUM GLUCARATE"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "730a4520-d1f3-4bc2-b6fb-20ef9907837d",
          "name": "D-(+)-SACCHARIC ACID",
          "stdName": "D-(+)-SACCHARIC ACID",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a91fdf2c-1db1-49d3-8e9c-02c7c129265c",
            "175bb4ba-5a9a-4720-894f-917959ee1291"
          ],
          "display_name": false
        },
        {
          "uuid": "c6eebacf-e15d-4f03-9500-2c2b26d5df88",
          "name": "D-GLUCARIC ACID",
          "stdName": "D-GLUCARIC ACID",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "175bb4ba-5a9a-4720-894f-917959ee1291",
            "8de0856d-fc76-48ce-a3fb-b31703f23310",
            "f32d82cf-7cff-45a6-b448-b9175e40d534",
            "d6bb78a6-bff5-45ff-9cc1-61947a2b9a12"
          ],
          "display_name": false
        },
        {
          "uuid": "ff178438-b4ed-4286-a901-e2b7152ba78c",
          "name": "D-GLUCARIC ACID [MI]",
          "stdName": "D-GLUCARIC ACID [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "175bb4ba-5a9a-4720-894f-917959ee1291",
            "8de0856d-fc76-48ce-a3fb-b31703f23310"
          ],
          "display_name": false
        },
        {
          "uuid": "908da2e8-f9d2-4540-9008-5dadfffe67aa",
          "name": "D-GLUCOSACCHARIC ACID",
          "stdName": "D-GLUCOSACCHARIC ACID",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "175bb4ba-5a9a-4720-894f-917959ee1291",
            "d6bb78a6-bff5-45ff-9cc1-61947a2b9a12"
          ],
          "display_name": false
        },
        {
          "uuid": "341e7f1d-9926-4cff-b561-2b736326679d",
          "name": "D-SACCHARATE",
          "stdName": "D-SACCHARATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a91fdf2c-1db1-49d3-8e9c-02c7c129265c",
            "175bb4ba-5a9a-4720-894f-917959ee1291"
          ],
          "display_name": false
        },
        {
          "uuid": "2c680b54-09d3-486a-98e7-f9f4121ac40f",
          "name": "D-SACCHARIC ACID",
          "stdName": "D-SACCHARIC ACID",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a91fdf2c-1db1-49d3-8e9c-02c7c129265c",
            "175bb4ba-5a9a-4720-894f-917959ee1291"
          ],
          "display_name": false
        },
        {
          "uuid": "05b8594e-9135-4ba3-b002-d73e1bb3690e",
          "name": "D-TETRAHYDROXYADIPIC ACID",
          "stdName": "D-TETRAHYDROXYADIPIC ACID",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "175bb4ba-5a9a-4720-894f-917959ee1291",
            "d6bb78a6-bff5-45ff-9cc1-61947a2b9a12"
          ],
          "display_name": false
        },
        {
          "uuid": "6b2ebc63-e9bd-4127-8880-06a86f315994",
          "name": "GLUCARIC ACID",
          "stdName": "GLUCARIC ACID",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "99db6da5-d5b0-4d80-9020-f01b62ccb77c",
            "2fc4e6c5-fb38-4611-9bfc-7fbc6ae1566f",
            "175bb4ba-5a9a-4720-894f-917959ee1291",
            "5a29211a-b2ee-445a-9152-4486875d69c3"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "6e727392-b849-4a33-a5fc-e2991dbcaf09",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "766c136a-5cdd-4763-9ec7-2dc8b36c799c",
          "name": "GLUCARIC ACID, D-",
          "stdName": "GLUCARIC ACID, D-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a91fdf2c-1db1-49d3-8e9c-02c7c129265c",
            "175bb4ba-5a9a-4720-894f-917959ee1291"
          ],
          "display_name": false
        },
        {
          "uuid": "5f882cae-9cfb-43d1-ae5e-b3fbe9d1417f",
          "name": "SACCHARIC ACID",
          "stdName": "SACCHARIC ACID",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "175bb4ba-5a9a-4720-894f-917959ee1291",
            "d6bb78a6-bff5-45ff-9cc1-61947a2b9a12"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "5a29211a-b2ee-445a-9152-4486875d69c3",
          "citation": "ndf-rt",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "175bb4ba-5a9a-4720-894f-917959ee1291",
          "citation": "NDF-RT",
          "doc_type": "NDF-RT",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d6bb78a6-bff5-45ff-9cc1-61947a2b9a12",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a91fdf2c-1db1-49d3-8e9c-02c7c129265c",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8de0856d-fc76-48ce-a3fb-b31703f23310",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "99db6da5-d5b0-4d80-9020-f01b62ccb77c",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5156024b-16ee-49f2-9c3a-1e53e49ab552",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390925000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f91977b8-8e04-4384-aac6-c154a637a399",
          "citation": "SRS import [QLZ991V4A2]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=QLZ991V4A2",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390925000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f32d82cf-7cff-45a6-b448-b9175e40d534",
          "citation": "D-GLUCARIC ACID [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "2fc4e6c5-fb38-4611-9bfc-7fbc6ae1566f",
          "citation": "GLUCARIC ACID [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "a4e2d402-154e-f807-09e0-f3ab900685c3",
          "citation": "RXNORM",
          "doc_type": "NLM",
          "public_domain": true
        },
        {
          "uuid": "0fef3d2a-adb2-4d8b-8b9d-ba9380caac1b",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "a4085941-8de9-446c-9f51-dd5e3aead49b",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493393040000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5353acf0-417a-9736-b526-7b5ec56705da",
          "doc_type": "SYSTEM",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "1c1b9889-205d-42c1-814a-0630814fb008",
          "id": "1c1b9889-205d-42c1-814a-0630814fb008",
          "molfile": "\n  Marvin  01132101382D          \n\n 14 13  0  0  1  0            999 V2000\n    6.6438   -2.4346    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    6.6438   -3.2595    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3628   -2.0243    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3628   -1.1947    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0726   -2.4299    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9340   -2.0244    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    5.9340   -1.2039    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2150   -2.4391    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    5.2150   -3.2642    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5052   -2.0336    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    4.5052   -1.2087    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7864   -2.4484    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7864   -3.2733    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0766   -2.0382    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  6  0  0  0\n  1  3  1  0  0  0  0\n  6  1  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  3  2  0  0  0  0\n  6  7  1  6  0  0  0\n  6  8  1  0  0  0  0\n  8  9  1  6  0  0  0\n  8 10  1  0  0  0  0\n 10 11  1  1  0  0  0\n 10 12  1  0  0  0  0\n 13 12  1  0  0  0  0\n 14 12  2  0  0  0  0\nM  END",
          "smiles": "[C@H]([C@@H]([C@H](C(=O)O)O)O)([C@@H](C(=O)O)O)O",
          "formula": "C6H10O8",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "43e83052-2f9e-4275-a8e9-d050f1cd8a45"
          },
          "defined_stereo": 4,
          "ez_centers": 0,
          "molecular_weight": "210.1391",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 4
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "143b0731-8592-4c89-8d54-ac86d722fa10",
      "version": "12",
      "structure": {
        "id": "077dcc82-f0d3-420a-884d-f655d7ad751f",
        "molfile": "\n  Marvin  01132100402D          \n\n 14 13  0  0  1  0            999 V2000\n    5.2150   -3.2642    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2150   -2.4391    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    4.5052   -2.0336    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    3.7864   -2.4484    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7864   -3.2733    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0766   -2.0382    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5052   -1.2087    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9340   -2.0244    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    6.6438   -2.4346    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    7.3628   -2.0243    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3628   -1.1947    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0726   -2.4299    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6438   -3.2595    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9340   -1.2039    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  6  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  2  0  0  0  0\n  6  4  1  0  0  0  0\n  3  7  1  1  0  0  0\n  8  2  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10  9  1  0  0  0  0\n 11 10  2  0  0  0  0\n 12 10  1  0  0  0  0\n  9 13  1  6  0  0  0\n  8 14  1  6  0  0  0\nM  END",
        "smiles": "[C@H]([C@@H]([C@H](C(=O)O)O)O)([C@@H](C(=O)O)O)O",
        "formula": "C6H10O8",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 4,
        "ez_centers": 0,
        "molecular_weight": "210.1391",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "a91fdf2c-1db1-49d3-8e9c-02c7c129265c",
          "f91977b8-8e04-4384-aac6-c154a637a399"
        ],
        "stereo_centers": 4
      },
      "unii": "QLZ991V4A2"
    }
  ]
}