{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "370c376f-3883-4aba-a613-3c5666350a40", "code": "10591-84-1", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=10591-84-1", "code_system": "CAS", "references": [ "e7ff8118-bed2-45ad-9a12-674efd9a20b4", "913e68f6-61ee-46e2-8f6a-2afd4f7c9f32" ] }, { "uuid": "e0196706-c1b0-4114-9acb-6662e54d9743", "code": "234-196-6", "type": "PRIMARY", "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.031.075", "code_system": "ECHA (EC/EINECS)", "references": [ "e7ff8118-bed2-45ad-9a12-674efd9a20b4" ] }, { "uuid": "0a05d108-4860-4743-96a2-3b29aa9565b2", "code": "82747", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/82747", "code_system": "PUBCHEM", "references": [ "e7ff8118-bed2-45ad-9a12-674efd9a20b4" ] }, { "uuid": "b09a81bd-a931-eec2-2dd9-d0fb8fefeb03", "code": "DTXSID90147413", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID90147413", "code_system": "EPA CompTox", "references": [ "02b0cb3d-57a2-0031-4de2-48ccc803b2f4" ] }, { "uuid": "ca4e2760-149c-3150-416f-3babd34c35e3", "code": "37161", "type": "PRIMARY", "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=37161", "code_system": "NSC", "references": [ "558b573c-f68a-c4ab-2437-2367f77451b3" ] }, { "uuid": "e96350d8-61a7-4a03-96b9-471defaf2c3c", "code": "QC4LB75RUZ", "type": "PRIMARY", "code_system": "FDA UNII" } ], "substance_class": "chemical", "names": [ { "uuid": "b7e6cced-40d1-439d-b2fc-570d751b586e", "name": "N,N'-Dimethyldiphenylthiuram disulfide", "stdName": "N,N'-DIMETHYLDIPHENYLTHIURAM DISULFIDE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "913e68f6-61ee-46e2-8f6a-2afd4f7c9f32" ], "display_name": true }, { "uuid": "90cf051d-a292-470e-bfe8-87fda5775f31", "name": "N,N'-Dimethyldiphenylthiuram disulphide", "stdName": "N,N'-DIMETHYLDIPHENYLTHIURAM DISULPHIDE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "932a37ae-0f20-4990-b4d9-e07c094f99fb", "fe6cb387-5aeb-4b44-a395-640b58cf37e5" ], "display_name": false }, { "uuid": "1917e066-80e1-4a1c-baea-bf9c18354614", "name": "NSC-37161", "stdName": "NSC-37161", "type": "cd", "languages": [ "en" ], "preferred": false, "references": [ "558b573c-f68a-c4ab-2437-2367f77451b3" ], "display_name": false }, { "uuid": "8165deb3-3dd4-4be0-a272-d6f754b07f17", "name": "Thioperoxydicarbonic diamide ([(H2N)C(S)]2S2), N,N′-dimethyl-N,N′-diphenyl-", "stdName": "THIOPEROXYDICARBONIC DIAMIDE (((H2N)C(S))2S2), N,N'-DIMETHYL-N,N'-DIPHENYL-", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "913e68f6-61ee-46e2-8f6a-2afd4f7c9f32" ], "display_name": false } ], "references": [ { "uuid": "932a37ae-0f20-4990-b4d9-e07c094f99fb", "citation": "CHEMID", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "fe6cb387-5aeb-4b44-a395-640b58cf37e5", "citation": "EPA", "doc_type": "EPA", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "e7ff8118-bed2-45ad-9a12-674efd9a20b4", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493393785000, "tags": [ "NOMEN" ] }, { "uuid": "02b0cb3d-57a2-0031-4de2-48ccc803b2f4", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=10591-84-1", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "558b573c-f68a-c4ab-2437-2367f77451b3", "citation": "NCI", "doc_type": "NCI DRUG DICTIONARY", "public_domain": true }, { "uuid": "913e68f6-61ee-46e2-8f6a-2afd4f7c9f32", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "361218e2-f29f-40ff-8b21-45f525f6bddc", "id": "361218e2-f29f-40ff-8b21-45f525f6bddc", "molfile": "\n Marvin 01132102532D \n\n 22 23 0 0 0 0 999 V2000\n 11.4107 5.8518 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.6996 6.2700 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 9.9885 5.8518 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.9885 5.0194 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 9.2775 6.2700 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 8.5705 5.8518 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 7.8595 6.2700 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.8595 7.1066 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1484 5.8518 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1484 5.0194 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4373 6.2700 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4373 7.1066 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7263 7.5248 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0194 7.1066 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0194 6.2700 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7263 5.8518 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.6996 7.1066 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.9885 7.5248 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.9885 8.3614 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.6996 8.7797 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.4107 8.3614 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.4107 7.5248 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 1 0 0 0 0\n 17 2 1 0 0 0 0\n 4 3 2 0 0 0 0\n 3 5 1 0 0 0 0\n 5 6 1 0 0 0 0\n 6 7 1 0 0 0 0\n 8 7 2 0 0 0 0\n 9 7 1 0 0 0 0\n 10 9 1 0 0 0 0\n 11 9 1 0 0 0 0\n 12 11 1 0 0 0 0\n 16 11 2 0 0 0 0\n 13 12 2 0 0 0 0\n 14 13 1 0 0 0 0\n 14 15 2 0 0 0 0\n 15 16 1 0 0 0 0\n 18 17 1 0 0 0 0\n 22 17 2 0 0 0 0\n 19 18 2 0 0 0 0\n 20 19 1 0 0 0 0\n 20 21 2 0 0 0 0\n 21 22 1 0 0 0 0\nM END", "smiles": "CN(c1ccccc1)C(=S)SSC(=S)N(C)c2ccccc2", "formula": "C16H16N2S4", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "1aec8ad6-356e-4fb0-ac21-6801db93062b" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "364.5766", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "6369002f-a410-4838-bc2a-700572331df9", "version": "7", "structure": { "id": "0235e4f8-f176-43ff-bb45-edff7b0d61db", "molfile": "\n Marvin 01132100262D \n\n 22 23 0 0 0 0 999 V2000\n 7.8595 6.2700 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.9885 5.8518 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1484 5.8518 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 10.6996 6.2700 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 8.5705 5.8518 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 9.2775 6.2700 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 7.8595 7.1066 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 9.9885 5.0194 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 10.6996 7.1066 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4373 6.2700 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.4107 5.8518 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1484 5.0194 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.4107 7.5248 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4373 7.1066 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7263 5.8518 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.9885 7.5248 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7263 7.5248 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0194 6.2700 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.9885 8.3614 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.4107 8.3614 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.6996 8.7797 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0194 7.1066 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 6 1 0 0 0 0\n 3 1 1 0 0 0 0\n 4 2 1 0 0 0 0\n 5 1 1 0 0 0 0\n 6 5 1 0 0 0 0\n 7 1 2 0 0 0 0\n 8 2 2 0 0 0 0\n 9 4 1 0 0 0 0\n 10 3 1 0 0 0 0\n 11 4 1 0 0 0 0\n 12 3 1 0 0 0 0\n 13 9 1 0 0 0 0\n 14 10 1 0 0 0 0\n 15 10 2 0 0 0 0\n 16 9 2 0 0 0 0\n 17 14 2 0 0 0 0\n 18 15 1 0 0 0 0\n 19 16 1 0 0 0 0\n 20 13 2 0 0 0 0\n 21 19 2 0 0 0 0\n 22 18 2 0 0 0 0\n 22 17 1 0 0 0 0\n 21 20 1 0 0 0 0\nM END", "smiles": "CN(c1ccccc1)C(=S)SSC(=S)N(C)c2ccccc2", "formula": "C16H16N2S4", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "364.5766", "optical_activity": "NONE", "references": [ "932a37ae-0f20-4990-b4d9-e07c094f99fb" ], "stereo_centers": 0 }, "unii": "QC4LB75RUZ" } ] }