{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "494dff4e-1c72-4656-beec-db0444366119",
          "code": "95266-40-3",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=95266-40-3",
          "code_system": "CAS",
          "references": [
            "c71a3fe2-73dc-4384-97da-bc4acbd2f4c0",
            "54478edd-6236-4e5c-9efd-7eb5fa2ad5ac"
          ]
        },
        {
          "uuid": "f1137be9-efa9-470f-9ad2-36c4894c9769",
          "code": "C478127",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67478127",
          "code_system": "MESH",
          "references": [
            "c71a3fe2-73dc-4384-97da-bc4acbd2f4c0"
          ]
        },
        {
          "uuid": "b55a8244-0bcc-414d-9845-62e8ba56a4c8",
          "code": "112602",
          "comments": "EPA PESTICIDE|CONVENTIONAL CHEMICAL",
          "type": "PRIMARY",
          "url": "http://iaspub.epa.gov/apex/pesticides/f?p=CHEMICALSEARCH:3:0::NO:21,3,31,7,12,25:P3_XCHEMICAL_ID:4160",
          "code_system": "EPA PESTICIDE CODE",
          "references": [
            "c71a3fe2-73dc-4384-97da-bc4acbd2f4c0"
          ]
        },
        {
          "uuid": "d1039a75-3271-4bc9-8de2-b636edb048a7",
          "code": "m11167",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m11167?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "c71a3fe2-73dc-4384-97da-bc4acbd2f4c0"
          ]
        },
        {
          "uuid": "0986b6dc-40f6-e4ca-724e-8bc2c4c83ff1",
          "code": "DTXSID9032535",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID9032535",
          "code_system": "EPA CompTox",
          "references": [
            "9bf47897-05b0-85e9-62b8-aa7083e9965e"
          ]
        },
        {
          "uuid": "bf202f26-33cc-4919-93a2-7ce233d18559",
          "code": "Q89W563T9J",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "c1201ffb-19f5-4249-8683-ed6266f5627d",
          "code": "83454",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:83454",
          "code_system": "CHEBI",
          "references": [
            "4c756244-6873-3515-47f9-874281da3b68"
          ]
        },
        {
          "uuid": "81266347-2893-b7c3-8f9a-b0b322f626da",
          "code": "trinexapac-ethyl",
          "type": "PRIMARY",
          "url": "https://pesticidecompendium.bcpc.org/trinexapac-ethyl.html",
          "code_system": "ALANWOOD",
          "references": [
            "d6375df4-dbd8-86fc-424a-ba238ceda4de"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "0516f656-0748-4b49-ba99-83fa8745ab0b",
          "name": "4-(CYCLOPROPYLHYDROXYMETHYLENE)-3,5-DIOXOCYCLOHEXANECARBOXYLIC ACID ETHYL ESTER",
          "stdName": "4-(CYCLOPROPYLHYDROXYMETHYLENE)-3,5-DIOXOCYCLOHEXANECARBOXYLIC ACID ETHYL ESTER",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "dd474e59-80b7-4ebb-bfb5-564cae25947d",
            "35a86827-423e-4c18-8c8f-2e2667a34a6a"
          ],
          "display_name": false
        },
        {
          "uuid": "3dc13bbb-abac-4246-bbab-eac86c713ee9",
          "name": "CGA-163935",
          "stdName": "CGA-163935",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "dd474e59-80b7-4ebb-bfb5-564cae25947d",
            "35a86827-423e-4c18-8c8f-2e2667a34a6a"
          ],
          "display_name": false
        },
        {
          "uuid": "cf1c4ff4-2b1b-4e61-8f44-81c62f45bc2b",
          "name": "CIMECTACARB",
          "stdName": "CIMECTACARB",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "dd474e59-80b7-4ebb-bfb5-564cae25947d",
            "35a86827-423e-4c18-8c8f-2e2667a34a6a"
          ],
          "display_name": false
        },
        {
          "uuid": "b58ad199-eec9-4db1-9009-ecfabdd65c11",
          "name": "PALISADE",
          "stdName": "PALISADE",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "dd474e59-80b7-4ebb-bfb5-564cae25947d",
            "35a86827-423e-4c18-8c8f-2e2667a34a6a"
          ],
          "display_name": false
        },
        {
          "uuid": "dfa40047-b5ba-45c4-98e4-71294d547dfd",
          "name": "TRINEXAPAC-ETHYL",
          "stdName": "TRINEXAPAC-ETHYL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a552f990-c3b2-4a52-9f35-0218b5908981",
            "d66aeaf4-a3c3-4620-a487-fb625ebf8c11",
            "40223da5-df5a-4b9a-a6df-cd283c9c5a0a",
            "3c87c4e7-5aed-4159-9303-021002f4391a",
            "dd474e59-80b7-4ebb-bfb5-564cae25947d",
            "a11270c4-df3b-47f4-ab0d-b155d663cf17"
          ],
          "display_name": true
        },
        {
          "uuid": "3d06ca12-8184-457a-b73c-b27e762bab1c",
          "name": "TRINEXAPAC-ETHYL [ISO]",
          "stdName": "TRINEXAPAC-ETHYL [ISO]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d66aeaf4-a3c3-4620-a487-fb625ebf8c11",
            "dd474e59-80b7-4ebb-bfb5-564cae25947d"
          ],
          "display_name": false
        },
        {
          "uuid": "bd126495-d85b-49a0-b47b-0787d2ba08ab",
          "name": "TRINEXAPAC-ETHYL [MI]",
          "stdName": "TRINEXAPAC-ETHYL [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3c87c4e7-5aed-4159-9303-021002f4391a",
            "dd474e59-80b7-4ebb-bfb5-564cae25947d"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "40223da5-df5a-4b9a-a6df-cd283c9c5a0a",
          "citation": "ICSAS BATCH 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "3c87c4e7-5aed-4159-9303-021002f4391a",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "dd474e59-80b7-4ebb-bfb5-564cae25947d",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "35a86827-423e-4c18-8c8f-2e2667a34a6a",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d66aeaf4-a3c3-4620-a487-fb625ebf8c11",
          "citation": "ISO",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c71a3fe2-73dc-4384-97da-bc4acbd2f4c0",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390917000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ce6d16f8-e5ff-4a02-bfe5-670f6221e5a7",
          "citation": "SRS import [Q89W563T9J]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=Q89W563T9J",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390917000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0377d6e7-9d25-4147-8f15-f1c3d16600cb",
          "citation": "CHEMID 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a11270c4-df3b-47f4-ab0d-b155d663cf17",
          "citation": "TRINEXAPAC-ETHYL [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "a552f990-c3b2-4a52-9f35-0218b5908981",
          "citation": "TRINEXAPAC-ETHYL [ISO]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "9bf47897-05b0-85e9-62b8-aa7083e9965e",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=95266-40-3",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "d6375df4-dbd8-86fc-424a-ba238ceda4de",
          "citation": "AW",
          "doc_type": "ALANWOOD",
          "public_domain": true
        },
        {
          "uuid": "4c756244-6873-3515-47f9-874281da3b68",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "54478edd-6236-4e5c-9efd-7eb5fa2ad5ac",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "68925ac5-a23e-4382-abb3-50a63bba7a47",
          "id": "68925ac5-a23e-4382-abb3-50a63bba7a47",
          "molfile": "\n  Marvin  01132105262D          \n\n 18 19  0  0  0  0            999 V2000\n    4.2095   -6.0364    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7746   -5.6248    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6102   -5.9118    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0193   -5.1968    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6037   -4.4809    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8443   -5.1968    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2534   -5.9105    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0821   -5.9105    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4959   -6.6239    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4924   -5.1912    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3172   -5.1912    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7329   -5.9035    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7264   -4.4750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4440   -4.0601    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7264   -3.6462    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0783   -4.4798    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4862   -3.7628    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2546   -4.4798    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  4  5  2  0  0  0  0\n  6  4  1  0  0  0  0\n  6  7  1  0  0  0  0\n 18  6  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  2  0  0  0  0\n  8 10  1  0  0  0  0\n 11 10  1  0  0  0  0\n 10 16  2  0  0  0  0\n 11 12  2  0  0  0  0\n 13 11  1  0  0  0  0\n 13 14  1  0  0  0  0\n 15 13  1  0  0  0  0\n 14 15  1  0  0  0  0\n 16 17  1  0  0  0  0\n 16 18  1  0  0  0  0\nM  END",
          "smiles": "CCOC(=O)C1CC(=C(C(=O)C1)C(=O)C2CC2)O",
          "formula": "C13H16O5",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "RACEMIC",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "a5cba25d-8f02-4414-ac7b-9bb3f6a92381"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "252.2636",
          "optical_activity": "( + / - )",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "6100a91b-48f8-4f7e-94ce-2fa9fddd6b9c",
      "version": "5",
      "structure": {
        "id": "ea7a302b-8e90-4ee6-9979-9d08269bd518",
        "molfile": "\n  Marvin  01132112082D          \n\n 18 19  0  0  0  0            999 V2000\n   10.4440   -4.0601    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7264   -3.6462    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7264   -4.4750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3172   -5.1912    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7329   -5.9035    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4924   -5.1912    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0783   -4.4798    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4862   -3.7628    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2546   -4.4798    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8443   -5.1968    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0193   -5.1968    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6037   -4.4809    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6102   -5.9118    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7746   -5.6248    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2095   -6.0364    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2534   -5.9105    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0821   -5.9105    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4959   -6.6239    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  1  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  4  6  2  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  2  0  0  0  0\n  7  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  2  0  0  0  0\n 11 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 10 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 17  6  1  0  0  0  0\n 17 18  2  0  0  0  0\nM  END",
        "smiles": "CCOC(=O)C1CC(=O)/C(=C(\\C2CC2)/O)/C(=O)C1",
        "formula": "C13H16O5",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 1,
        "molecular_weight": "252.2636",
        "optical_activity": "NONE",
        "references": [
          "0377d6e7-9d25-4147-8f15-f1c3d16600cb",
          "ce6d16f8-e5ff-4a02-bfe5-670f6221e5a7"
        ],
        "stereo_centers": 0
      },
      "unii": "Q89W563T9J"
    }
  ]
}