{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "4619af5b-f611-435e-b062-c555962ca5d3", "code": "QDF33V439Z", "type": "PRIMARY", "code_system": "FDA UNII", "references": [ "1bb5e423-24b3-48a8-8dfd-0a1a861df25c" ] }, { "uuid": "4b68fd4b-a34a-49d4-9175-aabb05e842d7", "code": "36196-44-8", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=36196-44-8", "code_system": "CAS", "references": [ "5fd0857d-a1e9-496b-9b3a-46cebff19324", "1bb5e423-24b3-48a8-8dfd-0a1a861df25c" ] }, { "uuid": "edeeea3c-64cf-4990-acb7-abbcff0d2ece", "code": "252-907-8", "type": "PRIMARY", "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.048.083", "code_system": "ECHA (EC/EINECS)", "references": [ "5fd0857d-a1e9-496b-9b3a-46cebff19324" ] }, { "uuid": "d7aa6013-9305-42f2-8f31-3d5c0767aa41", "code": "118925", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/118925", "code_system": "PUBCHEM", "references": [ "5fd0857d-a1e9-496b-9b3a-46cebff19324" ] }, { "uuid": "2e5b86be-4b55-ab49-8e32-2aa29ab2e409", "code": "DTXSID2067959", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID2067959", "code_system": "EPA CompTox", "references": [ "6f4c1b57-cd3f-1256-4d6d-927a500fac92" ] } ], "substance_class": "chemical", "names": [ { "uuid": "f59ceeca-70c8-4300-8cae-2e8e4b963f66", "name": "1,1′,1′′-[(2,4,6-Trioxo-1,3,5-triazine-1,3,5(2H,4H,6H)-triyl)tri-2,1-ethanediyl] tris(3-mercaptopropanoate)", "stdName": "1,1',1''-((2,4,6-TRIOXO-1,3,5-TRIAZINE-1,3,5(2H,4H,6H)-TRIYL)TRI-2,1-ETHANEDIYL) TRIS(3-MERCAPTOPROPANOATE)", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "1bb5e423-24b3-48a8-8dfd-0a1a861df25c" ], "display_name": false }, { "uuid": "5109c016-f59b-4932-b1d0-4216e00e9809", "name": "Propanoic acid, 3-mercapto-, (2,4,6-trioxo-1,3,5-triazine-1,3,5(2H,4H,6H)-triyl)tri-2,1-ethanediyl ester", "stdName": "PROPANOIC ACID, 3-MERCAPTO-, (2,4,6-TRIOXO-1,3,5-TRIAZINE-1,3,5(2H,4H,6H)-TRIYL)TRI-2,1-ETHANEDIYL ESTER", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "fea5583b-2e35-47dd-a49d-f854a7624515", "45646592-9510-4013-a76e-7c0f9a19645c" ], "display_name": false }, { "uuid": "99d6cadc-f8b7-477e-ad14-0f2547f686a1", "name": "Propanoic acid, 3-mercapto-, 1,1′,1′′-[(2,4,6-trioxo-1,3,5-triazine-1,3,5(2H,4H,6H)-triyl)tri-2,1-ethanediyl] ester", "stdName": "PROPANOIC ACID, 3-MERCAPTO-, 1,1',1''-((2,4,6-TRIOXO-1,3,5-TRIAZINE-1,3,5(2H,4H,6H)-TRIYL)TRI-2,1-ETHANEDIYL) ESTER", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "1bb5e423-24b3-48a8-8dfd-0a1a861df25c" ], "display_name": false }, { "uuid": "a55b5b9a-e918-4d8e-b3e4-06a6b54875f8", "name": "Tris[2-(3-mercaptopropionyloxy)ethyl] isocyanurate", "stdName": "TRIS(2-(3-MERCAPTOPROPIONYLOXY)ETHYL) ISOCYANURATE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "1bb5e423-24b3-48a8-8dfd-0a1a861df25c" ], "display_name": true } ], "references": [ { "uuid": "fea5583b-2e35-47dd-a49d-f854a7624515", "citation": "CHEMID", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "45646592-9510-4013-a76e-7c0f9a19645c", "citation": "EPA", "doc_type": "EPA", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "5fd0857d-a1e9-496b-9b3a-46cebff19324", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493394022000, "tags": [ "NOMEN" ] }, { "uuid": "6f4c1b57-cd3f-1256-4d6d-927a500fac92", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=36196-44-8", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "1bb5e423-24b3-48a8-8dfd-0a1a861df25c", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "bf995693-34b0-4e31-ab6d-2ade40695166", "id": "bf995693-34b0-4e31-ab6d-2ade40695166", "molfile": "\n Marvin 01132109542D \n\n 33 33 0 0 0 0 999 V2000\n 0.4008 -4.4969 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 1.1156 -4.9210 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.8315 -4.5159 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.5442 -4.9348 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.5391 -5.7581 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3.2602 -4.5298 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3.9729 -4.9486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.6950 -4.5496 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.6933 -3.7261 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 3.9763 -3.3144 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.2567 -3.7331 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3.9763 -2.4908 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 3.2567 -2.0762 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.5479 -2.4952 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.8292 -2.0865 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1.1122 -2.5053 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.1215 -3.3330 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 0.3935 -2.0965 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.3235 -2.5197 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.0439 -2.1110 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 4.6933 -2.0791 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.6950 -1.2555 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.4037 -2.4908 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 6.1263 -2.0740 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.8304 -2.4932 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.5532 -2.0983 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.2602 -2.5233 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.9831 -2.1252 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.2433 -3.3435 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.9503 -3.7751 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.9327 -4.5958 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 5.4037 -3.3144 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.1263 -3.7353 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 3 2 1 0 0 0 0\n 4 3 1 0 0 0 0\n 4 5 2 0 0 0 0\n 6 4 1 0 0 0 0\n 7 6 1 0 0 0 0\n 8 7 1 0 0 0 0\n 9 8 1 0 0 0 0\n 10 9 1 0 0 0 0\n 9 32 1 0 0 0 0\n 10 11 2 0 0 0 0\n 12 10 1 0 0 0 0\n 12 13 1 0 0 0 0\n 21 12 1 0 0 0 0\n 13 14 1 0 0 0 0\n 14 15 1 0 0 0 0\n 15 16 1 0 0 0 0\n 16 17 2 0 0 0 0\n 16 18 1 0 0 0 0\n 18 19 1 0 0 0 0\n 19 20 1 0 0 0 0\n 21 22 2 0 0 0 0\n 23 21 1 0 0 0 0\n 24 23 1 0 0 0 0\n 32 23 1 0 0 0 0\n 25 24 1 0 0 0 0\n 26 25 1 0 0 0 0\n 27 26 1 0 0 0 0\n 28 27 2 0 0 0 0\n 27 29 1 0 0 0 0\n 29 30 1 0 0 0 0\n 30 31 1 0 0 0 0\n 32 33 2 0 0 0 0\nM END", "smiles": "C(CS)C(=O)OCCn1c(=O)n(CCOC(=O)CCS)c(=O)n(CCOC(=O)CCS)c1=O", "formula": "C18H27N3O9S3", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "1fb8cf2e-7a50-44d5-bbbb-34f4dd4ee5fe" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "525.6207", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "bfecd720-7dac-4d47-8778-8b4dc8ad2c72", "version": "6", "structure": { "id": "5291b8e2-744f-4fd3-8b1f-96f9ea1f02eb", "molfile": "\n JSDraw201212519562D\n\n 33 33 0 0 0 0 0 V2000\n 39.7117 -3.8998 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 39.7119 -2.3398 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 41.0631 -1.5600 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 38.3606 -4.6796 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 37.0097 -3.8994 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 38.3603 -6.2396 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 37.0092 -7.0194 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 37.0090 -8.5794 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 35.6578 -9.3591 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 34.3068 -8.5791 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 34.3065 -7.0191 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 32.9554 -9.3600 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 31.6043 -8.5800 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 30.2533 -9.3600 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.9024 -8.5800 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 27.5513 -9.3600 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.5513 -10.9200 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 26.2004 -8.5800 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 24.8493 -9.3600 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 23.4983 -8.5800 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 32.9548 -10.9208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 31.6037 -11.7006 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 34.3058 -11.7008 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 34.3061 -13.2608 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 35.6572 -14.0406 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 35.6575 -15.6006 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 37.0086 -16.3804 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 38.3594 -15.6002 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 37.0089 -17.9404 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 38.3599 -18.7202 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 38.3602 -20.2802 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 35.6573 -10.9200 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 37.0083 -11.7000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 1 0 0 0 0\n 1 4 1 0 0 0 0\n 4 5 2 0 0 0 0\n 4 6 1 0 0 0 0\n 6 7 1 0 0 0 0\n 7 8 1 0 0 0 0\n 8 9 1 0 0 0 0\n 9 10 1 0 0 0 0\n 10 11 2 0 0 0 0\n 10 12 1 0 0 0 0\n 12 13 1 0 0 0 0\n 13 14 1 0 0 0 0\n 14 15 1 0 0 0 0\n 15 16 1 0 0 0 0\n 16 17 2 0 0 0 0\n 16 18 1 0 0 0 0\n 18 19 1 0 0 0 0\n 19 20 1 0 0 0 0\n 12 21 1 0 0 0 0\n 21 22 2 0 0 0 0\n 21 23 1 0 0 0 0\n 23 24 1 0 0 0 0\n 24 25 1 0 0 0 0\n 25 26 1 0 0 0 0\n 26 27 1 0 0 0 0\n 27 28 2 0 0 0 0\n 27 29 1 0 0 0 0\n 29 30 1 0 0 0 0\n 30 31 1 0 0 0 0\n 23 32 1 0 0 0 0\n 9 32 1 0 0 0 0\n 32 33 2 0 0 0 0\nM END", "smiles": "C(CS)C(=O)OCCn1c(=O)n(CCOC(=O)CCS)c(=O)n(CCOC(=O)CCS)c1=O", "formula": "C18H27N3O9S3", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "525.6207", "optical_activity": "NONE", "references": [ "fea5583b-2e35-47dd-a49d-f854a7624515" ], "stereo_centers": 0 }, "unii": "QDF33V439Z" } ] }