{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "4901ed22-31b5-4ee6-9a3b-f690219eb22b",
          "code": "17955-88-3",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=17955-88-3",
          "code_system": "CAS",
          "references": [
            "7bd7ef05-af5b-43d9-90f6-0a71278bc03b",
            "6abaa147-bc9c-44b5-bbce-67fd642d027b"
          ]
        },
        {
          "uuid": "765480ad-f2b8-4194-bedf-c2f43c929b28",
          "code": "1363431",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1363431/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "7bd7ef05-af5b-43d9-90f6-0a71278bc03b"
          ]
        },
        {
          "uuid": "f713a08f-8adc-4485-9ca0-5e556fa81657",
          "code": "241-881-3",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.038.059",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "7bd7ef05-af5b-43d9-90f6-0a71278bc03b"
          ]
        },
        {
          "uuid": "48895f5b-8d18-40d7-bdbe-8f2e3f83965e",
          "code": "87373",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/87373",
          "code_system": "PUBCHEM",
          "references": [
            "7bd7ef05-af5b-43d9-90f6-0a71278bc03b"
          ]
        },
        {
          "uuid": "998e0289-e7e6-af5a-12bf-fd62f46a5830",
          "code": "DTXSID6051807",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID6051807",
          "code_system": "EPA CompTox",
          "references": [
            "8b1517b6-dbd6-45cc-601b-dc46c495f42b"
          ]
        },
        {
          "uuid": "69814f0b-bc42-4407-89ba-bc9bf05cca59",
          "code": "Q95M2P1KJL",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "3f154977-6f82-8f2f-db44-beab49a19e2d",
          "code": "Q95M2P1KJL",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=Q95M2P1KJL",
          "code_system": "DAILYMED",
          "references": [
            "90473292-1a55-a2e9-5a68-0da251d9aa3e"
          ]
        },
        {
          "uuid": "19727f9f-3618-4d12-c787-cf1f67408112",
          "code": "300000048632",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "8a0fec86-0b28-722c-190d-f1e4b3b03df8"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "d00d9671-74c8-40ad-8c85-8f71061be5ff",
          "name": "BIS(TRIMETHYLSILOXY)OCTYLMETHYLSILANE",
          "stdName": "BIS(TRIMETHYLSILOXY)OCTYLMETHYLSILANE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d2acea64-1d1e-4509-8184-e8f7519cf738",
            "369a83ba-bc11-444c-96f2-7f748522820a"
          ],
          "display_name": false
        },
        {
          "uuid": "25a568e2-7da9-b3da-5c76-914ce8fb9e74",
          "name": "BRB CAPRYLYL METHICONE",
          "stdName": "BRB CAPRYLYL METHICONE",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "737276fd-db15-cd48-6a08-8d4cc3e294ad"
          ],
          "display_name": false
        },
        {
          "uuid": "b728e610-62ab-84da-f059-4f2faeb87908",
          "name": "CAPRYLYL METHICONE",
          "stdName": "CAPRYLYL METHICONE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": true,
          "references": [
            "01e73721-ab65-4c62-bd81-c1bd00ceb6d1"
          ],
          "display_name": false,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "6d7dc74d-79df-4f1e-908e-2bcb203f7dc5",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "f2ac4038-2c59-476f-b2e2-0ae9d32c5104",
          "name": "CAPRYLYL TRISILOXANE",
          "stdName": "CAPRYLYL TRISILOXANE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cd4b6c60-d3eb-4abe-b383-e29e8b287352",
            "d2acea64-1d1e-4509-8184-e8f7519cf738"
          ],
          "display_name": true
        },
        {
          "uuid": "23b7c0ba-b28f-4dad-b3ca-402f399f9939",
          "name": "HEPTAMETHYLOCTYLTRISILOXANE",
          "stdName": "HEPTAMETHYLOCTYLTRISILOXANE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2ccc3981-3d36-47c4-a633-0b9ccfdea17e",
            "d2acea64-1d1e-4509-8184-e8f7519cf738"
          ],
          "display_name": false
        },
        {
          "uuid": "347cf69e-26a6-451b-9b68-62130801ebd3",
          "name": "OCTYLHEPTAMETHYLTRISILOXANE",
          "stdName": "OCTYLHEPTAMETHYLTRISILOXANE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d2acea64-1d1e-4509-8184-e8f7519cf738",
            "369a83ba-bc11-444c-96f2-7f748522820a"
          ],
          "display_name": false
        },
        {
          "uuid": "3cd27d6e-ffab-8766-d1e8-4e41aa4da631",
          "name": "SILCARE 41M15",
          "stdName": "SILCARE 41M15",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d2acea64-1d1e-4509-8184-e8f7519cf738"
          ],
          "display_name": false
        },
        {
          "uuid": "571e6c1a-0591-8094-2f14-1cd11232dcdd",
          "name": "SILSOFT 034",
          "stdName": "SILSOFT 034",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d2acea64-1d1e-4509-8184-e8f7519cf738"
          ],
          "display_name": false
        },
        {
          "uuid": "527b0aa1-6bee-0f89-fbb7-1c6cf3d2f3c6",
          "name": "SS 3408",
          "stdName": "SS 3408",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d2acea64-1d1e-4509-8184-e8f7519cf738"
          ],
          "display_name": false
        },
        {
          "uuid": "cb1ea331-25e2-4be9-9578-d4e3df2e6ee1",
          "name": "TRISILOXANE, 1,1,1,3,5,5,5-HEPTAMETHYL-3-OCTYL-",
          "stdName": "TRISILOXANE, 1,1,1,3,5,5,5-HEPTAMETHYL-3-OCTYL-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2ccc3981-3d36-47c4-a633-0b9ccfdea17e",
            "d2acea64-1d1e-4509-8184-e8f7519cf738"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "2ccc3981-3d36-47c4-a633-0b9ccfdea17e",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "d2acea64-1d1e-4509-8184-e8f7519cf738",
          "citation": "STN (SCIFINDER)",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "50d300e4-fc04-4e58-8ecd-9dbdd6ab8277",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "369a83ba-bc11-444c-96f2-7f748522820a",
          "citation": "http://www.gelest.com/cosmetics_silicones.asp",
          "url": "http://www.gelest.com/cosmetics_silicones.asp",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "cd4b6c60-d3eb-4abe-b383-e29e8b287352",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "31a18765-1b4a-4e60-a7fb-58789ca9f581",
          "citation": "MSDS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7bd7ef05-af5b-43d9-90f6-0a71278bc03b",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391401000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0678c087-48ab-418c-b3a3-bd508eb12f42",
          "citation": "SRS import [Q95M2P1KJL]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=Q95M2P1KJL",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391401000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "01e73721-ab65-4c62-bd81-c1bd00ceb6d1",
          "citation": "CAPRYLYL METHICONE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "8b1517b6-dbd6-45cc-601b-dc46c495f42b",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=17955-88-3",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "737276fd-db15-cd48-6a08-8d4cc3e294ad",
          "citation": "https://glenncorp.com/wp-content/uploads/2016/11/BRB-Caprylyl-Methicone.pdf",
          "doc_type": "MANUFACTURER PRODUCT DESCRIPTION",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "6abaa147-bc9c-44b5-bbce-67fd642d027b",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "1332e34d-75ab-9d95-750d-6cd38c476aa9",
          "citation": "PCPC",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true
        },
        {
          "uuid": "90473292-1a55-a2e9-5a68-0da251d9aa3e",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "8a0fec86-0b28-722c-190d-f1e4b3b03df8",
          "citation": "SMS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "5e58abd7-e2b5-48a8-abf9-c97c4f2bdcf7",
          "id": "5e58abd7-e2b5-48a8-abf9-c97c4f2bdcf7",
          "molfile": "\n  Marvin  01132104532D          \n\n 20 19  0  0  0  0            999 V2000\n    7.5976   -7.4348    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8852   -7.0187    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8893   -6.1937    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1769   -5.7777    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1810   -4.9527    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4685   -4.5366    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4726   -3.7116    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7602   -3.2956    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7643   -2.4706    0.0000 Si  0  0  0  0  0  0  0  0  0  0  0  0\n    4.7602   -1.6456    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9393   -2.4706    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5810   -2.4665    0.0000 Si  0  0  0  0  0  0  0  0  0  0  0  0\n    2.5768   -3.2915    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.7560   -2.4665    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5768   -1.6415    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0352   -2.4706    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7861   -2.5069    0.0000 Si  0  0  0  0  0  0  0  0  0  0  0  0\n    7.7949   -3.3319    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7857   -1.6819    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6111   -2.5023    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n  9 10  1  0  0  0  0\n 11  9  1  0  0  0  0\n  9 16  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 12 14  1  0  0  0  0\n 12 15  1  0  0  0  0\n 17 16  1  0  0  0  0\n 17 18  1  0  0  0  0\n 17 19  1  0  0  0  0\n 17 20  1  0  0  0  0\nM  END",
          "smiles": "CCCCCCCC[Si](C)(O[Si](C)(C)C)O[Si](C)(C)C",
          "formula": "C15H38O2Si3",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "b71eff60-2159-4ac0-b64a-d335486100a7"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "334.7178",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "2c424114-878c-4d68-a73c-5de3843daa71",
      "version": "8",
      "structure": {
        "id": "dacd39c3-03e9-4722-ac5c-2c7ae39ae1f6",
        "molfile": "\n  Marvin  01132111212D          \n\n 20 19  0  0  0  0            999 V2000\n    2.5768   -3.2915    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5810   -2.4665    0.0000 Si  0  0  0  0  0  0  0  0  0  0  0  0\n    1.7560   -2.4665    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5768   -1.6415    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9393   -2.4706    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7643   -2.4706    0.0000 Si  0  0  0  0  0  0  0  0  0  0  0  0\n    4.7602   -3.2956    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4726   -3.7116    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4685   -4.5366    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1810   -4.9527    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1769   -5.7777    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8893   -6.1937    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8852   -7.0187    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5976   -7.4348    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7602   -1.6456    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0352   -2.4706    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7861   -2.5069    0.0000 Si  0  0  0  0  0  0  0  0  0  0  0  0\n    7.7949   -3.3319    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7857   -1.6819    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6111   -2.5023    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  2  4  1  0  0  0  0\n  5  2  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n  6 15  1  0  0  0  0\n  6 16  1  0  0  0  0\n 17 16  1  0  0  0  0\n 17 18  1  0  0  0  0\n 17 19  1  0  0  0  0\n 17 20  1  0  0  0  0\nM  END",
        "smiles": "CCCCCCCC[Si](C)(O[Si](C)(C)C)O[Si](C)(C)C",
        "formula": "C15H38O2Si3",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "334.7178",
        "optical_activity": "NONE",
        "references": [
          "50d300e4-fc04-4e58-8ecd-9dbdd6ab8277",
          "0678c087-48ab-418c-b3a3-bd508eb12f42"
        ],
        "stereo_centers": 0
      },
      "unii": "Q95M2P1KJL"
    }
  ]
}