{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "1a5f3925-1b37-4179-888f-4cff5223e4c6",
          "code": "QP53AX65",
          "comments": "VATC|ECTOPARACITICIDES,  INSECTICIDES AND REPELLENTS|ECTOPARASITICIDES FOR TOPICAL USE, INCL. INSECTICIDES|Other ectoparasiticides for topical use|fipronil, combinations",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QP53AX65&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "8cd18c85-9678-4859-ad84-a1e3e009c15f"
          ]
        },
        {
          "uuid": "3a61d46d-5f48-4a0f-846a-25df16f172fe",
          "code": "QP53AX15",
          "comments": "VATC|ECTOPARACITICIDES,  INSECTICIDES AND REPELLENTS|ECTOPARASITICIDES FOR TOPICAL USE, INCL. INSECTICIDES|Other ectoparasiticides for topical use|fipronil",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QP53AX15&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "8cd18c85-9678-4859-ad84-a1e3e009c15f"
          ]
        },
        {
          "uuid": "4876e432-1cb6-4701-9887-c602208c66ad",
          "code": "120068-37-3",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=120068-37-3",
          "code_system": "CAS",
          "references": [
            "8cd18c85-9678-4859-ad84-a1e3e009c15f",
            "92cf244c-9389-48c3-a84a-ca4d1d7ba23e"
          ]
        },
        {
          "uuid": "a3916c35-e3e9-490e-be64-8cf2844db5e1",
          "code": "C74341",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C74341",
          "code_system": "NCI_THESAURUS",
          "references": [
            "8cd18c85-9678-4859-ad84-a1e3e009c15f"
          ]
        },
        {
          "uuid": "73254986-0e59-4231-9862-501843b3bf6b",
          "code": "C082360",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67082360",
          "code_system": "MESH",
          "references": [
            "8cd18c85-9678-4859-ad84-a1e3e009c15f"
          ]
        },
        {
          "uuid": "6b647156-64b0-4204-8ab3-49982bab7e17",
          "code": "FIPRONIL",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Fipronil",
          "code_system": "WIKIPEDIA",
          "references": [
            "8cd18c85-9678-4859-ad84-a1e3e009c15f"
          ]
        },
        {
          "uuid": "8ced040b-ab2f-493b-a541-df4f72032e73",
          "code": "129121",
          "comments": "EPA PESTICIDE|CONVENTIONAL CHEMICAL",
          "type": "PRIMARY",
          "url": "http://iaspub.epa.gov/apex/pesticides/f?p=CHEMICALSEARCH:3:0::NO:21,3,31,7,12,25:P3_XCHEMICAL_ID:2377",
          "code_system": "EPA PESTICIDE CODE",
          "references": [
            "8cd18c85-9678-4859-ad84-a1e3e009c15f"
          ]
        },
        {
          "uuid": "f84df579-0cd7-4658-8c55-f579bf7cf429",
          "code": "1433761",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1433761/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "8cd18c85-9678-4859-ad84-a1e3e009c15f"
          ]
        },
        {
          "uuid": "cd84afec-9890-4dbc-8655-8f41e7abe789",
          "code": "m5386",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m5386?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "8cd18c85-9678-4859-ad84-a1e3e009c15f"
          ]
        },
        {
          "uuid": "3843d5c2-097b-4495-a0e3-2ec6475e24b0",
          "code": "CHEMBL101326",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL101326",
          "code_system": "ChEMBL",
          "references": [
            "8cd18c85-9678-4859-ad84-a1e3e009c15f"
          ]
        },
        {
          "uuid": "69986dd6-e38f-46ea-b8a6-98664aec2512",
          "code": "3352",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/3352",
          "code_system": "PUBCHEM",
          "references": [
            "8cd18c85-9678-4859-ad84-a1e3e009c15f"
          ]
        },
        {
          "uuid": "bbed93ef-028c-433c-8faf-c5ba248f27be",
          "code": "CERTIFECT (WITHDRAWN)",
          "comments": "EMA VET. EPAR|DOGS|TREATMENT OF FLEA, LICE AND TICK INFESTATION",
          "type": "ALTERNATIVE",
          "url": "http://www.ema.europa.eu/ema/index.jsp?curl=pages/medicines/veterinary/medicines/002002/vet_med_000241.jsp&mid=WC0b01ac058001fa1c",
          "code_system": "EMA VETERINARY ASSESSMENT REPORTS",
          "references": [
            "155ae7f9-e80c-b2ab-aa9b-63aab4460572"
          ]
        },
        {
          "uuid": "528bc28f-49c4-4d50-a67e-17b2dc45dcb5",
          "code": "BROADLINE (AUTHORIZED)",
          "comments": "EMA VET. EPAR|CATS|TREATMENT AND PREVENTION OF MIXED C INFECTIONS BY CESTODES, NEMATODES AND ECTOPARASITES",
          "type": "PRIMARY",
          "url": "http://www.ema.europa.eu/ema/index.jsp?curl=pages/medicines/veterinary/medicines/002700/vet_med_000283.jsp&mid=WC0b01ac058001fa1c",
          "code_system": "EMA VETERINARY ASSESSMENT REPORTS",
          "references": [
            "155ae7f9-e80c-b2ab-aa9b-63aab4460572"
          ]
        },
        {
          "uuid": "a617b813-1959-c192-4819-5fadafd9555f",
          "code": "7051",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/7051",
          "code_system": "HSDB",
          "references": [
            "8255c243-ec8f-cacf-ad57-f27e4ac5204d"
          ]
        },
        {
          "uuid": "c0dbfc70-bf59-9c99-5d35-1b66d9fd2faf",
          "code": "DTXSID4034609",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID4034609",
          "code_system": "EPA CompTox",
          "references": [
            "7d6dc58d-4b76-8cc3-b901-b081855f18fa"
          ]
        },
        {
          "uuid": "595a873f-9a93-7325-3f15-12745d3822fc",
          "code": "C737",
          "comments": "Industrial Aid[C45678]|Pesticide",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C737",
          "code_system": "NCI_THESAURUS",
          "references": [
            "38090587-b428-dc95-2be8-4f3dda79cc50"
          ]
        },
        {
          "uuid": "f21d43b9-dc24-4ef0-b517-d7bb5ea0a002",
          "code": "QGH063955F",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "241ba7c7-d6ad-2f1c-1110-69f4fd529d2b",
          "code": "5063",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:5063",
          "code_system": "CHEBI",
          "references": [
            "38090587-b428-dc95-2be8-4f3dda79cc50"
          ]
        },
        {
          "uuid": "d8999dca-4f95-672e-8381-8d2254cc3a8d",
          "code": "300000023741",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "8ec59a40-beae-c1f5-6558-bade7edd5d9f"
          ]
        },
        {
          "uuid": "1a3bc04c-a0b5-2434-b293-21a2172b4fd1",
          "code": "QGH063955F",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=QGH063955F",
          "code_system": "DAILYMED",
          "references": [
            "570ad922-9199-dddb-ceeb-099978e0c219"
          ]
        },
        {
          "uuid": "3ad893fb-96c3-edd6-71dc-016ba3132035",
          "code": "fipronil",
          "type": "PRIMARY",
          "url": "https://pesticidecompendium.bcpc.org/fipronil.html",
          "code_system": "ALANWOOD",
          "references": [
            "10f9149e-6a7f-329b-8516-d0b24344f948"
          ]
        },
        {
          "uuid": "27544fae-49ff-1038-67d7-5a240b619f4e",
          "code": "758960",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=758960",
          "code_system": "NSC",
          "references": [
            "fe44c7e1-825a-8f80-acf8-df2ddf81dd17"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "17ddc268-0247-48dc-ad26-b038d457b55c",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "84d19ef4-6bf1-43fa-bb89-083a1642fb70",
            "refuuid": "7fab2e02-70b6-414b-aea3-401acf0e0d1f",
            "name": "FIPRONIL",
            "unii": "QGH063955F",
            "linking_id": "QGH063955F",
            "ref_pname": "FIPRONIL",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "eca6540d-33b1-4171-b31c-3cf54397f5a6",
          "type": "DEGRADENT->PARENT",
          "related_substance": {
            "uuid": "d00a7acc-b033-478d-85fe-425eff710834",
            "refuuid": "b860ad10-a914-402c-851f-5c5404dda283",
            "name": "5-AMINO-1-(2,6-DICHLORO-4-(TRIFLUOROMETHYL)PHENYL)-4-(TRIFLUOROMETHYL)-1H-PYRAZOLE-3-CARBONITRILE",
            "unii": "A9Y6W9QM9D",
            "linking_id": "A9Y6W9QM9D",
            "ref_pname": "5-AMINO-1-(2,6-DICHLORO-4-(TRIFLUOROMETHYL)PHENYL)-4-(TRIFLUOROMETHYL)-1H-PYRAZOLE-3-CARBONITRILE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "8ef69970-fb6e-4ffc-a430-69bb7c06691d",
          "type": "ENANTIOMER->RACEMATE",
          "related_substance": {
            "uuid": "dced649d-8e8f-403b-aa7f-46be339ec750",
            "refuuid": "87d5d269-186f-48aa-8486-ae45882ced03",
            "name": "FIPRONIL, (S)-",
            "unii": "42M76BR9DT",
            "linking_id": "42M76BR9DT",
            "ref_pname": "FIPRONIL, (S)-"
          }
        },
        {
          "uuid": "4ecd81e1-397d-4c12-a13d-d07674afa84f",
          "amount": {
            "uuid": "9d4e542e-16cf-4633-8091-f5f5b6fba776"
          },
          "type": "ENANTIOMER->RACEMATE",
          "related_substance": {
            "uuid": "310d5d4d-7df7-444d-a368-8ef24037c115",
            "refuuid": "88eb856f-2bf8-494b-b5fc-a9b271a377f8",
            "name": "FIPRONIL, (R)-",
            "unii": "95Q7F5498G",
            "linking_id": "95Q7F5498G",
            "ref_pname": "FIPRONIL, (R)-"
          }
        },
        {
          "uuid": "cdff4e00-a71e-4f16-bd50-e97d63c6a332",
          "amount": {
            "uuid": "d6467179-a69b-4cf5-b465-ff2aa1397433"
          },
          "type": "METABOLITE->PARENT",
          "references": [
            "ac9b51c9-0dda-4d3d-a7c9-7ddb04d921f1"
          ],
          "related_substance": {
            "uuid": "d9917482-74a6-4ac7-900d-3388a69b580d",
            "refuuid": "79c8024b-940d-4c02-815c-9c5bf3e0e830",
            "name": "FIPRONIL SULFONE",
            "unii": "KE7T0T1PQ7",
            "linking_id": "KE7T0T1PQ7",
            "ref_pname": "FIPRONIL SULFONE"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "02a74987-6f8d-4986-90c2-f1ac2bc3eb3c",
          "name": "(RS)-5-AMINO-1-(2,6-DICHLORO-4-TRIFLUOROMETHYLPHENYL)-4-(TRIFLUOROMETHYLSULFINYL)PYRAZOLE-3-CARBONITRILE",
          "stdName": "(RS)-5-AMINO-1-(2,6-DICHLORO-4-TRIFLUOROMETHYLPHENYL)-4-(TRIFLUOROMETHYLSULFINYL)PYRAZOLE-3-CARBONITRILE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "73444e29-894e-48a2-b12c-196d43b95396"
          ],
          "display_name": false
        },
        {
          "uuid": "9ef39b4c-db27-482e-952f-e7bb89db60e1",
          "name": "(±)-FIPRONIL",
          "stdName": "(+/-)-FIPRONIL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ea12faa8-a225-438c-b899-7c0883542487"
          ],
          "display_name": false
        },
        {
          "uuid": "32eed942-4ccf-43b9-ad14-1e01c6e45d65",
          "name": "5-AMINO-1-(2,6-DICHLORO-.ALPHA.,.ALPHA.,.ALPHA.-TRIFLUORO-P-TOLYL)-4-((TRIFLUOROMETHYL)SULFINYL)PYRAZOLE-3-CARBONITRILE",
          "stdName": "5-AMINO-1-(2,6-DICHLORO-.ALPHA.,.ALPHA.,.ALPHA.-TRIFLUORO-P-TOLYL)-4-((TRIFLUOROMETHYL)SULFINYL)PYRAZOLE-3-CARBONITRILE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2a15f1e0-29d4-43f4-af33-9491bff67d69",
            "63cc1e9f-0774-4d1c-a337-4b846f95f5ce"
          ],
          "display_name": false
        },
        {
          "uuid": "2f59cc35-cc3e-40da-9bed-8f6a59647fc3",
          "name": "5-AMINO-1-(2,6-DICHLORO-4-(TRIFLUOROMETHYL)PHENYL)-4-((TRIFLUOROMETHYL)SULFINYL)-1H-PYRAZOLE-3-CARBONITRILE",
          "stdName": "5-AMINO-1-(2,6-DICHLORO-4-(TRIFLUOROMETHYL)PHENYL)-4-((TRIFLUOROMETHYL)SULFINYL)-1H-PYRAZOLE-3-CARBONITRILE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8b3c4e82-6e9e-48bf-986f-7d98428b12a6",
            "63cc1e9f-0774-4d1c-a337-4b846f95f5ce"
          ],
          "display_name": false
        },
        {
          "uuid": "2759cefe-f816-ef90-fc43-c768e3385086",
          "name": "BROADLINE COMPONENT FIPRONIL",
          "stdName": "BROADLINE COMPONENT FIPRONIL",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "155ae7f9-e80c-b2ab-aa9b-63aab4460572"
          ],
          "display_name": false
        },
        {
          "uuid": "7036b1b2-be87-4eeb-bb2f-2780cc0134f5",
          "name": "FIPRONIL",
          "stdName": "FIPRONIL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "42fdc1b5-8a71-4b67-bd06-00476e2f3720",
            "765d3998-9c77-4926-b2f0-2442df711a79",
            "ed5bece7-41fd-4c80-8eed-6aa4b9cb3a31",
            "4162416a-ec2f-456d-98d4-64b50f8497a1",
            "a57ea399-65bc-49b1-8b57-89a5327abca8",
            "995c4504-73a6-4a01-b574-f3f73ac55fe6",
            "d515661a-7b94-4fe1-ac7d-d74729d613b8",
            "26e7312e-68d9-4c8a-b306-63dfac4a4e75",
            "df787292-0edb-4144-9530-f1c6037ef184",
            "d8b442c4-f6fb-42a9-a496-5fe07655d23f",
            "bbb533c6-62a1-4be5-a4be-39a9d3eacaf2",
            "73444e29-894e-48a2-b12c-196d43b95396"
          ],
          "display_name": true
        },
        {
          "uuid": "b01eb469-038c-4dd9-99e5-7b25b29bd740",
          "name": "FIPRONIL (EMA EPAR: VETERINARY)",
          "stdName": "FIPRONIL (EMA EPAR: VETERINARY)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "155ae7f9-e80c-b2ab-aa9b-63aab4460572"
          ],
          "display_name": false
        },
        {
          "uuid": "9966c339-d69e-4706-871f-9ab326bad3e2",
          "name": "FIPRONIL [HSDB]",
          "stdName": "FIPRONIL [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ed5bece7-41fd-4c80-8eed-6aa4b9cb3a31",
            "d8b442c4-f6fb-42a9-a496-5fe07655d23f"
          ],
          "display_name": false
        },
        {
          "uuid": "08de6d2c-c350-4f8f-8714-c73a4596821c",
          "name": "FIPRONIL [ISO]",
          "stdName": "FIPRONIL [ISO]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d8b442c4-f6fb-42a9-a496-5fe07655d23f",
            "995c4504-73a6-4a01-b574-f3f73ac55fe6"
          ],
          "display_name": false
        },
        {
          "uuid": "b262e006-92c4-40c2-bf1d-b347e8953796",
          "name": "FIPRONIL [JAN]",
          "stdName": "FIPRONIL [JAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "42fdc1b5-8a71-4b67-bd06-00476e2f3720",
            "d8b442c4-f6fb-42a9-a496-5fe07655d23f"
          ],
          "display_name": false
        },
        {
          "uuid": "d7ac4f8b-24d5-480c-b9f0-1d61b9ef5f37",
          "name": "FIPRONIL [MART.]",
          "stdName": "FIPRONIL [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "bbb533c6-62a1-4be5-a4be-39a9d3eacaf2"
          ],
          "display_name": false
        },
        {
          "uuid": "38b0668d-f347-4346-bd12-caa06f17b4bb",
          "name": "FIPRONIL [MI]",
          "stdName": "FIPRONIL [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d8b442c4-f6fb-42a9-a496-5fe07655d23f",
            "d515661a-7b94-4fe1-ac7d-d74729d613b8"
          ],
          "display_name": false
        },
        {
          "uuid": "e8040447-3139-411b-be2c-0bded5ede024",
          "name": "FRONTLINE",
          "stdName": "FRONTLINE",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d515661a-7b94-4fe1-ac7d-d74729d613b8"
          ],
          "display_name": false
        },
        {
          "uuid": "a82cf8ac-a449-42d5-8ad4-482f24c9c0e2",
          "name": "MB 46030",
          "stdName": "MB 46030",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "73444e29-894e-48a2-b12c-196d43b95396"
          ],
          "display_name": false
        },
        {
          "uuid": "acf753c2-c46e-4779-a9ec-9ea75098fd5a",
          "name": "MB-46030",
          "stdName": "MB-46030",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d8b442c4-f6fb-42a9-a496-5fe07655d23f",
            "e7d8b503-b965-4a35-b563-597d931acfe7"
          ],
          "display_name": false
        },
        {
          "uuid": "90b74c72-9d17-c075-2ded-6cab68e6e3b1",
          "name": "NSC-758960",
          "stdName": "NSC-758960",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fe44c7e1-825a-8f80-acf8-df2ddf81dd17"
          ],
          "display_name": false
        },
        {
          "uuid": "f2b94396-9422-43a7-a48a-bafbe3ff1c78",
          "name": "RM 1601",
          "stdName": "RM 1601",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "73444e29-894e-48a2-b12c-196d43b95396"
          ],
          "display_name": false
        },
        {
          "uuid": "2559cb12-c3f5-4be0-a874-1b932cafd767",
          "name": "RM-1601",
          "stdName": "RM-1601",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d8b442c4-f6fb-42a9-a496-5fe07655d23f",
            "e7d8b503-b965-4a35-b563-597d931acfe7"
          ],
          "display_name": false
        },
        {
          "uuid": "77173c19-c80a-b7ba-a116-39fc155b3201",
          "name": "TERMIDOR",
          "stdName": "TERMIDOR",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d515661a-7b94-4fe1-ac7d-d74729d613b8"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "73444e29-894e-48a2-b12c-196d43b95396",
          "citation": "USP DICTIONARY 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "63cc1e9f-0774-4d1c-a337-4b846f95f5ce",
          "citation": "ALANWOOD.NET",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2a15f1e0-29d4-43f4-af33-9491bff67d69",
          "citation": "ALANWOOD IUPAC",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8b3c4e82-6e9e-48bf-986f-7d98428b12a6",
          "citation": "ALANWOOD CAS",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "42fdc1b5-8a71-4b67-bd06-00476e2f3720",
          "citation": "KEGG 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d8b442c4-f6fb-42a9-a496-5fe07655d23f",
          "citation": "KEGG",
          "doc_type": "KEGG",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "bbb533c6-62a1-4be5-a4be-39a9d3eacaf2",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d515661a-7b94-4fe1-ac7d-d74729d613b8",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "ed5bece7-41fd-4c80-8eed-6aa4b9cb3a31",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "995c4504-73a6-4a01-b574-f3f73ac55fe6",
          "citation": "ISO",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e7d8b503-b965-4a35-b563-597d931acfe7",
          "citation": "CHEMBL",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8cd18c85-9678-4859-ad84-a1e3e009c15f",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389858000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2e3337bb-08ae-4297-91f9-8db81a13c6d6",
          "citation": "SRS import [QGH063955F]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=QGH063955F",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389858000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3394f27c-46f0-4d89-b6c0-9cd87810426d",
          "citation": "USP Dictionary 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4162416a-ec2f-456d-98d4-64b50f8497a1",
          "citation": "FIPRONIL [JAN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "a57ea399-65bc-49b1-8b57-89a5327abca8",
          "citation": "FIPRONIL [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "26e7312e-68d9-4c8a-b306-63dfac4a4e75",
          "citation": "FIPRONIL [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "765d3998-9c77-4926-b2f0-2442df711a79",
          "citation": "FIPRONIL [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "df787292-0edb-4144-9530-f1c6037ef184",
          "citation": "FIPRONIL [ISO]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "155ae7f9-e80c-b2ab-aa9b-63aab4460572",
          "citation": "http://www.ema.europa.eu/ema/index.jsp?curl=pages%2Fmedicines%2Flanding%2Fvet_epar_search.jsp&mid=WC0b01ac058001fa1c&searchTab=&alreadyLoaded=true&isNewQuery=true&status=Authorised&status=Withdrawn&status=Suspended&status=Refused&startLetter=View+all&keyword=Enter+keywords&searchType=name&taxonomyPath=&treeNumber=",
          "doc_type": "EMA REVIEW",
          "public_domain": true
        },
        {
          "uuid": "8255c243-ec8f-cacf-ad57-f27e4ac5204d",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+120068-37-3",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "7d6dc58d-4b76-8cc3-b901-b081855f18fa",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=120068-37-3",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "38090587-b428-dc95-2be8-4f3dda79cc50",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "10f9149e-6a7f-329b-8516-d0b24344f948",
          "citation": "BCPC",
          "doc_type": "ALANWOOD",
          "public_domain": true
        },
        {
          "uuid": "ea12faa8-a225-438c-b899-7c0883542487",
          "citation": "SCIFINDER",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "92cf244c-9389-48c3-a84a-ca4d1d7ba23e",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "ac9b51c9-0dda-4d3d-a7c9-7ddb04d921f1",
          "citation": "Br J Pharmacol 2008 Nov;155(5):783-94",
          "doc_type": "JA",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "fe44c7e1-825a-8f80-acf8-df2ddf81dd17",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "570ad922-9199-dddb-ceeb-099978e0c219",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "8ec59a40-beae-c1f5-6558-bade7edd5d9f",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "3c4922c7-76be-4ff3-ab5e-87dbce3fee64",
          "id": "3c4922c7-76be-4ff3-ab5e-87dbce3fee64",
          "molfile": "\n  Marvin  01132103122D          \n\n 26 27  0  0  0  0            999 V2000\n    5.5791   -3.5030    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0862   -2.8414    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2644   -2.8491    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9923   -2.0735    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6567   -1.5723    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3320   -2.0462    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1130   -1.7791    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1118   -0.9541    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3972   -0.5419    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    6.8290   -0.5407    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5391   -0.9522    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5402   -1.7772    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8312   -2.1906    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8345   -3.0156    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    8.2536   -0.5398    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6660   -1.2543    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8413    0.1747    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9682   -0.1274    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2026   -1.8348    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4129   -1.5960    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7801   -3.4556    0.0000 S   0  0  0  0  0  0  0  0  0  3  0  0\n    4.1389   -4.2752    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9729   -3.4523    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9542   -2.7082    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1309   -3.4550    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9786   -4.2294    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  2  0  0  0  0\n  6  2  1  0  0  0  0\n  3  4  1  0  0  0  0\n  3 21  1  0  0  0  0\n  4  5  2  0  0  0  0\n  4 19  1  0  0  0  0\n  5  6  1  0  0  0  0\n  7  6  1  0  0  0  0\n  7  8  1  0  0  0  0\n 13  7  2  0  0  0  0\n  9  8  1  0  0  0  0\n  8 10  2  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  2  0  0  0  0\n 11 15  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 15 16  1  0  0  0  0\n 15 17  1  0  0  0  0\n 15 18  1  0  0  0  0\n 19 20  3  0  0  0  0\n 21 22  2  0  0  0  0\n 21 23  1  0  0  0  0\n 23 24  1  0  0  0  0\n 23 25  1  0  0  0  0\n 23 26  1  0  0  0  0\nM  END",
          "smiles": "c1c(cc(c(c1Cl)-n2c(c(c(C#N)n2)S(=O)C(F)(F)F)N)Cl)C(F)(F)F",
          "formula": "C12H4Cl2F6N4OS",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "ea65f1cd-449b-4088-ad2c-9e8e51b4525e"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "437.1492",
          "optical_activity": "NONE",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "7fab2e02-70b6-414b-aea3-401acf0e0d1f",
      "version": "27",
      "structure": {
        "id": "780abe5e-8516-4b51-8c60-19dd375607b7",
        "molfile": "\n  Marvin  01132106142D          \n\n 26 27  0  0  0  0            999 V2000\n    5.3972   -0.5419    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    6.1118   -0.9541    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8290   -0.5407    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5391   -0.9522    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2536   -0.5398    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6660   -1.2543    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8413    0.1747    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9682   -0.1274    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5402   -1.7772    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8312   -2.1906    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8345   -3.0156    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    6.1130   -1.7791    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3320   -2.0462    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0862   -2.8414    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5791   -3.5030    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2644   -2.8491    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7801   -3.4556    0.0000 S   0  3  0  0  0  0  0  0  0  0  0  0\n    4.1389   -4.2752    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    2.9729   -3.4523    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9542   -2.7082    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1309   -3.4550    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9786   -4.2294    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9923   -2.0735    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2026   -1.8348    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4129   -1.5960    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6567   -1.5723    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  2  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  5  7  1  0  0  0  0\n  5  8  1  0  0  0  0\n  4  9  1  0  0  0  0\n  9 10  2  0  0  0  0\n 10 11  1  0  0  0  0\n 10 12  1  0  0  0  0\n 12  2  2  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 14 16  2  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 17 19  1  0  0  0  0\n 19 20  1  0  0  0  0\n 19 21  1  0  0  0  0\n 19 22  1  0  0  0  0\n 16 23  1  0  0  0  0\n 23 24  1  0  0  0  0\n 24 25  3  0  0  0  0\n 23 26  2  0  0  0  0\n 26 13  1  0  0  0  0\nM  CHG  2  17   1  18  -1\nM  END",
        "smiles": "c1c(cc(c(c1Cl)-n2c(c(c(C#N)n2)[S+](C(F)(F)F)[O-])N)Cl)C(F)(F)F",
        "formula": "C12H4Cl2F6N4OS",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "RACEMIC",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "437.1492",
        "optical_activity": "( + / - )",
        "references": [
          "3394f27c-46f0-4d89-b6c0-9cd87810426d",
          "2e3337bb-08ae-4297-91f9-8db81a13c6d6"
        ],
        "stereo_centers": 1
      },
      "unii": "QGH063955F"
    }
  ]
}