{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "dc870897-b86a-4e72-a524-a3892f48faa6",
          "code": "QP53AE03",
          "comments": "VATC|ECTOPARACITICIDES,  INSECTICIDES AND REPELLENTS|ECTOPARASITICIDES FOR TOPICAL USE, INCL. INSECTICIDES|Carbamates|bendiocarb",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QP53AE03&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "dd136330-19ed-448a-8aaa-0e08e321e2af"
          ]
        },
        {
          "uuid": "b8a68a32-94bc-4289-9c91-4901c8522dc0",
          "code": "22781-23-3",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=22781-23-3",
          "code_system": "CAS",
          "references": [
            "dd136330-19ed-448a-8aaa-0e08e321e2af",
            "cbc30bbf-39fb-4093-a383-e3d4b4dd6d8d"
          ]
        },
        {
          "uuid": "8728b438-73fe-4a81-96fe-e63c5073b30f",
          "code": "C007725",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67007725",
          "code_system": "MESH",
          "references": [
            "dd136330-19ed-448a-8aaa-0e08e321e2af"
          ]
        },
        {
          "uuid": "778733ed-4e37-4722-aece-3d084874b03a",
          "code": "BENDIOCARB",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Bendiocarb",
          "code_system": "WIKIPEDIA",
          "references": [
            "dd136330-19ed-448a-8aaa-0e08e321e2af"
          ]
        },
        {
          "uuid": "861692de-e99b-4410-b84d-0f7006c07c6a",
          "code": "105201",
          "comments": "EPA PESTICIDE|CONVENTIONAL CHEMICAL",
          "type": "PRIMARY",
          "url": "http://iaspub.epa.gov/apex/pesticides/f?p=CHEMICALSEARCH:3:0::NO:21,3,31,7,12,25:P3_XCHEMICAL_ID:1403",
          "code_system": "EPA PESTICIDE CODE",
          "references": [
            "dd136330-19ed-448a-8aaa-0e08e321e2af"
          ]
        },
        {
          "uuid": "3541df3d-02c7-4f7a-a1ae-733339b761d6",
          "code": "245-216-8",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.041.091",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "dd136330-19ed-448a-8aaa-0e08e321e2af"
          ]
        },
        {
          "uuid": "888a3f3a-5f59-4d5c-b2f9-be61a955c531",
          "code": "m2308",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m2308?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "dd136330-19ed-448a-8aaa-0e08e321e2af"
          ]
        },
        {
          "uuid": "ceeabd8a-3cd6-4a9d-948b-08ca372257a9",
          "code": "2314",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/2314",
          "code_system": "PUBCHEM",
          "references": [
            "dd136330-19ed-448a-8aaa-0e08e321e2af"
          ]
        },
        {
          "uuid": "97bef1b7-c1a3-8857-b4d2-d8ae700d7c60",
          "code": "C163589",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C163589",
          "code_system": "NCI_THESAURUS",
          "references": [
            "86649cd7-dc8c-d812-f5c3-1939fdc55101"
          ]
        },
        {
          "uuid": "e8fa2f25-ed27-fa1e-13a7-59b0fa02cff6",
          "code": "3918",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/3918",
          "code_system": "HSDB",
          "references": [
            "2aa6109f-8392-bfb4-cfe6-c6d6f9949332"
          ]
        },
        {
          "uuid": "54bceb9d-cd01-8d31-1192-3121223b9b04",
          "code": "DTXSID9032327",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID9032327",
          "code_system": "EPA CompTox",
          "references": [
            "4098230a-446e-d998-abc9-1956074f9a11"
          ]
        },
        {
          "uuid": "f3ead057-9c9b-9101-2269-42e000759c95",
          "code": "34556",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:34556",
          "code_system": "CHEBI",
          "references": [
            "23ccd3be-dafc-6df5-021a-561ee525063a"
          ]
        },
        {
          "uuid": "10b797b4-740d-4164-b564-fa63a5eaa918",
          "code": "QFH0ZU0A5U",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "7f6ad749-6471-a773-59ad-26e4ccb773dd",
          "code": "300000023680",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "cc7e86a7-c53e-a2af-fb29-488fabc3719f"
          ]
        },
        {
          "uuid": "f780b4ea-f264-7775-7127-3fdac84f1ef2",
          "code": "bendiocarb",
          "type": "PRIMARY",
          "url": "https://pesticidecompendium.bcpc.org/bendiocarb.html",
          "code_system": "ALANWOOD",
          "references": [
            "a038e0e3-4eba-3103-566b-15fa734b03e7"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "cb53ca49-9e78-48b8-9d51-1f5e32bcec5e",
          "name": "2,2-DIMETHYL-1,3-BENZODIOXOL-4-YL METHYLCARBAMATE",
          "stdName": "2,2-DIMETHYL-1,3-BENZODIOXOL-4-YL METHYLCARBAMATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "71f9cc30-e565-46a1-a140-779502313888",
            "9e37b210-9fd4-4986-852b-43dae50e4f9e"
          ],
          "display_name": false
        },
        {
          "uuid": "e1868052-2335-4f49-abf4-4278dbd2ea6b",
          "name": "2,2-DIMETHYL-1,3-BENZODIOXOL-4-YL N-METHYLCARBAMATE",
          "stdName": "2,2-DIMETHYL-1,3-BENZODIOXOL-4-YL N-METHYLCARBAMATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9e37b210-9fd4-4986-852b-43dae50e4f9e",
            "f6d61aaa-35ff-4373-ac43-935d71f0f633"
          ],
          "display_name": false
        },
        {
          "uuid": "8104e26b-93ce-40ee-b987-09ff2f131637",
          "name": "BENDIOCARB",
          "stdName": "BENDIOCARB",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2e9e76f5-dc7d-422f-b3db-ee96f494c9c6",
            "129292f4-a5bc-465b-a355-d2c96cd2119b",
            "e54cbb0a-5011-4839-91f5-be22ca82f719",
            "29cf951d-7ea7-497f-9f46-064028c6a58c",
            "f23873eb-6204-4f61-9c74-d758763f1b4d",
            "514a9ad1-51fa-4fdd-859d-250de1375e25",
            "982f04ba-99cf-429a-982f-59b555fb9150",
            "4717ad9a-9bae-4c37-84f4-67a8cafc19b6",
            "776c0e0a-25b0-4c5f-909b-df15fbb4b5b1",
            "5a2a5c7a-bade-4973-b4fd-ad719631ef5a"
          ],
          "display_name": true
        },
        {
          "uuid": "ef93e30a-7366-4e4a-999f-9a0b7924d47e",
          "name": "BENDIOCARB [HSDB]",
          "stdName": "BENDIOCARB [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2e9e76f5-dc7d-422f-b3db-ee96f494c9c6",
            "f23873eb-6204-4f61-9c74-d758763f1b4d"
          ],
          "display_name": false
        },
        {
          "uuid": "d66718ca-cc67-419b-b2ae-8c02aed4ba94",
          "name": "BENDIOCARB [ISO]",
          "stdName": "BENDIOCARB [ISO]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2e9e76f5-dc7d-422f-b3db-ee96f494c9c6",
            "129292f4-a5bc-465b-a355-d2c96cd2119b"
          ],
          "display_name": false
        },
        {
          "uuid": "cc0fb957-1676-47dd-82ef-43febb240921",
          "name": "BENDIOCARB [MART.]",
          "stdName": "BENDIOCARB [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5a2a5c7a-bade-4973-b4fd-ad719631ef5a"
          ],
          "display_name": false
        },
        {
          "uuid": "f7e88a9a-7cd1-4cef-adb7-563bc7007f92",
          "name": "BENDIOCARB [MI]",
          "stdName": "BENDIOCARB [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2e9e76f5-dc7d-422f-b3db-ee96f494c9c6",
            "29cf951d-7ea7-497f-9f46-064028c6a58c"
          ],
          "display_name": false
        },
        {
          "uuid": "d0babf5e-8d8d-46c7-8ad9-ed1e696197f6",
          "name": "DYCARB",
          "stdName": "DYCARB",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2e9e76f5-dc7d-422f-b3db-ee96f494c9c6",
            "51ea316e-4ecc-48ca-bc37-55a4082c3aaf"
          ],
          "display_name": false
        },
        {
          "uuid": "e0a57bae-d4e6-4a8a-bf7c-cc48dcbada3e",
          "name": "FICAM",
          "stdName": "FICAM",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2e9e76f5-dc7d-422f-b3db-ee96f494c9c6",
            "51ea316e-4ecc-48ca-bc37-55a4082c3aaf"
          ],
          "display_name": false
        },
        {
          "uuid": "84e27753-222e-436e-8f68-1c8b50394501",
          "name": "NIOMIL",
          "stdName": "NIOMIL",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2e9e76f5-dc7d-422f-b3db-ee96f494c9c6",
            "51ea316e-4ecc-48ca-bc37-55a4082c3aaf"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "e54cbb0a-5011-4839-91f5-be22ca82f719",
          "citation": "ICSAS BATCH 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "9e37b210-9fd4-4986-852b-43dae50e4f9e",
          "citation": "ALANWOOD.NET",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "71f9cc30-e565-46a1-a140-779502313888",
          "citation": "ALANWOOD IUPAC",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f6d61aaa-35ff-4373-ac43-935d71f0f633",
          "citation": "ALANWOOD CAS",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "51ea316e-4ecc-48ca-bc37-55a4082c3aaf",
          "citation": "http://pmep.cce.cornell.edu/profiles/extoxnet/24d-captan/bendiocarb-ext.html#24",
          "url": "http://pmep.cce.cornell.edu/profiles/extoxnet/24d-captan/bendiocarb-ext.html#24",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2e9e76f5-dc7d-422f-b3db-ee96f494c9c6",
          "citation": "WEB PAGE",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5a2a5c7a-bade-4973-b4fd-ad719631ef5a",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "29cf951d-7ea7-497f-9f46-064028c6a58c",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f23873eb-6204-4f61-9c74-d758763f1b4d",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "129292f4-a5bc-465b-a355-d2c96cd2119b",
          "citation": "ISO",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "dd136330-19ed-448a-8aaa-0e08e321e2af",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390880000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "cc37fbbf-615b-4ed9-80d9-216c625140d8",
          "citation": "SRS import [QFH0ZU0A5U]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=QFH0ZU0A5U",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390880000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f8f9102c-b020-4c99-ac48-1750dc780b4b",
          "citation": "CHEMID 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "514a9ad1-51fa-4fdd-859d-250de1375e25",
          "citation": "BENDIOCARB [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "982f04ba-99cf-429a-982f-59b555fb9150",
          "citation": "BENDIOCARB [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "776c0e0a-25b0-4c5f-909b-df15fbb4b5b1",
          "citation": "BENDIOCARB [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "4717ad9a-9bae-4c37-84f4-67a8cafc19b6",
          "citation": "BENDIOCARB [ISO]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "2aa6109f-8392-bfb4-cfe6-c6d6f9949332",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+22781-23-3",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "4098230a-446e-d998-abc9-1956074f9a11",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=22781-23-3",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "86649cd7-dc8c-d812-f5c3-1939fdc55101",
          "citation": "NCIT",
          "doc_type": "NCI THESAURUS",
          "public_domain": true
        },
        {
          "uuid": "a038e0e3-4eba-3103-566b-15fa734b03e7",
          "citation": "AW",
          "doc_type": "ALANWOOD",
          "public_domain": true
        },
        {
          "uuid": "23ccd3be-dafc-6df5-021a-561ee525063a",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "cbc30bbf-39fb-4093-a383-e3d4b4dd6d8d",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "cc7e86a7-c53e-a2af-fb29-488fabc3719f",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "0959286f-97a8-42b3-850f-80eed0dbc3d5",
          "id": "0959286f-97a8-42b3-850f-80eed0dbc3d5",
          "molfile": "\n  Marvin  01132100452D          \n\n 16 17  0  0  0  0            999 V2000\n    3.8480   -5.9602    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6731   -5.9602    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0856   -5.2457    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6731   -4.5313    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9106   -5.2457    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3230   -4.5313    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9106   -3.8168    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3230   -3.1022    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1480   -3.1022    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5605   -3.8168    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3675   -3.9883    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4537   -4.8088    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7087   -5.5934    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2607   -4.6372    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7000   -5.1443    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1480   -4.5313    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  3  4  2  0  0  0  0\n  5  3  1  0  0  0  0\n  6  5  1  0  0  0  0\n  6  7  1  0  0  0  0\n 16  6  2  0  0  0  0\n  7  8  2  0  0  0  0\n  9  8  1  0  0  0  0\n 10  9  2  0  0  0  0\n 10 11  1  0  0  0  0\n 16 10  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 12 14  1  0  0  0  0\n 15 12  1  0  0  0  0\n 16 15  1  0  0  0  0\nM  END",
          "smiles": "CC1(C)Oc2cccc(c2O1)OC(=O)NC",
          "formula": "C11H13NO4",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "582431cc-245d-4f40-bf03-18d9bba50b4b"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "223.2256",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "02bd35af-7004-48b3-9ab6-e77b6a344d44",
      "version": "8",
      "structure": {
        "id": "ff7d70be-1bd2-4886-b0a1-85b14a05e038",
        "molfile": "\n  Marvin  01132113132D          \n\n 16 17  0  0  0  0            999 V2000\n    7.1480   -4.5313    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5605   -3.8168    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3675   -3.9883    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4537   -4.8088    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7000   -5.1443    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7087   -5.5934    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2607   -4.6372    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1480   -3.1022    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3230   -3.1022    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9106   -3.8168    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3230   -4.5313    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9106   -5.2457    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0856   -5.2457    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6731   -5.9602    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8480   -5.9602    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6731   -4.5313    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  2  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  5  4  1  0  0  0  0\n  1  5  1  0  0  0  0\n  4  6  1  0  0  0  0\n  4  7  1  0  0  0  0\n  2  8  1  0  0  0  0\n  8  9  2  0  0  0  0\n 10  9  1  0  0  0  0\n 11 10  2  0  0  0  0\n  1 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 13 16  2  0  0  0  0\nM  END",
        "smiles": "CC1(C)Oc2cccc(c2O1)OC(=O)NC",
        "formula": "C11H13NO4",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "223.2256",
        "optical_activity": "NONE",
        "references": [
          "cc37fbbf-615b-4ed9-80d9-216c625140d8",
          "f8f9102c-b020-4c99-ac48-1750dc780b4b"
        ],
        "stereo_centers": 0
      },
      "unii": "QFH0ZU0A5U"
    }
  ]
}