{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "3831889f-1ef0-4b14-8c78-c1504bda7aa5", "code": "25713-60-4", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=25713-60-4", "code_system": "CAS", "references": [ "ab6299fc-146f-4770-a872-624f9ad5b46b", "cee3242e-191a-44a0-894d-28307479c28f" ] }, { "uuid": "5bed65d8-b89c-4685-9c7e-7d7719a2ca5a", "code": "91820", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/91820", "code_system": "PUBCHEM", "references": [ "ab6299fc-146f-4770-a872-624f9ad5b46b" ] }, { "uuid": "37a16855-2085-46fb-d6b9-d1a85a9a92a5", "code": "DTXSID0058695", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID0058695", "code_system": "EPA CompTox", "references": [ "68e58f48-6bcb-ebdf-6ad5-eaa53c2f0f65" ] }, { "uuid": "6cf2b4bf-af3d-4652-a15b-8a74581d13cb", "code": "m11203", "type": "PRIMARY", "url": "https://merckindex.rsc.org/monographs/m11203", "code_system": "MERCK INDEX", "references": [ "b91c127b-56a0-8be6-3444-47c407ed241f" ] }, { "uuid": "5c26848f-710e-4a70-8d09-558d3fedab16", "code": "QKS4PD9ZS8", "type": "PRIMARY", "code_system": "FDA UNII" } ], "substance_class": "chemical", "names": [ { "uuid": "4d9d6f6a-794a-4007-b7be-3863fe41e7af", "name": "1,3,5-TRIAZINE, 2,4,6-TRIS(2,4,6-TRIBROMOPHENOXY)-", "stdName": "1,3,5-TRIAZINE, 2,4,6-TRIS(2,4,6-TRIBROMOPHENOXY)-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "56a482c6-0ada-48be-81de-d450933aec91", "fa66e725-5307-4d29-ac52-97fa9b4535cf" ], "display_name": false }, { "uuid": "a94e6842-ab24-456e-991c-48107aa429f0", "name": "2,4,6-TRIS(2,4,6-TRIBROMOPHENOXY)-1,3,5-TRIAZINE", "stdName": "2,4,6-TRIS(2,4,6-TRIBROMOPHENOXY)-1,3,5-TRIAZINE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "cee3242e-191a-44a0-894d-28307479c28f" ], "display_name": true }, { "uuid": "10efb2c2-7618-4cef-94c2-2b5b7cf05ee0", "name": "FR-235", "stdName": "FR-235", "type": "cd", "languages": [ "en" ], "preferred": false, "references": [ "56a482c6-0ada-48be-81de-d450933aec91", "fa66e725-5307-4d29-ac52-97fa9b4535cf" ], "display_name": false }, { "uuid": "7e670f3d-fcb2-4d60-84bc-c388fc922300", "name": "FR-245", "stdName": "FR-245", "type": "cd", "languages": [ "en" ], "preferred": false, "references": [ "56a482c6-0ada-48be-81de-d450933aec91", "fa66e725-5307-4d29-ac52-97fa9b4535cf" ], "display_name": false }, { "uuid": "ef384052-e58f-45b4-b538-b781c220e897", "name": "FR-368", "stdName": "FR-368", "type": "cd", "languages": [ "en" ], "preferred": false, "references": [ "56a482c6-0ada-48be-81de-d450933aec91", "fa66e725-5307-4d29-ac52-97fa9b4535cf" ], "display_name": false }, { "uuid": "570f05af-3e01-4977-adf0-e031d4ce24d9", "name": "GX-6145", "stdName": "GX-6145", "type": "cd", "languages": [ "en" ], "preferred": false, "references": [ "56a482c6-0ada-48be-81de-d450933aec91", "fa66e725-5307-4d29-ac52-97fa9b4535cf" ], "display_name": false }, { "uuid": "2c4e4ef8-848d-4e8c-965d-91336a1cb592", "name": "PYROGUARD SR-245", "stdName": "PYROGUARD SR-245", "type": "cd", "languages": [ "en" ], "preferred": false, "references": [ "56a482c6-0ada-48be-81de-d450933aec91", "fa66e725-5307-4d29-ac52-97fa9b4535cf" ], "display_name": false }, { "uuid": "257b4967-985a-4b10-9788-668ab7aadaf5", "name": "TRIS(2,4,6-TRIBROMOPHENOXY)-S-TRIAZINE", "stdName": "TRIS(2,4,6-TRIBROMOPHENOXY)-S-TRIAZINE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "56a482c6-0ada-48be-81de-d450933aec91", "fa66e725-5307-4d29-ac52-97fa9b4535cf" ], "display_name": false }, { "uuid": "a7a26e1b-452f-446c-8a1d-60c44768c73d", "name": "TRIS(TRIBROMOPHENOXY)TRIAZINE", "stdName": "TRIS(TRIBROMOPHENOXY)TRIAZINE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "225e5e25-accb-45b9-96de-ba283fd6e003", "fa66e725-5307-4d29-ac52-97fa9b4535cf" ], "display_name": false }, { "uuid": "8cbf40f7-567d-1eec-6cda-35125050d99f", "name": "TRIS(TRIBROMOPHENOXY)TRIAZINE [MI]", "stdName": "TRIS(TRIBROMOPHENOXY)TRIAZINE [MI]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "b91c127b-56a0-8be6-3444-47c407ed241f" ], "display_name": false } ], "references": [ { "uuid": "225e5e25-accb-45b9-96de-ba283fd6e003", "citation": "MERCK INDEX", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "fa66e725-5307-4d29-ac52-97fa9b4535cf", "citation": "MERCK INDEX", "doc_type": "MERCK INDEX", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "56a482c6-0ada-48be-81de-d450933aec91", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "ab6299fc-146f-4770-a872-624f9ad5b46b", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493392603000, "tags": [ "NOMEN" ] }, { "uuid": "68e58f48-6bcb-ebdf-6ad5-eaa53c2f0f65", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=25713-60-4", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "b91c127b-56a0-8be6-3444-47c407ed241f", "citation": "MI", "doc_type": "MERCK INDEX", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE", "NOMEN" ] }, { "uuid": "cee3242e-191a-44a0-894d-28307479c28f", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "c448331f-ac68-474a-8c1d-1c0d8ddd7140", "id": "c448331f-ac68-474a-8c1d-1c0d8ddd7140", "molfile": "\n Marvin 01132110092D \n\n 36 39 0 0 0 0 999 V2000\n 4.6150 -2.4227 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2205 -3.1401 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.6150 -3.8575 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2205 -4.5749 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.6150 -5.2564 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0\n 3.3955 -4.5749 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.9650 -5.2922 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1400 -5.2922 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.7096 -5.9738 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 0.8846 -5.9738 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.4900 -6.7270 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 0.8846 -7.4445 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.4900 -8.1618 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.3350 -8.1618 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0\n 0.9205 -8.8792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.7096 -8.8792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1400 -9.5608 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1400 -8.1260 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.7096 -7.4086 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1400 -6.6911 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0\n 0.4542 -5.2922 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 0.8846 -4.5749 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.4900 -3.8575 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -0.3708 -3.8216 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.7654 -3.1042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.3350 -2.3868 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0\n -1.5904 -3.1042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.0208 -3.8216 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.8458 -3.7858 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0\n -1.5904 -4.5390 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.7654 -4.5390 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.3708 -5.2564 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0\n 1.7096 -4.5749 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 2.9650 -3.8575 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1400 -3.8575 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0\n 3.3955 -3.1401 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 1 0 0 0 0\n 2 36 2 0 0 0 0\n 3 4 2 0 0 0 0\n 5 4 1 0 0 0 0\n 4 6 1 0 0 0 0\n 6 7 1 0 0 0 0\n 34 6 2 0 0 0 0\n 7 8 1 0 0 0 0\n 9 8 1 0 0 0 0\n 8 33 2 0 0 0 0\n 10 9 2 0 0 0 0\n 11 10 1 0 0 0 0\n 21 10 1 0 0 0 0\n 12 11 1 0 0 0 0\n 13 12 1 0 0 0 0\n 19 12 2 0 0 0 0\n 14 13 1 0 0 0 0\n 15 13 2 0 0 0 0\n 16 15 1 0 0 0 0\n 17 16 1 0 0 0 0\n 16 18 2 0 0 0 0\n 18 19 1 0 0 0 0\n 20 19 1 0 0 0 0\n 22 21 2 0 0 0 0\n 23 22 1 0 0 0 0\n 22 33 1 0 0 0 0\n 24 23 1 0 0 0 0\n 25 24 1 0 0 0 0\n 31 24 2 0 0 0 0\n 26 25 1 0 0 0 0\n 27 25 2 0 0 0 0\n 28 27 1 0 0 0 0\n 29 28 1 0 0 0 0\n 28 30 2 0 0 0 0\n 30 31 1 0 0 0 0\n 32 31 1 0 0 0 0\n 35 34 1 0 0 0 0\n 36 34 1 0 0 0 0\nM END", "smiles": "c1c(cc(c(c1Br)Oc2nc(nc(n2)Oc3c(cc(cc3Br)Br)Br)Oc4c(cc(cc4Br)Br)Br)Br)Br", "formula": "C21H6Br9N3O3", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "05397b82-ecad-4b0c-af0d-82c8a8bfd7a3" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "1067.4232", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "56b1b66a-7174-4b9d-bff4-6c0944d315cf", "version": "7", "structure": { "id": "c69cef61-1924-48a0-a0c7-4ebee079cb97", "molfile": "\n Marvin 01132110162D \n\n 36 39 0 0 0 0 999 V2000\n 1.7096 -4.5749 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1400 -5.2922 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.7096 -5.9738 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 0.8846 -5.9738 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.4542 -5.2922 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 0.8846 -4.5749 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.9650 -5.2922 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3.3955 -4.5749 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2205 -4.5749 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.9650 -3.8575 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.6150 -3.8575 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.3955 -3.1401 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2205 -3.1401 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.6150 -5.2564 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0\n 4.6150 -2.4227 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1400 -3.8575 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0\n 0.4900 -6.7270 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 0.8846 -7.4445 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.4900 -8.1618 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.7096 -7.4086 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.9205 -8.8792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1400 -8.1260 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.7096 -8.8792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.3350 -8.1618 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1400 -9.5608 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1400 -6.6911 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0\n 0.4900 -3.8575 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -0.3708 -3.8216 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.7654 -3.1042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.7654 -4.5390 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.5904 -3.1042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.5904 -4.5390 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.0208 -3.8216 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.3350 -2.3868 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0\n -2.8458 -3.7858 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0\n -0.3708 -5.2564 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 2 0 0 0 0\n 6 1 1 0 0 0 0\n 3 2 1 0 0 0 0\n 7 2 1 0 0 0 0\n 4 3 2 0 0 0 0\n 5 4 1 0 0 0 0\n 17 4 1 0 0 0 0\n 6 5 2 0 0 0 0\n 27 6 1 0 0 0 0\n 8 7 1 0 0 0 0\n 9 8 2 0 0 0 0\n 10 8 1 0 0 0 0\n 11 9 1 0 0 0 0\n 14 9 1 0 0 0 0\n 12 10 2 0 0 0 0\n 16 10 1 0 0 0 0\n 13 11 2 0 0 0 0\n 13 12 1 0 0 0 0\n 15 13 1 0 0 0 0\n 18 17 1 0 0 0 0\n 19 18 2 0 0 0 0\n 20 18 1 0 0 0 0\n 21 19 1 0 0 0 0\n 24 19 1 0 0 0 0\n 22 20 2 0 0 0 0\n 26 20 1 0 0 0 0\n 23 21 2 0 0 0 0\n 23 22 1 0 0 0 0\n 25 23 1 0 0 0 0\n 28 27 1 0 0 0 0\n 29 28 2 0 0 0 0\n 30 28 1 0 0 0 0\n 31 29 1 0 0 0 0\n 34 29 1 0 0 0 0\n 32 30 2 0 0 0 0\n 36 30 1 0 0 0 0\n 33 31 2 0 0 0 0\n 33 32 1 0 0 0 0\n 35 33 1 0 0 0 0\nM END", "smiles": "c1c(cc(c(c1Br)Oc2nc(nc(n2)Oc3c(cc(cc3Br)Br)Br)Oc4c(cc(cc4Br)Br)Br)Br)Br", "formula": "C21H6Br9N3O3", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "1067.4232", "optical_activity": "NONE", "references": [ "56a482c6-0ada-48be-81de-d450933aec91" ], "stereo_centers": 0 }, "unii": "QKS4PD9ZS8" } ] }