{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "22a1fb5d-c0ee-4f4b-948e-719784faae0a",
          "code": "126833-17-8",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=126833-17-8",
          "code_system": "CAS",
          "references": [
            "b077d73d-0be9-4d20-9fbb-4eb76fc6c795",
            "769a41fc-8153-4540-ba8e-8e15a3f54121"
          ]
        },
        {
          "uuid": "9aa3bd54-f91c-4749-a9a0-ef32a299ac6e",
          "code": "C451426",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67451426",
          "code_system": "MESH",
          "references": [
            "b077d73d-0be9-4d20-9fbb-4eb76fc6c795"
          ]
        },
        {
          "uuid": "85f28efb-f517-4ee4-b13e-cd6ed831e75e",
          "code": "90209",
          "comments": "EPA PESTICIDE|CONVENTIONAL CHEMICAL",
          "type": "PRIMARY",
          "url": "http://iaspub.epa.gov/apex/pesticides/f?p=CHEMICALSEARCH:3:0::NO:21,3,31,7,12,25:P3_XCHEMICAL_ID:2353",
          "code_system": "EPA PESTICIDE CODE",
          "references": [
            "b077d73d-0be9-4d20-9fbb-4eb76fc6c795"
          ]
        },
        {
          "uuid": "d40cb1c8-13ef-44e7-9f55-0cf73457e300",
          "code": "m5275",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m5275?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "b077d73d-0be9-4d20-9fbb-4eb76fc6c795"
          ]
        },
        {
          "uuid": "91b3c865-57b1-4cf4-ab89-005d4b167717",
          "code": "213031",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/213031",
          "code_system": "PUBCHEM",
          "references": [
            "b077d73d-0be9-4d20-9fbb-4eb76fc6c795"
          ]
        },
        {
          "uuid": "6ad3b46a-bc90-cf71-ef35-0bacf37c8e52",
          "code": "7273",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/7273",
          "code_system": "HSDB",
          "references": [
            "6eb250d1-a0fe-fe27-88b3-832469431f85"
          ]
        },
        {
          "uuid": "e993e1b6-c403-b1e4-4e8b-f606d375dfd4",
          "code": "DTXSID3032549",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID3032549",
          "code_system": "EPA CompTox",
          "references": [
            "b63d6a52-132c-6814-c2a6-829dd48e65d3"
          ]
        },
        {
          "uuid": "47ba36ed-5be9-42ca-bf9b-6d4895a285d6",
          "code": "Q68C3C9P1U",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "95d2936f-25b0-27c0-e594-d58f9d78bf5f",
          "code": "81853",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:81853",
          "code_system": "CHEBI",
          "references": [
            "c0ae5a7e-c7dd-c5fc-662f-b14e3e1bcead"
          ]
        },
        {
          "uuid": "5585165a-9ef8-363c-88a7-3bc496b1dd14",
          "code": "fenhexamid",
          "type": "PRIMARY",
          "url": "https://pesticidecompendium.bcpc.org/fenhexamid.html",
          "code_system": "ALANWOOD",
          "references": [
            "86c928f5-c8f1-b0dc-1b46-ff796b5e68e6"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "22996467-ff58-4a54-bdf7-921d48cafa82",
          "name": "1-METHYL-CYCLOHEXANECARBOXYLIC ACID (2,3-DICHLORO-4-HYDROXY-PHENYL)-AMIDE",
          "stdName": "1-METHYL-CYCLOHEXANECARBOXYLIC ACID (2,3-DICHLORO-4-HYDROXY-PHENYL)-AMIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b73e0e05-d448-4a43-87e7-73cf554fb2e4",
            "a861dd0b-6996-4a1f-b246-e6b5e153a533"
          ],
          "display_name": false
        },
        {
          "uuid": "1b71e5c6-2f95-43a2-bd74-4af7c68508a3",
          "name": "2',3'-DICHLORO-4'-HYDROXY-1-METHYLCYCLOHEXANECARBOXANILIDE",
          "stdName": "2',3'-DICHLORO-4'-HYDROXY-1-METHYLCYCLOHEXANECARBOXANILIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ef1f8883-1930-4888-ba71-864c49485026",
            "0e2bd3af-3140-4f5b-916d-71999e916fb3"
          ],
          "display_name": false
        },
        {
          "uuid": "d17b46bf-e6ba-4ee5-b33c-3eb2fe3c83b0",
          "name": "DECREE",
          "stdName": "DECREE",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5d282210-dd7f-4913-84f6-f677e727f713",
            "a861dd0b-6996-4a1f-b246-e6b5e153a533"
          ],
          "display_name": false
        },
        {
          "uuid": "1f8a3838-d643-4945-a19c-b70129a309f2",
          "name": "ELEVATE",
          "stdName": "ELEVATE",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5d282210-dd7f-4913-84f6-f677e727f713",
            "a861dd0b-6996-4a1f-b246-e6b5e153a533"
          ],
          "display_name": false
        },
        {
          "uuid": "0884cfc0-50d4-4ee8-b765-89c519cc5281",
          "name": "FENHEXAMID",
          "stdName": "FENHEXAMID",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d1b46d94-9fe0-48ce-a913-8bae5eba68a6",
            "463ffe5f-0ed9-4262-86b2-25497c8e265e",
            "18be28f0-f336-4b65-bcec-1e8273ac701a",
            "f83510a7-b29c-4df5-ada1-79bc4d5097d9",
            "134295b9-9336-4a17-9800-336f0cebfdd0",
            "b8b8b553-7382-48ef-baa4-ff94107bcaaa",
            "a861dd0b-6996-4a1f-b246-e6b5e153a533",
            "d2f9343c-152f-475d-884d-c46ded4bc18d"
          ],
          "display_name": true
        },
        {
          "uuid": "05f86b2e-9ba0-4a00-936a-e954c5c777d5",
          "name": "FENHEXAMID [HSDB]",
          "stdName": "FENHEXAMID [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f83510a7-b29c-4df5-ada1-79bc4d5097d9",
            "a861dd0b-6996-4a1f-b246-e6b5e153a533"
          ],
          "display_name": false
        },
        {
          "uuid": "272a39de-e8bc-4c86-8ccc-3bd53195a789",
          "name": "FENHEXAMID [ISO]",
          "stdName": "FENHEXAMID [ISO]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "463ffe5f-0ed9-4262-86b2-25497c8e265e",
            "a861dd0b-6996-4a1f-b246-e6b5e153a533"
          ],
          "display_name": false
        },
        {
          "uuid": "1b750d54-1b49-46d6-ba6d-fe454528f812",
          "name": "FENHEXAMID [MI]",
          "stdName": "FENHEXAMID [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "18be28f0-f336-4b65-bcec-1e8273ac701a",
            "a861dd0b-6996-4a1f-b246-e6b5e153a533"
          ],
          "display_name": false
        },
        {
          "uuid": "15024103-1a05-4357-a387-8a8c900d959b",
          "name": "KBR-2738",
          "stdName": "KBR-2738",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b73e0e05-d448-4a43-87e7-73cf554fb2e4",
            "a861dd0b-6996-4a1f-b246-e6b5e153a533"
          ],
          "display_name": false
        },
        {
          "uuid": "29576492-b431-40c1-94fd-1fb138d02378",
          "name": "N-(2,3-DICHLORO-4-HYDROXYPHENYL)-1-METHYLCYCLOHEXANECARBOXAMIDE",
          "stdName": "N-(2,3-DICHLORO-4-HYDROXYPHENYL)-1-METHYLCYCLOHEXANECARBOXAMIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ef1f8883-1930-4888-ba71-864c49485026",
            "66ae6216-2501-4570-8d54-b333ac24af4d"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "134295b9-9336-4a17-9800-336f0cebfdd0",
          "citation": "ICSAS BATCH 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "ef1f8883-1930-4888-ba71-864c49485026",
          "citation": "ALANWOOD.NET",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0e2bd3af-3140-4f5b-916d-71999e916fb3",
          "citation": "ALANWOOD IUPAC",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "66ae6216-2501-4570-8d54-b333ac24af4d",
          "citation": "ALANWOOD CAS",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "18be28f0-f336-4b65-bcec-1e8273ac701a",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a861dd0b-6996-4a1f-b246-e6b5e153a533",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b73e0e05-d448-4a43-87e7-73cf554fb2e4",
          "citation": "Merck",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5d282210-dd7f-4913-84f6-f677e727f713",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f83510a7-b29c-4df5-ada1-79bc4d5097d9",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "463ffe5f-0ed9-4262-86b2-25497c8e265e",
          "citation": "ISO",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b077d73d-0be9-4d20-9fbb-4eb76fc6c795",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390954000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e8c95f4e-b1b5-4036-ae58-90b6132d366f",
          "citation": "SRS import [Q68C3C9P1U]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=Q68C3C9P1U",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390954000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c40c03b3-e175-4a69-b149-317454941c5e",
          "citation": "CHEMID 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d2f9343c-152f-475d-884d-c46ded4bc18d",
          "citation": "FENHEXAMID [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "d1b46d94-9fe0-48ce-a913-8bae5eba68a6",
          "citation": "FENHEXAMID [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "b8b8b553-7382-48ef-baa4-ff94107bcaaa",
          "citation": "FENHEXAMID [ISO]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "6eb250d1-a0fe-fe27-88b3-832469431f85",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+126833-17-8",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "b63d6a52-132c-6814-c2a6-829dd48e65d3",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=126833-17-8",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "86c928f5-c8f1-b0dc-1b46-ff796b5e68e6",
          "citation": "BCPC",
          "doc_type": "ALANWOOD",
          "public_domain": true
        },
        {
          "uuid": "c0ae5a7e-c7dd-c5fc-662f-b14e3e1bcead",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "769a41fc-8153-4540-ba8e-8e15a3f54121",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "08f4416c-7e10-4f3b-bc5c-054c881dd098",
          "id": "08f4416c-7e10-4f3b-bc5c-054c881dd098",
          "molfile": "\n  Marvin  01132100442D          \n\n 19 20  0  0  0  0            999 V2000\n    5.6051   -5.9686    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4241   -5.1759    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6324   -5.4024    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0330   -4.8307    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2357   -4.0237    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0320   -3.7974    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6269   -4.3735    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1440   -4.7496    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1440   -3.9408    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8583   -5.1619    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5681   -4.7379    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5681   -3.9127    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2659   -3.4852    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9804   -3.8966    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6839   -3.4824    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9804   -4.7107    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7241   -5.1024    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    8.2770   -5.1341    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2770   -5.9644    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  7  2  1  0  0  0  0\n  2  8  1  0  0  0  0\n  4  3  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  8  9  2  0  0  0  0\n  8 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 18 11  2  0  0  0  0\n 12 13  2  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 14 16  2  0  0  0  0\n 16 17  1  0  0  0  0\n 16 18  1  0  0  0  0\n 18 19  1  0  0  0  0\nM  END",
          "smiles": "CC1(CCCCC1)C(=O)Nc2ccc(c(c2Cl)Cl)O",
          "formula": "C14H17Cl2NO2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "e07e6c2c-daa0-4f7e-8f44-33a45a42eb65"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "302.1967",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "b27f7946-b232-47d4-a074-e1f57e47e191",
      "version": "6",
      "structure": {
        "id": "2b55a1f1-952c-4e45-8cb3-016560e4edea",
        "molfile": "\n  Marvin  01132102212D          \n\n 19 20  0  0  0  0            999 V2000\n    4.0330   -4.8307    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2357   -4.0237    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0320   -3.7974    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6269   -4.3735    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4241   -5.1759    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6324   -5.4024    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6051   -5.9686    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1440   -4.7496    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8583   -5.1619    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5681   -4.7379    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5681   -3.9127    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2659   -3.4852    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9804   -3.8966    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9804   -4.7107    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2770   -5.1341    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2770   -5.9644    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    9.7241   -5.1024    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    9.6839   -3.4824    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1440   -3.9408    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  1  6  1  0  0  0  0\n  5  7  1  0  0  0  0\n  5  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  2  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  2  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  2  0  0  0  0\n 15 10  1  0  0  0  0\n 15 16  1  0  0  0  0\n 14 17  1  0  0  0  0\n 13 18  1  0  0  0  0\n  8 19  2  0  0  0  0\nM  END",
        "smiles": "CC1(CCCCC1)C(=O)Nc2ccc(c(c2Cl)Cl)O",
        "formula": "C14H17Cl2NO2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "302.1967",
        "optical_activity": "NONE",
        "references": [
          "c40c03b3-e175-4a69-b149-317454941c5e",
          "e8c95f4e-b1b5-4036-ae58-90b6132d366f"
        ],
        "stereo_centers": 0
      },
      "unii": "Q68C3C9P1U"
    }
  ]
}