{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2026-09-09", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "794c2f3a-920e-4328-942b-9b4591ba02ba", "code": "78350-78-4", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=78350-78-4", "code_system": "CAS", "references": [ "ea5e290f-a957-43ce-a77e-0568c1b01a66" ] }, { "uuid": "c08bc540-ae5a-0069-a665-1f4ee2c88753", "code": "DTXSID10893682", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID10893682", "code_system": "EPA CompTox", "references": [ "29f9856c-80ab-de43-c4ef-8342cf39300b" ] }, { "uuid": "4badb1c8-a09a-4803-b4ba-eef7214329b6", "code": "Q65Q8TWC55", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "7eaac2e2-6a08-e709-c696-b35828475d46", "code": "174128", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/174128", "code_system": "PUBCHEM", "references": [ "67c66199-17e0-b8ac-62b2-da50312d180c" ] } ], "substance_class": "chemical", "names": [ { "uuid": "a901f871-3f74-402a-a7e7-d2e37c9d8e96", "name": "Butan-2-yl propan-2-yloxycarbonyloxy carbonate", "stdName": "BUTAN-2-YL PROPAN-2-YLOXYCARBONYLOXY CARBONATE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "ea5e290f-a957-43ce-a77e-0568c1b01a66" ], "display_name": false }, { "uuid": "2690b526-dd45-4947-a0f9-06a262f447ca", "name": "Isopropyl sec-butyl peroxydicarbonate", "stdName": "ISOPROPYL SEC-BUTYL PEROXYDICARBONATE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "ea5e290f-a957-43ce-a77e-0568c1b01a66" ], "display_name": true }, { "uuid": "697ca6e7-6f02-4e81-818b-8ad5c231a3cf", "name": "Peroxydicarbonic acid, C-(1-methylethyl) C′-(1-methylpropyl) ester", "stdName": "PEROXYDICARBONIC ACID, C-(1-METHYLETHYL) C'-(1-METHYLPROPYL) ESTER", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "ea5e290f-a957-43ce-a77e-0568c1b01a66" ], "display_name": false } ], "references": [ { "uuid": "ea5e290f-a957-43ce-a77e-0568c1b01a66", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "29f9856c-80ab-de43-c4ef-8342cf39300b", "citation": "EPA CompTox", "doc_type": "EPA", "public_domain": true }, { "uuid": "67c66199-17e0-b8ac-62b2-da50312d180c", "citation": "PUBCHEM", "doc_type": "PUBCHEM", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "f57e5e8c-1ef3-4f87-a013-817b0490ad23", "id": "f57e5e8c-1ef3-4f87-a013-817b0490ad23", "molfile": "Peroxydicarbonic acid, C-(1-methylethyl) C'-(1-methylpropyl) ester\n CDK 01102416252D\n78350-78-4 Copyright (C) 2023 ACS\n 15 14 0 0 0 0 0 0 0 0999 V2000\n 8.0022 2.3101 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.6685 1.5400 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.3360 1.5400 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.0022 3.8501 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.3348 2.3101 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.6697 2.3101 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.0010 1.5400 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.0033 1.5400 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.6697 3.8501 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.6673 2.3101 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.0010 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 13.3370 2.3101 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.3337 1.5400 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.3337 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 2.3101 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 1 3 1 0 0 0 0\n 1 4 2 0 0 0 0\n 2 5 1 0 0 0 0\n 3 6 1 0 0 0 0\n 5 7 1 0 0 0 0\n 6 8 1 0 0 0 0\n 6 9 1 0 0 0 0\n 7 10 1 0 0 0 0\n 7 11 2 0 0 0 0\n 8 12 1 0 0 0 0\n 10 13 1 0 0 0 0\n 13 14 1 0 0 0 0\n 13 15 1 0 0 0 0\nM END", "smiles": "CCC(C)OC(=O)OOC(=O)OC(C)C", "formula": "C9H16O6", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "RACEMIC", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "249855b7-2f61-4489-bdf8-023ce7e54a9f" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "220.2201", "optical_activity": "( + / - )", "stereo_centers": 1 } ], "definition_level": "COMPLETE", "uuid": "eca0aa01-409a-4e04-b0b3-a7a52bb2eac7", "version": "4", "structure": { "id": "74796b9a-60ab-47f1-8670-9dd782521c8a", "molfile": "Peroxydicarbonic acid, C-(1-methylethyl) C'-(1-methylpropyl) ester\n JSDraw201102416252D\n\n 15 14 0 0 0 0 0 V2000\n 26.5190 -7.3060 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 25.1680 -8.0860 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 27.8700 -8.0860 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 26.5190 -5.7460 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 23.8170 -7.3060 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 29.2210 -7.3060 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 22.4660 -8.0860 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 30.5718 -8.0860 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.2210 -5.7460 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 21.1150 -7.3060 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 22.4660 -9.6460 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 31.9228 -7.3060 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 19.7642 -8.0860 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 19.7642 -9.6460 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.4132 -7.3060 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 1 3 1 0 0 0 0\n 1 4 2 0 0 0 0\n 2 5 1 0 0 0 0\n 3 6 1 0 0 0 0\n 5 7 1 0 0 0 0\n 6 8 1 0 0 0 0\n 6 9 1 0 0 0 0\n 7 10 1 0 0 0 0\n 7 11 2 0 0 0 0\n 8 12 1 0 0 0 0\n 10 13 1 0 0 0 0\n 13 14 1 0 0 0 0\n 13 15 1 0 0 0 0\nM END", "smiles": "CCC(C)OC(=O)OOC(=O)OC(C)C", "formula": "C9H16O6", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "RACEMIC", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "220.2201", "optical_activity": "( + / - )", "references": [ "ea5e290f-a957-43ce-a77e-0568c1b01a66" ], "stereo_centers": 1 }, "unii": "Q65Q8TWC55" } ] }