{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "32cd94aa-8335-4ad7-8bf3-197eb3e679ad",
          "code": "534-73-6",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=534-73-6",
          "code_system": "CAS",
          "references": [
            "895aa4f6-07f2-4050-8166-d9585efbbf36",
            "a721c4e7-78b0-4331-b1e4-5263f6cfafb6"
          ]
        },
        {
          "uuid": "4c4513e6-b3c0-4b1f-9e59-72e15ccfaf32",
          "code": "C008187",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67008187",
          "code_system": "MESH",
          "references": [
            "895aa4f6-07f2-4050-8166-d9585efbbf36"
          ]
        },
        {
          "uuid": "4ae4ba98-eabf-42bc-98c8-b58d0679cb66",
          "code": "208-605-3",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.007.825",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "895aa4f6-07f2-4050-8166-d9585efbbf36"
          ]
        },
        {
          "uuid": "5e89db38-ec89-4cc6-a46e-071e6fe96b83",
          "code": "94169",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/94169",
          "code_system": "PUBCHEM",
          "references": [
            "895aa4f6-07f2-4050-8166-d9585efbbf36"
          ]
        },
        {
          "uuid": "23446ec7-4aa3-8ed6-c078-d0ba0cb8b5e3",
          "code": "DTXSID3074571",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID3074571",
          "code_system": "EPA CompTox",
          "references": [
            "47d0eab5-9674-bcd3-2ec0-1bdd28ea08d5"
          ]
        },
        {
          "uuid": "d71574fc-3d27-4e23-a1b3-6a862563a7d1",
          "code": "m11796",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m11796",
          "code_system": "MERCK INDEX",
          "references": [
            "6b2f40ab-fbf3-2481-e89a-13a3f9c748ec"
          ]
        },
        {
          "uuid": "796259ff-4a00-4989-a520-7694a7749a4f",
          "code": "QFA026JZX2",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "f0758ea4-71ab-4ee7-d219-cad184c392e6",
          "code": "2600777",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/2600777/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "6b340ce8-0715-e376-f35c-04b17700fdfd"
          ]
        },
        {
          "uuid": "85b852c0-743d-db05-63fd-c051472b5229",
          "code": "QFA026JZX2",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=QFA026JZX2",
          "code_system": "DAILYMED",
          "references": [
            "d2342aaf-d3a9-b702-036c-38d84fc5ebd0"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "ff539d5f-8256-4ab6-98b3-043100a30f92",
          "name": "1,6-GPS",
          "stdName": "1,6-GPS",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3cd83592-d2ce-4984-a618-32e1942e8604",
            "fcbd89cf-ceb8-45b1-9454-68508fe2f60c"
          ],
          "display_name": false
        },
        {
          "uuid": "cd994546-5c09-4364-b97a-ef428de58930",
          "name": "6-O-.ALPHA.-D-GLUCOPYRANOSYL-D-GLUCITOL",
          "stdName": "6-O-.ALPHA.-D-GLUCOPYRANOSYL-D-GLUCITOL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3cd83592-d2ce-4984-a618-32e1942e8604",
            "a212615c-3ed8-4bec-bd4b-f198472c4ad0"
          ],
          "display_name": false
        },
        {
          "uuid": "2c8d93ea-6667-48a5-ab5c-048fb34297a8",
          "name": "6-O-.ALPHA.-GLUCOPYRANOSYL-D-SORBITOL",
          "stdName": "6-O-.ALPHA.-GLUCOPYRANOSYL-D-SORBITOL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3cd83592-d2ce-4984-a618-32e1942e8604",
            "fcbd89cf-ceb8-45b1-9454-68508fe2f60c"
          ],
          "display_name": false
        },
        {
          "uuid": "baad657a-416c-4db9-8559-c7d6414d1ff8",
          "name": "D-GLUCITOL, 6-O-.ALPHA.-D-GLUCOPYRANOSYL-",
          "stdName": "D-GLUCITOL, 6-O-.ALPHA.-D-GLUCOPYRANOSYL-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3cd83592-d2ce-4984-a618-32e1942e8604",
            "a212615c-3ed8-4bec-bd4b-f198472c4ad0"
          ],
          "display_name": false
        },
        {
          "uuid": "806a3720-cddf-a99e-4434-82c914949e4f",
          "name": "GLUCOSYLSORBITOL",
          "stdName": "GLUCOSYLSORBITOL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6b2f40ab-fbf3-2481-e89a-13a3f9c748ec"
          ],
          "display_name": false
        },
        {
          "uuid": "e4eae7c8-954d-23e5-d9b3-b85608a2a116",
          "name": "GLUCOSYLSORBITOL [MI]",
          "stdName": "GLUCOSYLSORBITOL [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6b2f40ab-fbf3-2481-e89a-13a3f9c748ec"
          ],
          "display_name": false
        },
        {
          "uuid": "670dc9be-d875-40cd-aabd-92003de20c25",
          "name": "ISOMALTITOL",
          "stdName": "ISOMALTITOL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3cd83592-d2ce-4984-a618-32e1942e8604",
            "4d1339d8-50eb-4a5b-b93a-a5457cd0d295"
          ],
          "display_name": true
        }
      ],
      "references": [
        {
          "uuid": "4d1339d8-50eb-4a5b-b93a-a5457cd0d295",
          "citation": "ChemID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "3cd83592-d2ce-4984-a618-32e1942e8604",
          "citation": "CHEMID",
          "doc_type": "CHEMID",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a212615c-3ed8-4bec-bd4b-f198472c4ad0",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "fcbd89cf-ceb8-45b1-9454-68508fe2f60c",
          "citation": "FCC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "895aa4f6-07f2-4050-8166-d9585efbbf36",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390983000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0e362d07-0c48-4bac-91d1-99835da53e8a",
          "citation": "SRS import [QFA026JZX2]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=QFA026JZX2",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390983000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "47d0eab5-9674-bcd3-2ec0-1bdd28ea08d5",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=534-73-6",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "6b340ce8-0715-e376-f35c-04b17700fdfd",
          "citation": "RXNORM",
          "doc_type": "NLM",
          "public_domain": true
        },
        {
          "uuid": "6b2f40ab-fbf3-2481-e89a-13a3f9c748ec",
          "citation": "MERCK",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "a721c4e7-78b0-4331-b1e4-5263f6cfafb6",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "d2342aaf-d3a9-b702-036c-38d84fc5ebd0",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "5a6e6866-95b6-4dea-8de1-b1bab5428e54",
          "id": "5a6e6866-95b6-4dea-8de1-b1bab5428e54",
          "molfile": "\n  Marvin  01132104412D          \n\n 23 23  0  0  1  0            999 V2000\n   15.4709   -6.6469    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n   15.4709   -7.4719    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   16.1853   -6.2344    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.8998   -6.6469    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   14.7564   -6.2344    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n   14.7564   -5.4094    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   14.0419   -6.6469    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n   14.0419   -7.4719    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   13.3275   -6.2344    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n   13.3275   -5.4094    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   12.6130   -6.6469    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.8985   -6.2344    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.0735   -6.2344    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n   10.6610   -5.5199    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8360   -5.5199    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    9.4235   -4.8054    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5985   -4.8054    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4235   -6.2344    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    8.5985   -6.2344    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8360   -6.9488    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    9.2527   -7.5322    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6610   -6.9488    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n   11.0735   -7.6633    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  6  0  0  0\n  1  3  1  0  0  0  0\n  5  1  1  0  0  0  0\n  3  4  1  0  0  0  0\n  5  6  1  6  0  0  0\n  5  7  1  0  0  0  0\n  7  8  1  6  0  0  0\n  7  9  1  0  0  0  0\n  9 10  1  1  0  0  0\n  9 11  1  0  0  0  0\n 12 11  1  0  0  0  0\n 13 12  1  6  0  0  0\n 13 14  1  0  0  0  0\n 22 13  1  0  0  0  0\n 15 14  1  0  0  0  0\n 15 16  1  1  0  0  0\n 18 15  1  0  0  0  0\n 16 17  1  0  0  0  0\n 18 19  1  6  0  0  0\n 20 18  1  0  0  0  0\n 20 21  1  1  0  0  0\n 22 20  1  0  0  0  0\n 22 23  1  6  0  0  0\nM  END",
          "smiles": "C([C@@H]([C@H]([C@@H]([C@@H](CO[C@@H]1[C@@H]([C@H]([C@@H]([C@@H](CO)O1)O)O)O)O)O)O)O)O",
          "formula": "C12H24O11",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "6f4fa411-403a-4b13-8f31-614e024a11ae"
          },
          "defined_stereo": 9,
          "ez_centers": 0,
          "molecular_weight": "344.3129",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 9
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "37c4560c-9398-44e3-ae05-a7aa38b3c6e6",
      "version": "7",
      "structure": {
        "id": "43f91f51-b09b-4209-a83b-9c570ecfffc1",
        "molfile": "\n  Marvin  01132103352D          \n\n 23 23  0  0  1  0            999 V2000\n    9.8360   -5.5199    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    9.4235   -6.2344    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    9.8360   -6.9488    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   10.6610   -6.9488    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   11.0735   -6.2344    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   10.6610   -5.5199    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4235   -4.8054    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.8985   -6.2344    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.0735   -7.6633    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2527   -7.5322    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5985   -6.2344    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5985   -4.8054    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   12.6130   -6.6469    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.3275   -6.2344    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   14.0419   -6.6469    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   14.7564   -6.2344    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   15.4709   -6.6469    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   14.0419   -7.4719    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   13.3275   -5.4094    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   16.1853   -6.2344    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.8998   -6.6469    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   14.7564   -5.4094    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   15.4709   -7.4719    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  1  1  0  0  0  0\n  1  7  1  1  0  0  0\n  5  8  1  6  0  0  0\n  4  9  1  6  0  0  0\n  3 10  1  1  0  0  0\n  2 11  1  6  0  0  0\n  7 12  1  0  0  0  0\n  8 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 15 18  1  6  0  0  0\n 14 19  1  1  0  0  0\n 17 20  1  0  0  0  0\n 20 21  1  0  0  0  0\n 16 22  1  6  0  0  0\n 17 23  1  6  0  0  0\nM  END",
        "smiles": "C([C@@H]([C@H]([C@@H]([C@@H](CO[C@@H]1[C@@H]([C@H]([C@@H]([C@@H](CO)O1)O)O)O)O)O)O)O)O",
        "formula": "C12H24O11",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 9,
        "ez_centers": 0,
        "molecular_weight": "344.3129",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "0e362d07-0c48-4bac-91d1-99835da53e8a",
          "4d1339d8-50eb-4a5b-b93a-a5457cd0d295"
        ],
        "stereo_centers": 9
      },
      "unii": "QFA026JZX2"
    }
  ]
}