{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "425fac20-f78e-4196-b505-b985ad94cbc8",
          "code": "N0000178369",
          "comments": "Established Pharmacologic Class [EPC]|Folate Analog [EPC]",
          "type": "PRIMARY",
          "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000178369",
          "code_system": "NDF-RT",
          "references": [
            "f96c2aef-5812-4b2e-8e0c-ef4e99ae99e7"
          ]
        },
        {
          "uuid": "29d0a29f-d0b3-49f4-8801-47c1ffd77909",
          "code": "N0000007151",
          "comments": "Chemical Ingredients [Chemical/Ingredient]|Chemical Classes for Pharmacologic Classification [Chemical/Ingredient]|Vitamin B Complex Compounds [Chemical/Ingredient]|Folic Acid [Chemical/Ingredient]",
          "type": "PRIMARY",
          "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000007151",
          "code_system": "NDF-RT",
          "references": [
            "f96c2aef-5812-4b2e-8e0c-ef4e99ae99e7"
          ]
        },
        {
          "uuid": "3cd3aa33-4a29-4506-b895-acd7a0a7806e",
          "code": "N0000007151",
          "comments": "Chemical Ingredients [Chemical/Ingredient]|Biological Factors [Chemical/Ingredient]|Pigments, Biological [Chemical/Ingredient]|Pterins [Chemical/Ingredient]|Folic Acid [Chemical/Ingredient]",
          "type": "PRIMARY",
          "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000007151",
          "code_system": "NDF-RT",
          "references": [
            "f96c2aef-5812-4b2e-8e0c-ef4e99ae99e7"
          ]
        },
        {
          "uuid": "d61fc919-3bc7-43d4-a3b2-7fd57eccde1e",
          "code": "N0000007151",
          "comments": "Chemical Ingredients [Chemical/Ingredient]|Heterocyclic Compounds [Chemical/Ingredient]|Heterocyclic Compounds, 2-Ring [Chemical/Ingredient]|Pteridines [Chemical/Ingredient]|Pterins [Chemical/Ingredient]|Folic Acid [Chemical/Ingredient]",
          "type": "PRIMARY",
          "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000007151",
          "code_system": "NDF-RT",
          "references": [
            "f96c2aef-5812-4b2e-8e0c-ef4e99ae99e7"
          ]
        },
        {
          "uuid": "0c5491b0-34ed-4a0d-9c9d-6a412a13e28b",
          "code": "58-05-9",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=58-05-9",
          "code_system": "CAS",
          "references": [
            "f96c2aef-5812-4b2e-8e0c-ef4e99ae99e7",
            "84ed2a9f-40b1-43c0-873a-75cdca1a3f79"
          ]
        },
        {
          "uuid": "6d3adb0c-e645-4148-8be9-2b0eb87ede71",
          "code": "C71631",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C71631",
          "code_system": "NCI_THESAURUS",
          "references": [
            "f96c2aef-5812-4b2e-8e0c-ef4e99ae99e7"
          ]
        },
        {
          "uuid": "65c4ece6-fb30-447a-9bfe-f1ab0f89813d",
          "code": "D002955",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/68002955",
          "code_system": "MESH",
          "references": [
            "f96c2aef-5812-4b2e-8e0c-ef4e99ae99e7"
          ]
        },
        {
          "uuid": "940c8342-e021-46d8-9648-0c4294705d18",
          "code": "547",
          "comments": "LiverTox|HDS: Nutritional Sup|General health|Vitamin, folate",
          "type": "PRIMARY",
          "url": "https://livertox.nlm.nih.gov/Leucovorin.htm",
          "code_system": "LIVERTOX",
          "references": [
            "f96c2aef-5812-4b2e-8e0c-ef4e99ae99e7"
          ]
        },
        {
          "uuid": "7baf705c-812b-475c-8645-e0efd70b35f3",
          "code": "FOLINIC ACID",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Folinic_acid",
          "code_system": "WIKIPEDIA",
          "references": [
            "f96c2aef-5812-4b2e-8e0c-ef4e99ae99e7"
          ]
        },
        {
          "uuid": "5de4c898-b221-460d-856f-1ee6cb31706c",
          "code": "200-361-6",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.000.328",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "f96c2aef-5812-4b2e-8e0c-ef4e99ae99e7"
          ]
        },
        {
          "uuid": "3bd1632c-e0ec-4e8e-8055-aac37997df24",
          "code": "4816",
          "type": "PRIMARY",
          "url": "http://www.guidetopharmacology.org/GRAC/LigandDisplayForward?ligandId=4816",
          "code_system": "IUPHAR",
          "references": [
            "f96c2aef-5812-4b2e-8e0c-ef4e99ae99e7"
          ]
        },
        {
          "uuid": "e60e1a17-b1e7-4676-bfc3-a521032fdbf2",
          "code": "6313",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/6313/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "f96c2aef-5812-4b2e-8e0c-ef4e99ae99e7"
          ]
        },
        {
          "uuid": "c0c644da-1f58-4d76-9e76-09649a57b9ba",
          "code": "m5519",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m5519?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "f96c2aef-5812-4b2e-8e0c-ef4e99ae99e7"
          ]
        },
        {
          "uuid": "b7ad674a-60cc-4d31-ac4f-7f28289af417",
          "code": "SUB13910MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "f96c2aef-5812-4b2e-8e0c-ef4e99ae99e7"
          ]
        },
        {
          "uuid": "d72bf825-b83d-42cb-b37a-7438e3891270",
          "code": "CHEMBL1679",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL1679",
          "code_system": "ChEMBL",
          "references": [
            "f96c2aef-5812-4b2e-8e0c-ef4e99ae99e7"
          ]
        },
        {
          "uuid": "b5acb620-100e-4919-9f87-fd21c5d5c85e",
          "code": "N0000175452",
          "comments": "Analogs/Derivatives [Chemical/Ingredient]",
          "type": "PRIMARY",
          "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000175452",
          "code_system": "NDF-RT",
          "references": [
            "f96c2aef-5812-4b2e-8e0c-ef4e99ae99e7"
          ]
        },
        {
          "uuid": "fefa2435-6dd4-7205-04d7-6981fb92f69d",
          "code": "135403648",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/135403648",
          "code_system": "PUBCHEM",
          "references": [
            "32bf3364-4dfe-4e8f-aba0-e8228bdeb1a5"
          ]
        },
        {
          "uuid": "11b670d3-1c74-cc5e-2d10-3ca0620cf03f",
          "code": "6544",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/6544",
          "code_system": "HSDB",
          "references": [
            "2a6d594c-e8f6-f14b-92ec-caca39770a68"
          ]
        },
        {
          "uuid": "dbd90780-a9dc-63ab-d9ce-14f68abfe377",
          "code": "DTXSID0048216",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID0048216",
          "code_system": "EPA CompTox",
          "references": [
            "f8431e99-4d8c-d4c9-581b-8eba62c1c5d6"
          ]
        },
        {
          "uuid": "4b382e4d-1548-a596-d3d0-1fc90421bb37",
          "code": "16786",
          "comments": "ORPHAN DRUG|Designated/Approved|For use in combination with 5-fluorouracil for the treatment of metastatic colorectal cancer.",
          "type": "PRIMARY",
          "url": "https://www.accessdata.fda.gov/scripts/opdlisting/oopd/detailedIndex.cfm?cfgridkey=16786",
          "code_system": "FDA ORPHAN DRUG"
        },
        {
          "uuid": "c7f9df9c-5054-71e5-e277-df5bcedba8c8",
          "code": "30588",
          "comments": "ORPHAN DRUG|Designated/Approved|For rescue use after high dose methotrexate therapy in the treatment of osteosarcoma.",
          "type": "PRIMARY",
          "url": "https://www.accessdata.fda.gov/scripts/opdlisting/oopd/detailedIndex.cfm?cfgridkey=30588",
          "code_system": "FDA ORPHAN DRUG"
        },
        {
          "uuid": "196f871a-5956-9bcf-3fd1-7620930960cf",
          "code": "C2078",
          "comments": "Pharmacologic Substance[C1909]|Antineoplastic Agent[C274]|Antimetabolite[C272]|Folic Acid Derivative",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C2078",
          "code_system": "NCI_THESAURUS",
          "references": [
            "17e6da33-58bb-3f0b-a8f0-0e7a0d540c13"
          ]
        },
        {
          "uuid": "50c253c8-bd66-297e-171b-9477a61a6a12",
          "code": "1232",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/1232",
          "code_system": "DRUG CENTRAL",
          "references": [
            "17e6da33-58bb-3f0b-a8f0-0e7a0d540c13"
          ]
        },
        {
          "uuid": "3d4270d3-401c-6d0c-2a17-3caaa327cdf8",
          "code": "DB00650",
          "type": "PRIMARY",
          "url": "https://go.drugbank.com/drugs/DB00650",
          "code_system": "DRUG BANK",
          "references": [
            "17e6da33-58bb-3f0b-a8f0-0e7a0d540c13"
          ]
        },
        {
          "uuid": "e2137cf4-061d-4570-9427-8b37cddac66d",
          "code": "Q573I9DVLP",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "82c6bb99-7057-cef0-b1d7-dfbecb8f775d",
          "code": "187 (Number of products:13)",
          "comments": "Dietary Supplement Label Database|Vitamin|Folinic Acid",
          "type": "PRIMARY",
          "url": "https://dsld.od.nih.gov/dsld/rptIngredient.jsp?grpid=187&item=Folinic Acid",
          "code_system": "DSLD",
          "references": [
            "17e6da33-58bb-3f0b-a8f0-0e7a0d540c13"
          ]
        },
        {
          "uuid": "ce4d1f5b-ef4b-fbf0-61b0-8a94bd65a0ff",
          "code": "57457",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:57457",
          "code_system": "CHEBI",
          "references": [
            "17e6da33-58bb-3f0b-a8f0-0e7a0d540c13"
          ]
        },
        {
          "uuid": "adfc9d1a-ba88-cfb9-b0f1-63a0297dfcfe",
          "code": "15640",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:15640",
          "code_system": "CHEBI",
          "references": [
            "17e6da33-58bb-3f0b-a8f0-0e7a0d540c13"
          ]
        },
        {
          "uuid": "ff0d8704-c6b1-1eb6-7023-9571a231f638",
          "code": "100000089017",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "8d4334c3-dee7-227b-a87d-4a9573e803df"
          ]
        },
        {
          "uuid": "5e6e50e2-08f6-959c-2c47-1e3a6e47b5ec",
          "code": "Q573I9DVLP",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=Q573I9DVLP",
          "code_system": "DAILYMED",
          "references": [
            "89767d60-6dd4-c359-6651-da1ef6437ef4"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "202291f7-5358-4477-afa2-95a75a10f024",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "1087fa37-e49b-4b66-b690-7f63feb9ea94",
            "refuuid": "1483c2c9-f3de-4c4c-9bd3-5ed5e5fcb38d",
            "name": "LEUCOVORIN",
            "unii": "Q573I9DVLP",
            "linking_id": "Q573I9DVLP",
            "ref_pname": "LEUCOVORIN",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "725f54c6-577c-4c34-8015-a161b266bc5b",
          "type": "SALT/SOLVATE->PARENT",
          "references": [
            "8350129a-5676-5d48-9fa5-9bfd46fba917"
          ],
          "related_substance": {
            "uuid": "e26b57f7-7bd8-4a5f-819d-342e3ec78188",
            "refuuid": "567af8b8-7aa0-43cf-8d92-a2233ee25a5c",
            "name": "LEUCOVORIN MONOSODIUM",
            "unii": "DR33Q67R37",
            "linking_id": "DR33Q67R37",
            "ref_pname": "LEUCOVORIN MONOSODIUM",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "0ba2977c-265a-4881-b519-c78f5c2e9306",
          "amount": {
            "uuid": "758fc84b-3228-4fc9-b964-cd5b5dcefeba"
          },
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "ea698788-364c-42fa-aec8-e814ae468b97",
            "refuuid": "f95ba313-7650-4e94-81cd-2918d3f9cf35",
            "name": "LEUCOVORIN CALCIUM PENTAHYDRATE",
            "unii": "R3W57OBQ5W",
            "linking_id": "R3W57OBQ5W",
            "ref_pname": "LEUCOVORIN CALCIUM PENTAHYDRATE",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "df6d47ca-0fc4-4288-8d14-580ece41afed",
          "name": "5-FORMYLTETRAHYDROFOLATE",
          "stdName": "5-FORMYLTETRAHYDROFOLATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "54a05aea-050d-4faa-97e2-9bf09e5aeefa",
            "b1ecf078-3ed4-4511-be03-a52ae871e039"
          ],
          "display_name": false
        },
        {
          "uuid": "8128d124-c59b-4e27-bacd-6513135f65a4",
          "name": "5-FORMYLTETRAHYDROFOLIC ACID",
          "stdName": "5-FORMYLTETRAHYDROFOLIC ACID",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ec661dcf-f126-4f88-9818-240d73b63e10",
            "b1ecf078-3ed4-4511-be03-a52ae871e039"
          ],
          "display_name": false
        },
        {
          "uuid": "83b48b76-4929-425c-97bc-e3b45a42c1bf",
          "name": "FOLINIC ACID",
          "stdName": "FOLINIC ACID",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6665e67a-354a-44bb-ab77-7ecae0d34f29",
            "755eb77e-fb1a-4334-9eda-9e505df11686",
            "12a5986a-9ebd-4da4-b9c1-0e293ef3a09b",
            "237e1529-d7a4-471c-bda0-a09ed32f87cc",
            "e6b50d2b-03ef-4d37-af3e-f45d6a503721",
            "b1ecf078-3ed4-4511-be03-a52ae871e039",
            "2ddebb63-31be-47a1-abfe-68500f901cd0",
            "cc1762eb-5ff2-48c5-9094-9a35fc14d0f2"
          ],
          "display_name": false
        },
        {
          "uuid": "57ea24b0-48ea-4767-a823-415d1aaa1e50",
          "name": "FOLINIC ACID [MART.]",
          "stdName": "FOLINIC ACID [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cc1762eb-5ff2-48c5-9094-9a35fc14d0f2"
          ],
          "display_name": false
        },
        {
          "uuid": "d98c4457-aaa1-452c-bd73-a5452e449ae3",
          "name": "FOLINIC ACID [MI]",
          "stdName": "FOLINIC ACID [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6665e67a-354a-44bb-ab77-7ecae0d34f29",
            "b1ecf078-3ed4-4511-be03-a52ae871e039"
          ],
          "display_name": false
        },
        {
          "uuid": "6dbbc399-73b4-cfb2-d6db-1c7dbc5c8c7f",
          "name": "Folinic acid [WHO-DD]",
          "stdName": "FOLINIC ACID [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5082460f-e2d4-8bab-bc3d-19ce360c380c"
          ],
          "display_name": false
        },
        {
          "uuid": "94d1ca3e-1cf1-4e9f-95a7-093a4e01088a",
          "name": "L-GLUTAMIC ACID, N-(4-(((2-AMINO-5-FORMYL-1,4,5,6,7,8-HEXAHYDRO-4-OXO-6-PTERIDINYL)METHYL)AMINO)BENZOYL)-",
          "stdName": "L-GLUTAMIC ACID, N-(4-(((2-AMINO-5-FORMYL-1,4,5,6,7,8-HEXAHYDRO-4-OXO-6-PTERIDINYL)METHYL)AMINO)BENZOYL)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "755eb77e-fb1a-4334-9eda-9e505df11686",
            "b1ecf078-3ed4-4511-be03-a52ae871e039"
          ],
          "display_name": false
        },
        {
          "uuid": "73622660-493a-4d39-bbf3-e37ef4af6fa5",
          "name": "LEUCOVORIN",
          "stdName": "LEUCOVORIN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "74e3f4ca-4585-4e3f-9ed2-80cf7f7526b8",
            "2bf89b17-01bd-4394-9d32-f33a9e2a731c",
            "b6ef8150-2c2a-4202-adf2-c1a160abfced",
            "9611f0e8-bb2b-4e13-92d8-615aa9eae85a",
            "b1ecf078-3ed4-4511-be03-a52ae871e039",
            "163674dc-54c5-45f7-8ef4-ef7daf29ab3b"
          ],
          "display_name": true
        },
        {
          "uuid": "bb2fca19-39f9-434c-a4ba-b455d2d39040",
          "name": "LEUCOVORIN [HSDB]",
          "stdName": "LEUCOVORIN [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b1ecf078-3ed4-4511-be03-a52ae871e039",
            "163674dc-54c5-45f7-8ef4-ef7daf29ab3b"
          ],
          "display_name": false
        },
        {
          "uuid": "e52be044-a4fb-4446-9659-08ac63ca7760",
          "name": "LEUCOVORIN [VANDF]",
          "stdName": "LEUCOVORIN [VANDF]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2bf89b17-01bd-4394-9d32-f33a9e2a731c",
            "b1ecf078-3ed4-4511-be03-a52ae871e039"
          ],
          "display_name": false
        },
        {
          "uuid": "21b69ee9-66c3-4de9-a2f7-e22d810dc095",
          "name": "N-(P-((((6RS)-2-AMINO-5-FORMYL-5,6,7,8-TETRAHYDRO-4-HYDROXY-6-PTERIDINYL)METHYL)AMINO)BENZOYL)-L-GLUTAMATE",
          "stdName": "N-(P-((((6RS)-2-AMINO-5-FORMYL-5,6,7,8-TETRAHYDRO-4-HYDROXY-6-PTERIDINYL)METHYL)AMINO)BENZOYL)-L-GLUTAMATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "755eb77e-fb1a-4334-9eda-9e505df11686",
            "b1ecf078-3ed4-4511-be03-a52ae871e039"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "9611f0e8-bb2b-4e13-92d8-615aa9eae85a",
          "citation": "USP Dictionary 2009",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "755eb77e-fb1a-4334-9eda-9e505df11686",
          "citation": "USP DICTIONARY 2009",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b1ecf078-3ed4-4511-be03-a52ae871e039",
          "citation": "BAN",
          "doc_type": "BAN",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "cc1762eb-5ff2-48c5-9094-9a35fc14d0f2",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6665e67a-354a-44bb-ab77-7ecae0d34f29",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2ddebb63-31be-47a1-abfe-68500f901cd0",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2bf89b17-01bd-4394-9d32-f33a9e2a731c",
          "citation": "NDF-RT",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ec661dcf-f126-4f88-9818-240d73b63e10",
          "citation": "http://www.ebi.ac.uk/chebi/searchId.do?chebiId=CHEBI:15640",
          "url": "http://www.ebi.ac.uk/chebi/searchId.do?chebiId=CHEBI:15640",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "163674dc-54c5-45f7-8ef4-ef7daf29ab3b",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "54a05aea-050d-4faa-97e2-9bf09e5aeefa",
          "citation": "NCT00877227",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f96c2aef-5812-4b2e-8e0c-ef4e99ae99e7",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390696000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "bc051dcd-9c32-4daa-83a7-956bdd44f3d6",
          "citation": "SRS import [Q573I9DVLP]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=Q573I9DVLP",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390696000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "88b3767a-7706-4231-9377-a3c970d23855",
          "citation": "USP DICTIONARY 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "12a5986a-9ebd-4da4-b9c1-0e293ef3a09b",
          "citation": "FOLINIC ACID [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "e6b50d2b-03ef-4d37-af3e-f45d6a503721",
          "citation": "FOLINIC ACID [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "237e1529-d7a4-471c-bda0-a09ed32f87cc",
          "citation": "FOLINIC ACID [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "b6ef8150-2c2a-4202-adf2-c1a160abfced",
          "citation": "LEUCOVORIN [VANDF]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "74e3f4ca-4585-4e3f-9ed2-80cf7f7526b8",
          "citation": "LEUCOVORIN [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "2a6d594c-e8f6-f14b-92ec-caca39770a68",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+58-05-9",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "f8431e99-4d8c-d4c9-581b-8eba62c1c5d6",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=58-05-9",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "8350129a-5676-5d48-9fa5-9bfd46fba917",
          "citation": "FDA_SRS",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "17e6da33-58bb-3f0b-a8f0-0e7a0d540c13",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "84ed2a9f-40b1-43c0-873a-75cdca1a3f79",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "32bf3364-4dfe-4e8f-aba0-e8228bdeb1a5",
          "citation": "PUBCHEM",
          "doc_type": "PUBCHEM",
          "public_domain": true
        },
        {
          "uuid": "89767d60-6dd4-c359-6651-da1ef6437ef4",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "5082460f-e2d4-8bab-bc3d-19ce360c380c",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "8d4334c3-dee7-227b-a87d-4a9573e803df",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "814c752a-f5e1-40f2-a70f-1bfde2e82a00",
          "citation": "WIKIPEDIA FOLFOXIRI",
          "url": "https://en.wikipedia.org/wiki/FOLFOXIRI",
          "doc_type": "WIKI",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "e53c8858-eb0e-4435-8595-1f88d89d7f44",
          "id": "e53c8858-eb0e-4435-8595-1f88d89d7f44",
          "molfile": "\n  Marvin  01132111522D          \n\n 34 36  0  0  1  0            999 V2000\n   10.8299   -6.3296    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n   11.5435   -5.9084    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.2581   -6.3304    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.9670   -5.9174    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.6802   -6.3385    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   12.9670   -5.0942    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1181   -5.9139    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4091   -6.3338    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4091   -7.1558    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6971   -5.9228    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9876   -6.3514    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2490   -5.9591    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2490   -5.1234    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5238   -4.7262    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8176   -5.1602    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1018   -4.7629    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    5.1018   -3.9412    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3768   -3.5256    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6656   -3.9411    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9501   -3.5256    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2252   -3.9412    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.5003   -3.5441    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2252   -4.7629    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9501   -5.1832    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9501   -6.0052    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6656   -4.7724    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3768   -5.1832    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3768   -6.0052    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6656   -6.4255    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9507   -4.6983    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6971   -5.1048    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.8299   -7.1542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1181   -7.5674    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.5458   -7.5722    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  1  7  1  1  0  0  0\n  1 32  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  4  2  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  2  0  0  0  0\n 10  8  1  0  0  0  0\n 10 11  1  0  0  0  0\n 31 10  2  0  0  0  0\n 11 12  2  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 30 13  2  0  0  0  0\n 14 15  1  0  0  0  0\n 16 15  1  0  0  0  0\n 17 16  1  0  0  0  0\n 16 27  1  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n 20 19  1  0  0  0  0\n 19 26  2  0  0  0  0\n 21 20  2  0  0  0  0\n 22 21  1  0  0  0  0\n 21 23  1  0  0  0  0\n 23 24  1  0  0  0  0\n 25 24  2  0  0  0  0\n 24 26  1  0  0  0  0\n 27 26  1  0  0  0  0\n 28 27  1  0  0  0  0\n 29 28  2  0  0  0  0\n 31 30  1  0  0  0  0\n 32 33  1  0  0  0  0\n 32 34  2  0  0  0  0\nM  END",
          "smiles": "c1cc(ccc1C(=O)N[C@@H](CCC(=O)O)C(=O)O)NCC2CNc3c(c(=O)[nH]c(N)n3)N2C=O",
          "formula": "C20H23N7O7",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "EPIMERIC",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "c3ceca94-d8e1-4928-8568-70cd11e9df34"
          },
          "defined_stereo": 1,
          "ez_centers": 0,
          "molecular_weight": "473.4401",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 2
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "1483c2c9-f3de-4c4c-9bd3-5ed5e5fcb38d",
      "version": "28",
      "structure": {
        "id": "4c1fe657-2549-4b5b-92ca-5e89f306b7b5",
        "molfile": "\n  Marvin  01132103582D          \n\n 34 36  0  0  1  0            999 V2000\n    9.4091   -6.3338    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1181   -5.9139    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   10.8299   -6.3296    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   10.8299   -7.1542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1181   -7.5674    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.5458   -7.5722    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.5435   -5.9084    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.2581   -6.3304    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.9670   -5.9174    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.6802   -6.3385    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   12.9670   -5.0942    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6971   -5.9228    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9876   -6.3514    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2490   -5.9591    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2490   -5.1234    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5238   -4.7262    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8176   -5.1602    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1018   -4.7629    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3768   -5.1832    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6656   -4.7724    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6656   -3.9411    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9501   -3.5256    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2252   -3.9412    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2252   -4.7629    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9501   -5.1832    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9501   -6.0052    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.5003   -3.5441    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3768   -3.5256    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1018   -3.9412    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3768   -6.0052    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6656   -6.4255    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9507   -4.6983    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6971   -5.1048    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4091   -7.1558    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  3  4  1  1  0  0  0\n  4  5  2  0  0  0  0\n  4  6  1  0  0  0  0\n  7  3  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10  9  1  0  0  0  0\n 11  9  2  0  0  0  0\n 12  1  1  0  0  0  0\n 12 13  2  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  2  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 18 17  1  0  0  0  0\n 18 19  1  0  0  0  0\n 19 20  1  0  0  0  0\n 21 20  2  0  0  0  0\n 22 21  1  0  0  0  0\n 23 22  1  0  0  0  0\n 23 24  2  0  0  0  0\n 24 25  1  0  0  0  0\n 25 20  1  0  0  0  0\n 26 25  2  0  0  0  0\n 27 23  1  0  0  0  0\n 28 21  1  0  0  0  0\n 29 28  1  0  0  0  0\n 29 18  1  0  0  0  0\n 30 19  1  0  0  0  0\n 31 30  2  0  0  0  0\n 32 15  1  0  0  0  0\n 33 32  2  0  0  0  0\n 33 12  1  0  0  0  0\n  1 34  2  0  0  0  0\nM  END",
        "smiles": "c1cc(ccc1C(=O)N[C@@H](CCC(=O)O)C(=O)O)NCC2CNc3c(c(=O)nc(N)[nH]3)N2C=O",
        "formula": "C20H23N7O7",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "EPIMERIC",
        "defined_stereo": 1,
        "ez_centers": 0,
        "molecular_weight": "473.4401",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "bc051dcd-9c32-4daa-83a7-956bdd44f3d6",
          "88b3767a-7706-4231-9377-a3c970d23855"
        ],
        "stereo_centers": 2
      },
      "unii": "Q573I9DVLP"
    }
  ]
}