{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "49e8faff-6a6f-445d-939e-24fa7eb1ec1e",
          "code": "82-68-8",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=82-68-8",
          "code_system": "CAS",
          "references": [
            "6d66bd04-56f8-4940-8f7e-9af7f1f11e4f",
            "4abe47b5-6555-46ab-9446-6b149ac68991"
          ]
        },
        {
          "uuid": "a0405ef8-1ea0-412e-9f02-38bf5d3433cb",
          "code": "PENTACHLORONITROBENZENE",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Pentachloronitrobenzene",
          "code_system": "WIKIPEDIA",
          "references": [
            "6d66bd04-56f8-4940-8f7e-9af7f1f11e4f"
          ]
        },
        {
          "uuid": "b6ff7e44-d332-4524-a05c-2109bea774a2",
          "code": "C005805",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67005805",
          "code_system": "MESH",
          "references": [
            "6d66bd04-56f8-4940-8f7e-9af7f1f11e4f"
          ]
        },
        {
          "uuid": "38623121-7d7c-4342-9793-524a82442c6d",
          "code": "56502",
          "comments": "EPA PESTICIDE|CONVENTIONAL CHEMICAL",
          "type": "PRIMARY",
          "url": "http://iaspub.epa.gov/apex/pesticides/f?p=CHEMICALSEARCH:3:0::NO:21,3,31,7,12,25:P3_XCHEMICAL_ID:3236",
          "code_system": "EPA PESTICIDE CODE",
          "references": [
            "6d66bd04-56f8-4940-8f7e-9af7f1f11e4f"
          ]
        },
        {
          "uuid": "8e832b8d-1338-4f81-9033-412705791694",
          "code": "201-435-0",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.001.305",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "6d66bd04-56f8-4940-8f7e-9af7f1f11e4f"
          ]
        },
        {
          "uuid": "746f8a3e-51d1-4a1b-bf1f-8f97037f3466",
          "code": "m9467",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m9467?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "6d66bd04-56f8-4940-8f7e-9af7f1f11e4f"
          ]
        },
        {
          "uuid": "b632eb91-9e48-4beb-ba0a-6bbf3f386eb2",
          "code": "6720",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/6720",
          "code_system": "PUBCHEM",
          "references": [
            "6d66bd04-56f8-4940-8f7e-9af7f1f11e4f"
          ]
        },
        {
          "uuid": "f1b339c1-0425-a8d1-2a6e-10bb46e28e03",
          "code": "1749",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/1749",
          "code_system": "HSDB",
          "references": [
            "489f4a9b-1361-d5c2-3105-7464a16c0576"
          ]
        },
        {
          "uuid": "16e60a5d-58e2-8825-c9ee-857443780ccd",
          "code": "DTXSID2021105",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID2021105",
          "code_system": "EPA CompTox",
          "references": [
            "4e42a565-71f2-79cf-b7c9-34be35d2bedf"
          ]
        },
        {
          "uuid": "41a95cc8-323a-48e1-a4be-8154685adbf5",
          "code": "Q37G40S4S8",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "91e390b5-ce8f-0fd1-1ae4-74c3a6909dc4",
          "code": "34908",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:34908",
          "code_system": "CHEBI",
          "references": [
            "59a22b14-2082-b797-6024-2e8f0936ab02"
          ]
        },
        {
          "uuid": "9e2d6f7d-44c9-5c1c-0f31-1499ab4c71d3",
          "code": "58427",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=58427",
          "code_system": "NSC",
          "references": [
            "26a8ed16-62e6-67b9-9c7c-7ea8035a6235"
          ]
        },
        {
          "uuid": "8972edb4-bd39-00c5-8fbc-8b6300300e16",
          "code": "quintozene",
          "type": "PRIMARY",
          "url": "https://pesticidecompendium.bcpc.org/quintozene.html",
          "code_system": "ALANWOOD",
          "references": [
            "78632720-a611-9442-ae16-1fd4b13e8184"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "da75d363-8e12-4fe9-80cd-fff7c7bf2b63",
          "name": "BENZENE, 1,2,3,4,5-PENTACHLORO-6-NITRO-",
          "stdName": "BENZENE, 1,2,3,4,5-PENTACHLORO-6-NITRO-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5e92e045-4a2c-43a1-afe4-5aa4cce2e590",
            "719ce0b1-f23b-4112-98af-359af38919e6"
          ],
          "display_name": false
        },
        {
          "uuid": "8e861577-20b6-4c4b-901f-deed57538f62",
          "name": "NSC-58427",
          "stdName": "NSC-58427",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5e92e045-4a2c-43a1-afe4-5aa4cce2e590",
            "719ce0b1-f23b-4112-98af-359af38919e6"
          ],
          "display_name": false
        },
        {
          "uuid": "c2c89993-c12f-436d-8ce3-15bc79bb69a4",
          "name": "OLPISAN",
          "stdName": "OLPISAN",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5ddddabd-7f5f-4320-99ff-a5e980835a63",
            "5e92e045-4a2c-43a1-afe4-5aa4cce2e590"
          ],
          "display_name": false
        },
        {
          "uuid": "b1162ef3-b477-44fd-8530-180c3bf2afb6",
          "name": "PCNB",
          "stdName": "PCNB",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5ddddabd-7f5f-4320-99ff-a5e980835a63",
            "5e92e045-4a2c-43a1-afe4-5aa4cce2e590"
          ],
          "display_name": false
        },
        {
          "uuid": "bdead6bc-0ec2-4e5d-9a99-1c08e3c7ab36",
          "name": "PENTACHLORONITROBENZENE",
          "stdName": "PENTACHLORONITROBENZENE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5e92e045-4a2c-43a1-afe4-5aa4cce2e590",
            "7076e029-c8b5-4093-9155-1756e45c1541"
          ],
          "display_name": false
        },
        {
          "uuid": "d097d32d-6a37-40c5-8172-9e2ca0be2425",
          "name": "QUINOSAN",
          "stdName": "QUINOSAN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5ddddabd-7f5f-4320-99ff-a5e980835a63",
            "5e92e045-4a2c-43a1-afe4-5aa4cce2e590"
          ],
          "display_name": false
        },
        {
          "uuid": "dc663887-768b-d36f-2405-54b4c3cae46b",
          "name": "QUINTOZEN",
          "stdName": "QUINTOZEN",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c508c5e2-9ca6-f839-0109-a30c858063c0"
          ],
          "display_name": false
        },
        {
          "uuid": "db56b305-c340-487a-8522-3ac2582c65e7",
          "name": "QUINTOZENE",
          "stdName": "QUINTOZENE",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "800b3b6a-9016-48f6-8506-4b5e80555d67",
            "5ddddabd-7f5f-4320-99ff-a5e980835a63",
            "9ff492fe-efa0-4729-8e50-f9a4089a4ad2",
            "5e92e045-4a2c-43a1-afe4-5aa4cce2e590",
            "0cd75b18-c0da-43c9-b76f-00a7dbfba29a",
            "3b51777a-eb30-4a64-9147-f0c8e45b303b",
            "663be80f-ab3b-4736-9913-3b02dbb54f6b",
            "c681e219-f2eb-4f50-a9a0-6940539cf02b"
          ],
          "display_name": true
        },
        {
          "uuid": "afc95e84-3f88-4960-98a9-c8943cbf8512",
          "name": "QUINTOZENE [HSDB]",
          "stdName": "QUINTOZENE [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "800b3b6a-9016-48f6-8506-4b5e80555d67",
            "5e92e045-4a2c-43a1-afe4-5aa4cce2e590"
          ],
          "display_name": false
        },
        {
          "uuid": "808288eb-0a98-90b6-86a2-4be4fb6fdee0",
          "name": "QUINTOZENE [IARC]",
          "stdName": "QUINTOZENE [IARC]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "91588729-edcd-5c98-ccd2-fd463a4e1497"
          ],
          "display_name": false
        },
        {
          "uuid": "af8ab610-6702-4de7-9168-0731d8537899",
          "name": "QUINTOZENE [ISO]",
          "stdName": "QUINTOZENE [ISO]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5e92e045-4a2c-43a1-afe4-5aa4cce2e590",
            "3b51777a-eb30-4a64-9147-f0c8e45b303b"
          ],
          "display_name": false
        },
        {
          "uuid": "c01c0c9f-9330-4282-a328-f218487a2e7d",
          "name": "QUINTOZENE [MI]",
          "stdName": "QUINTOZENE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0cd75b18-c0da-43c9-b76f-00a7dbfba29a",
            "5e92e045-4a2c-43a1-afe4-5aa4cce2e590"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "7076e029-c8b5-4093-9155-1756e45c1541",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "5e92e045-4a2c-43a1-afe4-5aa4cce2e590",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0cd75b18-c0da-43c9-b76f-00a7dbfba29a",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5ddddabd-7f5f-4320-99ff-a5e980835a63",
          "citation": "SITTIG",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "800b3b6a-9016-48f6-8506-4b5e80555d67",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "719ce0b1-f23b-4112-98af-359af38919e6",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3b51777a-eb30-4a64-9147-f0c8e45b303b",
          "citation": "ISO",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6d66bd04-56f8-4940-8f7e-9af7f1f11e4f",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389681000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "408c6de4-f6a3-4cad-a868-26cbe27c4b9e",
          "citation": "SRS import [Q37G40S4S8]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=Q37G40S4S8",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389681000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "663be80f-ab3b-4736-9913-3b02dbb54f6b",
          "citation": "QUINTOZENE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "c681e219-f2eb-4f50-a9a0-6940539cf02b",
          "citation": "QUINTOZENE [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "9ff492fe-efa0-4729-8e50-f9a4089a4ad2",
          "citation": "QUINTOZENE [ISO]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "489f4a9b-1361-d5c2-3105-7464a16c0576",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+82-68-8",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "4e42a565-71f2-79cf-b7c9-34be35d2bedf",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=82-68-8",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "c508c5e2-9ca6-f839-0109-a30c858063c0",
          "citation": "TKB",
          "doc_type": "TOBACCO KNOWLEDGE BASE",
          "public_domain": true
        },
        {
          "uuid": "91588729-edcd-5c98-ccd2-fd463a4e1497",
          "citation": "IARC",
          "doc_type": "IARC",
          "public_domain": true
        },
        {
          "uuid": "78632720-a611-9442-ae16-1fd4b13e8184",
          "citation": "AW",
          "doc_type": "ALANWOOD",
          "public_domain": true
        },
        {
          "uuid": "59a22b14-2082-b797-6024-2e8f0936ab02",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "4abe47b5-6555-46ab-9446-6b149ac68991",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "26a8ed16-62e6-67b9-9c7c-7ea8035a6235",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "0c9fded5-b760-4299-8bc6-158a61f38aa7",
          "id": "0c9fded5-b760-4299-8bc6-158a61f38aa7",
          "molfile": "\n  Marvin  01132100542D          \n\n 14 14  0  0  0  0            999 V2000\n    0.0000   -2.2469    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    0.6553   -1.4325    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n    0.0902   -0.7030    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4882   -1.4325    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.8888   -0.7189    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4882    0.0000    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    2.7138   -0.7189    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1303    0.0000    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    3.1303   -1.4325    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9500   -1.4325    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    2.7138   -2.1329    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1303   -2.8571    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    1.8888   -2.1329    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4882   -2.8571    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  3  2  2  0  0  0  0\n  2  4  1  0  0  0  0\n  5  4  1  0  0  0  0\n 13  4  2  0  0  0  0\n  6  5  1  0  0  0  0\n  7  5  2  0  0  0  0\n  8  7  1  0  0  0  0\n  9  7  1  0  0  0  0\n 10  9  1  0  0  0  0\n 11  9  2  0  0  0  0\n 12 11  1  0  0  0  0\n 11 13  1  0  0  0  0\n 14 13  1  0  0  0  0\nM  CHG  2   1  -1   2   1\nM  END",
          "smiles": "c1(c(c(c(c(c1Cl)Cl)[N+](=O)[O-])Cl)Cl)Cl",
          "formula": "C6Cl5NO2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "6915e826-06de-4038-988b-86fe7ecd715a"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "295.3346",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "035be8fc-13c0-4cb1-9fdb-ee36cad1f111",
      "version": "10",
      "structure": {
        "id": "0252e5cd-cfbb-43d4-85c2-ecdfe031af78",
        "molfile": "\n  Marvin  01132100262D          \n\n 14 14  0  0  0  0            999 V2000\n   14.7983   -4.0800    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.1988   -4.7803    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.1988   -3.3664    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.9653   -4.0800    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n   16.0238   -3.3664    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.0238   -4.7803    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.4403   -4.0800    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.3927   -4.6741    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n   13.4003   -3.3505    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   14.7983   -5.5045    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n   14.7983   -2.6475    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n   16.4403   -2.6475    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n   16.4403   -5.5045    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n   17.2600   -4.0800    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  2  0  0  0  0\n  3  1  1  0  0  0  0\n  4  1  1  0  0  0  0\n  5  3  2  0  0  0  0\n  6  2  1  0  0  0  0\n  7  5  1  0  0  0  0\n  8  4  1  0  0  0  0\n  9  4  2  0  0  0  0\n 10  2  1  0  0  0  0\n 11  3  1  0  0  0  0\n 12  5  1  0  0  0  0\n 13  6  1  0  0  0  0\n 14  7  1  0  0  0  0\n  6  7  2  0  0  0  0\nM  CHG  2   4   1   8  -1\nM  END",
        "smiles": "c1(c(c(c(c(c1Cl)Cl)[N+](=O)[O-])Cl)Cl)Cl",
        "formula": "C6Cl5NO2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "295.3346",
        "optical_activity": "NONE",
        "references": [
          "408c6de4-f6a3-4cad-a868-26cbe27c4b9e",
          "719ce0b1-f23b-4112-98af-359af38919e6"
        ],
        "stereo_centers": 0
      },
      "unii": "Q37G40S4S8"
    }
  ]
}