{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "99e4ac15-c07d-416b-87d5-f7df61149a19",
          "code": "557-09-5",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=557-09-5",
          "code_system": "CAS",
          "references": [
            "7809a69b-c081-44da-a485-726575d4f2ac",
            "c3eae95e-c4ec-401b-b790-67b4acb56165"
          ]
        },
        {
          "uuid": "24adb80c-fbcb-4ae9-b026-15670615458a",
          "code": "C84246",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C84246",
          "code_system": "NCI_THESAURUS",
          "references": [
            "7809a69b-c081-44da-a485-726575d4f2ac"
          ]
        },
        {
          "uuid": "d2202606-9482-4ae0-881b-b9f9ea340345",
          "code": "m11599",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m11599?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "7809a69b-c081-44da-a485-726575d4f2ac"
          ]
        },
        {
          "uuid": "66cbf436-0bd5-4359-9769-198bf5634944",
          "code": "11180",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/11180",
          "code_system": "PUBCHEM",
          "references": [
            "7809a69b-c081-44da-a485-726575d4f2ac"
          ]
        },
        {
          "uuid": "6016fed7-729c-46c1-ac59-24bdc1ba07c9",
          "code": "209-156-6",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.008.325",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "7809a69b-c081-44da-a485-726575d4f2ac"
          ]
        },
        {
          "uuid": "954da8ef-7c93-e4f6-dba3-df9af22ba781",
          "code": "DTXSID2042517",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID2042517",
          "code_system": "EPA CompTox",
          "references": [
            "e5d27de2-2165-52d3-15d6-a6c9077fde40"
          ]
        },
        {
          "uuid": "e5e4458b-fa12-f966-4cae-1433aac10482",
          "code": "C737",
          "comments": "Industrial Aid[C45678]|Pesticide",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C737",
          "code_system": "NCI_THESAURUS",
          "references": [
            "25afdfc4-a548-0ae2-301f-2ab1b283b40f"
          ]
        },
        {
          "uuid": "32c44eea-cfda-49ef-80a5-94aaf97f5feb",
          "code": "QL5435GI2S",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "16e89c71-d608-e557-1794-fbf7be777da6",
          "code": "63869",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=63869",
          "code_system": "NSC",
          "references": [
            "80fa310e-45b1-0f64-3259-690e0d37ca4f"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "c2022437-ffae-49e4-94d6-fe689a05cf25",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "e39ef9e0-0e36-4122-9090-d92b65a77455",
            "refuuid": "a0cf59d1-0ce6-46d2-a53c-21c4b202ec9c",
            "name": "ZINC CATION",
            "unii": "13S1S8SF37",
            "linking_id": "13S1S8SF37",
            "ref_pname": "ZINC CATION",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "68b41d4d-a8c2-4c46-a65a-49ad59294985",
          "type": "PARENT->SALT/SOLVATE",
          "related_substance": {
            "uuid": "c13f0547-2680-4a8d-86cf-fa4c6f0a6356",
            "refuuid": "7180aff9-4e84-47ff-822c-26dae136e1a2",
            "name": "Caprylic Acid",
            "unii": "OBL58JN025",
            "linking_id": "OBL58JN025",
            "ref_pname": "Caprylic Acid",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "828074da-7cc4-4770-b98a-c76d456cfdf7",
          "type": "PARENT->SALT/SOLVATE",
          "related_substance": {
            "uuid": "88615d40-1bfb-4d1c-8c60-c7aa8547d3bb",
            "refuuid": "a0cf59d1-0ce6-46d2-a53c-21c4b202ec9c",
            "name": "ZINC CATION",
            "unii": "13S1S8SF37",
            "linking_id": "13S1S8SF37",
            "ref_pname": "ZINC CATION",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "d731c366-acfa-4be5-846b-357a54356c7c",
          "name": "NSC-63869",
          "stdName": "NSC-63869",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c0c27cb5-3888-473d-a316-d2e5034e0e3c",
            "555405f6-6e19-4c7c-96de-988bf7ca2540"
          ],
          "display_name": false
        },
        {
          "uuid": "8976eb1d-12c9-4c31-9032-86a086d8aeb6",
          "name": "OCTANOIC ACID ZINC SALT",
          "stdName": "OCTANOIC ACID ZINC SALT",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3505f2c4-feec-4d1b-a2ae-37dbf405d34a",
            "555405f6-6e19-4c7c-96de-988bf7ca2540"
          ],
          "display_name": false
        },
        {
          "uuid": "0c5d5144-538c-4813-bb8c-188d3b249af3",
          "name": "OCTANOIC ACID, ZINC SALT (2:1)",
          "stdName": "OCTANOIC ACID, ZINC SALT (2:1)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c0c27cb5-3888-473d-a316-d2e5034e0e3c",
            "555405f6-6e19-4c7c-96de-988bf7ca2540"
          ],
          "display_name": false
        },
        {
          "uuid": "53a58afc-34ac-417a-a7d7-1bc625bb36df",
          "name": "ZINC CAPRYLATE",
          "stdName": "ZINC CAPRYLATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a094fb1f-b6b5-49a7-bece-cd6d495a5ad8",
            "d321a583-3844-4327-bcb3-e46a3273b3ac",
            "c47e5730-ceda-4d1f-9e84-11c9a6087cd5",
            "555405f6-6e19-4c7c-96de-988bf7ca2540"
          ],
          "display_name": true
        },
        {
          "uuid": "93274586-e127-4a03-9e7d-6440c1b7c9b9",
          "name": "ZINC CAPRYLATE [MI]",
          "stdName": "ZINC CAPRYLATE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a094fb1f-b6b5-49a7-bece-cd6d495a5ad8",
            "555405f6-6e19-4c7c-96de-988bf7ca2540"
          ],
          "display_name": false
        },
        {
          "uuid": "8e408e90-3ab3-4841-8fb9-40c54c4c65f0",
          "name": "ZINC OCTANOATE",
          "stdName": "ZINC OCTANOATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "dbdea539-42e7-495d-9117-17d0de613ecf",
            "555405f6-6e19-4c7c-96de-988bf7ca2540"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "c47e5730-ceda-4d1f-9e84-11c9a6087cd5",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "3505f2c4-feec-4d1b-a2ae-37dbf405d34a",
          "citation": "MERCK 14TH",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "555405f6-6e19-4c7c-96de-988bf7ca2540",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a094fb1f-b6b5-49a7-bece-cd6d495a5ad8",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "dbdea539-42e7-495d-9117-17d0de613ecf",
          "citation": "cfsan",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c0c27cb5-3888-473d-a316-d2e5034e0e3c",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7809a69b-c081-44da-a485-726575d4f2ac",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389649000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a6f8e9c6-82ca-4dd7-8a3e-aa1835273912",
          "citation": "SRS import [QL5435GI2S]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=QL5435GI2S",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389649000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "678ad97d-e682-4df7-8054-c3b03280a8fc",
          "citation": "OTC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d321a583-3844-4327-bcb3-e46a3273b3ac",
          "citation": "ZINC CAPRYLATE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "e5d27de2-2165-52d3-15d6-a6c9077fde40",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=557-09-5",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "25afdfc4-a548-0ae2-301f-2ab1b283b40f",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "c3eae95e-c4ec-401b-b790-67b4acb56165",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "80fa310e-45b1-0f64-3259-690e0d37ca4f",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "1f092a53-8d32-45d4-b62d-3d6f96dac745",
          "id": "1f092a53-8d32-45d4-b62d-3d6f96dac745",
          "molfile": "\n  Marvin  01132101462D          \n\n  1  0  0  0  0  0            999 V2000\n    7.0172    0.0334    0.0000 Zn  0  2  0  0  0  0  0  0  0  0  0  0\nM  CHG  1   1   2\nM  END",
          "smiles": "[Zn+2]",
          "formula": "Zn",
          "atropisomerism": "No",
          "charge": 2,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "9acdf70a-345b-40b2-a204-27f7547aec4c"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "65.3956",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "6ab40da5-5bdb-4f91-a8ff-53a1a5ce7fcc",
          "id": "6ab40da5-5bdb-4f91-a8ff-53a1a5ce7fcc",
          "molfile": "\n  Marvin  01132105332D          \n\n 10  9  0  0  0  0            999 V2000\n    0.0051   -0.5281    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7307   -0.1308    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4357   -0.5281    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1587   -0.1308    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8535   -0.5281    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5867   -0.1308    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2815   -0.5281    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0071   -0.1308    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7019   -0.5281    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    5.0071    0.6948    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n 10  8  2  0  0  0  0\nM  CHG  1   9  -1\nM  END",
          "smiles": "CCCCCCCC(=O)[O-]",
          "formula": "C8H15O2",
          "atropisomerism": "No",
          "charge": -1,
          "count": 2,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 2,
            "units": "MOL RATIO",
            "uuid": "5065bc80-4595-4b97-af4b-608885716312"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "143.2038",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "0af368d3-364f-4aa5-9dbd-13a135b6585b",
      "version": "6",
      "structure": {
        "id": "dfb3f949-9927-473a-8f25-81458d927e27",
        "molfile": "\n  Marvin  01132111352D          \n\n 21 18  0  0  0  0            999 V2000\n    5.0071   -0.1308    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7019   -0.5281    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    5.0071    0.6948    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2815   -0.5281    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5867   -0.1308    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7307   -0.1308    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4357   -0.5281    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8535   -0.5281    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1587   -0.1308    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0051   -0.5281    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0172    0.0334    0.0000 Zn  0  2  0  0  0  0  0  0  0  0  0  0\n    5.0071   -0.1308    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7019   -0.5281    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    5.0071    0.6948    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2815   -0.5281    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5867   -0.1308    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7307   -0.1308    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4357   -0.5281    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8535   -0.5281    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1587   -0.1308    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0051   -0.5281    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n 10  6  1  0  0  0  0\n  1  2  1  0  0  0  0\n  3  1  2  0  0  0  0\n  4  1  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  9  1  0  0  0  0\n  8  5  1  0  0  0  0\n  9  8  1  0  0  0  0\n 12 13  1  0  0  0  0\n 14 12  2  0  0  0  0\n 15 12  1  0  0  0  0\n 16 15  1  0  0  0  0\n 19 16  1  0  0  0  0\n 21 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 18 20  1  0  0  0  0\n 20 19  1  0  0  0  0\nM  CHG  3   2  -1  11   2  13  -1\nM  STY  1   1 MUL\nM  SCN  1   1 HT \nM  SAL   1 15   1   2   3   4   5   6   7   8   9  10  12  13  14  15  16\nM  SAL   1  5  17  18  19  20  21\nM  SPA   1 10   1   2   3   4   5   6   7   8   9  10\nM  SDI   1  4   -0.4149   -0.9481   -0.4149    1.1148\nM  SDI   1  4    6.1219    1.1148    6.1219   -0.9481\nM  SMT   1 2\nM  END",
        "smiles": "CCCCCCCC(=O)[O-].CCCCCCCC(=O)[O-].[Zn+2]",
        "formula": "2C8H15O2.Zn",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "351.8032",
        "optical_activity": "NONE",
        "references": [
          "a6f8e9c6-82ca-4dd7-8a3e-aa1835273912",
          "678ad97d-e682-4df7-8054-c3b03280a8fc"
        ],
        "stereo_centers": 0
      },
      "unii": "QL5435GI2S"
    }
  ]
}