{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "f0029b21-40d8-444f-a82a-8d3230736c97",
          "code": "847250-25-3",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=847250-25-3",
          "code_system": "CAS",
          "references": [
            "fc640c64-82ee-4111-87f6-4a10c94bc1ff",
            "a483e8ad-d935-4e06-9ac1-bec1263cc88e"
          ]
        },
        {
          "uuid": "4566d03c-c59e-4704-80cf-d09d2a45566d",
          "code": "11674052",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/11674052",
          "code_system": "PUBCHEM",
          "references": [
            "fc640c64-82ee-4111-87f6-4a10c94bc1ff"
          ]
        },
        {
          "uuid": "0db1b226-bfbb-4af3-be39-678551349332",
          "code": "QID2K1DVZF",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "69e18708-f331-4572-b464-d0c3d83d83ee",
          "name": "1,4-BENZENEDICARBOXAMIDE, N1-HYDROXY-N4-TRICYCLO(3.3.1.13,7)DEC-1-YL-",
          "stdName": "1,4-BENZENEDICARBOXAMIDE, N1-HYDROXY-N4-TRICYCLO(3.3.1.13,7)DEC-1-YL-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "521ec167-59d9-4be0-ab4a-2990c1766ac1",
            "69aa4045-8221-40dc-8e64-f4c41d42223e"
          ],
          "display_name": false
        },
        {
          "uuid": "f7333253-aa2b-4589-ab91-1f06e36509b7",
          "name": "ADAMANTANYL HYDROXYLTEREPHTHALAMIDE",
          "stdName": "ADAMANTANYL HYDROXYLTEREPHTHALAMIDE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b870d8c2-5963-493e-b2ab-6886ac145186",
            "69aa4045-8221-40dc-8e64-f4c41d42223e",
            "b75cbcf4-d97f-4c70-8220-7ea461c1efd0"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "13d5a0e5-1cc5-4ffb-bc4c-89338989f208",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "22a465d0-f4bd-420e-97f0-45ed60fde7cf",
          "name": "ECLATNOID AP138",
          "stdName": "ECLATNOID AP138",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b870d8c2-5963-493e-b2ab-6886ac145186",
            "69aa4045-8221-40dc-8e64-f4c41d42223e"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "b870d8c2-5963-493e-b2ab-6886ac145186",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "69aa4045-8221-40dc-8e64-f4c41d42223e",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "521ec167-59d9-4be0-ab4a-2990c1766ac1",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "fc640c64-82ee-4111-87f6-4a10c94bc1ff",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391327000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ff89d17f-c879-44bf-80a6-467962326919",
          "citation": "SRS import [QID2K1DVZF]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=QID2K1DVZF",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391327000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b75cbcf4-d97f-4c70-8220-7ea461c1efd0",
          "citation": "ADAMANTANYL HYDROXYLTEREPHTHALAMIDE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "a483e8ad-d935-4e06-9ac1-bec1263cc88e",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "388aa54b-4aaa-47e9-b1f5-4b1726b86e9d",
          "id": "388aa54b-4aaa-47e9-b1f5-4b1726b86e9d",
          "molfile": "\n  Marvin  01132103002D          \n\n 23 26  0  0  0  0            999 V2000\n    7.5972   -4.8861    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1915   -5.6044    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6107   -6.3150    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4356   -6.3072    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2049   -7.0333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6242   -7.7438    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2184   -8.4622    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3934   -8.4700    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9742   -7.7594    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3800   -7.0411    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9877   -9.1883    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4069   -9.8988    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1627   -9.1961    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7570   -9.9144    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2887  -10.8150    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7748  -11.7251    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7677  -11.1203    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2420  -10.8245    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7222  -11.1311    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1953  -10.8354    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7282  -11.7347    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7115   -9.9240    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2359  -10.2209    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  3  4  2  0  0  0  0\n  5  3  1  0  0  0  0\n  5  6  1  0  0  0  0\n 10  5  2  0  0  0  0\n  6  7  2  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  2  0  0  0  0\n  8 11  1  0  0  0  0\n  9 10  1  0  0  0  0\n 11 12  2  0  0  0  0\n 11 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 14 22  1  0  0  0  0\n 14 23  1  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 16 21  1  0  0  0  0\n 18 17  1  0  0  0  0\n 18 19  1  0  0  0  0\n 18 23  1  0  0  0  0\n 20 19  1  0  0  0  0\n 21 20  1  0  0  0  0\n 20 22  1  0  0  0  0\nM  END",
          "smiles": "c1cc(ccc1C(=O)NC23CC4CC(CC(C4)C2)C3)C(=O)NO",
          "formula": "C18H22N2O3",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "1c415e36-0129-4ddc-9c76-2a0423f91166"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "314.3796",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "66f6d21e-dd26-4357-914a-f47426f0498a",
      "version": "4",
      "structure": {
        "id": "d3f52a00-9f01-4099-a461-cd24afd98c99",
        "molfile": "\n  Marvin  01132110592D          \n\n 23 26  0  0  0  0            999 V2000\n    7.6242   -7.7438    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2184   -8.4622    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3934   -8.4700    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9877   -9.1883    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4069   -9.8988    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1627   -9.1961    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7570   -9.9144    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2359  -10.2209    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2420  -10.8245    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7677  -11.1203    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7748  -11.7251    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7282  -11.7347    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1953  -10.8354    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7222  -11.1311    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7115   -9.9240    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2887  -10.8150    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9742   -7.7594    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3800   -7.0411    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2049   -7.0333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6107   -6.3150    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4356   -6.3072    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1915   -5.6044    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5972   -4.8861    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  2  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  2  0  0  0  0\n  4  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  9  8  1  0  0  0  0\n  9 10  1  0  0  0  0\n 11 10  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n  9 14  1  0  0  0  0\n 13 15  1  0  0  0  0\n  7 15  1  0  0  0  0\n 16 11  1  0  0  0  0\n  7 16  1  0  0  0  0\n  3 17  1  0  0  0  0\n 17 18  2  0  0  0  0\n 18 19  1  0  0  0  0\n 19  1  2  0  0  0  0\n 19 20  1  0  0  0  0\n 20 21  2  0  0  0  0\n 20 22  1  0  0  0  0\n 22 23  1  0  0  0  0\nM  END",
        "smiles": "c1cc(ccc1C(=O)NC23CC4CC(CC(C4)C2)C3)C(=O)NO",
        "formula": "C18H22N2O3",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "314.3796",
        "optical_activity": "NONE",
        "references": [
          "b870d8c2-5963-493e-b2ab-6886ac145186",
          "ff89d17f-c879-44bf-80a6-467962326919"
        ],
        "stereo_centers": 0
      },
      "unii": "QID2K1DVZF"
    }
  ]
}