{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "593aaa2b-4b6f-448e-95d9-9414b42286e7",
          "code": "102-60-3",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=102-60-3",
          "code_system": "CAS",
          "references": [
            "c8a9d86d-b057-491d-880d-0d636efa1572",
            "e3d92db1-b93e-4f2d-a10d-1e8432077e9d"
          ]
        },
        {
          "uuid": "08b38131-954c-4d57-86ca-3896de353cd4",
          "code": "5313",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=5313",
          "code_system": "INN",
          "references": [
            "c8a9d86d-b057-491d-880d-0d636efa1572"
          ]
        },
        {
          "uuid": "71ef6607-d22b-4578-91c7-920a422a5d01",
          "code": "C76706",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C76706",
          "code_system": "NCI_THESAURUS",
          "references": [
            "c8a9d86d-b057-491d-880d-0d636efa1572"
          ]
        },
        {
          "uuid": "df4ad064-59be-456b-8441-2a65a62130f7",
          "code": "1314349",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1314349/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "c8a9d86d-b057-491d-880d-0d636efa1572"
          ]
        },
        {
          "uuid": "9ebff29d-2780-450a-acab-cbc6b945cceb",
          "code": "m4923",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m4923?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "c8a9d86d-b057-491d-880d-0d636efa1572"
          ]
        },
        {
          "uuid": "a9f768a1-569d-45e3-9580-9767ea0978e4",
          "code": "SUB06457MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "c8a9d86d-b057-491d-880d-0d636efa1572"
          ]
        },
        {
          "uuid": "912742d7-24a5-4a58-8d48-8e36ae06e360",
          "code": "CHEMBL1573178",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL1573178",
          "code_system": "ChEMBL",
          "references": [
            "c8a9d86d-b057-491d-880d-0d636efa1572"
          ]
        },
        {
          "uuid": "91990b68-ebd5-48f9-8177-78f312d6891f",
          "code": "203-041-4",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.002.766",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "c8a9d86d-b057-491d-880d-0d636efa1572"
          ]
        },
        {
          "uuid": "e568edb1-b322-45dc-a001-dcc6aad36c85",
          "code": "7615",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/7615",
          "code_system": "PUBCHEM",
          "references": [
            "c8a9d86d-b057-491d-880d-0d636efa1572"
          ]
        },
        {
          "uuid": "0fbf597f-3fb3-52d7-0895-c92990696fa5",
          "code": "5349",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/5349",
          "code_system": "HSDB",
          "references": [
            "5877d2ec-46ea-b45d-940a-f52f7431da69"
          ]
        },
        {
          "uuid": "b5745c9f-3123-9114-b16f-a018124315b6",
          "code": "DTXSID9026689",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID9026689",
          "code_system": "EPA CompTox",
          "references": [
            "61a4b7d2-9121-c91c-37fd-8c3ba4089e4f"
          ]
        },
        {
          "uuid": "f745f685-b100-77f5-3bee-6b18746762e6",
          "code": "C45678",
          "comments": "Industrial Aid",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C45678",
          "code_system": "NCI_THESAURUS",
          "references": [
            "ed3c7ccd-5393-8221-6f96-dca6a6595086"
          ]
        },
        {
          "uuid": "40f1c91c-f272-4f6e-bd64-3ab447cba9ce",
          "code": "Q4R969U9FR",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "b03c7fdd-7f1c-97ea-bc87-51102a6f2fac",
          "code": "100000080491",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "1707913b-d831-12d1-764e-88d967219a51"
          ]
        },
        {
          "uuid": "2a0c7ce8-e49b-7d80-f59d-e16d72254ff3",
          "code": "T-71",
          "type": "PRIMARY",
          "url": "https://searchusan.ama-assn.org/finder/usan/search/T-71/relevant/1/",
          "code_system": "USAN",
          "references": [
            "0cc670d2-8f3b-eb85-4ba3-79c13b9aa5be"
          ]
        },
        {
          "uuid": "41bbb0ef-64da-d5f0-26de-da12c439e68d",
          "code": "Q4R969U9FR",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=Q4R969U9FR",
          "code_system": "DAILYMED",
          "references": [
            "24c6fc96-6a0b-01ff-fe57-051cf08b2fe4"
          ]
        },
        {
          "uuid": "edf1fd0c-4e30-3da6-7a5a-8f8344a5987e",
          "code": "369219",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=369219",
          "code_system": "NSC",
          "references": [
            "137b123b-ae59-97d6-cc8a-ead6e9860cb7"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "a92d6083-2584-46a3-b07d-1c395145be1a",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "6a2b2145-e00b-4e52-bbbd-12d9cf61fc08",
            "refuuid": "02fdee81-c1f9-4073-a715-1e042756e87a",
            "name": "EDETOL",
            "unii": "Q4R969U9FR",
            "linking_id": "Q4R969U9FR",
            "ref_pname": "EDETOL",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "c3d30816-a267-4931-9657-2971943189de",
          "name": "1,1',1'',1'''-(1,2-ETHANEDIYLDINITRILO)TETRAKIS(2-PROPANOL)",
          "stdName": "1,1',1'',1'''-(1,2-ETHANEDIYLDINITRILO)TETRAKIS(2-PROPANOL)",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cc0e8813-5081-4e4e-b746-8881adae4d1a",
            "a477e6ed-670c-4245-9def-788cbb8edb69"
          ],
          "display_name": false
        },
        {
          "uuid": "16ff6bfd-350d-4a66-a739-53ae5330daba",
          "name": "2-PROPANOL, 1,1',1'',1'''-(1,2-ETHANEDIYLDINITRILO)TETRAKIS-",
          "stdName": "2-PROPANOL, 1,1',1'',1'''-(1,2-ETHANEDIYLDINITRILO)TETRAKIS-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "918474eb-b85f-4a8c-9478-6b5a7323ae5c"
          ],
          "display_name": false
        },
        {
          "uuid": "f7a1c8eb-1011-4548-9b0f-db3a0dc7cd21",
          "name": "EDETOL",
          "stdName": "EDETOL",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "46739942-ff49-4c89-a45e-384915887824",
            "e3d5ebed-6df6-4f99-872d-af726d2febc7",
            "3c09c634-f7e0-40a3-98cf-f0d349d3393b",
            "65ba6264-62c9-44c8-aabc-7faf80acd07b",
            "cc0e8813-5081-4e4e-b746-8881adae4d1a",
            "838e43af-351a-4d57-809e-f26ce4ad3348",
            "75209118-72c2-4ffc-9330-dfae2786c207",
            "0e50dc3b-98df-4a8e-a003-97971d66f817"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "5f4caadd-7181-4c00-8511-096a417a55dd",
              "name_org": "INN"
            },
            {
              "uuid": "85cde3d1-59d0-4ec4-a07f-648c54919e69",
              "name_org": "USAN"
            }
          ]
        },
        {
          "uuid": "220851f7-73f5-4fef-82ee-503dcf058e61",
          "name": "EDETOL [HSDB]",
          "stdName": "EDETOL [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cc0e8813-5081-4e4e-b746-8881adae4d1a",
            "0e50dc3b-98df-4a8e-a003-97971d66f817"
          ],
          "display_name": false
        },
        {
          "uuid": "fd6da2f1-ed64-4067-bf53-c3c7d386fcee",
          "name": "EDETOL [USAN]",
          "stdName": "EDETOL [USAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3c09c634-f7e0-40a3-98cf-f0d349d3393b"
          ],
          "display_name": false
        },
        {
          "uuid": "ea41da0b-6478-441a-9356-04b77a13471e",
          "name": "ENTPROL [MI]",
          "stdName": "ENTPROL [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cc0e8813-5081-4e4e-b746-8881adae4d1a",
            "cd479816-4fcb-42c8-b1cf-75e4e50a3f3c"
          ],
          "display_name": false
        },
        {
          "uuid": "1bf46551-b1b9-4beb-8849-be72ca3b9d36",
          "name": "N,N,N',N'-TETRAKIS (2-HYDROXYPROPYL) ETHYLENEDIAMINE",
          "stdName": "N,N,N',N'-TETRAKIS (2-HYDROXYPROPYL) ETHYLENEDIAMINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d7c245ea-c668-47cb-8601-84523716a498",
            "cc0e8813-5081-4e4e-b746-8881adae4d1a"
          ],
          "display_name": false
        },
        {
          "uuid": "df3cfad4-bbe1-4b72-be99-a712b84212da",
          "name": "N,N,N',N'-TETRAKIS(2-HYDROXYPROPYL)ETHYLENEDIAMINE",
          "stdName": "N,N,N',N'-TETRAKIS(2-HYDROXYPROPYL)ETHYLENEDIAMINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cc0e8813-5081-4e4e-b746-8881adae4d1a",
            "a39938e3-49be-447d-aa6c-3b506628abb3"
          ],
          "display_name": false
        },
        {
          "uuid": "29be677a-029f-40b0-a172-9dadf4af6a74",
          "name": "NEUTROL TE",
          "stdName": "NEUTROL TE",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "918474eb-b85f-4a8c-9478-6b5a7323ae5c"
          ],
          "display_name": false
        },
        {
          "uuid": "773b4a75-bff9-49e8-a367-0c5beaf26d4c",
          "name": "NSC-369219",
          "stdName": "NSC-369219",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cc0e8813-5081-4e4e-b746-8881adae4d1a",
            "646d2bdc-195c-4153-ae93-9299d51af577"
          ],
          "display_name": false
        },
        {
          "uuid": "1f590215-fbe9-47c5-a5c3-bd57184bf34b",
          "name": "QUADROL",
          "stdName": "QUADROL",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "918474eb-b85f-4a8c-9478-6b5a7323ae5c"
          ],
          "display_name": false
        },
        {
          "uuid": "675e14d8-bba4-40fb-a289-d10d7f40b6c8",
          "name": "TETRAHYDROXYPROPYL ETHYLENEDIAMINE",
          "stdName": "TETRAHYDROXYPROPYL ETHYLENEDIAMINE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": true,
          "references": [
            "d7c245ea-c668-47cb-8601-84523716a498",
            "cc0e8813-5081-4e4e-b746-8881adae4d1a",
            "50b251eb-2350-4290-bcb6-b936d0a21474",
            "e1174c59-8ed7-40b3-8ae4-6f99537dd7cb"
          ],
          "display_name": false,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "c66e6ab0-e482-4955-bc6f-207aba8908ef",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "1ad14c88-f34a-41d9-9d25-41d22dc97ef2",
          "name": "edetol [INN]",
          "stdName": "EDETOL [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "838e43af-351a-4d57-809e-f26ce4ad3348"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "65ba6264-62c9-44c8-aabc-7faf80acd07b",
          "citation": "USP Dictionary",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "a477e6ed-670c-4245-9def-788cbb8edb69",
          "citation": "N,N,N',N'-TETRAKIS (2-HYDROXYPROPYL) ETHYLENEDIAMINE",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "cc0e8813-5081-4e4e-b746-8881adae4d1a",
          "citation": "WEB PAGE",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "918474eb-b85f-4a8c-9478-6b5a7323ae5c",
          "citation": "USP DICTIONARY 2009",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d7c245ea-c668-47cb-8601-84523716a498",
          "citation": "http://www.cosmeticsdatabase.com/ingredient.php?ingred06=706506",
          "url": "http://www.cosmeticsdatabase.com/ingredient.php?ingred06=706506",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "838e43af-351a-4d57-809e-f26ce4ad3348",
          "citation": "INN Proposed List 49",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL49.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "3c09c634-f7e0-40a3-98cf-f0d349d3393b",
          "citation": "USP DICTIONARY 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "cd479816-4fcb-42c8-b1cf-75e4e50a3f3c",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "50b251eb-2350-4290-bcb6-b936d0a21474",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0e50dc3b-98df-4a8e-a003-97971d66f817",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a39938e3-49be-447d-aa6c-3b506628abb3",
          "citation": "TOX 21",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "646d2bdc-195c-4153-ae93-9299d51af577",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c8a9d86d-b057-491d-880d-0d636efa1572",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390869000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ac9b5533-45a6-4b06-9dfe-9aa97e59e482",
          "citation": "SRS import [Q4R969U9FR]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=Q4R969U9FR",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390869000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7dd11ba7-2086-4431-89df-8d8b8f38b88e",
          "citation": "USP Dictionary 2009",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "75209118-72c2-4ffc-9330-dfae2786c207",
          "citation": "EDETOL [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "46739942-ff49-4c89-a45e-384915887824",
          "citation": "EDETOL [USAN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "e1174c59-8ed7-40b3-8ae4-6f99537dd7cb",
          "citation": "TETRAHYDROXYPROPYL ETHYLENEDIAMINE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "e3d5ebed-6df6-4f99-872d-af726d2febc7",
          "citation": "EDETOL [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "5877d2ec-46ea-b45d-940a-f52f7431da69",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+102-60-3",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "61a4b7d2-9121-c91c-37fd-8c3ba4089e4f",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=102-60-3",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "ed3c7ccd-5393-8221-6f96-dca6a6595086",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "0cc670d2-8f3b-eb85-4ba3-79c13b9aa5be",
          "citation": "USAD COUN",
          "doc_type": "USANCOUN",
          "public_domain": true
        },
        {
          "uuid": "e3d92db1-b93e-4f2d-a10d-1e8432077e9d",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "137b123b-ae59-97d6-cc8a-ead6e9860cb7",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "24c6fc96-6a0b-01ff-fe57-051cf08b2fe4",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "1707913b-d831-12d1-764e-88d967219a51",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "39dd24fc-3cf5-4b6e-a788-ebaea9cf8d79",
          "id": "39dd24fc-3cf5-4b6e-a788-ebaea9cf8d79",
          "molfile": "\n  Marvin  01132103042D          \n\n 20 19  0  0  0  0            999 V2000\n    5.2195   -2.0594    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5050   -2.4718    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    4.5021   -3.2938    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7905   -2.0594    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0759   -2.4718    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3586   -2.0652    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6440   -2.4776    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.9295   -2.0681    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    0.9266   -1.2461    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6353   -0.8307    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    2.3498   -1.2431    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6266   -0.0087    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.2150   -2.4806    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.4995   -2.0681    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n   -1.2141   -2.4806    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.5025   -1.2461    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0730   -3.2938    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3586   -3.7033    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    1.6440   -3.2909    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3586   -4.5254    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  2  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n 17  5  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  9  8  1  0  0  0  0\n 13  8  1  0  0  0  0\n 10  9  1  0  0  0  0\n 11 10  1  0  0  0  0\n 10 12  1  0  0  0  0\n 14 13  1  0  0  0  0\n 15 14  1  0  0  0  0\n 14 16  1  0  0  0  0\n 18 17  1  0  0  0  0\n 19 18  1  0  0  0  0\n 18 20  1  0  0  0  0\nM  END",
          "smiles": "CC(CN(CCN(CC(C)O)CC(C)O)CC(C)O)O",
          "formula": "C14H32N2O4",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "MIXED",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "49b7ec89-5196-4615-8e48-b1b4837bbd54"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "292.4154",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 4
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "02fdee81-c1f9-4073-a715-1e042756e87a",
      "version": "15",
      "structure": {
        "id": "373c7d52-2ea8-43fd-8b4b-79ed8dc13304",
        "molfile": "\n  Marvin  01132102562D          \n\n 20 19  0  0  0  0            999 V2000\n    0.9295   -2.0681    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0759   -2.4718    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    0.2150   -2.4806    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7905   -2.0594    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.9266   -1.2461    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0730   -3.2938    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6440   -2.4776    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3586   -2.0652    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6266   -0.0087    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.5025   -1.2461    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3586   -4.5254    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5021   -3.2938    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5050   -2.4718    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3586   -3.7033    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6353   -0.8307    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.4995   -2.0681    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2195   -2.0594    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6440   -3.2909    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3498   -1.2431    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.2141   -2.4806    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  8  1  0  0  0  0\n  3  1  1  0  0  0  0\n  4  2  1  0  0  0  0\n  5  1  1  0  0  0  0\n  6  2  1  0  0  0  0\n  7  1  1  0  0  0  0\n  8  7  1  0  0  0  0\n 15  9  1  0  0  0  0\n 16 10  1  0  0  0  0\n 14 11  1  0  0  0  0\n 13 12  1  0  0  0  0\n 13  4  1  0  0  0  0\n 14  6  1  0  0  0  0\n 15  5  1  0  0  0  0\n 16  3  1  0  0  0  0\n 17 13  1  0  0  0  0\n 18 14  1  0  0  0  0\n 19 15  1  0  0  0  0\n 20 16  1  0  0  0  0\nM  END",
        "smiles": "CC(CN(CCN(CC(C)O)CC(C)O)CC(C)O)O",
        "formula": "C14H32N2O4",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "MIXED",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "292.4154",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "7dd11ba7-2086-4431-89df-8d8b8f38b88e",
          "ac9b5533-45a6-4b06-9dfe-9aa97e59e482",
          "838e43af-351a-4d57-809e-f26ce4ad3348"
        ],
        "stereo_centers": 4
      },
      "unii": "Q4R969U9FR"
    }
  ]
}