{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "d0768f81-9294-4f44-bf5f-dd80c1a9c6a8",
          "code": "42405-01-6",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=42405-01-6",
          "code_system": "CAS",
          "references": [
            "9c069718-29b4-41d4-8442-67ef1a17bfb1",
            "eb77dd1f-e3c2-4cb0-9f38-30ec71dc256c"
          ]
        },
        {
          "uuid": "b709c533-862e-4246-9a19-e1b7d0caf9e9",
          "code": "59609175",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/59609175",
          "code_system": "PUBCHEM",
          "references": [
            "9c069718-29b4-41d4-8442-67ef1a17bfb1"
          ]
        },
        {
          "uuid": "1274af45-b90e-4614-9acd-0cc7cea56187",
          "code": "Q671K86TVQ",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "ae4f8afa-5ed3-49c6-a8a0-4cdb1d48948a",
          "name": "1,5,5-TRIMETHYL-1-((2-METHACRYLOYLOXYETHYL)CARBAMOYLMETHYL)-3-(2-METHACRYLOYLOXYETHYL)CARBAMOYLCYCLOHEXANE",
          "stdName": "1,5,5-TRIMETHYL-1-((2-METHACRYLOYLOXYETHYL)CARBAMOYLMETHYL)-3-(2-METHACRYLOYLOXYETHYL)CARBAMOYLCYCLOHEXANE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ef1375d8-af0d-43bd-b7e8-099e41e06cab",
            "976f6928-57a4-4228-b19b-6814243a6d28"
          ],
          "display_name": false
        },
        {
          "uuid": "de1c2db4-c336-4fd5-9e5e-3c9ee339d047",
          "name": "2-PROPENOIC ACID, 2-METHYL-, 2-(((((1,3,3-TRIMETHYL-5-(((2-((2-METHYL-1-OXO-2-PROPEN-1-YL)OXY)ETHOXY)CARBONYL)AMINO)CYCLOHEXYL)METHYL)AMINO)CARBONYL)OXY)ETHYL ESTER",
          "stdName": "2-PROPENOIC ACID, 2-METHYL-, 2-(((((1,3,3-TRIMETHYL-5-(((2-((2-METHYL-1-OXO-2-PROPEN-1-YL)OXY)ETHOXY)CARBONYL)AMINO)CYCLOHEXYL)METHYL)AMINO)CARBONYL)OXY)ETHYL ESTER",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ef1375d8-af0d-43bd-b7e8-099e41e06cab",
            "976f6928-57a4-4228-b19b-6814243a6d28"
          ],
          "display_name": false
        },
        {
          "uuid": "9b5c0c26-1737-41a4-995e-4dcbd5b6bc4b",
          "name": "BIS-HEMA IPDI",
          "stdName": "BIS-HEMA IPDI",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2f328892-9564-4da0-95da-d9f6d491dd34",
            "dffc8090-a93b-4a48-b2a6-34f3ed231461",
            "976f6928-57a4-4228-b19b-6814243a6d28"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "dc2ee331-0332-4118-889d-3c6d110ce39e",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "a29c60ac-af9a-4623-a9d8-3fd01cecec7f",
          "name": "M 407",
          "stdName": "M 407",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ef1375d8-af0d-43bd-b7e8-099e41e06cab",
            "976f6928-57a4-4228-b19b-6814243a6d28"
          ],
          "display_name": false
        },
        {
          "uuid": "6d5aa90a-45a2-4cb0-9696-99059d643040",
          "name": "M-407",
          "stdName": "M-407",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ef1375d8-af0d-43bd-b7e8-099e41e06cab",
            "976f6928-57a4-4228-b19b-6814243a6d28"
          ],
          "display_name": false
        },
        {
          "uuid": "3f10fc44-17b7-4bad-9de9-8555df432bb5",
          "name": "URETHANE DIMETHACRYLATE III",
          "stdName": "URETHANE DIMETHACRYLATE III",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "dffc8090-a93b-4a48-b2a6-34f3ed231461",
            "976f6928-57a4-4228-b19b-6814243a6d28"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "dffc8090-a93b-4a48-b2a6-34f3ed231461",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "976f6928-57a4-4228-b19b-6814243a6d28",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ef1375d8-af0d-43bd-b7e8-099e41e06cab",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9c069718-29b4-41d4-8442-67ef1a17bfb1",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493393134000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2fe4a9be-8d08-4682-a8aa-5b17e38c9e96",
          "citation": "SRS import [Q671K86TVQ]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=Q671K86TVQ",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493393134000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2f328892-9564-4da0-95da-d9f6d491dd34",
          "citation": "BIS-HEMA IPDI [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "eb77dd1f-e3c2-4cb0-9f38-30ec71dc256c",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "a74a7d00-23a3-4247-bb2d-706701cbc4c6",
          "id": "a74a7d00-23a3-4247-bb2d-706701cbc4c6",
          "molfile": "\n  Marvin  01132108412D          \n\n 34 34  0  0  0  0            999 V2000\n   16.5175   -9.1984    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.7050   -9.0552    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.1747   -9.6872    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.4229   -8.2800    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.9531   -7.6479    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   14.6104   -8.1367    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   14.3282   -7.3614    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.5157   -7.2181    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.2334   -6.4429    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   12.4210   -6.2996    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.8907   -6.9316    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   12.1388   -5.5243    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   12.6691   -4.8924    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.3870   -4.1171    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n   13.1995   -3.9738    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.3870   -3.2920    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.6725   -2.8796    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n   10.9580   -3.2920    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9580   -4.1171    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1455   -3.9738    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6758   -4.8924    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.6725   -4.5296    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.6725   -2.0545    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9580   -1.6420    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9580   -0.8171    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2435   -2.0545    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5290   -1.6420    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8145   -2.0545    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1001   -1.6420    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3856   -2.0545    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3856   -2.8796    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6711   -1.6420    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9566   -2.0545    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6711   -0.8171    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  2  0  0  0  0\n  4  2  1  0  0  0  0\n  4  5  2  0  0  0  0\n  4  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n 10  9  1  0  0  0  0\n 10 11  2  0  0  0  0\n 12 10  1  0  0  0  0\n 13 12  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 14 16  1  0  0  0  0\n 14 22  1  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 17 23  1  0  0  0  0\n 19 18  1  0  0  0  0\n 19 20  1  0  0  0  0\n 19 21  1  0  0  0  0\n 22 19  1  0  0  0  0\n 23 24  1  0  0  0  0\n 24 25  2  0  0  0  0\n 24 26  1  0  0  0  0\n 27 26  1  0  0  0  0\n 28 27  1  0  0  0  0\n 29 28  1  0  0  0  0\n 30 29  1  0  0  0  0\n 30 31  2  0  0  0  0\n 30 32  1  0  0  0  0\n 32 33  1  0  0  0  0\n 32 34  2  0  0  0  0\nM  END",
          "smiles": "C=C(C)C(=O)OCCOC(=O)NCC1(C)CC(CC(C)(C)C1)NC(=O)OCCOC(=O)C(=C)C",
          "formula": "C24H38N2O8",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "MIXED",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "21d2bd0f-1d8f-4188-a4fb-0fe95d6081a4"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "482.5681",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 2
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "f404ca5b-62bb-4fe5-9e7c-63e889a1febd",
      "version": "3",
      "structure": {
        "id": "fa477298-29bb-41a9-a776-8bbaa0069b78",
        "molfile": "\n  Marvin  01132112582D          \n\n 34 34  0  0  0  0            999 V2000\n    7.3856   -2.0545    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6711   -1.6420    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9566   -2.0545    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6711   -0.8171    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1001   -1.6420    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8145   -2.0545    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5290   -1.6420    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2435   -2.0545    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9580   -1.6420    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.6725   -2.0545    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   11.6725   -2.8796    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9580   -3.2920    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9580   -4.1171    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.6725   -4.5296    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.3870   -4.1171    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.6691   -4.8924    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.1388   -5.5243    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   12.4210   -6.2996    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.8907   -6.9316    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   13.2334   -6.4429    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   13.5157   -7.2181    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.3282   -7.3614    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.6104   -8.1367    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   15.4229   -8.2800    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.9531   -7.6479    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   15.7050   -9.0552    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.1747   -9.6872    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.5175   -9.1984    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.3870   -3.2920    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.1995   -3.9738    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1455   -3.9738    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6758   -4.8924    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9580   -0.8171    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3856   -2.8796    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  2  4  2  0  0  0  0\n  1  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10  9  1  0  0  0  0\n 11 10  1  0  0  0  0\n 11 12  1  0  0  0  0\n 13 12  1  0  0  0  0\n 14 13  1  0  0  0  0\n 15 14  1  0  0  0  0\n 16 15  1  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  2  0  0  0  0\n 18 20  1  0  0  0  0\n 21 20  1  0  0  0  0\n 22 21  1  0  0  0  0\n 23 22  1  0  0  0  0\n 24 23  1  0  0  0  0\n 24 25  2  0  0  0  0\n 24 26  1  0  0  0  0\n 26 27  2  0  0  0  0\n 26 28  1  0  0  0  0\n 29 11  1  0  0  0  0\n 15 29  1  0  0  0  0\n 15 30  1  0  0  0  0\n 13 31  1  0  0  0  0\n 13 32  1  0  0  0  0\n  9 33  2  0  0  0  0\n  1 34  2  0  0  0  0\nM  END",
        "smiles": "C=C(C)C(=O)OCCOC(=O)NCC1(C)CC(CC(C)(C)C1)NC(=O)OCCOC(=O)C(=C)C",
        "formula": "C24H38N2O8",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "MIXED",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "482.5681",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "ef1375d8-af0d-43bd-b7e8-099e41e06cab",
          "2fe4a9be-8d08-4682-a8aa-5b17e38c9e96"
        ],
        "stereo_centers": 2
      },
      "unii": "Q671K86TVQ"
    }
  ]
}