{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "0d0f1c9b-53f6-48e5-bb03-8b5fc88e64ac",
          "code": "10102-75-7",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=10102-75-7",
          "code_system": "CAS",
          "references": [
            "8a66005e-5195-417b-a20e-1e473951a88c",
            "217fb17d-9e87-4d73-a3e2-7797ea23e993"
          ]
        },
        {
          "uuid": "0b388cd9-45f3-4c0b-9341-f4d2224f3dd3",
          "code": "CALCIUM BROMATE",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Calcium_bromate",
          "code_system": "WIKIPEDIA",
          "references": [
            "8a66005e-5195-417b-a20e-1e473951a88c"
          ]
        },
        {
          "uuid": "d19f3e07-8fbd-41ea-88b6-e7d6cb455b04",
          "code": "233-278-9",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.030.240",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "8a66005e-5195-417b-a20e-1e473951a88c"
          ]
        },
        {
          "uuid": "eec40b13-fafb-4842-a7b2-c07abd90ceaa",
          "code": "61478",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/61478",
          "code_system": "PUBCHEM",
          "references": [
            "8a66005e-5195-417b-a20e-1e473951a88c"
          ]
        },
        {
          "uuid": "45010ba8-2314-7ab3-60d5-7fa780d89df1",
          "code": "DTXSID30143676",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID30143676",
          "code_system": "EPA CompTox",
          "references": [
            "ebf2cbd9-3103-c740-44e9-afd461f3139c"
          ]
        },
        {
          "uuid": "d4364976-e7ef-4b1d-95f5-05ffaeb71905",
          "code": "QJ2S78C3RO",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "e2c87f9c-37d7-bcfe-a625-a2e1e935c5fb",
          "code": "2601447",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/2601447/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "994212b8-53fa-0828-4802-40f96b0106f7"
          ]
        },
        {
          "uuid": "d08fd18e-8e05-a915-a08f-85f3e67d39ac",
          "code": "QJ2S78C3RO",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=QJ2S78C3RO",
          "code_system": "DAILYMED",
          "references": [
            "21740c3b-2b32-531d-f453-104dcf98aff6"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "07b26727-667c-4776-8995-fe7dd9299f3a",
          "name": "CALCIUM BROMATE",
          "stdName": "CALCIUM BROMATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fd96c550-c019-41f0-9213-77d421c4bc76",
            "d8195c6f-3c2e-41b8-919d-504d4f40a5af",
            "feac5bee-289c-4cc7-9414-9f8e893e3560"
          ],
          "display_name": true
        },
        {
          "uuid": "45105f3d-a973-4fa3-8591-2e330a4fc196",
          "name": "CALCIUM BROMATE [FCC]",
          "stdName": "CALCIUM BROMATE [FCC]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fd96c550-c019-41f0-9213-77d421c4bc76",
            "feac5bee-289c-4cc7-9414-9f8e893e3560"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "fd96c550-c019-41f0-9213-77d421c4bc76",
          "citation": "FCC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "feac5bee-289c-4cc7-9414-9f8e893e3560",
          "citation": "USP FOOD CHEMICALS CODEX",
          "doc_type": "USP FOOD CHEMICALS CODEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8a66005e-5195-417b-a20e-1e473951a88c",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390831000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b81c8507-e94e-4283-ab16-e52034dedb3c",
          "citation": "SRS import [QJ2S78C3RO]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=QJ2S78C3RO",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390831000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d8195c6f-3c2e-41b8-919d-504d4f40a5af",
          "citation": "CALCIUM BROMATE [FCC]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "ebf2cbd9-3103-c740-44e9-afd461f3139c",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=10102-75-7",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "994212b8-53fa-0828-4802-40f96b0106f7",
          "citation": "RXNORM",
          "doc_type": "NLM",
          "public_domain": true
        },
        {
          "uuid": "217fb17d-9e87-4d73-a3e2-7797ea23e993",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "21740c3b-2b32-531d-f453-104dcf98aff6",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "57c1936a-e189-4ac3-95f5-5a573ad57889",
          "id": "57c1936a-e189-4ac3-95f5-5a573ad57889",
          "molfile": "\n  Marvin  01132104332D          \n\n  1  0  0  0  0  0            999 V2000\n    7.4184   -0.0944    0.0000 Ca  0  2  0  0  0  0  0  0  0  0  0  0\nM  CHG  1   1   2\nM  END",
          "smiles": "[Ca+2]",
          "formula": "Ca",
          "atropisomerism": "No",
          "charge": 2,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "de59076a-7a65-4605-96aa-3a1a4f4e3ddc"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "40.078",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "b162ad03-8954-43d7-a050-b28409b8c4ab",
          "id": "b162ad03-8954-43d7-a050-b28409b8c4ab",
          "molfile": "\n  Marvin  01132109122D          \n\n  4  3  0  0  0  0            999 V2000\n    5.5759   -2.0297    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    4.8643   -1.6172    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0\n    4.1494   -2.0331    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8609   -0.7922    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  2  0  0  0  0\n  2  4  2  0  0  0  0\nM  CHG  1   1  -1\nM  END",
          "smiles": "Br(=O)(=O)[O-]",
          "formula": "BrO3",
          "atropisomerism": "No",
          "charge": -1,
          "count": 2,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 2,
            "units": "MOL RATIO",
            "uuid": "bed3a4b8-f8c1-4311-a3bd-20a4f877194d"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "127.9017",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "a9ec11cb-7eeb-421d-8b7a-6b25a58417ef",
      "version": "8",
      "structure": {
        "id": "345fa8c7-d49a-4875-9eba-823eda059b77",
        "molfile": "\n  Marvin  01132102482D          \n\n  9  6  0  0  0  0            999 V2000\n    4.8643   -1.6172    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0\n    4.1494   -2.0331    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8609   -0.7922    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5759   -2.0297    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    7.4184   -0.0944    0.0000 Ca  0  2  0  0  0  0  0  0  0  0  0  0\n    4.8643   -1.6172    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0\n    4.1494   -2.0331    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8609   -0.7922    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5759   -2.0297    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n  1  4  1  0  0  0  0\n  1  2  2  0  0  0  0\n  1  3  2  0  0  0  0\n  6  9  1  0  0  0  0\n  6  7  2  0  0  0  0\n  6  8  2  0  0  0  0\nM  CHG  3   4  -1   5   2   9  -1\nM  STY  1   1 MUL\nM  SCN  1   1 HT \nM  SAL   1  8   1   2   3   4   6   7   8   9\nM  SPA   1  4   1   2   3   4\nM  SDI   1  4    3.7294   -2.4531    3.7294   -0.3722\nM  SDI   1  4    5.9959   -0.3722    5.9959   -2.4531\nM  SMT   1 2\nM  END",
        "smiles": "Br(=O)(=O)[O-].Br(=O)(=O)[O-].[Ca+2]",
        "formula": "2BrO3.Ca",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "295.8815",
        "optical_activity": "NONE",
        "references": [
          "fd96c550-c019-41f0-9213-77d421c4bc76",
          "b81c8507-e94e-4283-ab16-e52034dedb3c"
        ],
        "stereo_centers": 0
      },
      "unii": "QJ2S78C3RO"
    }
  ]
}