{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "51b38427-6a39-44a4-a211-f146f461df56",
          "code": "S01EB10",
          "comments": "ATC|SENSORY ORGANS|OPHTHALMOLOGICALS|ANTIGLAUCOMA PREPARATIONS AND MIOTICS|Parasympathomimetics|paraoxon",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=S01EB10&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "89f3c300-020b-4844-82c2-74914c0d5d53"
          ]
        },
        {
          "uuid": "613eaa22-9c14-4587-ae6b-92bd7385d9d0",
          "code": "QS01EB10",
          "comments": "VATC|OPHTHALMOLOGICALS|ANTIGLAUCOMA PREPARATIONS AND MIOTICS|Parasympathomimetics|paraoxon",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QS01EB10&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "89f3c300-020b-4844-82c2-74914c0d5d53"
          ]
        },
        {
          "uuid": "db24d8ce-45d6-4c5a-90dc-71261be274e1",
          "code": "311-45-5",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=311-45-5",
          "code_system": "CAS",
          "references": [
            "89f3c300-020b-4844-82c2-74914c0d5d53",
            "88403c51-cde2-44d6-84fb-c57616ffdc42"
          ]
        },
        {
          "uuid": "a15e38d8-7335-45fb-a9d5-faeb4d0b19d8",
          "code": "C99562",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C99562",
          "code_system": "NCI_THESAURUS",
          "references": [
            "89f3c300-020b-4844-82c2-74914c0d5d53"
          ]
        },
        {
          "uuid": "3ce53d8d-598c-43c0-9d5e-4b461df04f54",
          "code": "D010261",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/68010261",
          "code_system": "MESH",
          "references": [
            "89f3c300-020b-4844-82c2-74914c0d5d53"
          ]
        },
        {
          "uuid": "92f0f7d6-5344-46f8-9aeb-ca16adfde41f",
          "code": "PARAOXON",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Paraoxon",
          "code_system": "WIKIPEDIA",
          "references": [
            "89f3c300-020b-4844-82c2-74914c0d5d53"
          ]
        },
        {
          "uuid": "9f451880-8eed-4e21-9e12-8e1a845a1a07",
          "code": "653502",
          "comments": "EPA PESTICIDE|CONVENTIONAL CHEMICAL",
          "type": "PRIMARY",
          "url": "http://iaspub.epa.gov/apex/pesticides/f?p=CHEMICALSEARCH:3:0::NO:21,3,31,7,12,25:P3_XCHEMICAL_ID:3219",
          "code_system": "EPA PESTICIDE CODE",
          "references": [
            "89f3c300-020b-4844-82c2-74914c0d5d53"
          ]
        },
        {
          "uuid": "bcad1cd0-5383-443e-9eab-9510c9866d16",
          "code": "m8404",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m8404?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "89f3c300-020b-4844-82c2-74914c0d5d53"
          ]
        },
        {
          "uuid": "bc990d7b-8c8b-4bbb-b013-078c4bfaebe2",
          "code": "CHEMBL23838",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL23838",
          "code_system": "ChEMBL",
          "references": [
            "89f3c300-020b-4844-82c2-74914c0d5d53"
          ]
        },
        {
          "uuid": "69903f9f-d967-4111-b534-32c645a9692a",
          "code": "206-221-0",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.005.657",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "89f3c300-020b-4844-82c2-74914c0d5d53"
          ]
        },
        {
          "uuid": "53132dfe-7851-436a-8501-a0e03a0c1e69",
          "code": "9395",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/9395",
          "code_system": "PUBCHEM",
          "references": [
            "89f3c300-020b-4844-82c2-74914c0d5d53"
          ]
        },
        {
          "uuid": "c80a9826-262e-eb79-97a9-0ab21f023fa5",
          "code": "6044",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/6044",
          "code_system": "HSDB",
          "references": [
            "8b8c69c5-482e-d4f1-b097-c343c9995ba8"
          ]
        },
        {
          "uuid": "c2a050a2-99e6-19e6-2ecd-812b17a0b1de",
          "code": "DTXSID6024046",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID6024046",
          "code_system": "EPA CompTox",
          "references": [
            "cb8c2ffd-1ee8-66e5-cca5-da39d723484e"
          ]
        },
        {
          "uuid": "90bde397-6789-4676-23a0-0e3f8acd4b12",
          "code": "C737",
          "comments": "Industrial Aid[C45678]|Pesticide",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C737",
          "code_system": "NCI_THESAURUS",
          "references": [
            "05fe43e6-8149-5861-f946-7ee95c146cd1"
          ]
        },
        {
          "uuid": "8d5410d4-53d4-4e08-92a0-3ec5b9d8a9b8",
          "code": "C47792",
          "comments": "Pharmacologic Substance[C1909]|Enzyme Inhibitor[C471]|Acetylcholinesterase Inhibitor",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C47792",
          "code_system": "NCI_THESAURUS",
          "references": [
            "05fe43e6-8149-5861-f946-7ee95c146cd1"
          ]
        },
        {
          "uuid": "b8f34598-e799-46cd-9e5e-82fe8d75ac4a",
          "code": "SUB197081",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "18fdba9b-c1e5-d176-fed8-c88dca075f09"
          ]
        },
        {
          "uuid": "339e3108-e866-4462-a69f-c45952c48308",
          "code": "Q9CX8P80JW",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "b8327c29-d587-5649-f20d-7801c743c095",
          "code": "DB13495",
          "type": "PRIMARY",
          "url": "https://go.drugbank.com/drugs/DB13495",
          "code_system": "DRUG BANK",
          "references": [
            "05fe43e6-8149-5861-f946-7ee95c146cd1"
          ]
        },
        {
          "uuid": "1a02d015-0581-6b3b-b84f-78daac8f9b2c",
          "code": "4683",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/4683",
          "code_system": "DRUG CENTRAL",
          "references": [
            "05fe43e6-8149-5861-f946-7ee95c146cd1"
          ]
        },
        {
          "uuid": "a94ca061-2be4-0d0d-2a1f-5bb1e9e8eefc",
          "code": "27827",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:27827",
          "code_system": "CHEBI",
          "references": [
            "05fe43e6-8149-5861-f946-7ee95c146cd1"
          ]
        },
        {
          "uuid": "aeba3409-11da-441d-b622-e4dc9d736170",
          "code": "100000182791",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "cceef32c-79af-b836-825d-e2318e33d073"
          ]
        },
        {
          "uuid": "6a1a481e-0e0f-eca2-ea9a-0db2e4bc6c35",
          "code": "404110",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=404110",
          "code_system": "NSC",
          "references": [
            "9ffec9d3-679b-a39b-aa2a-295f9809c1b2"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "afbdab20-2254-4e0f-845c-881076d1b9fa",
          "type": "PARENT->METABOLITE",
          "references": [
            "eff5945f-b878-4615-b3f0-b1ccdd60a413"
          ],
          "related_substance": {
            "uuid": "7db32371-ca39-46a5-b791-236713c436e3",
            "refuuid": "430182ed-6f87-4a28-8fee-50d84daff059",
            "name": "PARATHION",
            "unii": "61G466064D",
            "linking_id": "61G466064D",
            "ref_pname": "PARATHION"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "bde4efa4-ec03-4a13-9569-5480353c4774",
          "name": "DIETHYL P-NITROPHENYL PHOSPHATE",
          "stdName": "DIETHYL P-NITROPHENYL PHOSPHATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "001f0ca7-a208-4bce-a29c-73415da59ef1",
            "60924405-1112-4136-be1f-be8281595b47"
          ],
          "display_name": false
        },
        {
          "uuid": "4d57c757-c297-4d44-8791-eda2a3cb4b98",
          "name": "E-600",
          "stdName": "E-600",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "001f0ca7-a208-4bce-a29c-73415da59ef1",
            "60924405-1112-4136-be1f-be8281595b47"
          ],
          "display_name": false
        },
        {
          "uuid": "4fcdf6f5-a0ff-4046-b61a-e636fbcdd506",
          "name": "E600",
          "stdName": "E600",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "001f0ca7-a208-4bce-a29c-73415da59ef1",
            "60924405-1112-4136-be1f-be8281595b47"
          ],
          "display_name": false
        },
        {
          "uuid": "dc03f532-5aef-4b5f-9625-db7fe1ba4a78",
          "name": "MIOTISAL",
          "stdName": "MIOTISAL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "001f0ca7-a208-4bce-a29c-73415da59ef1",
            "60924405-1112-4136-be1f-be8281595b47"
          ],
          "display_name": false
        },
        {
          "uuid": "ff001e10-f577-486c-8a1e-6c39db46b956",
          "name": "NSC-404110",
          "stdName": "NSC-404110",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9fc1dd83-5612-4fc0-a162-0d7d197b6104",
            "60924405-1112-4136-be1f-be8281595b47"
          ],
          "display_name": false
        },
        {
          "uuid": "14dcaace-16f6-4df3-b293-0b84c47ba4f3",
          "name": "PARAOXON",
          "stdName": "PARAOXON",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2dcfaa4b-fb88-4a90-b18e-840d00aed5ab",
            "baf3c571-6eda-43f1-9e6f-5c98814fe28a",
            "7426de51-0ef1-4bea-a42d-4f0e1de4d46a",
            "dada4c7d-eb6b-4b70-9b3f-5e74d283b899",
            "14545dbf-7917-4866-b93e-0806459b3d60",
            "cf488fc2-10fd-40a8-990b-cce9b9fad4ce",
            "bbd0dc41-b5b9-4885-90b0-abebb8aca5ed",
            "1ffbf09e-9501-435a-8b90-68796a990c5b",
            "da948ae6-35ad-4a25-92bf-f6f11e340e94",
            "60924405-1112-4136-be1f-be8281595b47"
          ],
          "display_name": true
        },
        {
          "uuid": "dbaed1b4-dacf-471f-abc4-0c066e04033d",
          "name": "PARAOXON [HSDB]",
          "stdName": "PARAOXON [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "dada4c7d-eb6b-4b70-9b3f-5e74d283b899",
            "60924405-1112-4136-be1f-be8281595b47"
          ],
          "display_name": false
        },
        {
          "uuid": "5458d3f0-0ffd-4e3a-b9dd-12012b14c476",
          "name": "PARAOXON [MART.]",
          "stdName": "PARAOXON [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "baf3c571-6eda-43f1-9e6f-5c98814fe28a"
          ],
          "display_name": false
        },
        {
          "uuid": "b3944f20-4b53-469c-b769-94e253bec16e",
          "name": "PARAOXON [MI]",
          "stdName": "PARAOXON [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "da948ae6-35ad-4a25-92bf-f6f11e340e94",
            "60924405-1112-4136-be1f-be8281595b47"
          ],
          "display_name": false
        },
        {
          "uuid": "fb6a62a7-fa36-4718-bab1-f1e935c5101c",
          "name": "PARATHION OXYGEN ANALOG",
          "stdName": "PARATHION OXYGEN ANALOG",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "22d2da21-b103-4295-920d-8414b7555af1",
            "60924405-1112-4136-be1f-be8281595b47"
          ],
          "display_name": false
        },
        {
          "uuid": "d4445e4d-f730-4ab4-b4e6-fdb164599367",
          "name": "PHOSPHACOL",
          "stdName": "PHOSPHACOL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "001f0ca7-a208-4bce-a29c-73415da59ef1",
            "60924405-1112-4136-be1f-be8281595b47"
          ],
          "display_name": false
        },
        {
          "uuid": "6a929b48-bbd8-6a07-053d-cf3c078c688c",
          "name": "Paraoxon [WHO-DD]",
          "stdName": "PARAOXON [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "db1ba7d7-d290-ed90-9db2-0352ff53d53a"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "2dcfaa4b-fb88-4a90-b18e-840d00aed5ab",
          "citation": "ICSAS BATCH 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "001f0ca7-a208-4bce-a29c-73415da59ef1",
          "citation": "DOSE",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "60924405-1112-4136-be1f-be8281595b47",
          "citation": "DOSE",
          "doc_type": "DOSE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "baf3c571-6eda-43f1-9e6f-5c98814fe28a",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "da948ae6-35ad-4a25-92bf-f6f11e340e94",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "dada4c7d-eb6b-4b70-9b3f-5e74d283b899",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "cf488fc2-10fd-40a8-990b-cce9b9fad4ce",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "22d2da21-b103-4295-920d-8414b7555af1",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9fc1dd83-5612-4fc0-a162-0d7d197b6104",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "89f3c300-020b-4844-82c2-74914c0d5d53",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390906000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6d999e73-f434-4d0a-9c9e-90918e009cbf",
          "citation": "SRS import [Q9CX8P80JW]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=Q9CX8P80JW",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390906000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "33ef4bd7-52e8-479c-ae3f-2673de129de2",
          "citation": "CHEMID 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7426de51-0ef1-4bea-a42d-4f0e1de4d46a",
          "citation": "PARAOXON [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "bbd0dc41-b5b9-4885-90b0-abebb8aca5ed",
          "citation": "PARAOXON [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "14545dbf-7917-4866-b93e-0806459b3d60",
          "citation": "PARAOXON [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "1ffbf09e-9501-435a-8b90-68796a990c5b",
          "citation": "PARAOXON [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "cb8c2ffd-1ee8-66e5-cca5-da39d723484e",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=311-45-5",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "8b8c69c5-482e-d4f1-b097-c343c9995ba8",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+311-45-5",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "05fe43e6-8149-5861-f946-7ee95c146cd1",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "18fdba9b-c1e5-d176-fed8-c88dca075f09",
          "citation": "EVMPD",
          "doc_type": "EVMPD",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "88403c51-cde2-44d6-84fb-c57616ffdc42",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "eff5945f-b878-4615-b3f0-b1ccdd60a413",
          "citation": "Foxenberg, Robert J., et al. \"Human hepatic cytochrome p450-specific metabolism of parathion and chlorpyrifos.\" Drug metabolism and disposition 35.2 (2007): 189-193.",
          "url": "https://dmd.aspetjournals.org/content/dmd/35/2/189.full.pdf",
          "doc_type": "JA",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "9ffec9d3-679b-a39b-aa2a-295f9809c1b2",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "db1ba7d7-d290-ed90-9db2-0352ff53d53a",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "cceef32c-79af-b836-825d-e2318e33d073",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "6df063e1-a149-411d-b79d-979f5c904922",
          "id": "6df063e1-a149-411d-b79d-979f5c904922",
          "molfile": "\n  Marvin  01132105432D          \n\n 18 18  0  0  0  0            999 V2000\n    7.9154   -2.6921    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1182   -2.9062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5351   -2.3230    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7425   -2.5370    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1543   -3.2518    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9952   -2.8872    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9200   -3.7076    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1729   -4.0578    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3306   -1.8220    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5021   -1.8220    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0902   -1.1072    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2664   -1.1072    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8546   -1.8220    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2664   -2.5371    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0902   -2.5371    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0307   -1.8220    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n    1.6188   -1.1072    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    1.6188   -2.5371    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  4  5  2  0  0  0  0\n  4  6  1  0  0  0  0\n  4  9  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 10 15  2  0  0  0  0\n 11 12  2  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  2  0  0  0  0\n 13 16  1  0  0  0  0\n 14 15  1  0  0  0  0\n 16 17  1  0  0  0  0\n 16 18  2  0  0  0  0\nM  CHG  2  16   1  17  -1\nM  END",
          "smiles": "CCOP(=O)(OCC)Oc1ccc(cc1)[N+](=O)[O-]",
          "formula": "C10H14NO6P",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "bd3a74c1-06aa-4c9c-b879-e559603f1579"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "275.1954",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "ecc41daa-0948-4361-884c-4409bc3f43e0",
      "version": "17",
      "structure": {
        "id": "0b849945-302f-4ef2-8b48-f7280605394a",
        "molfile": "\n  Marvin  01132100512D          \n\n 18 18  0  0  0  0            999 V2000\n    5.7425   -2.5370    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3306   -1.8220    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5021   -1.8220    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0902   -1.1072    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2664   -1.1072    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8546   -1.8220    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0307   -1.8220    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n    1.6188   -1.1072    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    1.6188   -2.5371    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2664   -2.5371    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0902   -2.5371    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5351   -2.3230    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1182   -2.9062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9154   -2.6921    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9952   -2.8872    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9200   -3.7076    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1729   -4.0578    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1543   -3.2518    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  2  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  2  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  7  9  2  0  0  0  0\n  6 10  1  0  0  0  0\n 10 11  2  0  0  0  0\n  3 11  1  0  0  0  0\n  1 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n  1 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n  1 18  2  0  0  0  0\nM  CHG  2   7   1   8  -1\nM  END",
        "smiles": "CCOP(=O)(OCC)Oc1ccc(cc1)[N+](=O)[O-]",
        "formula": "C10H14NO6P",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "275.1954",
        "optical_activity": "NONE",
        "references": [
          "33ef4bd7-52e8-479c-ae3f-2673de129de2",
          "6d999e73-f434-4d0a-9c9e-90918e009cbf"
        ],
        "stereo_centers": 0
      },
      "unii": "Q9CX8P80JW"
    }
  ]
}