{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "dea18026-20e7-45e5-a25a-833e026cc3e8", "code": "483-17-0", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=483-17-0", "code_system": "CAS", "references": [ "f1d897ee-8d2f-4f5d-9d79-04b6b3d3d80f", "9c7fb564-e3a0-44f6-813e-aa40e5bc2c85" ] }, { "uuid": "dfbdd99a-4533-4a13-98bb-310eca91a14a", "code": "C005963", "type": "PRIMARY", "url": "http://www.ncbi.nlm.nih.gov/mesh/67005963", "code_system": "MESH", "references": [ "f1d897ee-8d2f-4f5d-9d79-04b6b3d3d80f" ] }, { "uuid": "09d83e2b-eda0-491b-9bc7-b6e3a092557c", "code": "CEPHAELINE", "type": "PRIMARY", "url": "https://en.wikipedia.org/wiki/Cephaeline", "code_system": "WIKIPEDIA", "references": [ "f1d897ee-8d2f-4f5d-9d79-04b6b3d3d80f" ] }, { "uuid": "f321f67c-8441-4e1a-a7ec-a37da124fdeb", "code": "207-591-6", "type": "PRIMARY", "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.006.902", "code_system": "ECHA (EC/EINECS)", "references": [ "f1d897ee-8d2f-4f5d-9d79-04b6b3d3d80f" ] }, { "uuid": "328d2ff1-c21f-4c9e-bf51-0fa3a600e2d5", "code": "m3243", "comments": "Merck Index", "type": "PRIMARY", "url": "https://merckindex.rsc.org/monographs/m3243?q=authorize", "code_system": "MERCK INDEX", "references": [ "f1d897ee-8d2f-4f5d-9d79-04b6b3d3d80f" ] }, { "uuid": "3058bf2b-7c01-47d6-8351-0d4c875a8164", "code": "442195", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/442195", "code_system": "PUBCHEM", "references": [ "f1d897ee-8d2f-4f5d-9d79-04b6b3d3d80f" ] }, { "uuid": "878ef7e8-a8c5-4f86-ab32-2137dfcff699", "code": "QA971541A1", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "0d9adac8-dde4-3a75-acc6-4c612be19130", "code": "3533", "type": "PRIMARY", "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:3533", "code_system": "CHEBI", "references": [ "c8ab92e2-d2c5-1140-77f0-8d8a7a0f0e55" ] }, { "uuid": "a7b21e26-3163-3694-9d74-2f3499b69c05", "code": "100000174381", "type": "PRIMARY", "code_system": "SMS_ID", "references": [ "59eb4ff9-5ed4-980f-e168-8d9035c8a023" ] }, { "uuid": "dda38bf3-3e85-238b-7705-08fbe30e72d9", "code": "DTXSID501016520", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID501016520", "code_system": "EPA CompTox", "references": [ "4def50a0-f148-5e80-9672-7c9667d4f392" ] } ], "relationships": [ { "uuid": "ec2d6a28-e3cd-4218-b2b8-d7089107d13e", "type": "ACTIVE MOIETY", "related_substance": { "uuid": "3b0d9511-e224-443a-9d04-83acb92a5366", "refuuid": "105332e6-38df-4f55-8126-4dd8fa67fdfb", "name": "CEPHAELINE", "unii": "QA971541A1", "linking_id": "QA971541A1", "ref_pname": "CEPHAELINE", "substance_class": "reference" } }, { "uuid": "2985367c-a73f-4c77-bf4d-ac3b0a864b02", "type": "SALT/SOLVATE->PARENT", "related_substance": { "uuid": "061960fc-c159-46a5-ac0e-4f7d30ffb3f3", "refuuid": "18ec2883-dbc8-430e-8e2a-74d59b7916fb", "name": "CEPHAELINE DIHYDROCHLORIDE HEPTAHYDRATE", "unii": "H5P411P33C", "linking_id": "H5P411P33C", "ref_pname": "CEPHAELINE DIHYDROCHLORIDE HEPTAHYDRATE", "substance_class": "reference" } } ], "substance_class": "chemical", "names": [ { "uuid": "3d37db27-f265-46fe-b1c8-d334d60a2804", "name": "(-)-CEPHAELINE", "stdName": "(-)-CEPHAELINE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "88c78aa1-b669-4442-b8b0-4581778c3a9d" ], "display_name": false }, { "uuid": "5d43418b-2043-4dac-b2e0-2f7b8dec5ada", "name": "(1R)-1-(((2S,3R,11BS)-3-ETHYL-1,3,4,6,7,11B-HEXAHYDRO-9,10-DIMETHOXY-2H-BENZO(A)QUINOLIZIN-2-YL)METHYL)-1,2,3,4-TETRAHYDRO-7-METHOXY-6-ISOQUINOLINOL", "stdName": "(1R)-1-(((2S,3R,11BS)-3-ETHYL-1,3,4,6,7,11B-HEXAHYDRO-9,10-DIMETHOXY-2H-BENZO(A)QUINOLIZIN-2-YL)METHYL)-1,2,3,4-TETRAHYDRO-7-METHOXY-6-ISOQUINOLINOL", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "53e3ab2b-4211-4588-93fd-5b99fdcb0095" ], "display_name": false }, { "uuid": "d43b1cbf-52f0-4d8b-b81d-c99b6021e01a", "name": "6-ISOQUINOLINOL, 1-(((2S,3R,11BS)-3-ETHYL-1,3,4,6,7,11B-HEXAHYDRO-9,10-DIMETHOXY-2H-BENZO(A)QUINOLIZIN-2-YL)METHYL)-1,2,3,4-TETRAHYDRO-7-METHOXY-, (1R)-", "stdName": "6-ISOQUINOLINOL, 1-(((2S,3R,11BS)-3-ETHYL-1,3,4,6,7,11B-HEXAHYDRO-9,10-DIMETHOXY-2H-BENZO(A)QUINOLIZIN-2-YL)METHYL)-1,2,3,4-TETRAHYDRO-7-METHOXY-, (1R)-", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "4f825653-f992-4386-a69b-5653ad17d9ca" ], "display_name": false }, { "uuid": "e806fcce-aaac-4ea0-a71a-4b67e5b5c09d", "name": "7',10,11-TRIMETHOXYEMETAN-6'-OL", "stdName": "7',10,11-TRIMETHOXYEMETAN-6'-OL", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "53e3ab2b-4211-4588-93fd-5b99fdcb0095" ], "display_name": false }, { "uuid": "1742795f-e1f8-4055-972d-b73ffc67dff8", "name": "CEPHAELINE", "stdName": "CEPHAELINE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "e8600729-8ee6-43f8-a335-a140bfe6d554", "0da98a08-6a4d-4692-9c4c-cbb0c003c959", "319bb141-bc38-49ea-8d1e-28e4ff9c73c7" ], "display_name": true }, { "uuid": "94078319-9487-46a0-a42e-bf06b4e7ecf3", "name": "CEPHAELINE [MI]", "stdName": "CEPHAELINE [MI]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "319bb141-bc38-49ea-8d1e-28e4ff9c73c7" ], "display_name": false }, { "uuid": "9c01675a-6617-406e-9938-576d9d1bca33", "name": "CEPHELINE", "stdName": "CEPHELINE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "e8600729-8ee6-43f8-a335-a140bfe6d554" ], "display_name": false }, { "uuid": "e7b1cd92-23fd-44fb-9392-1daa6b6f14c9", "name": "DESMETHYLEMETINE", "stdName": "DESMETHYLEMETINE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "88c78aa1-b669-4442-b8b0-4581778c3a9d" ], "display_name": false }, { "uuid": "58324a0c-82d8-49d2-8798-19cd4c4f8bfe", "name": "DIHYDROPSYCHOTRINE", "stdName": "DIHYDROPSYCHOTRINE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "53e3ab2b-4211-4588-93fd-5b99fdcb0095" ], "display_name": false }, { "uuid": "fb686506-0f65-4102-90ad-fa5f536eb449", "name": "EMETAN-6'-OL, 7',10,11-TRIMETHOXY-", "stdName": "EMETAN-6'-OL, 7',10,11-TRIMETHOXY-", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "4f825653-f992-4386-a69b-5653ad17d9ca" ], "display_name": false } ], "references": [ { "uuid": "e8600729-8ee6-43f8-a335-a140bfe6d554", "citation": "WIKIPEDIA", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "53e3ab2b-4211-4588-93fd-5b99fdcb0095", "citation": "MERCK", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "88c78aa1-b669-4442-b8b0-4581778c3a9d", "citation": "http://nikkajiweb.jst.go.jp/nikkaji_web/pages/top_e.jsp?CONTENT=syosai&SN=J5.985D", "url": "http://nikkajiweb.jst.go.jp/nikkaji_web/pages/top_e.jsp?CONTENT=syosai&SN=J5.985D", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "319bb141-bc38-49ea-8d1e-28e4ff9c73c7", "citation": "MERCK INDEX", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "4f825653-f992-4386-a69b-5653ad17d9ca", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "f1d897ee-8d2f-4f5d-9d79-04b6b3d3d80f", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493389718000, "tags": [ "NOMEN" ] }, { "uuid": "408ef74f-f0a4-4a05-9394-55109477d623", "citation": "SRS import [QA971541A1]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=QA971541A1", "doc_type": "SRS", "public_domain": true, "document_date": 1493389718000, "tags": [ "NOMEN" ] }, { "uuid": "0da98a08-6a4d-4692-9c4c-cbb0c003c959", "citation": "CEPHAELINE [MI]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "9c7fb564-e3a0-44f6-813e-aa40e5bc2c85", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "c8ab92e2-d2c5-1140-77f0-8d8a7a0f0e55", "doc_type": "SYSTEM", "public_domain": true }, { "uuid": "4def50a0-f148-5e80-9672-7c9667d4f392", "citation": "EPA CompTox", "doc_type": "EPA", "public_domain": true }, { "uuid": "59eb4ff9-5ed4-980f-e168-8d9035c8a023", "citation": "EU-SRS", "doc_type": "EMA LIST", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "58938659-1d09-4d01-b472-b780c194c3cd", "id": "58938659-1d09-4d01-b472-b780c194c3cd", "molfile": "\n Marvin 01132104362D \n\n 34 38 0 0 1 0 999 V2000\n 4.1567 -2.6423 0.0000 C 0 0 1 0 0 0 0 0 0 1 0 0\n 3.4562 -3.0754 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.4562 -3.8914 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.8988 -3.0617 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.5948 -2.6423 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 6.3138 -3.0386 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.0375 -2.6238 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.0375 -1.7988 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.7381 -1.3701 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.7381 -0.5497 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.4524 -0.1395 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.1806 -0.5358 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.0145 -0.1348 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.0145 0.6810 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.2815 1.0912 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.3138 -0.5681 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.3138 -1.3931 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.5948 -1.8034 0.0000 C 0 0 2 0 0 0 0 0 0 2 0 0\n 4.8758 -1.4116 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.1567 -1.8311 0.0000 C 0 0 2 0 0 0 0 0 0 2 0 0\n 3.4424 -1.4116 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.4424 -0.5866 0.0000 C 0 0 1 0 0 0 0 0 0 1 0 0\n 4.1429 -0.1671 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 4.1429 0.6625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.4192 1.0727 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.7003 0.6532 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.9858 1.0590 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.2668 0.6394 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.5571 1.0451 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1.2668 -0.1856 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.5616 -0.5958 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 0.5616 -1.4439 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.9997 -0.6004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.7003 -0.1764 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 6 0 0 0\n 1 4 1 0 0 0 0\n 1 20 1 0 0 0 0\n 3 2 1 0 0 0 0\n 4 5 1 0 0 0 0\n 6 5 1 0 0 0 0\n 18 5 1 0 0 0 0\n 7 6 1 0 0 0 0\n 8 7 1 0 0 0 0\n 9 8 1 0 0 0 0\n 17 8 2 0 0 0 0\n 10 9 2 0 0 0 0\n 11 10 1 0 0 0 0\n 13 10 1 0 0 0 0\n 12 11 1 0 0 0 0\n 14 13 1 0 0 0 0\n 13 16 2 0 0 0 0\n 15 14 1 0 0 0 0\n 16 17 1 0 0 0 0\n 17 18 1 0 0 0 0\n 18 19 1 1 0 0 0\n 20 19 1 0 0 0 0\n 20 21 1 1 0 0 0\n 22 21 1 6 0 0 0\n 22 23 1 0 0 0 0\n 22 34 1 0 0 0 0\n 24 23 1 0 0 0 0\n 25 24 1 0 0 0 0\n 26 25 1 0 0 0 0\n 27 26 1 0 0 0 0\n 26 34 2 0 0 0 0\n 28 27 2 0 0 0 0\n 29 28 1 0 0 0 0\n 30 28 1 0 0 0 0\n 31 30 1 0 0 0 0\n 30 33 2 0 0 0 0\n 32 31 1 0 0 0 0\n 33 34 1 0 0 0 0\nM END", "smiles": "CC[C@H]1CN2CCc3cc(c(cc3[C@@H]2C[C@@H]1C[C@@H]4c5cc(c(cc5CCN4)O)OC)OC)OC", "formula": "C28H38N2O4", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "9c7f75a2-1cab-45cd-bb71-166985255929" }, "defined_stereo": 4, "ez_centers": 0, "molecular_weight": "466.6134", "optical_activity": "UNSPECIFIED", "stereo_centers": 4 } ], "definition_level": "COMPLETE", "uuid": "105332e6-38df-4f55-8126-4dd8fa67fdfb", "version": "10", "structure": { "id": "3410bdc5-0fc7-4fcb-a58f-30dc753e5f27", "molfile": "\n Marvin 01132102472D \n\n 36 40 0 0 1 0 999 V2000\n 5.5948 -2.6423 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 5.5948 -1.8034 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 6.3138 -1.3931 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.3138 -0.5681 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.0145 -0.1348 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.0145 0.6810 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.2815 1.0912 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.7381 -0.5497 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.7381 -1.3701 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.0375 -1.7988 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.0375 -2.6238 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.3138 -3.0386 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.4524 -0.1395 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.1806 -0.5358 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.8758 -1.4116 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.1567 -1.8311 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 4.1567 -2.6423 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 4.8988 -3.0617 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.4562 -3.0754 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.4562 -3.8914 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.4424 -1.4116 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.4424 -0.5866 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 2.7003 -0.1764 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.9997 -0.6004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.2668 -0.1856 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.5616 -0.5958 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 0.5616 -1.4439 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.2668 0.6394 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.9858 1.0590 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.7003 0.6532 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.4192 1.0727 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.1429 0.6625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.1429 -0.1671 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 0.5571 1.0451 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8662 -0.9185 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n 5.5948 -0.9921 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 3 2 1 0 0 0 0\n 4 3 2 0 0 0 0\n 5 4 1 0 0 0 0\n 6 5 1 0 0 0 0\n 7 6 1 0 0 0 0\n 5 8 2 0 0 0 0\n 8 9 1 0 0 0 0\n 9 10 2 0 0 0 0\n 10 11 1 0 0 0 0\n 11 12 1 0 0 0 0\n 12 1 1 0 0 0 0\n 3 10 1 0 0 0 0\n 13 8 1 0 0 0 0\n 14 13 1 0 0 0 0\n 15 2 1 0 0 0 0\n 15 16 1 0 0 0 0\n 16 17 1 0 0 0 0\n 17 18 1 0 0 0 0\n 18 1 1 0 0 0 0\n 17 19 1 6 0 0 0\n 20 19 1 0 0 0 0\n 16 21 1 1 0 0 0\n 22 21 1 0 0 0 0\n 23 22 1 0 0 0 0\n 24 23 2 0 0 0 0\n 25 24 1 0 0 0 0\n 26 25 1 0 0 0 0\n 27 26 1 0 0 0 0\n 25 28 2 0 0 0 0\n 28 29 1 0 0 0 0\n 29 30 2 0 0 0 0\n 30 23 1 0 0 0 0\n 30 31 1 0 0 0 0\n 31 32 1 0 0 0 0\n 32 33 1 0 0 0 0\n 33 22 1 0 0 0 0\n 34 28 1 0 0 0 0\n 22 35 1 1 0 0 0\n 2 36 1 6 0 0 0\nM END", "smiles": "CC[C@H]1CN2CCc3cc(c(cc3[C@]2([H])C[C@@H]1C[C@]4([H])c5cc(c(cc5CCN4)O)OC)OC)OC", "formula": "C28H38N2O4", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "defined_stereo": 4, "ez_centers": 0, "molecular_weight": "466.6134", "optical_activity": "UNSPECIFIED", "references": [ "e8600729-8ee6-43f8-a335-a140bfe6d554", "408ef74f-f0a4-4a05-9394-55109477d623" ], "stereo_centers": 4 }, "unii": "QA971541A1" } ] }