{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "a6167336-5efb-4b1d-8264-624e05aed130",
          "code": "548-54-9",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=548-54-9",
          "code_system": "CAS",
          "references": [
            "007b8986-0a79-4bfa-a38a-68200549f165",
            "4b73ca66-4679-44d0-a3a1-672f20f374ce"
          ]
        },
        {
          "uuid": "8319e2c5-4cd7-4229-9f7c-5de138a0c00d",
          "code": "m11463",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m11463?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "007b8986-0a79-4bfa-a38a-68200549f165"
          ]
        },
        {
          "uuid": "badc394d-7a14-417a-90be-80fddb4a4f56",
          "code": "9928039",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/9928039",
          "code_system": "PUBCHEM",
          "references": [
            "007b8986-0a79-4bfa-a38a-68200549f165"
          ]
        },
        {
          "uuid": "b6d5bacb-7deb-8727-ab41-f8cf0431f73b",
          "code": "DTXSID001028415",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID001028415",
          "code_system": "EPA CompTox"
        },
        {
          "uuid": "50269263-2f10-4847-8b90-3a1c62a2235e",
          "code": "QJH0DSQ3SG",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "35aa0838-4c20-60da-cf53-fe87f7a897da",
          "code": "Violacein",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Violacein",
          "code_system": "WIKIPEDIA",
          "references": [
            "eb773e6f-7121-556e-947e-3ad2151ec40b"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "20107acc-c6d8-4478-b6d2-5f39f151382b",
          "name": "(3E)-3-(1,2-DIHYDRO-5-(5-HYDROXY-1H-INDOL-3-YL)-2-OXO-3H-PYRROL-3-YLIDENE)-1,3-DIHYDRO-2H-INDOL-2-ONE",
          "stdName": "(3E)-3-(1,2-DIHYDRO-5-(5-HYDROXY-1H-INDOL-3-YL)-2-OXO-3H-PYRROL-3-YLIDENE)-1,3-DIHYDRO-2H-INDOL-2-ONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4832f657-2212-48d9-b972-eeacf7c50ac1",
            "49d26e02-9bb8-4f93-8c17-4b30acd34eeb"
          ],
          "display_name": false
        },
        {
          "uuid": "1e630fe3-2829-433c-8ce7-238d8924f8be",
          "name": "2H-INDOL-2-ONE, 3-(1,2-DIHYDRO-5-(5-HYDROXY-1H-INDOL-3-YL)-2-OXO-3H-PYRROL-3-YLIDENE)-1,3-DIHYDRO-, (3E)-",
          "stdName": "2H-INDOL-2-ONE, 3-(1,2-DIHYDRO-5-(5-HYDROXY-1H-INDOL-3-YL)-2-OXO-3H-PYRROL-3-YLIDENE)-1,3-DIHYDRO-, (3E)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6e7b7679-e995-48ec-8731-9e914bb34930",
            "49d26e02-9bb8-4f93-8c17-4b30acd34eeb"
          ],
          "display_name": false
        },
        {
          "uuid": "1248d74d-6775-4d80-b733-3fd6bfe08241",
          "name": "VIOLACEIN",
          "stdName": "VIOLACEIN",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c35bbc78-1896-48f7-a995-7fb2693a69ad",
            "0b2c4c56-e23e-4443-8bae-f2cf5253c7ff",
            "4832f657-2212-48d9-b972-eeacf7c50ac1",
            "49d26e02-9bb8-4f93-8c17-4b30acd34eeb"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "5517fad3-3802-4cf0-8451-f376a907d760",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "86e525b4-cfb4-4eb0-b462-b288ec48e501",
          "name": "VIOLACEIN [MI]",
          "stdName": "VIOLACEIN [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4832f657-2212-48d9-b972-eeacf7c50ac1",
            "49d26e02-9bb8-4f93-8c17-4b30acd34eeb"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "4832f657-2212-48d9-b972-eeacf7c50ac1",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "49d26e02-9bb8-4f93-8c17-4b30acd34eeb",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6e7b7679-e995-48ec-8731-9e914bb34930",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c35bbc78-1896-48f7-a995-7fb2693a69ad",
          "citation": "Merk Index",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "007b8986-0a79-4bfa-a38a-68200549f165",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392603000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c0561555-cf30-4dde-8894-fb3b74a21f1e",
          "citation": "SRS import [QJH0DSQ3SG]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=QJH0DSQ3SG",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392603000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3d413a28-bb4c-4570-8397-c0414452afff",
          "citation": "MERK INDEX MONOGRAPH: MONO1500010193",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0b2c4c56-e23e-4443-8bae-f2cf5253c7ff",
          "citation": "VIOLACEIN [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "eb773e6f-7121-556e-947e-3ad2151ec40b",
          "citation": "WIKI",
          "doc_type": "WIKI",
          "public_domain": true
        },
        {
          "uuid": "e8dabe1f-054d-26b3-0798-83bc3d6c2021",
          "citation": "PCPC",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true
        },
        {
          "uuid": "4b73ca66-4679-44d0-a3a1-672f20f374ce",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "62cc8f42-d6b8-4947-b8de-8b380e010ceb",
          "id": "62cc8f42-d6b8-4947-b8de-8b380e010ceb",
          "molfile": "\n  Marvin  01132105082D          \n\n 26 30  0  0  0  0            999 V2000\n    5.7928   -3.8830    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4603   -3.3981    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4603   -2.5731    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2449   -2.3182    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5805   -1.5645    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4009   -1.4782    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8858   -2.1457    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5503   -2.8993    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7298   -2.9856    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2449   -3.6530    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4998   -4.4376    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0149   -5.1051    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4998   -5.7726    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2844   -5.5176    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2844   -4.6926    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9519   -4.2077    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2449   -6.5572    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7298   -7.2246    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2449   -7.8920    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4603   -7.6371    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7458   -8.0496    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0313   -7.6371    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0313   -6.8121    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3169   -6.3996    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7458   -6.3996    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4603   -6.8121    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  2 10  2  0  0  0  0\n  3  4  1  0  0  0  0\n  5  4  1  0  0  0  0\n  9  4  2  0  0  0  0\n  6  5  2  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  2  0  0  0  0\n  9  8  1  0  0  0  0\n 10  9  1  0  0  0  0\n 10 11  1  0  0  0  0\n 12 11  2  0  0  0  0\n 11 15  1  0  0  0  0\n 13 12  1  0  0  0  0\n 13 14  2  0  0  0  0\n 17 13  1  0  0  0  0\n 15 14  1  0  0  0  0\n 15 16  2  0  0  0  0\n 18 17  2  0  0  0  0\n 26 17  1  0  0  0  0\n 19 18  1  0  0  0  0\n 20 19  1  0  0  0  0\n 20 21  1  0  0  0  0\n 26 20  2  0  0  0  0\n 21 22  2  0  0  0  0\n 23 22  1  0  0  0  0\n 24 23  1  0  0  0  0\n 23 25  2  0  0  0  0\n 25 26  1  0  0  0  0\nM  END",
          "smiles": "c1ccc2c(c1)c(C3=CC(=NC3=O)c4c[nH]c5ccc(cc45)O)c([nH]2)O",
          "formula": "C20H13N3O3",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "a01d60d1-b747-4b79-879e-6b618b838581"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "343.3363",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "7c769e8e-c479-4d5c-ad44-5575e54bdbfa",
      "version": "6",
      "structure": {
        "id": "e719f4bf-4be3-4d7e-a807-dc0a4b414e0e",
        "molfile": "\n  Marvin  01132111582D          \n\n 26 30  0  0  0  0            999 V2000\n    4.3169   -6.3996    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0313   -6.8121    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0313   -7.6371    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7458   -8.0496    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4603   -7.6371    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2449   -7.8920    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7298   -7.2246    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2449   -6.5572    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4998   -5.7726    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2844   -5.5176    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2844   -4.6926    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9519   -4.2077    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4998   -4.4376    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2449   -3.6530    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4603   -3.3981    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4603   -2.5731    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2449   -2.3182    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5805   -1.5645    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4009   -1.4782    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8858   -2.1457    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5503   -2.8993    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7298   -2.9856    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7928   -3.8830    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0149   -5.1051    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4603   -6.8121    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7458   -6.3996    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  4  3  2  0  0  0  0\n  5  4  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  2  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 11 10  1  0  0  0  0\n 11 12  2  0  0  0  0\n 13 11  1  0  0  0  0\n 14 13  2  0  0  0  0\n 15 14  1  0  0  0  0\n 16 15  1  0  0  0  0\n 16 17  1  0  0  0  0\n 18 17  2  0  0  0  0\n 19 18  1  0  0  0  0\n 20 19  2  0  0  0  0\n 21 20  1  0  0  0  0\n 14 22  1  0  0  0  0\n 22 21  2  0  0  0  0\n 22 17  1  0  0  0  0\n 15 23  2  0  0  0  0\n 24 13  1  0  0  0  0\n  9 24  2  0  0  0  0\n 25  8  1  0  0  0  0\n 25  5  2  0  0  0  0\n 26 25  1  0  0  0  0\n  2 26  2  0  0  0  0\nM  END",
        "smiles": "c1ccc2c(c1)/C(=C\\3/C=C(c4c[nH]c5ccc(cc45)O)NC3=O)/C(=O)N2",
        "formula": "C20H13N3O3",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 1,
        "molecular_weight": "343.3363",
        "optical_activity": "NONE",
        "references": [
          "c0561555-cf30-4dde-8894-fb3b74a21f1e",
          "3d413a28-bb4c-4570-8397-c0414452afff"
        ],
        "stereo_centers": 0
      },
      "unii": "QJH0DSQ3SG"
    }
  ]
}