{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "0ff5488f-cf7d-44b3-be65-badff1092816", "code": "51898-34-1", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=51898-34-1", "code_system": "CAS", "references": [ "d3ef3e62-2db7-4ad3-93ce-a467f25cd3cd", "cb3b166a-36ad-4863-a567-f6dbfdfaf23c" ] }, { "uuid": "f6bd8102-db36-4467-a7fd-d4e8d5ce0a5d", "code": "SUB15586MIG", "type": "PRIMARY", "code_system": "EVMPD", "references": [ "d3ef3e62-2db7-4ad3-93ce-a467f25cd3cd" ] }, { "uuid": "c6a15a74-59e1-4e0a-b2e2-750adf0476a8", "code": "257-501-4", "type": "PRIMARY", "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.052.257", "code_system": "ECHA (EC/EINECS)", "references": [ "d3ef3e62-2db7-4ad3-93ce-a467f25cd3cd" ] }, { "uuid": "8d3419f3-9c73-44ad-ae24-e7c2f91d8666", "code": "QCP2FMP7I8", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "9c3743da-31bd-ab3a-84ec-609915895c9d", "code": "DTXSID401019802", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID401019802", "code_system": "EPA CompTox" } ], "relationships": [ { "uuid": "450d3f61-730f-4cd3-bad2-958a5eb900c1", "amount": { "uuid": "01c0ead1-0b13-443a-9235-834990727598" }, "type": "ENANTIOMER->RACEMATE", "related_substance": { "uuid": "09fbd96a-d2a1-4b16-af5c-e1cd70660f31", "refuuid": "6263ab61-9c4d-4f65-a5ce-adfb03edd334", "name": "TOCOPHERYL NICOTINATE", "unii": "WI1J5UCY5C", "linking_id": "WI1J5UCY5C", "ref_pname": "TOCOPHERYL NICOTINATE", "substance_class": "reference" } } ], "substance_class": "chemical", "names": [ { "uuid": "10a3cc31-3e71-4dfc-87a4-a1da0ecc2f94", "name": ".ALPHA.-TOCOPHEROL NICOTINATE, DL-", "stdName": ".ALPHA.-TOCOPHEROL NICOTINATE, DL-", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "126df30e-0542-4c31-9264-f5cf8c181c92", "1433f931-351b-4b6e-b6f0-594a83a73258" ], "display_name": true }, { "uuid": "3c0fb8cb-0589-4321-bb0c-392c9ab7fbfd", "name": "3-PYRIDINECARBOXYLIC ACID, 3,4-DIHYDRO-2,5,7,8-TETRAMETHYL-2-(4,8,12-TRIMETHYLTRIDECYL)-2H-1-BENZOPYRAN-6-YL ESTER, (2R*(4R*,8R*))-(±)-", "stdName": "3-PYRIDINECARBOXYLIC ACID, 3,4-DIHYDRO-2,5,7,8-TETRAMETHYL-2-(4,8,12-TRIMETHYLTRIDECYL)-2H-1-BENZOPYRAN-6-YL ESTER, (2R*(4R*,8R*))-(+/-)-", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "44674b4c-05df-4f89-8a7d-e5848d0d69f9", "126df30e-0542-4c31-9264-f5cf8c181c92" ], "display_name": false }, { "uuid": "ca9e9eb0-a220-457d-8d86-5e45a63ca659", "name": "DL-.ALPHA.-TOCOPHEROL NICOTINIC ACID ESTER", "stdName": "DL-.ALPHA.-TOCOPHEROL NICOTINIC ACID ESTER", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "44674b4c-05df-4f89-8a7d-e5848d0d69f9", "126df30e-0542-4c31-9264-f5cf8c181c92" ], "display_name": false }, { "uuid": "f48096ac-9cdd-493a-8cf1-2344a9738cd9", "name": "DL-.ALPHA.-TOCOPHERYL NICOTINATE", "stdName": "DL-.ALPHA.-TOCOPHERYL NICOTINATE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "44674b4c-05df-4f89-8a7d-e5848d0d69f9", "126df30e-0542-4c31-9264-f5cf8c181c92" ], "display_name": false }, { "uuid": "1cd0dff4-80a1-4f5c-a008-cd52e00c1526", "name": "J299.341D", "stdName": "J299.341D", "type": "cd", "languages": [ "en" ], "preferred": false, "references": [ "b2826bc7-10f7-40e3-bcb3-8c0050de7bd5", "126df30e-0542-4c31-9264-f5cf8c181c92" ], "display_name": false }, { "uuid": "73226ec3-3549-428d-bfde-3cba96609782", "name": "JUVELA NICOTINATE", "stdName": "JUVELA NICOTINATE", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "126df30e-0542-4c31-9264-f5cf8c181c92", "628458bb-a2da-4231-b8e7-87eb61a0b8d9" ], "display_name": false }, { "uuid": "6ba05ee4-bade-40ff-8d99-4d6988e40983", "name": "TOCOPHEROL NICOTINATE", "stdName": "TOCOPHEROL NICOTINATE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "761a47be-1a84-41da-8d36-5976737e9274", "126df30e-0542-4c31-9264-f5cf8c181c92", "769c8419-428e-4dc8-b7fe-7ef9cde84a9b" ], "display_name": false }, { "uuid": "24db27ca-56b6-4c31-9128-7ca4981cb662", "name": "TOCOPHEROL NICOTINATE [JAN]", "stdName": "TOCOPHEROL NICOTINATE [JAN]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "761a47be-1a84-41da-8d36-5976737e9274", "126df30e-0542-4c31-9264-f5cf8c181c92" ], "display_name": false }, { "uuid": "26f4318c-192d-427d-991f-f096a24f0075", "name": "TOCOPHERYL NICOTINATE, DL-.ALPHA.-", "stdName": "TOCOPHERYL NICOTINATE, DL-.ALPHA.-", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "44674b4c-05df-4f89-8a7d-e5848d0d69f9", "126df30e-0542-4c31-9264-f5cf8c181c92" ], "display_name": false } ], "references": [ { "uuid": "44674b4c-05df-4f89-8a7d-e5848d0d69f9", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "126df30e-0542-4c31-9264-f5cf8c181c92", "citation": "STN (SCIFINDER)", "doc_type": "STN (SCIFINDER)", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "1433f931-351b-4b6e-b6f0-594a83a73258", "citation": "FDA_SRS", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "761a47be-1a84-41da-8d36-5976737e9274", "citation": "http://www.kegg.jp/dbget-bin/www_bget?dr:D01530", "url": "http://www.kegg.jp/dbget-bin/www_bget?dr:D01530", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "b2826bc7-10f7-40e3-bcb3-8c0050de7bd5", "citation": "http://nikkajiweb.jst.go.jp/nikkaji_web/pages/top_e.jsp?CONTENT=syosai&SN=J299.341D", "url": "http://nikkajiweb.jst.go.jp/nikkaji_web/pages/top_e.jsp?CONTENT=syosai&SN=J299.341D", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "628458bb-a2da-4231-b8e7-87eb61a0b8d9", "citation": "http://www.genome.jp/dbget-bin/www_bget?dr:D01530", "url": "http://www.genome.jp/dbget-bin/www_bget?dr:D01530", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "d3ef3e62-2db7-4ad3-93ce-a467f25cd3cd", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493391329000, "tags": [ "NOMEN" ] }, { "uuid": "353b208d-0655-44df-8194-fa73ea66b0bf", "citation": "SRS import [QCP2FMP7I8]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=QCP2FMP7I8", "doc_type": "SRS", "public_domain": true, "document_date": 1493391329000, "tags": [ "NOMEN" ] }, { "uuid": "769c8419-428e-4dc8-b7fe-7ef9cde84a9b", "citation": "TOCOPHEROL NICOTINATE [JAN]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "cb3b166a-36ad-4863-a567-f6dbfdfaf23c", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "90e85c45-7e6a-f8e4-2d5f-1f455b7ef849", "citation": "PUBCHEM", "doc_type": "PUBCHEM", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "92df2d9d-49fe-4f22-bfbc-a3edc0693a1d", "id": "92df2d9d-49fe-4f22-bfbc-a3edc0693a1d", "molfile": "\n Marvin 01132107372D \n\n 39 41 0 0 0 0 999 V2000\n 8.5020 -1.2212 0.0000 C 0 0 2 0 0 0 0 0 0 1 0 0\n 8.5107 -2.0440 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.2115 -0.7967 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.9355 -1.1980 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.6479 -0.7822 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.3690 -1.1805 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.0784 -0.7618 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.3863 -2.0034 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.7809 -0.8171 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.0598 -1.2270 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.3357 -0.8316 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.6292 -1.2590 0.0000 C 0 0 1 0 0 0 0 0 0 1 0 0\n 5.6408 -2.0848 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9168 -0.8490 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2045 -1.2648 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.4747 -0.8723 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.7565 -1.2794 0.0000 C 0 0 2 0 0 0 0 0 0 1 0 0\n 3.4892 -1.6545 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.7565 -2.1255 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.0528 -2.5268 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.3288 -2.1255 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.6281 -2.5268 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.6281 -3.3496 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.1047 -2.1255 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.8287 -2.5209 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -1.5410 -2.1080 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.5498 -1.2852 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -2.2534 -2.5209 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.9658 -2.1051 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.6840 -2.5122 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.6840 -3.3438 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.9687 -3.7567 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n -2.2563 -3.3468 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.1047 -1.2794 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.8287 -0.8840 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.6281 -0.8810 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.6281 -0.0582 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.3288 -1.2794 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.0528 -0.8810 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 1 0 0 0\n 3 1 1 0 0 0 0\n 1 9 1 0 0 0 0\n 4 3 1 0 0 0 0\n 5 4 1 0 0 0 0\n 6 5 1 0 0 0 0\n 7 6 1 0 0 0 0\n 8 6 1 0 0 0 0\n 9 10 1 0 0 0 0\n 10 11 1 0 0 0 0\n 11 12 1 0 0 0 0\n 12 13 1 1 0 0 0\n 12 14 1 0 0 0 0\n 14 15 1 0 0 0 0\n 15 16 1 0 0 0 0\n 17 16 1 0 0 0 0\n 17 18 1 1 0 0 0\n 19 17 1 0 0 0 0\n 17 39 1 0 0 0 0\n 20 19 1 0 0 0 0\n 20 21 1 0 0 0 0\n 22 21 1 0 0 0 0\n 21 38 2 0 0 0 0\n 23 22 1 0 0 0 0\n 24 22 2 0 0 0 0\n 25 24 1 0 0 0 0\n 24 34 1 0 0 0 0\n 26 25 1 0 0 0 0\n 27 26 2 0 0 0 0\n 28 26 1 0 0 0 0\n 29 28 1 0 0 0 0\n 33 28 2 0 0 0 0\n 30 29 2 0 0 0 0\n 31 30 1 0 0 0 0\n 32 31 2 0 0 0 0\n 32 33 1 0 0 0 0\n 35 34 1 0 0 0 0\n 34 36 2 0 0 0 0\n 37 36 1 0 0 0 0\n 36 38 1 0 0 0 0\n 39 38 1 0 0 0 0\nM END", "smiles": "CC(C)CCC[C@@H](C)CCC[C@@H](C)CCC[C@]1(C)CCc2c(C)c(c(C)c(C)c2O1)OC(=O)c3cccnc3", "formula": "C35H53NO3", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "fd864cb3-e7b6-469b-8144-6bea14e55f16" }, "defined_stereo": 3, "ez_centers": 0, "molecular_weight": "535.8015", "optical_activity": "UNSPECIFIED", "stereo_centers": 3 } ], "definition_level": "COMPLETE", "uuid": "cf3609b5-3e97-4c5e-99b4-d55957eae69a", "version": "9", "structure": { "id": "8f955cac-e74b-4e82-b8e8-e66d7623f63c", "molfile": "\n Marvin 01132107272D \n\n 39 41 0 0 0 0 999 V2000\n 1.3288 -1.2794 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.1047 -2.1255 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.3288 -2.1255 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.6281 -2.5268 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.6281 -0.8810 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.1047 -1.2794 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.8287 -2.5209 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -1.5410 -2.1080 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.0528 -0.8810 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -2.2534 -2.5209 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.0528 -2.5268 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.7565 -1.2794 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n -1.5498 -1.2852 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -2.9687 -3.7567 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 2.7565 -2.1255 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.2563 -3.3468 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.6281 -3.3496 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.6281 -0.0582 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.8287 -0.8840 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.9658 -2.1051 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.4747 -0.8723 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2045 -1.2648 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.9355 -1.1980 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.0598 -1.2270 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.6840 -3.3438 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.4892 -1.6545 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.6479 -0.7822 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.7809 -0.8171 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.2115 -0.7967 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.3357 -0.8316 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9168 -0.8490 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.5020 -1.2212 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 5.6292 -1.2590 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 11.3690 -1.1805 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.6840 -2.5122 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.0784 -0.7618 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.3863 -2.0034 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.6408 -2.0848 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.5107 -2.0440 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 6 1 0 0 0 0\n 3 1 2 0 0 0 0\n 4 3 1 0 0 0 0\n 5 1 1 0 0 0 0\n 6 5 2 0 0 0 0\n 7 2 1 0 0 0 0\n 8 7 1 0 0 0 0\n 9 1 1 0 0 0 0\n 10 8 1 0 0 0 0\n 11 3 1 0 0 0 0\n 12 9 1 0 0 0 0\n 13 8 2 0 0 0 0\n 14 16 1 0 0 0 0\n 15 12 1 0 0 0 0\n 16 10 2 0 0 0 0\n 17 4 1 0 0 0 0\n 18 5 1 0 0 0 0\n 19 6 1 0 0 0 0\n 20 10 1 0 0 0 0\n 12 21 1 6 0 0 0\n 22 21 1 0 0 0 0\n 23 29 1 0 0 0 0\n 24 30 1 0 0 0 0\n 25 35 1 0 0 0 0\n 12 26 1 1 0 0 0\n 27 23 1 0 0 0 0\n 28 24 1 0 0 0 0\n 29 32 1 0 0 0 0\n 30 33 1 0 0 0 0\n 31 22 1 0 0 0 0\n 32 28 1 0 0 0 0\n 33 31 1 0 0 0 0\n 34 27 1 0 0 0 0\n 35 20 2 0 0 0 0\n 36 34 1 0 0 0 0\n 37 34 1 0 0 0 0\n 33 38 1 1 0 0 0\n 32 39 1 1 0 0 0\n 2 4 2 0 0 0 0\n 11 15 1 0 0 0 0\n 14 25 2 0 0 0 0\nM END", "smiles": "CC(C)CCC[C@@H](C)CCC[C@@H](C)CCC[C@]1(C)CCc2c(C)c(c(C)c(C)c2O1)OC(=O)c3cccnc3", "formula": "C35H53NO3", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "RACEMIC", "defined_stereo": 3, "ez_centers": 0, "molecular_weight": "535.8015", "optical_activity": "( + / - )", "references": [ "353b208d-0655-44df-8194-fa73ea66b0bf", "44674b4c-05df-4f89-8a7d-e5848d0d69f9" ], "stereo_centers": 3 }, "unii": "QCP2FMP7I8" } ] }