{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "398f9e25-66b6-4159-bf0c-c2b729ef1bbd", "code": "136-08-3", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=136-08-3", "code_system": "CAS", "references": [ "2a162f8f-9322-4bda-847c-6a2bf118e7b4", "ded2b601-c269-4cc1-8e5f-384759f5d049" ] }, { "uuid": "375186ef-4962-41b1-bae5-8134d61ab55a", "code": "C81632", "type": "PRIMARY", "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C81632", "code_system": "NCI_THESAURUS", "references": [ "2a162f8f-9322-4bda-847c-6a2bf118e7b4" ] }, { "uuid": "4be6530b-91af-4521-a876-0c52b2306202", "code": "D013835", "type": "PRIMARY", "url": "http://www.ncbi.nlm.nih.gov/mesh/68013835", "code_system": "MESH", "references": [ "2a162f8f-9322-4bda-847c-6a2bf118e7b4" ] }, { "uuid": "85363faf-6fd7-4c4b-8d9e-437d96c8ec1f", "code": "THIAMINE PYROPHOSPHATE", "type": "PRIMARY", "url": "https://en.wikipedia.org/wiki/Thiamine_pyrophosphate", "code_system": "WIKIPEDIA", "references": [ "2a162f8f-9322-4bda-847c-6a2bf118e7b4" ] }, { "uuid": "dee601c0-d2ea-4a74-9f41-49b2a5df8181", "code": "1358", "type": "PRIMARY", "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=1358", "code_system": "INN", "references": [ "2a162f8f-9322-4bda-847c-6a2bf118e7b4" ] }, { "uuid": "73fff586-0370-4c2e-95cb-1e6f4e5a09f3", "code": "136-09-4", "type": "ALTERNATIVE", "url": "https://commonchemistry.cas.org/detail?cas_rn=136-09-4", "code_system": "CAS", "references": [ "2a162f8f-9322-4bda-847c-6a2bf118e7b4", "06273511-c59f-4c00-8926-4142fe97170c" ] }, { "uuid": "494d6a44-7230-48c1-ab0a-2a2ad6d2ae66", "code": "10459", "comments": "RxNorm", "type": "PRIMARY", "url": "https://rxnav.nlm.nih.gov/REST/rxcui/10459/allProperties.xml?prop=all", "code_system": "RXCUI", "references": [ "2a162f8f-9322-4bda-847c-6a2bf118e7b4" ] }, { "uuid": "0143bd0e-ffa8-4722-9e3e-1d780d09c633", "code": "SUB06789MIG", "type": "PRIMARY", "code_system": "EVMPD", "references": [ "2a162f8f-9322-4bda-847c-6a2bf118e7b4" ] }, { "uuid": "eccec160-197f-f348-3078-95c602bc6eca", "code": "1132", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/1132", "code_system": "PUBCHEM", "references": [ "0a7462e5-7a3b-2f44-f5da-1f588b77513f" ] }, { "uuid": "10340412-1e18-bae3-a452-c66566205f57", "code": "DTXSID2048404", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID2048404", "code_system": "EPA CompTox", "references": [ "eb313b22-3954-04af-7cd6-a79f5d5208d1" ] }, { "uuid": "cd0f59d8-879d-955c-c7ab-3d60cabee5d1", "code": "342311", "comments": "ORPHAN DRUG|Designated|Treatment of mitochondrial disorders", "type": "PRIMARY", "url": "https://www.accessdata.fda.gov/scripts/opdlisting/oopd/detailedIndex.cfm?cfgridkey=342311", "code_system": "FDA ORPHAN DRUG" }, { "uuid": "4fdbfb75-b04b-e6c6-d036-57edd372741c", "code": "C45812", "comments": "Food or Food Product[C1949]|Food Component[C1930]|Bioactive Food Component[C54060]|Vitamin[C944]|Water-Soluble Vitamin[C1551]|B Vitamin", "type": "CONCEPT", "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C45812", "code_system": "NCI_THESAURUS", "references": [ "92024ecb-a1db-eaef-47c0-e900a4fc30ff" ] }, { "uuid": "0f3d7257-0a5d-29d1-cd54-0fecb5e595b9", "code": "74444-1", "comments": "LOINC|ACTIVE|CHEM|Bld|Thiamine pyrophosphate [Moles/volume] in Blood", "type": "PRIMARY", "url": "https://loinc.org/74444-1/", "code_system": "LOINC", "references": [ "92024ecb-a1db-eaef-47c0-e900a4fc30ff" ] }, { "uuid": "c664485a-c0f2-81a8-a88e-d18c0b9a64d3", "code": "3000-7", "comments": "LOINC|ACTIVE|CHEM|Ser|Thiamine pyrophosphate [Mass/volume] in Serum", "type": "PRIMARY", "url": "https://loinc.org/3000-7/", "code_system": "LOINC", "references": [ "92024ecb-a1db-eaef-47c0-e900a4fc30ff" ] }, { "uuid": "1b114f69-cce7-4d07-9421-f31e19fad90c", "code": "Q57971654Y", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "d6dc6e6e-bbbc-4ce9-b73e-d1912d27fc64", "code": "12318-71-7", "type": "SUPERSEDED", "url": "https://commonchemistry.cas.org/detail?cas_rn=12318-71-7", "code_system": "CAS", "references": [ "ded2b601-c269-4cc1-8e5f-384759f5d049" ] }, { "uuid": "1f590a41-6152-d2db-1b45-c0e4cb904e5d", "code": "445 (Number of products:3)", "comments": "Dietary Supplement Label Database|Enzyme|Cocarboxylase", "type": "PRIMARY", "url": "https://dsld.od.nih.gov/dsld/rptIngredient.jsp?grpid=445&item=Cocarboxylase", "code_system": "DSLD", "references": [ "92024ecb-a1db-eaef-47c0-e900a4fc30ff" ] }, { "uuid": "397ab324-0b95-ef7a-e877-15436211ccee", "code": "DB01987", "type": "PRIMARY", "url": "http://www.drugbank.ca/drugs/DB01987", "code_system": "DRUG BANK", "references": [ "92024ecb-a1db-eaef-47c0-e900a4fc30ff" ] }, { "uuid": "0eed2704-cd20-130a-63bb-e07c027b4d06", "code": "18290", "type": "PRIMARY", "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:18290", "code_system": "CHEBI", "references": [ "92024ecb-a1db-eaef-47c0-e900a4fc30ff" ] }, { "uuid": "3cfecb02-7ed8-8af8-50d3-97c71b5ceda3", "code": "58937", "type": "PRIMARY", "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:58937", "code_system": "CHEBI", "references": [ "92024ecb-a1db-eaef-47c0-e900a4fc30ff" ] }, { "uuid": "7a60dfd9-7dda-6deb-6102-377101aba480", "code": "45931", "type": "PRIMARY", "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:45931", "code_system": "CHEBI", "references": [ "92024ecb-a1db-eaef-47c0-e900a4fc30ff" ] }, { "uuid": "4880c4fa-ca88-8792-fc67-4fbeb189a066", "code": "9532", "type": "PRIMARY", "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:9532", "code_system": "CHEBI", "references": [ "92024ecb-a1db-eaef-47c0-e900a4fc30ff" ] }, { "uuid": "d8d1e86b-0dcb-e5ac-911b-972d77a603fd", "code": "100000085060", "type": "PRIMARY", "code_system": "SMS_ID", "references": [ "5f028a39-1c34-56c3-14da-f236694bb8ed" ] }, { "uuid": "cbbb200e-774f-a565-2206-6893274d2353", "code": "Q57971654Y", "type": "PRIMARY", "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=Q57971654Y", "code_system": "DAILYMED", "references": [ "cebafbec-bfef-33c4-1db7-3e053acf21a1" ] } ], "substance_class": "chemical", "references": [ { "uuid": "286dd42c-fba2-4305-b005-f9f12942bd62", "citation": "USP DICTIONARY 2008", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "ed946969-be3b-49cc-bf34-ca120a5c1c3d", "citation": "http://www.pubmedcentral.nih.gov/picrender.fcgi?artid=271930&blobtype=pdf", "url": "http://www.pubmedcentral.nih.gov/picrender.fcgi?artid=271930&blobtype=pdf", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "36fd92a3-8dba-4705-8ce7-4e894dbf3930", "citation": "INN Proposed List 1", "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL01.pdf", "doc_type": "INN_LIST", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "2a5d2648-18a5-4051-9e09-8bbd8c1b648c", "citation": "MARTINDALE 2011", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "18237108-ad80-4950-a41d-2c30f1585893", "citation": "KEGG 2011", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "390810eb-353d-4a5e-89c6-7687f1e7765e", "citation": "D01225", "doc_type": "KEGG", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "1a0d792f-07cb-4525-900e-d556483f7785", "citation": "WHO-DD", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "db00a232-bdc6-4c90-8765-348c7eb94f06", "citation": "wikipedia", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "e6703e5a-44df-4822-956e-6c5e4aaf2482", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "2a162f8f-9322-4bda-847c-6a2bf118e7b4", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493389705000, "tags": [ "NOMEN" ] }, { "uuid": "78639ca2-f334-4ee9-96c2-f0ba78e1dda9", "citation": "SRS import [Q57971654Y]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=Q57971654Y", "doc_type": "SRS", "public_domain": true, "document_date": 1493389705000, "tags": [ "NOMEN" ] }, { "uuid": "1fb345ed-63bb-4dc2-983d-cd0161907bb7", "citation": "COCARBOXYLASE [INN]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "fee3b998-38b7-40f4-b30d-6868c826e5dd", "citation": "COCARBOXYLASE [MART.]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "1a84c459-fa94-47f7-8768-abf71f7aad3e", "citation": "COCARBOXYLASE [WHO-DD]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "eb313b22-3954-04af-7cd6-a79f5d5208d1", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=136-08-3", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "92024ecb-a1db-eaef-47c0-e900a4fc30ff", "doc_type": "SYSTEM", "public_domain": true }, { "uuid": "06273511-c59f-4c00-8926-4142fe97170c", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "ded2b601-c269-4cc1-8e5f-384759f5d049", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "0a7462e5-7a3b-2f44-f5da-1f588b77513f", "citation": "PUBCHEM", "doc_type": "PUBCHEM", "public_domain": true }, { "uuid": "cebafbec-bfef-33c4-1db7-3e053acf21a1", "citation": "DailyMed", "doc_type": "DAILYMED", "public_domain": true }, { "uuid": "1fd3ba3a-cf39-0297-cb25-fbbc3747e55f", "citation": "WHO-DD", "doc_type": "WHO DRUG DICTIONARY", "public_domain": true }, { "uuid": "90d86240-bf40-4b0b-9f7e-f24b0c61a043", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "5f028a39-1c34-56c3-14da-f236694bb8ed", "citation": "EU-SRS", "doc_type": "EMA LIST", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "2b1e4d8d-d8fc-487c-84d5-2f6246158d9b", "id": "2b1e4d8d-d8fc-487c-84d5-2f6246158d9b", "molfile": "\n Marvin 01132102202D \n\n 26 27 0 0 0 0 999 V2000\n 11.2946 -3.5982 0.0000 N 0 3 0 0 0 0 0 0 0 0 0 0\n 12.0483 -3.2625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.6003 -3.8755 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.4207 -3.7894 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.9056 -4.4567 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.7262 -4.3706 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 15.2111 -5.0381 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0\n 15.9813 -4.7423 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 16.5609 -4.0365 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0\n 15.7728 -3.7928 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 17.3794 -4.1051 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 16.7351 -3.2299 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 14.5039 -5.4630 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 15.5728 -5.7796 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 12.1878 -4.5901 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 11.3807 -4.4187 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.2198 -2.4556 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.5802 -3.1854 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.8656 -3.5982 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.1512 -3.1854 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.4367 -3.5982 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 8.4367 -4.4232 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.1512 -4.8356 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 9.8656 -4.4232 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.7223 -4.8356 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.1512 -2.3605 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 16 1 2 0 0 0 0\n 18 1 1 0 0 0 0\n 3 2 2 0 0 0 0\n 17 2 1 0 0 0 0\n 4 3 1 0 0 0 0\n 3 15 1 0 0 0 0\n 5 4 1 0 0 0 0\n 6 5 1 0 0 0 0\n 7 6 1 0 0 0 0\n 8 7 1 0 0 0 0\n 13 7 2 0 0 0 0\n 14 7 1 0 0 0 0\n 9 8 1 0 0 0 0\n 10 9 2 0 0 0 0\n 11 9 1 0 0 0 0\n 12 9 1 0 0 0 0\n 15 16 1 0 0 0 0\n 19 18 1 0 0 0 0\n 20 19 1 0 0 0 0\n 24 19 2 0 0 0 0\n 21 20 2 0 0 0 0\n 26 20 1 0 0 0 0\n 22 21 1 0 0 0 0\n 22 23 2 0 0 0 0\n 25 22 1 0 0 0 0\n 23 24 1 0 0 0 0\nM CHG 1 1 1\nM END", "smiles": "Cc1c(CCOP(=O)(O)OP(=O)(O)O)sc[n+]1Cc2cnc(C)nc2N", "formula": "C12H19N4O7P2S", "atropisomerism": "No", "charge": 1, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "c7141e73-6c13-48fd-982a-f7cf04c504ae" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "425.316", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "9bdbd974-a68d-4fd2-ab2e-9d2cd4b62bce", "version": "27", "structure": { "id": "76e562a4-34c3-47ea-9a50-529af4b5323b", "molfile": "\n Marvin 01132106102D \n\n 26 27 0 0 0 0 999 V2000\n 11.2946 -3.5982 0.0000 N 0 3 0 0 0 0 0 0 0 0 0 0\n 12.0483 -3.2625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.6003 -3.8755 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.4207 -3.7894 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.9056 -4.4567 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.7262 -4.3706 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 15.2111 -5.0381 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0\n 15.9813 -4.7423 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 16.5609 -4.0365 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0\n 15.7728 -3.7928 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 17.3794 -4.1051 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 16.7351 -3.2299 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 14.5039 -5.4630 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 15.5728 -5.7796 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 12.1878 -4.5901 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 11.3807 -4.4187 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.2198 -2.4556 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.5802 -3.1854 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.8656 -3.5982 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.1512 -3.1854 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.4367 -3.5982 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 8.4367 -4.4232 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.1512 -4.8356 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 9.8656 -4.4232 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.7223 -4.8356 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.1512 -2.3605 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 3 2 2 0 0 0 0\n 4 3 1 0 0 0 0\n 5 4 1 0 0 0 0\n 6 5 1 0 0 0 0\n 7 6 1 0 0 0 0\n 8 7 1 0 0 0 0\n 9 8 1 0 0 0 0\n 10 9 2 0 0 0 0\n 11 9 1 0 0 0 0\n 12 9 1 0 0 0 0\n 13 7 2 0 0 0 0\n 14 7 1 0 0 0 0\n 3 15 1 0 0 0 0\n 15 16 1 0 0 0 0\n 16 1 2 0 0 0 0\n 17 2 1 0 0 0 0\n 18 1 1 0 0 0 0\n 19 18 1 0 0 0 0\n 20 19 1 0 0 0 0\n 21 20 2 0 0 0 0\n 22 21 1 0 0 0 0\n 22 23 2 0 0 0 0\n 23 24 1 0 0 0 0\n 24 19 2 0 0 0 0\n 25 22 1 0 0 0 0\n 26 20 1 0 0 0 0\nM CHG 1 1 1\nM END", "smiles": "Cc1c(CCOP(=O)(O)OP(=O)(O)O)sc[n+]1Cc2cnc(C)nc2N", "formula": "C12H19N4O7P2S", "atropisomerism": "No", "charge": 1, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "425.316", "optical_activity": "NONE", "references": [ "78639ca2-f334-4ee9-96c2-f0ba78e1dda9", "286dd42c-fba2-4305-b005-f9f12942bd62", "36fd92a3-8dba-4705-8ce7-4e894dbf3930" ], "stereo_centers": 0 }, "unii": "Q57971654Y", "relationships": [ { "uuid": "35dd1827-0db9-420f-9cb5-aed28b10a8aa", "type": "ACTIVE MOIETY", "related_substance": { "uuid": "8d3cdd38-4d0a-410e-b88f-518b5b4155af", "refuuid": "9bdbd974-a68d-4fd2-ab2e-9d2cd4b62bce", "name": "COCARBOXYLASE", "unii": "Q57971654Y", "linking_id": "Q57971654Y", "ref_pname": "COCARBOXYLASE", "substance_class": "reference" } }, { "uuid": "fa91b80c-4c69-45d8-ab1b-580c0695e21f", "type": "SALT/SOLVATE->PARENT", "related_substance": { "uuid": "c06b38b0-2014-4260-a3b2-faa126623005", "refuuid": "14b4bd9f-4b69-4b9a-bae9-7b6441e30c7a", "name": "COCARBOXYLASE CHLORIDE HYDROCHLORIDE", "unii": "U9TBV3W359", "linking_id": "U9TBV3W359", "ref_pname": "COCARBOXYLASE CHLORIDE HYDROCHLORIDE", "substance_class": "reference" } }, { "uuid": "54b6ceb3-23a0-439b-b20e-bd687a0888f7", "type": "SALT/SOLVATE->PARENT", "related_substance": { "uuid": "1777af3e-436a-4347-b845-d60d95557f05", "refuuid": "2d415818-e421-494a-b21e-aadd2a5a96a5", "name": "COCARBOXYLASE TETRAHYDRATE", "unii": "749XRF8JS6", "linking_id": "749XRF8JS6", "ref_pname": "COCARBOXYLASE TETRAHYDRATE", "substance_class": "reference" } }, { "uuid": "95356fc8-7bce-48bf-a9ca-c2208a3f56d3", "type": "SALT/SOLVATE->PARENT", "related_substance": { "uuid": "78c66234-e3f8-4213-ab89-39eb05b8043a", "refuuid": "bbdc8fce-5902-43da-bfec-e028c2645c52", "name": "COCARBOXYLASE CHLORIDE", "unii": "XMK8K8EVIU", "linking_id": "XMK8K8EVIU", "ref_pname": "COCARBOXYLASE CHLORIDE", "substance_class": "reference" } }, { "uuid": "411fd927-1bb8-494f-80fa-7459826dfa39", "type": "SALT/SOLVATE->PARENT", "related_substance": { "uuid": "b9839a66-da14-407f-9508-af021e8104e1", "refuuid": "d5fe1ec5-ad61-4b5f-b5a8-175939353839", "name": "COCARBOXYLASE HYDROCHLORIDE MONOHYDRATE", "unii": "C6A4I117L8", "linking_id": "C6A4I117L8", "ref_pname": "COCARBOXYLASE HYDROCHLORIDE MONOHYDRATE", "substance_class": "reference" } }, { "uuid": "465a6599-7f29-461e-8000-c6c375308804", "type": "SALT/SOLVATE->PARENT", "related_substance": { "uuid": "249f6246-11cb-41c6-873d-1acdee245a4d", "refuuid": "b58f6106-5353-4387-86c0-2b4abcd88cf9", "name": "COCARBOXYLASE HYDROCHLORIDE TETRAHYDRATE", "unii": "EHU3JCC2QR", "linking_id": "EHU3JCC2QR", "ref_pname": "COCARBOXYLASE HYDROCHLORIDE TETRAHYDRATE", "substance_class": "reference" } }, { "uuid": "b7c2e10d-1fae-4535-ae6c-4d62300e6a35", "amount": { "uuid": "cb210eb3-e05e-4f99-ab44-e3245340dbd1" }, "type": "IONIC MOIETY", "references": [ "06273511-c59f-4c00-8926-4142fe97170c" ], "related_substance": { "uuid": "a849f87e-f92b-47eb-8577-8d9bf0ca55d1", "refuuid": "9bdbd974-a68d-4fd2-ab2e-9d2cd4b62bce", "name": "COCARBOXYLASE", "unii": "Q57971654Y", "linking_id": "Q57971654Y", "ref_pname": "COCARBOXYLASE", "substance_class": "reference" } }, { "uuid": "2c513b4d-23cb-892c-888a-26b696c2047c", "type": "SOLVATE->ANHYDROUS", "references": [ "06273511-c59f-4c00-8926-4142fe97170c" ], "related_substance": { "uuid": "805f3d6c-59aa-4b95-98c0-59cab4c9c1ba", "refuuid": "2d415818-e421-494a-b21e-aadd2a5a96a5", "name": "COCARBOXYLASE TETRAHYDRATE", "unii": "749XRF8JS6", "linking_id": "749XRF8JS6", "ref_pname": "COCARBOXYLASE TETRAHYDRATE" } } ], "names": [ { "uuid": "19db5943-7fbc-4d02-9c87-944f27b060c2", "name": "COCARBOXYLASE", "stdName": "COCARBOXYLASE", "type": "of", "languages": [ "en" ], "preferred": false, "references": [ "1a84c459-fa94-47f7-8768-abf71f7aad3e", "2a5d2648-18a5-4051-9e09-8bbd8c1b648c", "1a0d792f-07cb-4525-900e-d556483f7785", "286dd42c-fba2-4305-b005-f9f12942bd62", "1fb345ed-63bb-4dc2-983d-cd0161907bb7", "36fd92a3-8dba-4705-8ce7-4e894dbf3930", "fee3b998-38b7-40f4-b30d-6868c826e5dd" ], "display_name": true, "domains": [ "drug" ], "name_orgs": [ { "uuid": "4dcd4917-0e6d-49e6-83aa-7bb1039046d6", "name_org": "INN" } ] }, { "uuid": "1715e67c-c171-4bef-9000-8e3fab620bab", "name": "COCARBOXYLASE [MART.]", "stdName": "COCARBOXYLASE [MART.]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "2a5d2648-18a5-4051-9e09-8bbd8c1b648c" ], "display_name": false }, { "uuid": "1ba4a645-cf90-462b-b87e-cf069467223c", "name": "COENZYMATE", "stdName": "COENZYMATE", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "18237108-ad80-4950-a41d-2c30f1585893", "390810eb-353d-4a5e-89c6-7687f1e7765e" ], "display_name": false }, { "uuid": "8ba1dc88-4a52-f96b-f86e-2ad9da1f518e", "name": "Cocarboxylase [WHO-DD]", "stdName": "COCARBOXYLASE [WHO-DD]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "1fd3ba3a-cf39-0297-cb25-fbbc3747e55f" ], "display_name": false }, { "uuid": "6901649e-9498-4391-8def-6ec3fa8c0ef1", "name": "PYROPHOSPHORIC ESTER OF THIAMINE", "stdName": "PYROPHOSPHORIC ESTER OF THIAMINE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "286dd42c-fba2-4305-b005-f9f12942bd62" ], "display_name": false }, { "uuid": "bbfb2332-dd90-41b2-97f7-5e2d31a4f395", "name": "THIAMINE DIPHOSPHATE", "stdName": "THIAMINE DIPHOSPHATE", "type": "of", "languages": [ "en" ], "preferred": true, "references": [ "db00a232-bdc6-4c90-8765-348c7eb94f06" ], "display_name": false, "domains": [ "cosmetic" ], "name_orgs": [ { "uuid": "c1e94971-6e42-4e50-a97e-e64846f6beb9", "name_org": "INCI" } ] }, { "uuid": "8a7a631a-d1e4-4711-9fee-511a29b4080d", "name": "THIAMINE PYROPHOSPHATE", "stdName": "THIAMINE PYROPHOSPHATE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "ed946969-be3b-49cc-bf34-ca120a5c1c3d" ], "display_name": false }, { "uuid": "476206f5-f9b7-4773-9b90-450e89333cec", "name": "THIAZOLIUM, 3-((4-AMINO-2-METHYL-5-PYRIMIDINYL)METHYL)-4-METHYL-5-(4,6,6-TRIHYDROXY-4,6-DIOXIDO-3,5-DIOXA-4,6-DIPHOSPHAHEX-1-YL)-", "stdName": "THIAZOLIUM, 3-((4-AMINO-2-METHYL-5-PYRIMIDINYL)METHYL)-4-METHYL-5-(4,6,6-TRIHYDROXY-4,6-DIOXIDO-3,5-DIOXA-4,6-DIPHOSPHAHEX-1-YL)-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "e6703e5a-44df-4822-956e-6c5e4aaf2482" ], "display_name": false }, { "uuid": "c76ec41b-164a-411b-ae97-248a7f7a613c", "name": "THIAZOLIUM, 3-((4-AMINO-2-METHYL-5-PYRIMIDINYL)METHYL)-4-METHYL-5-(4,6,6-TRIHYDROXY-4,6-DIOXIDO-3,5-DIOXA-4,6-DIPHOSPHAHEX-1-YL)-, INNER SALT", "stdName": "THIAZOLIUM, 3-((4-AMINO-2-METHYL-5-PYRIMIDINYL)METHYL)-4-METHYL-5-(4,6,6-TRIHYDROXY-4,6-DIOXIDO-3,5-DIOXA-4,6-DIPHOSPHAHEX-1-YL)-, INNER SALT", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "e6703e5a-44df-4822-956e-6c5e4aaf2482" ], "display_name": false }, { "uuid": "5e872aa0-e800-4ea3-84da-f31c1f066c8a", "name": "cocarboxylase [INN]", "stdName": "COCARBOXYLASE [INN]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "36fd92a3-8dba-4705-8ce7-4e894dbf3930" ], "display_name": false } ], "modifications": { "uuid": "94db14c9-aea1-42f0-a795-aa94f1c56744" } } ] }