{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "ba056e2f-27f6-4029-a652-0c73afb1f5d3",
          "code": "129025-54-3",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=129025-54-3",
          "code_system": "CAS",
          "references": [
            "5fe7e947-14ca-44a6-a398-2524da984d78",
            "5cef2002-6dfe-46be-92c1-031bdbf98aa9"
          ]
        },
        {
          "uuid": "63c6a520-039e-4726-a45b-8baef21ba512",
          "code": "C447862",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67447862",
          "code_system": "MESH",
          "references": [
            "5fe7e947-14ca-44a6-a398-2524da984d78"
          ]
        },
        {
          "uuid": "0986f698-4f14-41b2-a8ee-3c7f777c5da3",
          "code": "128726",
          "comments": "EPA PESTICIDE|CONVENTIONAL CHEMICAL",
          "type": "PRIMARY",
          "url": "http://iaspub.epa.gov/apex/pesticides/f?p=CHEMICALSEARCH:3:0::NO:21,3,31,7,12,25:P3_XCHEMICAL_ID:1849",
          "code_system": "EPA PESTICIDE CODE",
          "references": [
            "5fe7e947-14ca-44a6-a398-2524da984d78"
          ]
        },
        {
          "uuid": "cd77a044-e5b3-42e5-8ecd-821a18c8ce2d",
          "code": "m3638",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m3638?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "5fe7e947-14ca-44a6-a398-2524da984d78"
          ]
        },
        {
          "uuid": "efab9a77-2507-4b82-9c1f-a74dd6980245",
          "code": "123627",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/123627",
          "code_system": "PUBCHEM",
          "references": [
            "5fe7e947-14ca-44a6-a398-2524da984d78"
          ]
        },
        {
          "uuid": "563c764e-7f23-38d4-81e7-f401c8f662f8",
          "code": "7008",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/7008",
          "code_system": "HSDB",
          "references": [
            "1f62a1e7-cf14-54d2-4d09-9e7fd71a670e"
          ]
        },
        {
          "uuid": "54136a01-0869-2c06-6e4d-1029f75ef0a4",
          "code": "DTXSID5043978",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID5043978",
          "code_system": "EPA CompTox",
          "references": [
            "70b4e77f-18aa-184f-d69e-5d0f6e6ce329"
          ]
        },
        {
          "uuid": "4da72588-f794-497e-961e-67e5a96990b3",
          "code": "Q4N3YI429F",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "a7f6c1ad-dc5e-a071-98a0-06be326c0d72",
          "code": "133104",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:133104",
          "code_system": "CHEBI",
          "references": [
            "e8244304-78b7-f4d1-765b-4d479f083490"
          ]
        },
        {
          "uuid": "610d8420-80a6-e136-1673-2d2aa0c2ec20",
          "code": "clofencet",
          "type": "PRIMARY",
          "url": "https://pesticidecompendium.bcpc.org/clofencet.html",
          "code_system": "ALANWOOD",
          "references": [
            "89fac813-a1ff-c3db-0ac0-95bce1840ee0"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "2d6c20d4-402c-4994-8e2a-b1133b8f5263",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "25a1df12-f7e0-497e-9fa0-dc3ec9d6a62f",
            "refuuid": "0b0ce938-f12c-4268-9146-4f2da3d55d15",
            "name": "CLOFENCET",
            "unii": "Q4N3YI429F",
            "linking_id": "Q4N3YI429F",
            "ref_pname": "CLOFENCET",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "67a8f348-63ee-4652-960b-fc01e070ff24",
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "a01c2bb5-9514-4735-9358-a09a4a95b2c3",
            "refuuid": "596dc334-e050-4890-9da3-9ce91c654b96",
            "name": "CLOFENCET-POTASSIUM",
            "unii": "PV9F827G5A",
            "linking_id": "PV9F827G5A",
            "ref_pname": "CLOFENCET-POTASSIUM",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "473b324b-d0a2-4528-9034-1692213edd70",
          "name": "2-(4-CHLOROPHENYL)-3-ETHYL-2,5-DIHYDRO-5-OXO-4-PYRIDAZINECARBOXYLIC ACID",
          "stdName": "2-(4-CHLOROPHENYL)-3-ETHYL-2,5-DIHYDRO-5-OXO-4-PYRIDAZINECARBOXYLIC ACID",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f0d932fa-9df4-4404-b99e-45e9b066015d",
            "3c30c613-5839-4e3a-af61-88cf364f9de1"
          ],
          "display_name": false
        },
        {
          "uuid": "58840ce9-663a-4dd6-aa6e-98208159dd45",
          "name": "2-(4-CHLOROPHENYL)-3-ETHYL-2,5-DIHYDRO-5-OXOPYRIDAZINE-4-CARBOXYLIC ACID",
          "stdName": "2-(4-CHLOROPHENYL)-3-ETHYL-2,5-DIHYDRO-5-OXOPYRIDAZINE-4-CARBOXYLIC ACID",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f0d932fa-9df4-4404-b99e-45e9b066015d",
            "5595a0b5-9a20-4769-a786-97da3e07cfff"
          ],
          "display_name": false
        },
        {
          "uuid": "d8a7e2dc-e85b-4680-b396-016465ffee04",
          "name": "CLOFENCET",
          "stdName": "CLOFENCET",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0804f07b-cabd-4027-848b-543bce3fdcaf",
            "877954b2-819a-4fe0-904f-4832e466c890",
            "d1e936d9-99a3-4118-b16c-5860fd8a8202",
            "cf45d339-d77a-4550-8651-41b217b1eaac",
            "5e158b0f-6fd7-4926-b67c-722c9b24738b",
            "07c0f09c-fd10-40ff-9f22-fb230eba12cf",
            "85c5a658-7aa7-47ec-adca-7c29c709b361",
            "30e19e7d-a2b0-4da8-95b4-706f5ac0c838"
          ],
          "display_name": true
        },
        {
          "uuid": "2a4ab924-754e-4613-af44-7bb20e8c28a4",
          "name": "CLOFENCET [HSDB]",
          "stdName": "CLOFENCET [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "877954b2-819a-4fe0-904f-4832e466c890",
            "85c5a658-7aa7-47ec-adca-7c29c709b361"
          ],
          "display_name": false
        },
        {
          "uuid": "bf44f3ec-d75c-4c29-abaf-c91786d88a6a",
          "name": "CLOFENCET [ISO]",
          "stdName": "CLOFENCET [ISO]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "877954b2-819a-4fe0-904f-4832e466c890",
            "07c0f09c-fd10-40ff-9f22-fb230eba12cf"
          ],
          "display_name": false
        },
        {
          "uuid": "d1182862-6857-46d2-91c5-b37b1ef3e077",
          "name": "CLOFENCET [MI]",
          "stdName": "CLOFENCET [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "877954b2-819a-4fe0-904f-4832e466c890",
            "cf45d339-d77a-4550-8651-41b217b1eaac"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "5e158b0f-6fd7-4926-b67c-722c9b24738b",
          "citation": "ICSAS BATCH 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "f0d932fa-9df4-4404-b99e-45e9b066015d",
          "citation": "ALANWOOD.NET",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5595a0b5-9a20-4769-a786-97da3e07cfff",
          "citation": "ALANWOOD IUPAC",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3c30c613-5839-4e3a-af61-88cf364f9de1",
          "citation": "ALANWOOD CAS",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "cf45d339-d77a-4550-8651-41b217b1eaac",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "877954b2-819a-4fe0-904f-4832e466c890",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "85c5a658-7aa7-47ec-adca-7c29c709b361",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "07c0f09c-fd10-40ff-9f22-fb230eba12cf",
          "citation": "ISO",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5fe7e947-14ca-44a6-a398-2524da984d78",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390954000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "966aa931-b194-4c69-a53b-147080a5fe52",
          "citation": "SRS import [Q4N3YI429F]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=Q4N3YI429F",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390954000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4997bb84-3e64-4da4-ad7c-6e617d6d879c",
          "citation": "CHEMID 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "30e19e7d-a2b0-4da8-95b4-706f5ac0c838",
          "citation": "CLOFENCET [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "0804f07b-cabd-4027-848b-543bce3fdcaf",
          "citation": "CLOFENCET [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "d1e936d9-99a3-4118-b16c-5860fd8a8202",
          "citation": "CLOFENCET [ISO]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "1f62a1e7-cf14-54d2-4d09-9e7fd71a670e",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+129025-54-3",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "70b4e77f-18aa-184f-d69e-5d0f6e6ce329",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=129025-54-3",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "89fac813-a1ff-c3db-0ac0-95bce1840ee0",
          "citation": "BCPC",
          "doc_type": "ALANWOOD",
          "public_domain": true
        },
        {
          "uuid": "e8244304-78b7-f4d1-765b-4d479f083490",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "5cef2002-6dfe-46be-92c1-031bdbf98aa9",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "2c5fee18-2dfd-4168-a1fb-1426cb490492",
          "id": "2c5fee18-2dfd-4168-a1fb-1426cb490492",
          "molfile": "\n  Marvin  01132102242D          \n\n 19 20  0  0  0  0            999 V2000\n    6.6849   -5.5577    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5088   -5.5577    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9185   -4.8442    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7379   -4.8442    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1521   -5.5577    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9762   -5.5577    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7379   -6.2713    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1522   -4.1308    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9808   -4.1308    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7379   -3.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9185   -3.4125    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5043   -4.1261    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6849   -4.1261    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2797   -4.8489    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4603   -4.8489    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0415   -4.1353    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2175   -4.1353    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    5.4512   -3.4173    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2797   -3.4173    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  2  0  0  0  0\n 12  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  8  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  5  2  0  0  0  0\n  9  8  2  0  0  0  0\n 10  8  1  0  0  0  0\n 11 10  2  0  0  0  0\n 11 12  1  0  0  0  0\n 13 12  1  0  0  0  0\n 14 13  1  0  0  0  0\n 19 13  2  0  0  0  0\n 15 14  2  0  0  0  0\n 16 15  1  0  0  0  0\n 17 16  1  0  0  0  0\n 16 18  2  0  0  0  0\n 18 19  1  0  0  0  0\nM  END",
          "smiles": "CCc1c(c(=O)cnn1-c2ccc(cc2)Cl)C(=O)O",
          "formula": "C13H11ClN2O3",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "c02534b5-462e-46a4-84ef-5d5cfbc0b6fa"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "278.6915",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "0b0ce938-f12c-4268-9146-4f2da3d55d15",
      "version": "6",
      "structure": {
        "id": "3ad0284b-1a5a-4141-88ef-9cdb261defba",
        "molfile": "\n  Marvin  01132103072D          \n\n 19 20  0  0  0  0            999 V2000\n    8.7379   -4.8442    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9185   -4.8442    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5043   -4.1261    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9185   -3.4125    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7379   -3.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1522   -4.1308    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9808   -4.1308    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6849   -4.1261    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2797   -4.8489    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4603   -4.8489    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0415   -4.1353    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4512   -3.4173    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2797   -3.4173    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2175   -4.1353    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    7.5088   -5.5577    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6849   -5.5577    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1521   -5.5577    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9762   -5.5577    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7379   -6.2713    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  2  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  4  5  2  0  0  0  0\n  5  6  1  0  0  0  0\n  6  1  1  0  0  0  0\n  7  6  2  0  0  0  0\n  8  3  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10  9  2  0  0  0  0\n 11 10  1  0  0  0  0\n 11 12  2  0  0  0  0\n 12 13  1  0  0  0  0\n 13  8  2  0  0  0  0\n 14 11  1  0  0  0  0\n 15  2  1  0  0  0  0\n 16 15  1  0  0  0  0\n 17  1  1  0  0  0  0\n 18 17  2  0  0  0  0\n 19 17  1  0  0  0  0\nM  END",
        "smiles": "CCc1c(c(=O)cnn1-c2ccc(cc2)Cl)C(=O)O",
        "formula": "C13H11ClN2O3",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "278.6915",
        "optical_activity": "NONE",
        "references": [
          "4997bb84-3e64-4da4-ad7c-6e617d6d879c",
          "966aa931-b194-4c69-a53b-147080a5fe52"
        ],
        "stereo_centers": 0
      },
      "unii": "Q4N3YI429F"
    }
  ]
}