{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "844aec3d-ca7d-425f-b1a9-85e71f29c7de",
          "code": "176370-26-6",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=176370-26-6",
          "code_system": "CAS",
          "references": [
            "05487593-36fe-4725-8cbb-bbd23e0d6521",
            "b4e5e801-1b46-41ce-b062-34117040a4f7"
          ]
        },
        {
          "uuid": "e260b26b-cbd0-4b52-b43b-5fd684934e08",
          "code": "91864487",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/91864487",
          "code_system": "PUBCHEM",
          "references": [
            "05487593-36fe-4725-8cbb-bbd23e0d6521"
          ]
        },
        {
          "uuid": "396c0cb8-df50-436b-b01b-74c6ddd56d7d",
          "code": "QE56GZ77W4",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "57e626c8-be0e-cb6d-dd88-35c36079ebbb",
          "code": "DTXSID501021395",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID501021395",
          "code_system": "EPA CompTox"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "efe3e65c-c7bd-4fcc-940e-ec94de1f3767",
          "name": "BUTANEDIOIC ACID, COMPD. WITH N-(2-(2-HYDROXYETHOXY)ETHYL)GUANIDINE (1:2)",
          "stdName": "BUTANEDIOIC ACID, COMPD. WITH N-(2-(2-HYDROXYETHOXY)ETHYL)GUANIDINE (1:2)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "eea39738-41e3-444f-9356-7603ecc2541b"
          ],
          "display_name": false
        },
        {
          "uuid": "a81a0525-9410-425b-8fbe-65130793bd8a",
          "name": "DIETHYLENE GLYCOL GUANIDINE MONOSUCCINATE",
          "stdName": "DIETHYLENE GLYCOL GUANIDINE MONOSUCCINATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "86ec0e39-9cef-4263-8b20-2e4a9ebd32fd"
          ],
          "display_name": false
        },
        {
          "uuid": "461eb707-aead-4e3a-8713-3bb7cbb71cd1",
          "name": "DIGLYCOL GUANIDINE SUCCINATE",
          "stdName": "DIGLYCOL GUANIDINE SUCCINATE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3993edff-e123-4365-9ab2-8ed25aa82585"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "fce407ae-5b2b-4ea2-8043-48fcc6c111fb",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "7c48e366-f267-4386-b5b8-b126a0788fee",
          "name": "DIGLYCOL GUANIDINE SUCCINATE (PCPC-DB)",
          "stdName": "DIGLYCOL GUANIDINE SUCCINATE (PCPC-DB)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3993edff-e123-4365-9ab2-8ed25aa82585"
          ],
          "display_name": false
        },
        {
          "uuid": "a4c19313-83ef-4a7c-8119-273967ab7d5f",
          "name": "HP-50 SUCCINATE",
          "stdName": "HP-50 SUCCINATE",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3993edff-e123-4365-9ab2-8ed25aa82585"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "3993edff-e123-4365-9ab2-8ed25aa82585",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "eea39738-41e3-444f-9356-7603ecc2541b",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "05487593-36fe-4725-8cbb-bbd23e0d6521",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392539000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1eaaf789-b1a7-4f9b-8bee-a3be410bf367",
          "citation": "SRS import [QE56GZ77W4]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=QE56GZ77W4",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392539000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "86ec0e39-9cef-4263-8b20-2e4a9ebd32fd",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "8917a8ea-8522-17ad-efd1-464d437c0956",
          "citation": "PCPC",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true
        },
        {
          "uuid": "b4e5e801-1b46-41ce-b062-34117040a4f7",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "8f134cc0-5575-4b12-bf2d-d3e41cc23506",
          "id": "8f134cc0-5575-4b12-bf2d-d3e41cc23506",
          "molfile": "\n  Marvin  01132107252D          \n\n  8  7  0  0  0  0            999 V2000\n    8.0778   -8.5939    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0778   -7.7690    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7922   -7.3564    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3633   -7.3564    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6489   -7.7690    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9346   -7.3564    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9346   -6.5315    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2201   -7.7690    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  2  0  0  0  0\n  4  2  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  6  8  2  0  0  0  0\nM  END",
          "smiles": "C(CC(=O)O)C(=O)O",
          "formula": "C4H6O4",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "bfdc146b-0fb3-4c90-b489-353b44661b23"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "118.0882",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "9c21aad8-5dbd-46f8-b2ef-1667f989c334",
          "id": "9c21aad8-5dbd-46f8-b2ef-1667f989c334",
          "molfile": "\n  Marvin  01132108072D          \n\n 10  9  0  0  0  0            999 V2000\n    4.7641   -2.3734    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7641   -3.1985    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0496   -3.6109    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4785   -3.6109    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1930   -3.1985    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9075   -3.6109    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6220   -3.1985    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3365   -3.6109    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0510   -3.1985    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7655   -3.6109    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  2  0  0  0  0\n  4  2  1  0  0  0  0\n  5  4  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\nM  END",
          "smiles": "C(COCCO)NC(=N)N",
          "formula": "C5H13N3O2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 2,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 2,
            "units": "MOL RATIO",
            "uuid": "c555aa24-626f-43e8-bc73-610b7a95a394"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "147.1758",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "d51327b8-c284-44cf-a5ab-19ff52f2b1b1",
      "version": "6",
      "structure": {
        "id": "a3583e85-a513-44fa-835d-20a2621b7357",
        "molfile": "\n  Marvin  01132108292D          \n\n 28 25  0  0  0  0            999 V2000\n    7.3640   -7.3571    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0785   -7.7697    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0785   -8.5947    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7930   -7.3571    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6495   -7.7697    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9351   -7.3571    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9351   -6.5321    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2206   -7.7697    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1930   -3.1985    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9075   -3.6109    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6220   -3.1985    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3365   -3.6109    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0510   -3.1985    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7655   -3.6109    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4785   -3.6109    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7641   -3.1985    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7641   -2.3734    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0496   -3.6109    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1930   -3.1985    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9075   -3.6109    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6220   -3.1985    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3365   -3.6109    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0510   -3.1985    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7655   -3.6109    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4785   -3.6109    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7641   -3.1985    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7641   -2.3734    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0496   -3.6109    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  2  0  0  0  0\n  2  4  1  0  0  0  0\n  1  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  2  0  0  0  0\n  6  8  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n  9 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  2  0  0  0  0\n 16 18  1  0  0  0  0\n 19 20  1  0  0  0  0\n 19 25  1  0  0  0  0\n 20 21  1  0  0  0  0\n 21 22  1  0  0  0  0\n 22 23  1  0  0  0  0\n 23 24  1  0  0  0  0\n 25 26  1  0  0  0  0\n 26 27  2  0  0  0  0\n 26 28  1  0  0  0  0\nM  STY  1   1 MUL\nM  SCN  1   1 HT \nM  SAL   1 15   9  10  11  12  13  14  15  16  17  18  19  20  21  22  23\nM  SAL   1  5  24  25  26  27  28\nM  SPA   1 10   9  10  11  12  13  14  15  16  17  18\nM  SDI   1  4    3.6296   -4.0309    3.6296   -1.9534\nM  SDI   1  4   10.1855   -1.9534   10.1855   -4.0309\nM  SMT   1 2\nM  END",
        "smiles": "C(COCCO)NC(=N)N.C(COCCO)NC(=N)N.C(CC(=O)O)C(=O)O",
        "formula": "2C5H13N3O2.C4H6O4",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "412.4399",
        "optical_activity": "NONE",
        "references": [
          "eea39738-41e3-444f-9356-7603ecc2541b",
          "1eaaf789-b1a7-4f9b-8bee-a3be410bf367"
        ],
        "stereo_centers": 0
      },
      "unii": "QE56GZ77W4"
    }
  ]
}